diff options
Diffstat (limited to 'deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent')
60 files changed, 7039 insertions, 0 deletions
diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/.npmignore b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/.npmignore new file mode 100644 index 0000000000..c12f3a80c1 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/.npmignore @@ -0,0 +1,2 @@ +/node_modules +/?.js diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/.travis.yml b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/.travis.yml new file mode 100644 index 0000000000..85a50123c6 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/.travis.yml @@ -0,0 +1,8 @@ +language: node_js +node_js: + - "0.8" + - "0.10" + - "0.12" +before_install: + - '[ "${TRAVIS_NODE_VERSION}" != "0.8" ] || npm install -g npm@1.4.28' + - npm install -g npm@latest diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/History.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/History.md new file mode 100644 index 0000000000..0d882d4458 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/History.md @@ -0,0 +1,90 @@ + +1.0.0 / 2015-07-10 +================== + + * upgrade to "agent-base" v2 API + * test: test case is fixed + * use %o debug() formatter + * README: use SVG for Travis-CI badge + +0.3.6 / 2015-07-06 +================== + + * package: update "extend" to v3 + * package: update "mocha" to v2 + * package: update "debug" to v2 + * travis: test node v0.8, v0.10, and v0.12 + * test: use ssl-cert-snakeoil self-signed SSL certs + +0.3.5 / 2014-06-11 +================== + + * package: update "debug" to v1.0.0 + +0.3.4 / 2014-04-09 +================== + + * gitignore: ignore root level ?.js files + * package: update outdated dependencies + +0.3.3 / 2014-01-13 +================== + + * https-proxy-agnet: use debug() instead of console.error() + * https-proxy-agent: fix debug() call + * History: fix whitespace + +0.3.2 / 2013-11-18 +================== + + * https-proxy-agent: allow "https" without trailing colon + * README: fix typo + +0.3.1 / 2013-11-16 +================== + + * test: enable the HTTPS over HTTPS test on node v0.11.8 + * https-proxy-agent: create the proxy socket connection first + * https-proxy-agent: delete `pathname` from the proxy opts as well + * https-proxy-agent: remove dead "end"-emitting code + +0.3.0 / 2013-09-16 +================== + + * https-proxy-agent: use "debug" module + * https-proxy-agent: update to the "agent-base" v1 API + * https-proxy-agent: default the "port" to 443 if not set + * https-proxy-agent: augment the `opts` object for the `tls.connect` function + * https-proxy-agent: use "extend" module + * https-proxy-agent: remove use of `this` as much as possible + * https-proxy-agent: listen for the "error" event of the socket + * test: refactor of tests to use "proxy" module + * test: add "error" event catching test + * test: add 407 proxy response test + * test: use "semver" module, disable the HTTPS over HTTPS test for node >= v0.11.3 + +0.2.0 / 2013-09-03 +================== + + * Add initial "Proxy-Authorization" Basic authentication support + +0.1.0 / 2013-07-21 +================== + + * rename `secure` to `secureProxy` + * added `secureEndpoint` option + * various optimizations + * README improvements + +0.0.2 / 2013-07-11 +================== + + * test: add mocha tests + * don't use `socket.ondata`, use the official API instead + * throw an Error when no proxy info is given + * add support for passing options to net/tls .connect() + +0.0.1 / 2013-07-09 +================== + + * Initial release diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/README.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/README.md new file mode 100644 index 0000000000..b62d9c84bc --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/README.md @@ -0,0 +1,141 @@ +https-proxy-agent +================ +### An HTTP(s) proxy `http.Agent` implementation for HTTPS +[](https://travis-ci.org/TooTallNate/node-https-proxy-agent) + +This module provides an `http.Agent` implementation that connects to a specified +HTTP or HTTPS proxy server, and can be used with the built-in `https` module. + +Specifically, this `Agent` implementation connects to an intermediary "proxy" +server and issues the [CONNECT HTTP method][CONNECT], which tells the proxy to +open a direct TCP connection to the destination server. + +Since this agent implements the CONNECT HTTP method, it also works with other +protocols that use this method when connecting over proxies (i.e. WebSockets). +See the "Examples" section below for more. + + +Installation +------------ + +Install with `npm`: + +``` bash +$ npm install https-proxy-agent +``` + + +Examples +-------- + +#### `https` module example + +``` js +var url = require('url'); +var https = require('https'); +var HttpsProxyAgent = require('https-proxy-agent'); + +// HTTP/HTTPS proxy to connect to +var proxy = process.env.http_proxy || 'http://168.63.76.32:3128'; +console.log('using proxy server %j', proxy); + +// HTTPS endpoint for the proxy to connect to +var endpoint = process.argv[2] || 'https://graph.facebook.com/tootallnate'; +console.log('attempting to GET %j', endpoint); +var opts = url.parse(endpoint); + +// create an instance of the `HttpsProxyAgent` class with the proxy server information +var agent = new HttpsProxyAgent(proxy); +opts.agent = agent; + +https.get(opts, function (res) { + console.log('"response" event!', res.headers); + res.pipe(process.stdout); +}); +``` + +#### `ws` WebSocket connection example + +``` js +var url = require('url'); +var WebSocket = require('ws'); +var HttpsProxyAgent = require('https-proxy-agent'); + +// HTTP/HTTPS proxy to connect to +var proxy = process.env.http_proxy || 'http://168.63.76.32:3128'; +console.log('using proxy server %j', proxy); + +// WebSocket endpoint for the proxy to connect to +var endpoint = process.argv[2] || 'ws://echo.websocket.org'; +var parsed = url.parse(endpoint); +console.log('attempting to connect to WebSocket %j', endpoint); + +// create an instance of the `HttpsProxyAgent` class with the proxy server information +var opts = url.parse(proxy); + +// IMPORTANT! Set the `secureEndpoint` option to `false` when connecting +// over "ws://", but `true` when connecting over "wss://" +opts.secureEndpoint = parsed.protocol ? parsed.protocol == 'wss:' : false; + +var agent = new HttpsProxyAgent(opts); + +// finally, initiate the WebSocket connection +var socket = new WebSocket(endpoint, { agent: agent }); + +socket.on('open', function () { + console.log('"open" event!'); + socket.send('hello world'); +}); + +socket.on('message', function (data, flags) { + console.log('"message" event! %j %j', data, flags); + socket.close(); +}); +``` + +API +--- + +### new HttpsProxyAgent(opts) + +The `HttpsProxyAgent` class implements an `http.Agent` subclass that connects +to the specified "HTTP(s) proxy server" in order to proxy HTTPS and/or WebSocket +requests. This is achieved by using the [HTTP `CONNECT` method][CONNECT]. + +The `opts` argument may either be a string URI of the proxy server to use, or an +"options" object with more specific properties: + + * `host` - String - Proxy host to connect to (may use `hostname` as well). Required. + * `port` - Number - Proxy port to connect to. Required. + * `secureProxy` - Boolean - If `true`, then use TLS to connect to the proxy. Defaults to `false`. + * `secureEndpoint` - Boolean - If `true` then a TLS connection to the endpoint will be established on top of the proxy socket. Defaults to `true`. + * Any other options given are passed to the `net.connect()`/`tls.connect()` functions. + + +License +------- + +(The MIT License) + +Copyright (c) 2013 Nathan Rajlich <nathan@tootallnate.net> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +[CONNECT]: http://en.wikipedia.org/wiki/HTTP_tunnel#HTTP_CONNECT_Tunneling diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/https-proxy-agent.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/https-proxy-agent.js new file mode 100644 index 0000000000..6baaa9df2b --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/https-proxy-agent.js @@ -0,0 +1,202 @@ + +/** + * Module dependencies. + */ + +var net = require('net'); +var tls = require('tls'); +var url = require('url'); +var extend = require('extend'); +var Agent = require('agent-base'); +var inherits = require('util').inherits; +var debug = require('debug')('https-proxy-agent'); + +/** + * Module exports. + */ + +module.exports = HttpsProxyAgent; + +/** + * The `HttpsProxyAgent` implements an HTTP Agent subclass that connects to the + * specified "HTTP(s) proxy server" in order to proxy HTTPS requests. + * + * @api public + */ + +function HttpsProxyAgent (opts) { + if (!(this instanceof HttpsProxyAgent)) return new HttpsProxyAgent(opts); + if ('string' == typeof opts) opts = url.parse(opts); + if (!opts) throw new Error('an HTTP(S) proxy server `host` and `port` must be specified!'); + debug('creating new HttpsProxyAgent instance: %o', opts); + Agent.call(this, connect); + + var proxy = extend({}, opts); + + // if `true`, then connect to the proxy server over TLS. defaults to `false`. + this.secureProxy = proxy.protocol ? /^https:?$/i.test(proxy.protocol) : false; + + // prefer `hostname` over `host`, and set the `port` if needed + proxy.host = proxy.hostname || proxy.host; + proxy.port = +proxy.port || (this.secureProxy ? 443 : 80); + + if (proxy.host && proxy.path) { + // if both a `host` and `path` are specified then it's most likely the + // result of a `url.parse()` call... we need to remove the `path` portion so + // that `net.connect()` doesn't attempt to open that as a unix socket file. + delete proxy.path; + delete proxy.pathname; + } + + this.proxy = proxy; +} +inherits(HttpsProxyAgent, Agent); + +/** + * Called when the node-core HTTP client library is creating a new HTTP request. + * + * @api public + */ + +function connect (req, opts, fn) { + + var proxy = this.proxy; + + // create a socket connection to the proxy server + var socket; + if (this.secureProxy) { + socket = tls.connect(proxy); + } else { + socket = net.connect(proxy); + } + + // we need to buffer any HTTP traffic that happens with the proxy before we get + // the CONNECT response, so that if the response is anything other than an "200" + // response code, then we can re-play the "data" events on the socket once the + // HTTP parser is hooked up... + var buffers = []; + var buffersLength = 0; + + function read () { + var b = socket.read(); + if (b) ondata(b); + else socket.once('readable', read); + } + + function cleanup () { + socket.removeListener('data', ondata); + socket.removeListener('end', onend); + socket.removeListener('error', onerror); + socket.removeListener('close', onclose); + socket.removeListener('readable', read); + } + + function onclose (err) { + debug('onclose had error %o', err); + } + + function onend () { + debug('onend'); + } + + function onerror (err) { + cleanup(); + fn(err); + } + + function ondata (b) { + buffers.push(b); + buffersLength += b.length; + var buffered = Buffer.concat(buffers, buffersLength); + var str = buffered.toString('ascii'); + + if (!~str.indexOf('\r\n\r\n')) { + // keep buffering + debug('have not received end of HTTP headers yet...'); + if (socket.read) { + read(); + } else { + socket.once('data', ondata); + } + return; + } + + var firstLine = str.substring(0, str.indexOf('\r\n')); + var statusCode = +firstLine.split(' ')[1]; + debug('got proxy server response: %o', firstLine); + + if (200 == statusCode) { + // 200 Connected status code! + var sock = socket; + + // nullify the buffered data since we won't be needing it + buffers = buffered = null; + + if (opts.secureEndpoint) { + // since the proxy is connecting to an SSL server, we have + // to upgrade this socket connection to an SSL connection + debug('upgrading proxy-connected socket to TLS connection: %o', opts.host); + opts.socket = socket; + opts.servername = opts.host; + opts.host = null; + opts.hostname = null; + opts.port = null; + sock = tls.connect(opts); + } + + cleanup(); + fn(null, sock); + } else { + // some other status code that's not 200... need to re-play the HTTP header + // "data" events onto the socket once the HTTP machinery is attached so that + // the user can parse and handle the error status code + cleanup(); + + // save a reference to the concat'd Buffer for the `onsocket` callback + buffers = buffered; + + // need to wait for the "socket" event to re-play the "data" events + req.once('socket', onsocket); + fn(null, socket); + } + } + + function onsocket (socket) { + // replay the "buffers" Buffer onto the `socket`, since at this point + // the HTTP module machinery has been hooked up for the user + if ('function' == typeof socket.ondata) { + // node <= v0.11.3, the `ondata` function is set on the socket + socket.ondata(buffers, 0, buffers.length); + } else if (socket.listeners('data').length > 0) { + // node > v0.11.3, the "data" event is listened for directly + socket.emit('data', buffers); + } else { + // never? + throw new Error('should not happen...'); + } + + // nullify the cached Buffer instance + buffers = null; + } + + socket.on('error', onerror); + socket.on('close', onclose); + socket.on('end', onend); + + if (socket.read) { + read(); + } else { + socket.once('data', ondata); + } + + var hostname = opts.host + ':' + opts.port; + var msg = 'CONNECT ' + hostname + ' HTTP/1.1\r\n'; + var auth = proxy.auth; + if (auth) { + msg += 'Proxy-Authorization: Basic ' + new Buffer(auth).toString('base64') + '\r\n'; + } + msg += 'Host: ' + hostname + '\r\n' + + 'Connection: close\r\n' + + '\r\n'; + socket.write(msg); +}; diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/.npmignore b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/.npmignore new file mode 100644 index 0000000000..07e6e472cc --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/.npmignore @@ -0,0 +1 @@ +/node_modules diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/.travis.yml b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/.travis.yml new file mode 100644 index 0000000000..85a50123c6 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/.travis.yml @@ -0,0 +1,8 @@ +language: node_js +node_js: + - "0.8" + - "0.10" + - "0.12" +before_install: + - '[ "${TRAVIS_NODE_VERSION}" != "0.8" ] || npm install -g npm@1.4.28' + - npm install -g npm@latest diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/History.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/History.md new file mode 100644 index 0000000000..0ceef6c13f --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/History.md @@ -0,0 +1,41 @@ + +2.0.1 / 2015-09-10 +================== + + * package: update "semver" to v5.0.1 for WebPack (#1, @vhpoet) + +2.0.0 / 2015-07-10 +================== + + * refactor to patch Node.js core for more consistent `opts` values + * ensure that HTTP(s) default port numbers are always given + * test: use ssl-cert-snakeoil SSL certs + * test: add tests for arbitrary options + * README: add API section + * README: make the Agent HTTP/HTTPS generic in the example + * README: use SVG for Travis-CI badge + +1.0.2 / 2015-06-27 +================== + + * agent: set `req._hadError` to true after emitting "error" + * package: update "mocha" to v2 + * test: add artificial HTTP GET request test + * test: add artificial data events test + * test: fix artifical GET response test on node > v0.11.3 + * test: use a real timeout for the async error test + +1.0.1 / 2013-09-09 +================== + + * Fix passing an "error" object to the callback function on the first tick + +1.0.0 / 2013-09-09 +================== + + * New API: now you pass a callback function directly + +0.0.1 / 2013-07-09 +================== + + * Initial release diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/README.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/README.md new file mode 100644 index 0000000000..616b90cdbf --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/README.md @@ -0,0 +1,121 @@ +agent-base +========== +### Turn a function into an `http.Agent` instance +[](https://travis-ci.org/TooTallNate/node-agent-base) + +This module provides an `http.Agent` generator. That is, you pass it an async +callback function, and it returns a new `http.Agent` instance that will invoke the +given callback function when sending outbound HTTP requests. + +#### Some subclasses: + +Here's some more interesting uses of `agent-base`. +Send a pull request to list yours! + + * [`http-proxy-agent`][http-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTP endpoints + * [`https-proxy-agent`][https-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTPS endpoints + * [`pac-proxy-agent`][pac-proxy-agent]: A PAC file proxy `http.Agent` implementation for HTTP and HTTPS + * [`socks-proxy-agent`][socks-proxy-agent]: A SOCKS (v4a) proxy `http.Agent` implementation for HTTP and HTTPS + + +Installation +------------ + +Install with `npm`: + +``` bash +$ npm install agent-base +``` + + +Example +------- + +Here's a minimal example that creates a new `net.Socket` connection to the server +for every HTTP request (i.e. the equivalent of `agent: false` option): + +``` js +var net = require('net'); +var tls = require('tls'); +var url = require('url'); +var http = require('http'); +var agent = require('agent-base'); + +var endpoint = 'http://nodejs.org/api/'; +var opts = url.parse(endpoint); + +// This is the important part! +opts.agent = agent(function (req, opts, fn) { + var socket; + // `secureEndpoint` is true when using the https module + if (opts.secureEndpoint) { + socket = tls.connect(opts); + } else { + socket = net.connect(opts); + } + fn(null, socket); +}); + +// Everything else works just like normal... +http.get(opts, function (res) { + console.log('"response" event!', res.headers); + res.pipe(process.stdout); +}); +``` + +API +--- + +## Agent(Function callback) → http.Agent + +Creates a base `http.Agent` that will execute the callback function `callback` +for every HTTP request that it is used as the `agent` for. The callback function +is responsible for creating a `stream.Duplex` instance of some kind that will be +used as the underlying socket in the HTTP request. + +The callback function should have the following signature: + +### callback(http.ClientRequest req, Object options, Function cb) → undefined + +The ClientRequest `req` can be accessed to read request headers and +and the path, etc. The `options` object contains the options passed +to the `http.request()`/`https.request()` function call, and is formatted +to be directly passed to `net.connect()`/`tls.connect()`, or however +else you want a Socket to be created. Pass the created socket to +the callback function `cb` once created, and the HTTP request will +continue to proceed. + +If the `https` module is used to invoke the HTTP request, then the +`secureEndpoint` property on `options` will be set to `true`. + + +License +------- + +(The MIT License) + +Copyright (c) 2013 Nathan Rajlich <nathan@tootallnate.net> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +[http-proxy-agent]: https://github.com/TooTallNate/node-http-proxy-agent +[https-proxy-agent]: https://github.com/TooTallNate/node-https-proxy-agent +[pac-proxy-agent]: https://github.com/TooTallNate/node-pac-proxy-agent +[socks-proxy-agent]: https://github.com/TooTallNate/node-socks-proxy-agent diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/agent.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/agent.js new file mode 100644 index 0000000000..4005ebc0ef --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/agent.js @@ -0,0 +1,101 @@ + +/** + * Module dependencies. + */ + +require('./patch-core'); +var extend = require('extend'); +var inherits = require('util').inherits; +var EventEmitter = require('events').EventEmitter; + +/** + * Module exports. + */ + +module.exports = Agent; + +/** + * Base `http.Agent` implementation. + * No pooling/keep-alive is implemented by default. + * + * @param {Function} callback + * @api public + */ + +function Agent (callback) { + if (!(this instanceof Agent)) return new Agent(callback); + if ('function' != typeof callback) throw new Error('Must pass a "callback function"'); + EventEmitter.call(this); + this.callback = callback; +} +inherits(Agent, EventEmitter); + +/** + * Called by node-core's "_http_client.js" module when creating + * a new HTTP request with this Agent instance. + * + * @api public + */ + +Agent.prototype.addRequest = function (req, host, port, localAddress) { + var opts; + if ('object' == typeof host) { + // >= v0.11.x API + opts = extend({}, req._options, host); + } else { + // <= v0.10.x API + opts = extend({}, req._options, { host: host, port: port }); + if (null != localAddress) { + opts.localAddress = localAddress; + } + } + + if (opts.host && opts.path) { + // if both a `host` and `path` are specified then it's most likely the + // result of a `url.parse()` call... we need to remove the `path` portion so + // that `net.connect()` doesn't attempt to open that as a unix socket file. + delete opts.path; + } + + // set default `port` if none was explicitly specified + if (null == opts.port) { + opts.port = opts.secureEndpoint ? 443 : 80; + } + + delete opts.agent; + delete opts.hostname; + delete opts._defaultAgent; + delete opts.defaultPort; + delete opts.createConnection; + + // hint to use "Connection: close" + // XXX: non-documented `http` module API :( + req._last = true; + req.shouldKeepAlive = false; + + // clean up a bit of memory since we're no longer using this + req._options = null; + + // create the `net.Socket` instance + var sync = true; + this.callback(req, opts, function (err, socket) { + function emitErr () { + req.emit('error', err); + // For Safety. Some additional errors might fire later on + // and we need to make sure we don't double-fire the error event. + req._hadError = true; + } + if (err) { + if (sync) { + // need to defer the "error" event, when sync, because by now the `req` + // instance hasn't event been passed back to the user yet... + process.nextTick(emitErr); + } else { + emitErr(); + } + } else { + req.onSocket(socket); + } + }); + sync = false; +}; diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/.npmignore b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/.npmignore new file mode 100644 index 0000000000..534108e3f4 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/.npmignore @@ -0,0 +1,4 @@ +node_modules/ +coverage/ +.nyc_output/ +nyc_output/ diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/.travis.yml b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/.travis.yml new file mode 100644 index 0000000000..991d04b6e2 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/.travis.yml @@ -0,0 +1,5 @@ +language: node_js +node_js: + - '0.10' + - '0.12' + - 'iojs' diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/LICENSE b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/LICENSE new file mode 100644 index 0000000000..19129e315f --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/README.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/README.md new file mode 100644 index 0000000000..b5e35ff0b5 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/README.md @@ -0,0 +1,303 @@ +semver(1) -- The semantic versioner for npm +=========================================== + +## Usage + + $ npm install semver + + semver.valid('1.2.3') // '1.2.3' + semver.valid('a.b.c') // null + semver.clean(' =v1.2.3 ') // '1.2.3' + semver.satisfies('1.2.3', '1.x || >=2.5.0 || 5.0.0 - 7.2.3') // true + semver.gt('1.2.3', '9.8.7') // false + semver.lt('1.2.3', '9.8.7') // true + +As a command-line utility: + + $ semver -h + + Usage: semver <version> [<version> [...]] [-r <range> | -i <inc> | --preid <identifier> | -l | -rv] + Test if version(s) satisfy the supplied range(s), and sort them. + + Multiple versions or ranges may be supplied, unless increment + option is specified. In that case, only a single version may + be used, and it is incremented by the specified level + + Program exits successfully if any valid version satisfies + all supplied ranges, and prints all satisfying versions. + + If no versions are valid, or ranges are not satisfied, + then exits failure. + + Versions are printed in ascending order, so supplying + multiple versions to the utility will just sort them. + +## Versions + +A "version" is described by the `v2.0.0` specification found at +<http://semver.org/>. + +A leading `"="` or `"v"` character is stripped off and ignored. + +## Ranges + +A `version range` is a set of `comparators` which specify versions +that satisfy the range. + +A `comparator` is composed of an `operator` and a `version`. The set +of primitive `operators` is: + +* `<` Less than +* `<=` Less than or equal to +* `>` Greater than +* `>=` Greater than or equal to +* `=` Equal. If no operator is specified, then equality is assumed, + so this operator is optional, but MAY be included. + +For example, the comparator `>=1.2.7` would match the versions +`1.2.7`, `1.2.8`, `2.5.3`, and `1.3.9`, but not the versions `1.2.6` +or `1.1.0`. + +Comparators can be joined by whitespace to form a `comparator set`, +which is satisfied by the **intersection** of all of the comparators +it includes. + +A range is composed of one or more comparator sets, joined by `||`. A +version matches a range if and only if every comparator in at least +one of the `||`-separated comparator sets is satisfied by the version. + +For example, the range `>=1.2.7 <1.3.0` would match the versions +`1.2.7`, `1.2.8`, and `1.2.99`, but not the versions `1.2.6`, `1.3.0`, +or `1.1.0`. + +The range `1.2.7 || >=1.2.9 <2.0.0` would match the versions `1.2.7`, +`1.2.9`, and `1.4.6`, but not the versions `1.2.8` or `2.0.0`. + +### Prerelease Tags + +If a version has a prerelease tag (for example, `1.2.3-alpha.3`) then +it will only be allowed to satisfy comparator sets if at least one +comparator with the same `[major, minor, patch]` tuple also has a +prerelease tag. + +For example, the range `>1.2.3-alpha.3` would be allowed to match the +version `1.2.3-alpha.7`, but it would *not* be satisfied by +`3.4.5-alpha.9`, even though `3.4.5-alpha.9` is technically "greater +than" `1.2.3-alpha.3` according to the SemVer sort rules. The version +range only accepts prerelease tags on the `1.2.3` version. The +version `3.4.5` *would* satisfy the range, because it does not have a +prerelease flag, and `3.4.5` is greater than `1.2.3-alpha.7`. + +The purpose for this behavior is twofold. First, prerelease versions +frequently are updated very quickly, and contain many breaking changes +that are (by the author's design) not yet fit for public consumption. +Therefore, by default, they are excluded from range matching +semantics. + +Second, a user who has opted into using a prerelease version has +clearly indicated the intent to use *that specific* set of +alpha/beta/rc versions. By including a prerelease tag in the range, +the user is indicating that they are aware of the risk. However, it +is still not appropriate to assume that they have opted into taking a +similar risk on the *next* set of prerelease versions. + +#### Prerelease Identifiers + +The method `.inc` takes an additional `identifier` string argument that +will append the value of the string as a prerelease identifier: + +```javascript +> semver.inc('1.2.3', 'pre', 'beta') +'1.2.4-beta.0' +``` + +command-line example: + +```shell +$ semver 1.2.3 -i prerelease --preid beta +1.2.4-beta.0 +``` + +Which then can be used to increment further: + +```shell +$ semver 1.2.4-beta.0 -i prerelease +1.2.4-beta.1 +``` + +### Advanced Range Syntax + +Advanced range syntax desugars to primitive comparators in +deterministic ways. + +Advanced ranges may be combined in the same way as primitive +comparators using white space or `||`. + +#### Hyphen Ranges `X.Y.Z - A.B.C` + +Specifies an inclusive set. + +* `1.2.3 - 2.3.4` := `>=1.2.3 <=2.3.4` + +If a partial version is provided as the first version in the inclusive +range, then the missing pieces are replaced with zeroes. + +* `1.2 - 2.3.4` := `>=1.2.0 <=2.3.4` + +If a partial version is provided as the second version in the +inclusive range, then all versions that start with the supplied parts +of the tuple are accepted, but nothing that would be greater than the +provided tuple parts. + +* `1.2.3 - 2.3` := `>=1.2.3 <2.4.0` +* `1.2.3 - 2` := `>=1.2.3 <3.0.0` + +#### X-Ranges `1.2.x` `1.X` `1.2.*` `*` + +Any of `X`, `x`, or `*` may be used to "stand in" for one of the +numeric values in the `[major, minor, patch]` tuple. + +* `*` := `>=0.0.0` (Any version satisfies) +* `1.x` := `>=1.0.0 <2.0.0` (Matching major version) +* `1.2.x` := `>=1.2.0 <1.3.0` (Matching major and minor versions) + +A partial version range is treated as an X-Range, so the special +character is in fact optional. + +* `""` (empty string) := `*` := `>=0.0.0` +* `1` := `1.x.x` := `>=1.0.0 <2.0.0` +* `1.2` := `1.2.x` := `>=1.2.0 <1.3.0` + +#### Tilde Ranges `~1.2.3` `~1.2` `~1` + +Allows patch-level changes if a minor version is specified on the +comparator. Allows minor-level changes if not. + +* `~1.2.3` := `>=1.2.3 <1.(2+1).0` := `>=1.2.3 <1.3.0` +* `~1.2` := `>=1.2.0 <1.(2+1).0` := `>=1.2.0 <1.3.0` (Same as `1.2.x`) +* `~1` := `>=1.0.0 <(1+1).0.0` := `>=1.0.0 <2.0.0` (Same as `1.x`) +* `~0.2.3` := `>=0.2.3 <0.(2+1).0` := `>=0.2.3 <0.3.0` +* `~0.2` := `>=0.2.0 <0.(2+1).0` := `>=0.2.0 <0.3.0` (Same as `0.2.x`) +* `~0` := `>=0.0.0 <(0+1).0.0` := `>=0.0.0 <1.0.0` (Same as `0.x`) +* `~1.2.3-beta.2` := `>=1.2.3-beta.2 <1.3.0` Note that prereleases in + the `1.2.3` version will be allowed, if they are greater than or + equal to `beta.2`. So, `1.2.3-beta.4` would be allowed, but + `1.2.4-beta.2` would not, because it is a prerelease of a + different `[major, minor, patch]` tuple. + +#### Caret Ranges `^1.2.3` `^0.2.5` `^0.0.4` + +Allows changes that do not modify the left-most non-zero digit in the +`[major, minor, patch]` tuple. In other words, this allows patch and +minor updates for versions `1.0.0` and above, patch updates for +versions `0.X >=0.1.0`, and *no* updates for versions `0.0.X`. + +Many authors treat a `0.x` version as if the `x` were the major +"breaking-change" indicator. + +Caret ranges are ideal when an author may make breaking changes +between `0.2.4` and `0.3.0` releases, which is a common practice. +However, it presumes that there will *not* be breaking changes between +`0.2.4` and `0.2.5`. It allows for changes that are presumed to be +additive (but non-breaking), according to commonly observed practices. + +* `^1.2.3` := `>=1.2.3 <2.0.0` +* `^0.2.3` := `>=0.2.3 <0.3.0` +* `^0.0.3` := `>=0.0.3 <0.0.4` +* `^1.2.3-beta.2` := `>=1.2.3-beta.2 <2.0.0` Note that prereleases in + the `1.2.3` version will be allowed, if they are greater than or + equal to `beta.2`. So, `1.2.3-beta.4` would be allowed, but + `1.2.4-beta.2` would not, because it is a prerelease of a + different `[major, minor, patch]` tuple. +* `^0.0.3-beta` := `>=0.0.3-beta <0.0.4` Note that prereleases in the + `0.0.3` version *only* will be allowed, if they are greater than or + equal to `beta`. So, `0.0.3-pr.2` would be allowed. + +When parsing caret ranges, a missing `patch` value desugars to the +number `0`, but will allow flexibility within that value, even if the +major and minor versions are both `0`. + +* `^1.2.x` := `>=1.2.0 <2.0.0` +* `^0.0.x` := `>=0.0.0 <0.1.0` +* `^0.0` := `>=0.0.0 <0.1.0` + +A missing `minor` and `patch` values will desugar to zero, but also +allow flexibility within those values, even if the major version is +zero. + +* `^1.x` := `>=1.0.0 <2.0.0` +* `^0.x` := `>=0.0.0 <1.0.0` + +## Functions + +All methods and classes take a final `loose` boolean argument that, if +true, will be more forgiving about not-quite-valid semver strings. +The resulting output will always be 100% strict, of course. + +Strict-mode Comparators and Ranges will be strict about the SemVer +strings that they parse. + +* `valid(v)`: Return the parsed version, or null if it's not valid. +* `inc(v, release)`: Return the version incremented by the release + type (`major`, `premajor`, `minor`, `preminor`, `patch`, + `prepatch`, or `prerelease`), or null if it's not valid + * `premajor` in one call will bump the version up to the next major + version and down to a prerelease of that major version. + `preminor`, and `prepatch` work the same way. + * If called from a non-prerelease version, the `prerelease` will work the + same as `prepatch`. It increments the patch version, then makes a + prerelease. If the input version is already a prerelease it simply + increments it. +* `major(v)`: Return the major version number. +* `minor(v)`: Return the minor version number. +* `patch(v)`: Return the patch version number. + +### Comparison + +* `gt(v1, v2)`: `v1 > v2` +* `gte(v1, v2)`: `v1 >= v2` +* `lt(v1, v2)`: `v1 < v2` +* `lte(v1, v2)`: `v1 <= v2` +* `eq(v1, v2)`: `v1 == v2` This is true if they're logically equivalent, + even if they're not the exact same string. You already know how to + compare strings. +* `neq(v1, v2)`: `v1 != v2` The opposite of `eq`. +* `cmp(v1, comparator, v2)`: Pass in a comparison string, and it'll call + the corresponding function above. `"==="` and `"!=="` do simple + string comparison, but are included for completeness. Throws if an + invalid comparison string is provided. +* `compare(v1, v2)`: Return `0` if `v1 == v2`, or `1` if `v1` is greater, or `-1` if + `v2` is greater. Sorts in ascending order if passed to `Array.sort()`. +* `rcompare(v1, v2)`: The reverse of compare. Sorts an array of versions + in descending order when passed to `Array.sort()`. +* `diff(v1, v2)`: Returns difference between two versions by the release type + (`major`, `premajor`, `minor`, `preminor`, `patch`, `prepatch`, or `prerelease`), + or null if the versions are the same. + + +### Ranges + +* `validRange(range)`: Return the valid range or null if it's not valid +* `satisfies(version, range)`: Return true if the version satisfies the + range. +* `maxSatisfying(versions, range)`: Return the highest version in the list + that satisfies the range, or `null` if none of them do. +* `gtr(version, range)`: Return `true` if version is greater than all the + versions possible in the range. +* `ltr(version, range)`: Return `true` if version is less than all the + versions possible in the range. +* `outside(version, range, hilo)`: Return true if the version is outside + the bounds of the range in either the high or low direction. The + `hilo` argument must be either the string `'>'` or `'<'`. (This is + the function called by `gtr` and `ltr`.) + +Note that, since ranges may be non-contiguous, a version might not be +greater than a range, less than a range, *or* satisfy a range! For +example, the range `1.2 <1.2.9 || >2.0.0` would have a hole from `1.2.9` +until `2.0.0`, so the version `1.2.10` would not be greater than the +range (because `2.0.1` satisfies, which is higher), nor less than the +range (since `1.2.8` satisfies, which is lower), and it also does not +satisfy the range. + +If you want to know if a version satisfies or does not satisfy a +range, use the `satisfies(version, range)` function. diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/bin/semver b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/bin/semver new file mode 100755 index 0000000000..c5f2e857e8 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/bin/semver @@ -0,0 +1,133 @@ +#!/usr/bin/env node +// Standalone semver comparison program. +// Exits successfully and prints matching version(s) if +// any supplied version is valid and passes all tests. + +var argv = process.argv.slice(2) + , versions = [] + , range = [] + , gt = [] + , lt = [] + , eq = [] + , inc = null + , version = require("../package.json").version + , loose = false + , identifier = undefined + , semver = require("../semver") + , reverse = false + +main() + +function main () { + if (!argv.length) return help() + while (argv.length) { + var a = argv.shift() + var i = a.indexOf('=') + if (i !== -1) { + a = a.slice(0, i) + argv.unshift(a.slice(i + 1)) + } + switch (a) { + case "-rv": case "-rev": case "--rev": case "--reverse": + reverse = true + break + case "-l": case "--loose": + loose = true + break + case "-v": case "--version": + versions.push(argv.shift()) + break + case "-i": case "--inc": case "--increment": + switch (argv[0]) { + case "major": case "minor": case "patch": case "prerelease": + case "premajor": case "preminor": case "prepatch": + inc = argv.shift() + break + default: + inc = "patch" + break + } + break + case "--preid": + identifier = argv.shift() + break + case "-r": case "--range": + range.push(argv.shift()) + break + case "-h": case "--help": case "-?": + return help() + default: + versions.push(a) + break + } + } + + versions = versions.filter(function (v) { + return semver.valid(v, loose) + }) + if (!versions.length) return fail() + if (inc && (versions.length !== 1 || range.length)) + return failInc() + + for (var i = 0, l = range.length; i < l ; i ++) { + versions = versions.filter(function (v) { + return semver.satisfies(v, range[i], loose) + }) + if (!versions.length) return fail() + } + return success(versions) +} + +function failInc () { + console.error("--inc can only be used on a single version with no range") + fail() +} + +function fail () { process.exit(1) } + +function success () { + var compare = reverse ? "rcompare" : "compare" + versions.sort(function (a, b) { + return semver[compare](a, b, loose) + }).map(function (v) { + return semver.clean(v, loose) + }).map(function (v) { + return inc ? semver.inc(v, inc, loose, identifier) : v + }).forEach(function (v,i,_) { console.log(v) }) +} + +function help () { + console.log(["SemVer " + version + ,"" + ,"A JavaScript implementation of the http://semver.org/ specification" + ,"Copyright Isaac Z. Schlueter" + ,"" + ,"Usage: semver [options] <version> [<version> [...]]" + ,"Prints valid versions sorted by SemVer precedence" + ,"" + ,"Options:" + ,"-r --range <range>" + ," Print versions that match the specified range." + ,"" + ,"-i --increment [<level>]" + ," Increment a version by the specified level. Level can" + ," be one of: major, minor, patch, premajor, preminor," + ," prepatch, or prerelease. Default level is 'patch'." + ," Only one version may be specified." + ,"" + ,"--preid <identifier>" + ," Identifier to be used to prefix premajor, preminor," + ," prepatch or prerelease version increments." + ,"" + ,"-l --loose" + ," Interpret versions and ranges loosely" + ,"" + ,"Program exits successfully if any valid version satisfies" + ,"all supplied ranges, and prints all satisfying versions." + ,"" + ,"If no satisfying versions are found, then exits failure." + ,"" + ,"Versions are printed in ascending order, so supplying" + ,"multiple versions to the utility will just sort them." + ].join("\n")) +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/package.json b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/package.json new file mode 100644 index 0000000000..9f13c61eab --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/package.json @@ -0,0 +1,52 @@ +{ + "_from": "semver@~5.0.1", + "_id": "semver@5.0.3", + "_integrity": "sha1-d0Zt5YnNXTyV8TiqeLxWmjy10no=", + "_location": "/pacote/make-fetch-happen/https-proxy-agent/agent-base/semver", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "semver@~5.0.1", + "name": "semver", + "escapedName": "semver", + "rawSpec": "~5.0.1", + "saveSpec": null, + "fetchSpec": "~5.0.1" + }, + "_requiredBy": [ + "/pacote/make-fetch-happen/https-proxy-agent/agent-base" + ], + "_resolved": "https://registry.npmjs.org/semver/-/semver-5.0.3.tgz", + "_shasum": "77466de589cd5d3c95f138aa78bc569a3cb5d27a", + "_shrinkwrap": null, + "_spec": "semver@~5.0.1", + "_where": "/Users/zkat/Documents/code/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base", + "bin": { + "semver": "./bin/semver" + }, + "bugs": { + "url": "https://github.com/npm/node-semver/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "The semantic version parser used by npm.", + "devDependencies": { + "tap": "^1.3.4" + }, + "homepage": "https://github.com/npm/node-semver#readme", + "license": "ISC", + "main": "semver.js", + "name": "semver", + "optionalDependencies": {}, + "peerDependencies": {}, + "repository": { + "type": "git", + "url": "git+https://github.com/npm/node-semver.git" + }, + "scripts": { + "test": "tap test/*.js" + }, + "version": "5.0.3" +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/semver.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/semver.js new file mode 100644 index 0000000000..19392d8ff9 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/semver.js @@ -0,0 +1,1200 @@ +exports = module.exports = SemVer; + +// The debug function is excluded entirely from the minified version. +/* nomin */ var debug; +/* nomin */ if (typeof process === 'object' && + /* nomin */ process.env && + /* nomin */ process.env.NODE_DEBUG && + /* nomin */ /\bsemver\b/i.test(process.env.NODE_DEBUG)) + /* nomin */ debug = function() { + /* nomin */ var args = Array.prototype.slice.call(arguments, 0); + /* nomin */ args.unshift('SEMVER'); + /* nomin */ console.log.apply(console, args); + /* nomin */ }; +/* nomin */ else + /* nomin */ debug = function() {}; + +// Note: this is the semver.org version of the spec that it implements +// Not necessarily the package version of this code. +exports.SEMVER_SPEC_VERSION = '2.0.0'; + +var MAX_LENGTH = 256; +var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991; + +// The actual regexps go on exports.re +var re = exports.re = []; +var src = exports.src = []; +var R = 0; + +// The following Regular Expressions can be used for tokenizing, +// validating, and parsing SemVer version strings. + +// ## Numeric Identifier +// A single `0`, or a non-zero digit followed by zero or more digits. + +var NUMERICIDENTIFIER = R++; +src[NUMERICIDENTIFIER] = '0|[1-9]\\d*'; +var NUMERICIDENTIFIERLOOSE = R++; +src[NUMERICIDENTIFIERLOOSE] = '[0-9]+'; + + +// ## Non-numeric Identifier +// Zero or more digits, followed by a letter or hyphen, and then zero or +// more letters, digits, or hyphens. + +var NONNUMERICIDENTIFIER = R++; +src[NONNUMERICIDENTIFIER] = '\\d*[a-zA-Z-][a-zA-Z0-9-]*'; + + +// ## Main Version +// Three dot-separated numeric identifiers. + +var MAINVERSION = R++; +src[MAINVERSION] = '(' + src[NUMERICIDENTIFIER] + ')\\.' + + '(' + src[NUMERICIDENTIFIER] + ')\\.' + + '(' + src[NUMERICIDENTIFIER] + ')'; + +var MAINVERSIONLOOSE = R++; +src[MAINVERSIONLOOSE] = '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' + + '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' + + '(' + src[NUMERICIDENTIFIERLOOSE] + ')'; + +// ## Pre-release Version Identifier +// A numeric identifier, or a non-numeric identifier. + +var PRERELEASEIDENTIFIER = R++; +src[PRERELEASEIDENTIFIER] = '(?:' + src[NUMERICIDENTIFIER] + + '|' + src[NONNUMERICIDENTIFIER] + ')'; + +var PRERELEASEIDENTIFIERLOOSE = R++; +src[PRERELEASEIDENTIFIERLOOSE] = '(?:' + src[NUMERICIDENTIFIERLOOSE] + + '|' + src[NONNUMERICIDENTIFIER] + ')'; + + +// ## Pre-release Version +// Hyphen, followed by one or more dot-separated pre-release version +// identifiers. + +var PRERELEASE = R++; +src[PRERELEASE] = '(?:-(' + src[PRERELEASEIDENTIFIER] + + '(?:\\.' + src[PRERELEASEIDENTIFIER] + ')*))'; + +var PRERELEASELOOSE = R++; +src[PRERELEASELOOSE] = '(?:-?(' + src[PRERELEASEIDENTIFIERLOOSE] + + '(?:\\.' + src[PRERELEASEIDENTIFIERLOOSE] + ')*))'; + +// ## Build Metadata Identifier +// Any combination of digits, letters, or hyphens. + +var BUILDIDENTIFIER = R++; +src[BUILDIDENTIFIER] = '[0-9A-Za-z-]+'; + +// ## Build Metadata +// Plus sign, followed by one or more period-separated build metadata +// identifiers. + +var BUILD = R++; +src[BUILD] = '(?:\\+(' + src[BUILDIDENTIFIER] + + '(?:\\.' + src[BUILDIDENTIFIER] + ')*))'; + + +// ## Full Version String +// A main version, followed optionally by a pre-release version and +// build metadata. + +// Note that the only major, minor, patch, and pre-release sections of +// the version string are capturing groups. The build metadata is not a +// capturing group, because it should not ever be used in version +// comparison. + +var FULL = R++; +var FULLPLAIN = 'v?' + src[MAINVERSION] + + src[PRERELEASE] + '?' + + src[BUILD] + '?'; + +src[FULL] = '^' + FULLPLAIN + '$'; + +// like full, but allows v1.2.3 and =1.2.3, which people do sometimes. +// also, 1.0.0alpha1 (prerelease without the hyphen) which is pretty +// common in the npm registry. +var LOOSEPLAIN = '[v=\\s]*' + src[MAINVERSIONLOOSE] + + src[PRERELEASELOOSE] + '?' + + src[BUILD] + '?'; + +var LOOSE = R++; +src[LOOSE] = '^' + LOOSEPLAIN + '$'; + +var GTLT = R++; +src[GTLT] = '((?:<|>)?=?)'; + +// Something like "2.*" or "1.2.x". +// Note that "x.x" is a valid xRange identifer, meaning "any version" +// Only the first item is strictly required. +var XRANGEIDENTIFIERLOOSE = R++; +src[XRANGEIDENTIFIERLOOSE] = src[NUMERICIDENTIFIERLOOSE] + '|x|X|\\*'; +var XRANGEIDENTIFIER = R++; +src[XRANGEIDENTIFIER] = src[NUMERICIDENTIFIER] + '|x|X|\\*'; + +var XRANGEPLAIN = R++; +src[XRANGEPLAIN] = '[v=\\s]*(' + src[XRANGEIDENTIFIER] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' + + '(?:' + src[PRERELEASE] + ')?' + + src[BUILD] + '?' + + ')?)?'; + +var XRANGEPLAINLOOSE = R++; +src[XRANGEPLAINLOOSE] = '[v=\\s]*(' + src[XRANGEIDENTIFIERLOOSE] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' + + '(?:' + src[PRERELEASELOOSE] + ')?' + + src[BUILD] + '?' + + ')?)?'; + +var XRANGE = R++; +src[XRANGE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAIN] + '$'; +var XRANGELOOSE = R++; +src[XRANGELOOSE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAINLOOSE] + '$'; + +// Tilde ranges. +// Meaning is "reasonably at or greater than" +var LONETILDE = R++; +src[LONETILDE] = '(?:~>?)'; + +var TILDETRIM = R++; +src[TILDETRIM] = '(\\s*)' + src[LONETILDE] + '\\s+'; +re[TILDETRIM] = new RegExp(src[TILDETRIM], 'g'); +var tildeTrimReplace = '$1~'; + +var TILDE = R++; +src[TILDE] = '^' + src[LONETILDE] + src[XRANGEPLAIN] + '$'; +var TILDELOOSE = R++; +src[TILDELOOSE] = '^' + src[LONETILDE] + src[XRANGEPLAINLOOSE] + '$'; + +// Caret ranges. +// Meaning is "at least and backwards compatible with" +var LONECARET = R++; +src[LONECARET] = '(?:\\^)'; + +var CARETTRIM = R++; +src[CARETTRIM] = '(\\s*)' + src[LONECARET] + '\\s+'; +re[CARETTRIM] = new RegExp(src[CARETTRIM], 'g'); +var caretTrimReplace = '$1^'; + +var CARET = R++; +src[CARET] = '^' + src[LONECARET] + src[XRANGEPLAIN] + '$'; +var CARETLOOSE = R++; +src[CARETLOOSE] = '^' + src[LONECARET] + src[XRANGEPLAINLOOSE] + '$'; + +// A simple gt/lt/eq thing, or just "" to indicate "any version" +var COMPARATORLOOSE = R++; +src[COMPARATORLOOSE] = '^' + src[GTLT] + '\\s*(' + LOOSEPLAIN + ')$|^$'; +var COMPARATOR = R++; +src[COMPARATOR] = '^' + src[GTLT] + '\\s*(' + FULLPLAIN + ')$|^$'; + + +// An expression to strip any whitespace between the gtlt and the thing +// it modifies, so that `> 1.2.3` ==> `>1.2.3` +var COMPARATORTRIM = R++; +src[COMPARATORTRIM] = '(\\s*)' + src[GTLT] + + '\\s*(' + LOOSEPLAIN + '|' + src[XRANGEPLAIN] + ')'; + +// this one has to use the /g flag +re[COMPARATORTRIM] = new RegExp(src[COMPARATORTRIM], 'g'); +var comparatorTrimReplace = '$1$2$3'; + + +// Something like `1.2.3 - 1.2.4` +// Note that these all use the loose form, because they'll be +// checked against either the strict or loose comparator form +// later. +var HYPHENRANGE = R++; +src[HYPHENRANGE] = '^\\s*(' + src[XRANGEPLAIN] + ')' + + '\\s+-\\s+' + + '(' + src[XRANGEPLAIN] + ')' + + '\\s*$'; + +var HYPHENRANGELOOSE = R++; +src[HYPHENRANGELOOSE] = '^\\s*(' + src[XRANGEPLAINLOOSE] + ')' + + '\\s+-\\s+' + + '(' + src[XRANGEPLAINLOOSE] + ')' + + '\\s*$'; + +// Star ranges basically just allow anything at all. +var STAR = R++; +src[STAR] = '(<|>)?=?\\s*\\*'; + +// Compile to actual regexp objects. +// All are flag-free, unless they were created above with a flag. +for (var i = 0; i < R; i++) { + debug(i, src[i]); + if (!re[i]) + re[i] = new RegExp(src[i]); +} + +exports.parse = parse; +function parse(version, loose) { + if (version instanceof SemVer) + return version; + + if (typeof version !== 'string') + return null; + + if (version.length > MAX_LENGTH) + return null; + + var r = loose ? re[LOOSE] : re[FULL]; + if (!r.test(version)) + return null; + + try { + return new SemVer(version, loose); + } catch (er) { + return null; + } +} + +exports.valid = valid; +function valid(version, loose) { + var v = parse(version, loose); + return v ? v.version : null; +} + + +exports.clean = clean; +function clean(version, loose) { + var s = parse(version.trim().replace(/^[=v]+/, ''), loose); + return s ? s.version : null; +} + +exports.SemVer = SemVer; + +function SemVer(version, loose) { + if (version instanceof SemVer) { + if (version.loose === loose) + return version; + else + version = version.version; + } else if (typeof version !== 'string') { + throw new TypeError('Invalid Version: ' + version); + } + + if (version.length > MAX_LENGTH) + throw new TypeError('version is longer than ' + MAX_LENGTH + ' characters') + + if (!(this instanceof SemVer)) + return new SemVer(version, loose); + + debug('SemVer', version, loose); + this.loose = loose; + var m = version.trim().match(loose ? re[LOOSE] : re[FULL]); + + if (!m) + throw new TypeError('Invalid Version: ' + version); + + this.raw = version; + + // these are actually numbers + this.major = +m[1]; + this.minor = +m[2]; + this.patch = +m[3]; + + if (this.major > MAX_SAFE_INTEGER || this.major < 0) + throw new TypeError('Invalid major version') + + if (this.minor > MAX_SAFE_INTEGER || this.minor < 0) + throw new TypeError('Invalid minor version') + + if (this.patch > MAX_SAFE_INTEGER || this.patch < 0) + throw new TypeError('Invalid patch version') + + // numberify any prerelease numeric ids + if (!m[4]) + this.prerelease = []; + else + this.prerelease = m[4].split('.').map(function(id) { + if (/^[0-9]+$/.test(id)) { + var num = +id + if (num >= 0 && num < MAX_SAFE_INTEGER) + return num + } + return id; + }); + + this.build = m[5] ? m[5].split('.') : []; + this.format(); +} + +SemVer.prototype.format = function() { + this.version = this.major + '.' + this.minor + '.' + this.patch; + if (this.prerelease.length) + this.version += '-' + this.prerelease.join('.'); + return this.version; +}; + +SemVer.prototype.inspect = function() { + return '<SemVer "' + this + '">'; +}; + +SemVer.prototype.toString = function() { + return this.version; +}; + +SemVer.prototype.compare = function(other) { + debug('SemVer.compare', this.version, this.loose, other); + if (!(other instanceof SemVer)) + other = new SemVer(other, this.loose); + + return this.compareMain(other) || this.comparePre(other); +}; + +SemVer.prototype.compareMain = function(other) { + if (!(other instanceof SemVer)) + other = new SemVer(other, this.loose); + + return compareIdentifiers(this.major, other.major) || + compareIdentifiers(this.minor, other.minor) || + compareIdentifiers(this.patch, other.patch); +}; + +SemVer.prototype.comparePre = function(other) { + if (!(other instanceof SemVer)) + other = new SemVer(other, this.loose); + + // NOT having a prerelease is > having one + if (this.prerelease.length && !other.prerelease.length) + return -1; + else if (!this.prerelease.length && other.prerelease.length) + return 1; + else if (!this.prerelease.length && !other.prerelease.length) + return 0; + + var i = 0; + do { + var a = this.prerelease[i]; + var b = other.prerelease[i]; + debug('prerelease compare', i, a, b); + if (a === undefined && b === undefined) + return 0; + else if (b === undefined) + return 1; + else if (a === undefined) + return -1; + else if (a === b) + continue; + else + return compareIdentifiers(a, b); + } while (++i); +}; + +// preminor will bump the version up to the next minor release, and immediately +// down to pre-release. premajor and prepatch work the same way. +SemVer.prototype.inc = function(release, identifier) { + switch (release) { + case 'premajor': + this.prerelease.length = 0; + this.patch = 0; + this.minor = 0; + this.major++; + this.inc('pre', identifier); + break; + case 'preminor': + this.prerelease.length = 0; + this.patch = 0; + this.minor++; + this.inc('pre', identifier); + break; + case 'prepatch': + // If this is already a prerelease, it will bump to the next version + // drop any prereleases that might already exist, since they are not + // relevant at this point. + this.prerelease.length = 0; + this.inc('patch', identifier); + this.inc('pre', identifier); + break; + // If the input is a non-prerelease version, this acts the same as + // prepatch. + case 'prerelease': + if (this.prerelease.length === 0) + this.inc('patch', identifier); + this.inc('pre', identifier); + break; + + case 'major': + // If this is a pre-major version, bump up to the same major version. + // Otherwise increment major. + // 1.0.0-5 bumps to 1.0.0 + // 1.1.0 bumps to 2.0.0 + if (this.minor !== 0 || this.patch !== 0 || this.prerelease.length === 0) + this.major++; + this.minor = 0; + this.patch = 0; + this.prerelease = []; + break; + case 'minor': + // If this is a pre-minor version, bump up to the same minor version. + // Otherwise increment minor. + // 1.2.0-5 bumps to 1.2.0 + // 1.2.1 bumps to 1.3.0 + if (this.patch !== 0 || this.prerelease.length === 0) + this.minor++; + this.patch = 0; + this.prerelease = []; + break; + case 'patch': + // If this is not a pre-release version, it will increment the patch. + // If it is a pre-release it will bump up to the same patch version. + // 1.2.0-5 patches to 1.2.0 + // 1.2.0 patches to 1.2.1 + if (this.prerelease.length === 0) + this.patch++; + this.prerelease = []; + break; + // This probably shouldn't be used publicly. + // 1.0.0 "pre" would become 1.0.0-0 which is the wrong direction. + case 'pre': + if (this.prerelease.length === 0) + this.prerelease = [0]; + else { + var i = this.prerelease.length; + while (--i >= 0) { + if (typeof this.prerelease[i] === 'number') { + this.prerelease[i]++; + i = -2; + } + } + if (i === -1) // didn't increment anything + this.prerelease.push(0); + } + if (identifier) { + // 1.2.0-beta.1 bumps to 1.2.0-beta.2, + // 1.2.0-beta.fooblz or 1.2.0-beta bumps to 1.2.0-beta.0 + if (this.prerelease[0] === identifier) { + if (isNaN(this.prerelease[1])) + this.prerelease = [identifier, 0]; + } else + this.prerelease = [identifier, 0]; + } + break; + + default: + throw new Error('invalid increment argument: ' + release); + } + this.format(); + this.raw = this.version; + return this; +}; + +exports.inc = inc; +function inc(version, release, loose, identifier) { + if (typeof(loose) === 'string') { + identifier = loose; + loose = undefined; + } + + try { + return new SemVer(version, loose).inc(release, identifier).version; + } catch (er) { + return null; + } +} + +exports.diff = diff; +function diff(version1, version2) { + if (eq(version1, version2)) { + return null; + } else { + var v1 = parse(version1); + var v2 = parse(version2); + if (v1.prerelease.length || v2.prerelease.length) { + for (var key in v1) { + if (key === 'major' || key === 'minor' || key === 'patch') { + if (v1[key] !== v2[key]) { + return 'pre'+key; + } + } + } + return 'prerelease'; + } + for (var key in v1) { + if (key === 'major' || key === 'minor' || key === 'patch') { + if (v1[key] !== v2[key]) { + return key; + } + } + } + } +} + +exports.compareIdentifiers = compareIdentifiers; + +var numeric = /^[0-9]+$/; +function compareIdentifiers(a, b) { + var anum = numeric.test(a); + var bnum = numeric.test(b); + + if (anum && bnum) { + a = +a; + b = +b; + } + + return (anum && !bnum) ? -1 : + (bnum && !anum) ? 1 : + a < b ? -1 : + a > b ? 1 : + 0; +} + +exports.rcompareIdentifiers = rcompareIdentifiers; +function rcompareIdentifiers(a, b) { + return compareIdentifiers(b, a); +} + +exports.major = major; +function major(a, loose) { + return new SemVer(a, loose).major; +} + +exports.minor = minor; +function minor(a, loose) { + return new SemVer(a, loose).minor; +} + +exports.patch = patch; +function patch(a, loose) { + return new SemVer(a, loose).patch; +} + +exports.compare = compare; +function compare(a, b, loose) { + return new SemVer(a, loose).compare(b); +} + +exports.compareLoose = compareLoose; +function compareLoose(a, b) { + return compare(a, b, true); +} + +exports.rcompare = rcompare; +function rcompare(a, b, loose) { + return compare(b, a, loose); +} + +exports.sort = sort; +function sort(list, loose) { + return list.sort(function(a, b) { + return exports.compare(a, b, loose); + }); +} + +exports.rsort = rsort; +function rsort(list, loose) { + return list.sort(function(a, b) { + return exports.rcompare(a, b, loose); + }); +} + +exports.gt = gt; +function gt(a, b, loose) { + return compare(a, b, loose) > 0; +} + +exports.lt = lt; +function lt(a, b, loose) { + return compare(a, b, loose) < 0; +} + +exports.eq = eq; +function eq(a, b, loose) { + return compare(a, b, loose) === 0; +} + +exports.neq = neq; +function neq(a, b, loose) { + return compare(a, b, loose) !== 0; +} + +exports.gte = gte; +function gte(a, b, loose) { + return compare(a, b, loose) >= 0; +} + +exports.lte = lte; +function lte(a, b, loose) { + return compare(a, b, loose) <= 0; +} + +exports.cmp = cmp; +function cmp(a, op, b, loose) { + var ret; + switch (op) { + case '===': + if (typeof a === 'object') a = a.version; + if (typeof b === 'object') b = b.version; + ret = a === b; + break; + case '!==': + if (typeof a === 'object') a = a.version; + if (typeof b === 'object') b = b.version; + ret = a !== b; + break; + case '': case '=': case '==': ret = eq(a, b, loose); break; + case '!=': ret = neq(a, b, loose); break; + case '>': ret = gt(a, b, loose); break; + case '>=': ret = gte(a, b, loose); break; + case '<': ret = lt(a, b, loose); break; + case '<=': ret = lte(a, b, loose); break; + default: throw new TypeError('Invalid operator: ' + op); + } + return ret; +} + +exports.Comparator = Comparator; +function Comparator(comp, loose) { + if (comp instanceof Comparator) { + if (comp.loose === loose) + return comp; + else + comp = comp.value; + } + + if (!(this instanceof Comparator)) + return new Comparator(comp, loose); + + debug('comparator', comp, loose); + this.loose = loose; + this.parse(comp); + + if (this.semver === ANY) + this.value = ''; + else + this.value = this.operator + this.semver.version; + + debug('comp', this); +} + +var ANY = {}; +Comparator.prototype.parse = function(comp) { + var r = this.loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; + var m = comp.match(r); + + if (!m) + throw new TypeError('Invalid comparator: ' + comp); + + this.operator = m[1]; + if (this.operator === '=') + this.operator = ''; + + // if it literally is just '>' or '' then allow anything. + if (!m[2]) + this.semver = ANY; + else + this.semver = new SemVer(m[2], this.loose); +}; + +Comparator.prototype.inspect = function() { + return '<SemVer Comparator "' + this + '">'; +}; + +Comparator.prototype.toString = function() { + return this.value; +}; + +Comparator.prototype.test = function(version) { + debug('Comparator.test', version, this.loose); + + if (this.semver === ANY) + return true; + + if (typeof version === 'string') + version = new SemVer(version, this.loose); + + return cmp(version, this.operator, this.semver, this.loose); +}; + + +exports.Range = Range; +function Range(range, loose) { + if ((range instanceof Range) && range.loose === loose) + return range; + + if (!(this instanceof Range)) + return new Range(range, loose); + + this.loose = loose; + + // First, split based on boolean or || + this.raw = range; + this.set = range.split(/\s*\|\|\s*/).map(function(range) { + return this.parseRange(range.trim()); + }, this).filter(function(c) { + // throw out any that are not relevant for whatever reason + return c.length; + }); + + if (!this.set.length) { + throw new TypeError('Invalid SemVer Range: ' + range); + } + + this.format(); +} + +Range.prototype.inspect = function() { + return '<SemVer Range "' + this.range + '">'; +}; + +Range.prototype.format = function() { + this.range = this.set.map(function(comps) { + return comps.join(' ').trim(); + }).join('||').trim(); + return this.range; +}; + +Range.prototype.toString = function() { + return this.range; +}; + +Range.prototype.parseRange = function(range) { + var loose = this.loose; + range = range.trim(); + debug('range', range, loose); + // `1.2.3 - 1.2.4` => `>=1.2.3 <=1.2.4` + var hr = loose ? re[HYPHENRANGELOOSE] : re[HYPHENRANGE]; + range = range.replace(hr, hyphenReplace); + debug('hyphen replace', range); + // `> 1.2.3 < 1.2.5` => `>1.2.3 <1.2.5` + range = range.replace(re[COMPARATORTRIM], comparatorTrimReplace); + debug('comparator trim', range, re[COMPARATORTRIM]); + + // `~ 1.2.3` => `~1.2.3` + range = range.replace(re[TILDETRIM], tildeTrimReplace); + + // `^ 1.2.3` => `^1.2.3` + range = range.replace(re[CARETTRIM], caretTrimReplace); + + // normalize spaces + range = range.split(/\s+/).join(' '); + + // At this point, the range is completely trimmed and + // ready to be split into comparators. + + var compRe = loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; + var set = range.split(' ').map(function(comp) { + return parseComparator(comp, loose); + }).join(' ').split(/\s+/); + if (this.loose) { + // in loose mode, throw out any that are not valid comparators + set = set.filter(function(comp) { + return !!comp.match(compRe); + }); + } + set = set.map(function(comp) { + return new Comparator(comp, loose); + }); + + return set; +}; + +// Mostly just for testing and legacy API reasons +exports.toComparators = toComparators; +function toComparators(range, loose) { + return new Range(range, loose).set.map(function(comp) { + return comp.map(function(c) { + return c.value; + }).join(' ').trim().split(' '); + }); +} + +// comprised of xranges, tildes, stars, and gtlt's at this point. +// already replaced the hyphen ranges +// turn into a set of JUST comparators. +function parseComparator(comp, loose) { + debug('comp', comp); + comp = replaceCarets(comp, loose); + debug('caret', comp); + comp = replaceTildes(comp, loose); + debug('tildes', comp); + comp = replaceXRanges(comp, loose); + debug('xrange', comp); + comp = replaceStars(comp, loose); + debug('stars', comp); + return comp; +} + +function isX(id) { + return !id || id.toLowerCase() === 'x' || id === '*'; +} + +// ~, ~> --> * (any, kinda silly) +// ~2, ~2.x, ~2.x.x, ~>2, ~>2.x ~>2.x.x --> >=2.0.0 <3.0.0 +// ~2.0, ~2.0.x, ~>2.0, ~>2.0.x --> >=2.0.0 <2.1.0 +// ~1.2, ~1.2.x, ~>1.2, ~>1.2.x --> >=1.2.0 <1.3.0 +// ~1.2.3, ~>1.2.3 --> >=1.2.3 <1.3.0 +// ~1.2.0, ~>1.2.0 --> >=1.2.0 <1.3.0 +function replaceTildes(comp, loose) { + return comp.trim().split(/\s+/).map(function(comp) { + return replaceTilde(comp, loose); + }).join(' '); +} + +function replaceTilde(comp, loose) { + var r = loose ? re[TILDELOOSE] : re[TILDE]; + return comp.replace(r, function(_, M, m, p, pr) { + debug('tilde', comp, _, M, m, p, pr); + var ret; + + if (isX(M)) + ret = ''; + else if (isX(m)) + ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + else if (isX(p)) + // ~1.2 == >=1.2.0- <1.3.0- + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + else if (pr) { + debug('replaceTilde pr', pr); + if (pr.charAt(0) !== '-') + pr = '-' + pr; + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + M + '.' + (+m + 1) + '.0'; + } else + // ~1.2.3 == >=1.2.3 <1.3.0 + ret = '>=' + M + '.' + m + '.' + p + + ' <' + M + '.' + (+m + 1) + '.0'; + + debug('tilde return', ret); + return ret; + }); +} + +// ^ --> * (any, kinda silly) +// ^2, ^2.x, ^2.x.x --> >=2.0.0 <3.0.0 +// ^2.0, ^2.0.x --> >=2.0.0 <3.0.0 +// ^1.2, ^1.2.x --> >=1.2.0 <2.0.0 +// ^1.2.3 --> >=1.2.3 <2.0.0 +// ^1.2.0 --> >=1.2.0 <2.0.0 +function replaceCarets(comp, loose) { + return comp.trim().split(/\s+/).map(function(comp) { + return replaceCaret(comp, loose); + }).join(' '); +} + +function replaceCaret(comp, loose) { + debug('caret', comp, loose); + var r = loose ? re[CARETLOOSE] : re[CARET]; + return comp.replace(r, function(_, M, m, p, pr) { + debug('caret', comp, _, M, m, p, pr); + var ret; + + if (isX(M)) + ret = ''; + else if (isX(m)) + ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + else if (isX(p)) { + if (M === '0') + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + else + ret = '>=' + M + '.' + m + '.0 <' + (+M + 1) + '.0.0'; + } else if (pr) { + debug('replaceCaret pr', pr); + if (pr.charAt(0) !== '-') + pr = '-' + pr; + if (M === '0') { + if (m === '0') + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + M + '.' + m + '.' + (+p + 1); + else + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + M + '.' + (+m + 1) + '.0'; + } else + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + (+M + 1) + '.0.0'; + } else { + debug('no pr'); + if (M === '0') { + if (m === '0') + ret = '>=' + M + '.' + m + '.' + p + + ' <' + M + '.' + m + '.' + (+p + 1); + else + ret = '>=' + M + '.' + m + '.' + p + + ' <' + M + '.' + (+m + 1) + '.0'; + } else + ret = '>=' + M + '.' + m + '.' + p + + ' <' + (+M + 1) + '.0.0'; + } + + debug('caret return', ret); + return ret; + }); +} + +function replaceXRanges(comp, loose) { + debug('replaceXRanges', comp, loose); + return comp.split(/\s+/).map(function(comp) { + return replaceXRange(comp, loose); + }).join(' '); +} + +function replaceXRange(comp, loose) { + comp = comp.trim(); + var r = loose ? re[XRANGELOOSE] : re[XRANGE]; + return comp.replace(r, function(ret, gtlt, M, m, p, pr) { + debug('xRange', comp, ret, gtlt, M, m, p, pr); + var xM = isX(M); + var xm = xM || isX(m); + var xp = xm || isX(p); + var anyX = xp; + + if (gtlt === '=' && anyX) + gtlt = ''; + + if (xM) { + if (gtlt === '>' || gtlt === '<') { + // nothing is allowed + ret = '<0.0.0'; + } else { + // nothing is forbidden + ret = '*'; + } + } else if (gtlt && anyX) { + // replace X with 0 + if (xm) + m = 0; + if (xp) + p = 0; + + if (gtlt === '>') { + // >1 => >=2.0.0 + // >1.2 => >=1.3.0 + // >1.2.3 => >= 1.2.4 + gtlt = '>='; + if (xm) { + M = +M + 1; + m = 0; + p = 0; + } else if (xp) { + m = +m + 1; + p = 0; + } + } else if (gtlt === '<=') { + // <=0.7.x is actually <0.8.0, since any 0.7.x should + // pass. Similarly, <=7.x is actually <8.0.0, etc. + gtlt = '<' + if (xm) + M = +M + 1 + else + m = +m + 1 + } + + ret = gtlt + M + '.' + m + '.' + p; + } else if (xm) { + ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + } else if (xp) { + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + } + + debug('xRange return', ret); + + return ret; + }); +} + +// Because * is AND-ed with everything else in the comparator, +// and '' means "any version", just remove the *s entirely. +function replaceStars(comp, loose) { + debug('replaceStars', comp, loose); + // Looseness is ignored here. star is always as loose as it gets! + return comp.trim().replace(re[STAR], ''); +} + +// This function is passed to string.replace(re[HYPHENRANGE]) +// M, m, patch, prerelease, build +// 1.2 - 3.4.5 => >=1.2.0 <=3.4.5 +// 1.2.3 - 3.4 => >=1.2.0 <3.5.0 Any 3.4.x will do +// 1.2 - 3.4 => >=1.2.0 <3.5.0 +function hyphenReplace($0, + from, fM, fm, fp, fpr, fb, + to, tM, tm, tp, tpr, tb) { + + if (isX(fM)) + from = ''; + else if (isX(fm)) + from = '>=' + fM + '.0.0'; + else if (isX(fp)) + from = '>=' + fM + '.' + fm + '.0'; + else + from = '>=' + from; + + if (isX(tM)) + to = ''; + else if (isX(tm)) + to = '<' + (+tM + 1) + '.0.0'; + else if (isX(tp)) + to = '<' + tM + '.' + (+tm + 1) + '.0'; + else if (tpr) + to = '<=' + tM + '.' + tm + '.' + tp + '-' + tpr; + else + to = '<=' + to; + + return (from + ' ' + to).trim(); +} + + +// if ANY of the sets match ALL of its comparators, then pass +Range.prototype.test = function(version) { + if (!version) + return false; + + if (typeof version === 'string') + version = new SemVer(version, this.loose); + + for (var i = 0; i < this.set.length; i++) { + if (testSet(this.set[i], version)) + return true; + } + return false; +}; + +function testSet(set, version) { + for (var i = 0; i < set.length; i++) { + if (!set[i].test(version)) + return false; + } + + if (version.prerelease.length) { + // Find the set of versions that are allowed to have prereleases + // For example, ^1.2.3-pr.1 desugars to >=1.2.3-pr.1 <2.0.0 + // That should allow `1.2.3-pr.2` to pass. + // However, `1.2.4-alpha.notready` should NOT be allowed, + // even though it's within the range set by the comparators. + for (var i = 0; i < set.length; i++) { + debug(set[i].semver); + if (set[i].semver === ANY) + continue; + + if (set[i].semver.prerelease.length > 0) { + var allowed = set[i].semver; + if (allowed.major === version.major && + allowed.minor === version.minor && + allowed.patch === version.patch) + return true; + } + } + + // Version has a -pre, but it's not one of the ones we like. + return false; + } + + return true; +} + +exports.satisfies = satisfies; +function satisfies(version, range, loose) { + try { + range = new Range(range, loose); + } catch (er) { + return false; + } + return range.test(version); +} + +exports.maxSatisfying = maxSatisfying; +function maxSatisfying(versions, range, loose) { + return versions.filter(function(version) { + return satisfies(version, range, loose); + }).sort(function(a, b) { + return rcompare(a, b, loose); + })[0] || null; +} + +exports.validRange = validRange; +function validRange(range, loose) { + try { + // Return '*' instead of '' so that truthiness works. + // This will throw if it's invalid anyway + return new Range(range, loose).range || '*'; + } catch (er) { + return null; + } +} + +// Determine if version is less than all the versions possible in the range +exports.ltr = ltr; +function ltr(version, range, loose) { + return outside(version, range, '<', loose); +} + +// Determine if version is greater than all the versions possible in the range. +exports.gtr = gtr; +function gtr(version, range, loose) { + return outside(version, range, '>', loose); +} + +exports.outside = outside; +function outside(version, range, hilo, loose) { + version = new SemVer(version, loose); + range = new Range(range, loose); + + var gtfn, ltefn, ltfn, comp, ecomp; + switch (hilo) { + case '>': + gtfn = gt; + ltefn = lte; + ltfn = lt; + comp = '>'; + ecomp = '>='; + break; + case '<': + gtfn = lt; + ltefn = gte; + ltfn = gt; + comp = '<'; + ecomp = '<='; + break; + default: + throw new TypeError('Must provide a hilo val of "<" or ">"'); + } + + // If it satisifes the range it is not outside + if (satisfies(version, range, loose)) { + return false; + } + + // From now on, variable terms are as if we're in "gtr" mode. + // but note that everything is flipped for the "ltr" function. + + for (var i = 0; i < range.set.length; ++i) { + var comparators = range.set[i]; + + var high = null; + var low = null; + + comparators.forEach(function(comparator) { + if (comparator.semver === ANY) { + comparator = new Comparator('>=0.0.0') + } + high = high || comparator; + low = low || comparator; + if (gtfn(comparator.semver, high.semver, loose)) { + high = comparator; + } else if (ltfn(comparator.semver, low.semver, loose)) { + low = comparator; + } + }); + + // If the edge version comparator has a operator then our version + // isn't outside it + if (high.operator === comp || high.operator === ecomp) { + return false; + } + + // If the lowest version comparator has an operator and our version + // is less than it then it isn't higher than the range + if ((!low.operator || low.operator === comp) && + ltefn(version, low.semver)) { + return false; + } else if (low.operator === ecomp && ltfn(version, low.semver)) { + return false; + } + } + return true; +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/big-numbers.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/big-numbers.js new file mode 100644 index 0000000000..c051864bc9 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/big-numbers.js @@ -0,0 +1,31 @@ +var test = require('tap').test +var semver = require('../') + +test('long version is too long', function (t) { + var v = '1.2.' + new Array(256).join('1') + t.throws(function () { + new semver.SemVer(v) + }) + t.equal(semver.valid(v, false), null) + t.equal(semver.valid(v, true), null) + t.equal(semver.inc(v, 'patch'), null) + t.end() +}) + +test('big number is like too long version', function (t) { + var v = '1.2.' + new Array(100).join('1') + t.throws(function () { + new semver.SemVer(v) + }) + t.equal(semver.valid(v, false), null) + t.equal(semver.valid(v, true), null) + t.equal(semver.inc(v, 'patch'), null) + t.end() +}) + +test('parsing null does not throw', function (t) { + t.equal(semver.parse(null), null) + t.equal(semver.parse({}), null) + t.equal(semver.parse(new semver.SemVer('1.2.3')).version, '1.2.3') + t.end() +}) diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/clean.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/clean.js new file mode 100644 index 0000000000..9e268de950 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/clean.js @@ -0,0 +1,29 @@ +var tap = require('tap'); +var test = tap.test; +var semver = require('../semver.js'); +var clean = semver.clean; + +test('\nclean tests', function(t) { + // [range, version] + // Version should be detectable despite extra characters + [ + ['1.2.3', '1.2.3'], + [' 1.2.3 ', '1.2.3'], + [' 1.2.3-4 ', '1.2.3-4'], + [' 1.2.3-pre ', '1.2.3-pre'], + [' =v1.2.3 ', '1.2.3'], + ['v1.2.3', '1.2.3'], + [' v1.2.3 ', '1.2.3'], + ['\t1.2.3', '1.2.3'], + ['>1.2.3', null], + ['~1.2.3', null], + ['<=1.2.3', null], + ['1.2.x', null] + ].forEach(function(tuple) { + var range = tuple[0]; + var version = tuple[1]; + var msg = 'clean(' + range + ') = ' + version; + t.equal(clean(range), version, msg); + }); + t.end(); +}); diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/gtr.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/gtr.js new file mode 100644 index 0000000000..bbb87896c6 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/gtr.js @@ -0,0 +1,173 @@ +var tap = require('tap'); +var test = tap.test; +var semver = require('../semver.js'); +var gtr = semver.gtr; + +test('\ngtr tests', function(t) { + // [range, version, loose] + // Version should be greater than range + [ + ['~1.2.2', '1.3.0'], + ['~0.6.1-1', '0.7.1-1'], + ['1.0.0 - 2.0.0', '2.0.1'], + ['1.0.0', '1.0.1-beta1'], + ['1.0.0', '2.0.0'], + ['<=2.0.0', '2.1.1'], + ['<=2.0.0', '3.2.9'], + ['<2.0.0', '2.0.0'], + ['0.1.20 || 1.2.4', '1.2.5'], + ['2.x.x', '3.0.0'], + ['1.2.x', '1.3.0'], + ['1.2.x || 2.x', '3.0.0'], + ['2.*.*', '5.0.1'], + ['1.2.*', '1.3.3'], + ['1.2.* || 2.*', '4.0.0'], + ['2', '3.0.0'], + ['2.3', '2.4.2'], + ['~2.4', '2.5.0'], // >=2.4.0 <2.5.0 + ['~2.4', '2.5.5'], + ['~>3.2.1', '3.3.0'], // >=3.2.1 <3.3.0 + ['~1', '2.2.3'], // >=1.0.0 <2.0.0 + ['~>1', '2.2.4'], + ['~> 1', '3.2.3'], + ['~1.0', '1.1.2'], // >=1.0.0 <1.1.0 + ['~ 1.0', '1.1.0'], + ['<1.2', '1.2.0'], + ['< 1.2', '1.2.1'], + ['1', '2.0.0beta', true], + ['~v0.5.4-pre', '0.6.0'], + ['~v0.5.4-pre', '0.6.1-pre'], + ['=0.7.x', '0.8.0'], + ['=0.7.x', '0.8.0-asdf'], + ['<0.7.x', '0.7.0'], + ['~1.2.2', '1.3.0'], + ['1.0.0 - 2.0.0', '2.2.3'], + ['1.0.0', '1.0.1'], + ['<=2.0.0', '3.0.0'], + ['<=2.0.0', '2.9999.9999'], + ['<=2.0.0', '2.2.9'], + ['<2.0.0', '2.9999.9999'], + ['<2.0.0', '2.2.9'], + ['2.x.x', '3.1.3'], + ['1.2.x', '1.3.3'], + ['1.2.x || 2.x', '3.1.3'], + ['2.*.*', '3.1.3'], + ['1.2.*', '1.3.3'], + ['1.2.* || 2.*', '3.1.3'], + ['2', '3.1.2'], + ['2.3', '2.4.1'], + ['~2.4', '2.5.0'], // >=2.4.0 <2.5.0 + ['~>3.2.1', '3.3.2'], // >=3.2.1 <3.3.0 + ['~1', '2.2.3'], // >=1.0.0 <2.0.0 + ['~>1', '2.2.3'], + ['~1.0', '1.1.0'], // >=1.0.0 <1.1.0 + ['<1', '1.0.0'], + ['1', '2.0.0beta', true], + ['<1', '1.0.0beta', true], + ['< 1', '1.0.0beta', true], + ['=0.7.x', '0.8.2'], + ['<0.7.x', '0.7.2'] + ].forEach(function(tuple) { + var range = tuple[0]; + var version = tuple[1]; + var loose = tuple[2] || false; + var msg = 'gtr(' + version + ', ' + range + ', ' + loose + ')'; + t.ok(gtr(version, range, loose), msg); + }); + t.end(); +}); + +test('\nnegative gtr tests', function(t) { + // [range, version, loose] + // Version should NOT be greater than range + [ + ['~0.6.1-1', '0.6.1-1'], + ['1.0.0 - 2.0.0', '1.2.3'], + ['1.0.0 - 2.0.0', '0.9.9'], + ['1.0.0', '1.0.0'], + ['>=*', '0.2.4'], + ['', '1.0.0', true], + ['*', '1.2.3'], + ['*', 'v1.2.3-foo'], + ['>=1.0.0', '1.0.0'], + ['>=1.0.0', '1.0.1'], + ['>=1.0.0', '1.1.0'], + ['>1.0.0', '1.0.1'], + ['>1.0.0', '1.1.0'], + ['<=2.0.0', '2.0.0'], + ['<=2.0.0', '1.9999.9999'], + ['<=2.0.0', '0.2.9'], + ['<2.0.0', '1.9999.9999'], + ['<2.0.0', '0.2.9'], + ['>= 1.0.0', '1.0.0'], + ['>= 1.0.0', '1.0.1'], + ['>= 1.0.0', '1.1.0'], + ['> 1.0.0', '1.0.1'], + ['> 1.0.0', '1.1.0'], + ['<= 2.0.0', '2.0.0'], + ['<= 2.0.0', '1.9999.9999'], + ['<= 2.0.0', '0.2.9'], + ['< 2.0.0', '1.9999.9999'], + ['<\t2.0.0', '0.2.9'], + ['>=0.1.97', 'v0.1.97'], + ['>=0.1.97', '0.1.97'], + ['0.1.20 || 1.2.4', '1.2.4'], + ['0.1.20 || >1.2.4', '1.2.4'], + ['0.1.20 || 1.2.4', '1.2.3'], + ['0.1.20 || 1.2.4', '0.1.20'], + ['>=0.2.3 || <0.0.1', '0.0.0'], + ['>=0.2.3 || <0.0.1', '0.2.3'], + ['>=0.2.3 || <0.0.1', '0.2.4'], + ['||', '1.3.4'], + ['2.x.x', '2.1.3'], + ['1.2.x', '1.2.3'], + ['1.2.x || 2.x', '2.1.3'], + ['1.2.x || 2.x', '1.2.3'], + ['x', '1.2.3'], + ['2.*.*', '2.1.3'], + ['1.2.*', '1.2.3'], + ['1.2.* || 2.*', '2.1.3'], + ['1.2.* || 2.*', '1.2.3'], + ['1.2.* || 2.*', '1.2.3'], + ['*', '1.2.3'], + ['2', '2.1.2'], + ['2.3', '2.3.1'], + ['~2.4', '2.4.0'], // >=2.4.0 <2.5.0 + ['~2.4', '2.4.5'], + ['~>3.2.1', '3.2.2'], // >=3.2.1 <3.3.0 + ['~1', '1.2.3'], // >=1.0.0 <2.0.0 + ['~>1', '1.2.3'], + ['~> 1', '1.2.3'], + ['~1.0', '1.0.2'], // >=1.0.0 <1.1.0 + ['~ 1.0', '1.0.2'], + ['>=1', '1.0.0'], + ['>= 1', '1.0.0'], + ['<1.2', '1.1.1'], + ['< 1.2', '1.1.1'], + ['1', '1.0.0beta', true], + ['~v0.5.4-pre', '0.5.5'], + ['~v0.5.4-pre', '0.5.4'], + ['=0.7.x', '0.7.2'], + ['>=0.7.x', '0.7.2'], + ['=0.7.x', '0.7.0-asdf'], + ['>=0.7.x', '0.7.0-asdf'], + ['<=0.7.x', '0.6.2'], + ['>0.2.3 >0.2.4 <=0.2.5', '0.2.5'], + ['>=0.2.3 <=0.2.4', '0.2.4'], + ['1.0.0 - 2.0.0', '2.0.0'], + ['^1', '0.0.0-0'], + ['^3.0.0', '2.0.0'], + ['^1.0.0 || ~2.0.1', '2.0.0'], + ['^0.1.0 || ~3.0.1 || 5.0.0', '3.2.0'], + ['^0.1.0 || ~3.0.1 || 5.0.0', '1.0.0beta', true], + ['^0.1.0 || ~3.0.1 || 5.0.0', '5.0.0-0', true], + ['^0.1.0 || ~3.0.1 || >4 <=5.0.0', '3.5.0'] + ].forEach(function(tuple) { + var range = tuple[0]; + var version = tuple[1]; + var loose = tuple[2] || false; + var msg = '!gtr(' + version + ', ' + range + ', ' + loose + ')'; + t.notOk(gtr(version, range, loose), msg); + }); + t.end(); +}); diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/index.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/index.js new file mode 100644 index 0000000000..47c3f5f951 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/index.js @@ -0,0 +1,698 @@ +'use strict'; + +var tap = require('tap'); +var test = tap.test; +var semver = require('../semver.js'); +var eq = semver.eq; +var gt = semver.gt; +var lt = semver.lt; +var neq = semver.neq; +var cmp = semver.cmp; +var gte = semver.gte; +var lte = semver.lte; +var satisfies = semver.satisfies; +var validRange = semver.validRange; +var inc = semver.inc; +var diff = semver.diff; +var replaceStars = semver.replaceStars; +var toComparators = semver.toComparators; +var SemVer = semver.SemVer; +var Range = semver.Range; + +test('\ncomparison tests', function(t) { + // [version1, version2] + // version1 should be greater than version2 + [['0.0.0', '0.0.0-foo'], + ['0.0.1', '0.0.0'], + ['1.0.0', '0.9.9'], + ['0.10.0', '0.9.0'], + ['0.99.0', '0.10.0'], + ['2.0.0', '1.2.3'], + ['v0.0.0', '0.0.0-foo', true], + ['v0.0.1', '0.0.0', true], + ['v1.0.0', '0.9.9', true], + ['v0.10.0', '0.9.0', true], + ['v0.99.0', '0.10.0', true], + ['v2.0.0', '1.2.3', true], + ['0.0.0', 'v0.0.0-foo', true], + ['0.0.1', 'v0.0.0', true], + ['1.0.0', 'v0.9.9', true], + ['0.10.0', 'v0.9.0', true], + ['0.99.0', 'v0.10.0', true], + ['2.0.0', 'v1.2.3', true], + ['1.2.3', '1.2.3-asdf'], + ['1.2.3', '1.2.3-4'], + ['1.2.3', '1.2.3-4-foo'], + ['1.2.3-5-foo', '1.2.3-5'], + ['1.2.3-5', '1.2.3-4'], + ['1.2.3-5-foo', '1.2.3-5-Foo'], + ['3.0.0', '2.7.2+asdf'], + ['1.2.3-a.10', '1.2.3-a.5'], + ['1.2.3-a.b', '1.2.3-a.5'], + ['1.2.3-a.b', '1.2.3-a'], + ['1.2.3-a.b.c.10.d.5', '1.2.3-a.b.c.5.d.100'], + ['1.2.3-r2', '1.2.3-r100'], + ['1.2.3-r100', '1.2.3-R2'] + ].forEach(function(v) { + var v0 = v[0]; + var v1 = v[1]; + var loose = v[2]; + t.ok(gt(v0, v1, loose), "gt('" + v0 + "', '" + v1 + "')"); + t.ok(lt(v1, v0, loose), "lt('" + v1 + "', '" + v0 + "')"); + t.ok(!gt(v1, v0, loose), "!gt('" + v1 + "', '" + v0 + "')"); + t.ok(!lt(v0, v1, loose), "!lt('" + v0 + "', '" + v1 + "')"); + t.ok(eq(v0, v0, loose), "eq('" + v0 + "', '" + v0 + "')"); + t.ok(eq(v1, v1, loose), "eq('" + v1 + "', '" + v1 + "')"); + t.ok(neq(v0, v1, loose), "neq('" + v0 + "', '" + v1 + "')"); + t.ok(cmp(v1, '==', v1, loose), "cmp('" + v1 + "' == '" + v1 + "')"); + t.ok(cmp(v0, '>=', v1, loose), "cmp('" + v0 + "' >= '" + v1 + "')"); + t.ok(cmp(v1, '<=', v0, loose), "cmp('" + v1 + "' <= '" + v0 + "')"); + t.ok(cmp(v0, '!=', v1, loose), "cmp('" + v0 + "' != '" + v1 + "')"); + }); + t.end(); +}); + +test('\nequality tests', function(t) { + // [version1, version2] + // version1 should be equivalent to version2 + [['1.2.3', 'v1.2.3', true], + ['1.2.3', '=1.2.3', true], + ['1.2.3', 'v 1.2.3', true], + ['1.2.3', '= 1.2.3', true], + ['1.2.3', ' v1.2.3', true], + ['1.2.3', ' =1.2.3', true], + ['1.2.3', ' v 1.2.3', true], + ['1.2.3', ' = 1.2.3', true], + ['1.2.3-0', 'v1.2.3-0', true], + ['1.2.3-0', '=1.2.3-0', true], + ['1.2.3-0', 'v 1.2.3-0', true], + ['1.2.3-0', '= 1.2.3-0', true], + ['1.2.3-0', ' v1.2.3-0', true], + ['1.2.3-0', ' =1.2.3-0', true], + ['1.2.3-0', ' v 1.2.3-0', true], + ['1.2.3-0', ' = 1.2.3-0', true], + ['1.2.3-1', 'v1.2.3-1', true], + ['1.2.3-1', '=1.2.3-1', true], + ['1.2.3-1', 'v 1.2.3-1', true], + ['1.2.3-1', '= 1.2.3-1', true], + ['1.2.3-1', ' v1.2.3-1', true], + ['1.2.3-1', ' =1.2.3-1', true], + ['1.2.3-1', ' v 1.2.3-1', true], + ['1.2.3-1', ' = 1.2.3-1', true], + ['1.2.3-beta', 'v1.2.3-beta', true], + ['1.2.3-beta', '=1.2.3-beta', true], + ['1.2.3-beta', 'v 1.2.3-beta', true], + ['1.2.3-beta', '= 1.2.3-beta', true], + ['1.2.3-beta', ' v1.2.3-beta', true], + ['1.2.3-beta', ' =1.2.3-beta', true], + ['1.2.3-beta', ' v 1.2.3-beta', true], + ['1.2.3-beta', ' = 1.2.3-beta', true], + ['1.2.3-beta+build', ' = 1.2.3-beta+otherbuild', true], + ['1.2.3+build', ' = 1.2.3+otherbuild', true], + ['1.2.3-beta+build', '1.2.3-beta+otherbuild'], + ['1.2.3+build', '1.2.3+otherbuild'], + [' v1.2.3+build', '1.2.3+otherbuild'] + ].forEach(function(v) { + var v0 = v[0]; + var v1 = v[1]; + var loose = v[2]; + t.ok(eq(v0, v1, loose), "eq('" + v0 + "', '" + v1 + "')"); + t.ok(!neq(v0, v1, loose), "!neq('" + v0 + "', '" + v1 + "')"); + t.ok(cmp(v0, '==', v1, loose), 'cmp(' + v0 + '==' + v1 + ')'); + t.ok(!cmp(v0, '!=', v1, loose), '!cmp(' + v0 + '!=' + v1 + ')'); + t.ok(!cmp(v0, '===', v1, loose), '!cmp(' + v0 + '===' + v1 + ')'); + t.ok(cmp(v0, '!==', v1, loose), 'cmp(' + v0 + '!==' + v1 + ')'); + t.ok(!gt(v0, v1, loose), "!gt('" + v0 + "', '" + v1 + "')"); + t.ok(gte(v0, v1, loose), "gte('" + v0 + "', '" + v1 + "')"); + t.ok(!lt(v0, v1, loose), "!lt('" + v0 + "', '" + v1 + "')"); + t.ok(lte(v0, v1, loose), "lte('" + v0 + "', '" + v1 + "')"); + }); + t.end(); +}); + + +test('\nrange tests', function(t) { + // [range, version] + // version should be included by range + [['1.0.0 - 2.0.0', '1.2.3'], + ['^1.2.3+build', '1.2.3'], + ['^1.2.3+build', '1.3.0'], + ['1.2.3-pre+asdf - 2.4.3-pre+asdf', '1.2.3'], + ['1.2.3pre+asdf - 2.4.3-pre+asdf', '1.2.3', true], + ['1.2.3-pre+asdf - 2.4.3pre+asdf', '1.2.3', true], + ['1.2.3pre+asdf - 2.4.3pre+asdf', '1.2.3', true], + ['1.2.3-pre+asdf - 2.4.3-pre+asdf', '1.2.3-pre.2'], + ['1.2.3-pre+asdf - 2.4.3-pre+asdf', '2.4.3-alpha'], + ['1.2.3+asdf - 2.4.3+asdf', '1.2.3'], + ['1.0.0', '1.0.0'], + ['>=*', '0.2.4'], + ['', '1.0.0'], + ['*', '1.2.3'], + ['*', 'v1.2.3', true], + ['>=1.0.0', '1.0.0'], + ['>=1.0.0', '1.0.1'], + ['>=1.0.0', '1.1.0'], + ['>1.0.0', '1.0.1'], + ['>1.0.0', '1.1.0'], + ['<=2.0.0', '2.0.0'], + ['<=2.0.0', '1.9999.9999'], + ['<=2.0.0', '0.2.9'], + ['<2.0.0', '1.9999.9999'], + ['<2.0.0', '0.2.9'], + ['>= 1.0.0', '1.0.0'], + ['>= 1.0.0', '1.0.1'], + ['>= 1.0.0', '1.1.0'], + ['> 1.0.0', '1.0.1'], + ['> 1.0.0', '1.1.0'], + ['<= 2.0.0', '2.0.0'], + ['<= 2.0.0', '1.9999.9999'], + ['<= 2.0.0', '0.2.9'], + ['< 2.0.0', '1.9999.9999'], + ['<\t2.0.0', '0.2.9'], + ['>=0.1.97', 'v0.1.97', true], + ['>=0.1.97', '0.1.97'], + ['0.1.20 || 1.2.4', '1.2.4'], + ['>=0.2.3 || <0.0.1', '0.0.0'], + ['>=0.2.3 || <0.0.1', '0.2.3'], + ['>=0.2.3 || <0.0.1', '0.2.4'], + ['||', '1.3.4'], + ['2.x.x', '2.1.3'], + ['1.2.x', '1.2.3'], + ['1.2.x || 2.x', '2.1.3'], + ['1.2.x || 2.x', '1.2.3'], + ['x', '1.2.3'], + ['2.*.*', '2.1.3'], + ['1.2.*', '1.2.3'], + ['1.2.* || 2.*', '2.1.3'], + ['1.2.* || 2.*', '1.2.3'], + ['*', '1.2.3'], + ['2', '2.1.2'], + ['2.3', '2.3.1'], + ['~2.4', '2.4.0'], // >=2.4.0 <2.5.0 + ['~2.4', '2.4.5'], + ['~>3.2.1', '3.2.2'], // >=3.2.1 <3.3.0, + ['~1', '1.2.3'], // >=1.0.0 <2.0.0 + ['~>1', '1.2.3'], + ['~> 1', '1.2.3'], + ['~1.0', '1.0.2'], // >=1.0.0 <1.1.0, + ['~ 1.0', '1.0.2'], + ['~ 1.0.3', '1.0.12'], + ['>=1', '1.0.0'], + ['>= 1', '1.0.0'], + ['<1.2', '1.1.1'], + ['< 1.2', '1.1.1'], + ['~v0.5.4-pre', '0.5.5'], + ['~v0.5.4-pre', '0.5.4'], + ['=0.7.x', '0.7.2'], + ['<=0.7.x', '0.7.2'], + ['>=0.7.x', '0.7.2'], + ['<=0.7.x', '0.6.2'], + ['~1.2.1 >=1.2.3', '1.2.3'], + ['~1.2.1 =1.2.3', '1.2.3'], + ['~1.2.1 1.2.3', '1.2.3'], + ['~1.2.1 >=1.2.3 1.2.3', '1.2.3'], + ['~1.2.1 1.2.3 >=1.2.3', '1.2.3'], + ['~1.2.1 1.2.3', '1.2.3'], + ['>=1.2.1 1.2.3', '1.2.3'], + ['1.2.3 >=1.2.1', '1.2.3'], + ['>=1.2.3 >=1.2.1', '1.2.3'], + ['>=1.2.1 >=1.2.3', '1.2.3'], + ['>=1.2', '1.2.8'], + ['^1.2.3', '1.8.1'], + ['^0.1.2', '0.1.2'], + ['^0.1', '0.1.2'], + ['^1.2', '1.4.2'], + ['^1.2 ^1', '1.4.2'], + ['^1.2.3-alpha', '1.2.3-pre'], + ['^1.2.0-alpha', '1.2.0-pre'], + ['^0.0.1-alpha', '0.0.1-beta'] + ].forEach(function(v) { + var range = v[0]; + var ver = v[1]; + var loose = v[2]; + t.ok(satisfies(ver, range, loose), range + ' satisfied by ' + ver); + }); + t.end(); +}); + +test('\nnegative range tests', function(t) { + // [range, version] + // version should not be included by range + [['1.0.0 - 2.0.0', '2.2.3'], + ['1.2.3+asdf - 2.4.3+asdf', '1.2.3-pre.2'], + ['1.2.3+asdf - 2.4.3+asdf', '2.4.3-alpha'], + ['^1.2.3+build', '2.0.0'], + ['^1.2.3+build', '1.2.0'], + ['^1.2.3', '1.2.3-pre'], + ['^1.2', '1.2.0-pre'], + ['>1.2', '1.3.0-beta'], + ['<=1.2.3', '1.2.3-beta'], + ['^1.2.3', '1.2.3-beta'], + ['=0.7.x', '0.7.0-asdf'], + ['>=0.7.x', '0.7.0-asdf'], + ['1', '1.0.0beta', true], + ['<1', '1.0.0beta', true], + ['< 1', '1.0.0beta', true], + ['1.0.0', '1.0.1'], + ['>=1.0.0', '0.0.0'], + ['>=1.0.0', '0.0.1'], + ['>=1.0.0', '0.1.0'], + ['>1.0.0', '0.0.1'], + ['>1.0.0', '0.1.0'], + ['<=2.0.0', '3.0.0'], + ['<=2.0.0', '2.9999.9999'], + ['<=2.0.0', '2.2.9'], + ['<2.0.0', '2.9999.9999'], + ['<2.0.0', '2.2.9'], + ['>=0.1.97', 'v0.1.93', true], + ['>=0.1.97', '0.1.93'], + ['0.1.20 || 1.2.4', '1.2.3'], + ['>=0.2.3 || <0.0.1', '0.0.3'], + ['>=0.2.3 || <0.0.1', '0.2.2'], + ['2.x.x', '1.1.3'], + ['2.x.x', '3.1.3'], + ['1.2.x', '1.3.3'], + ['1.2.x || 2.x', '3.1.3'], + ['1.2.x || 2.x', '1.1.3'], + ['2.*.*', '1.1.3'], + ['2.*.*', '3.1.3'], + ['1.2.*', '1.3.3'], + ['1.2.* || 2.*', '3.1.3'], + ['1.2.* || 2.*', '1.1.3'], + ['2', '1.1.2'], + ['2.3', '2.4.1'], + ['~2.4', '2.5.0'], // >=2.4.0 <2.5.0 + ['~2.4', '2.3.9'], + ['~>3.2.1', '3.3.2'], // >=3.2.1 <3.3.0 + ['~>3.2.1', '3.2.0'], // >=3.2.1 <3.3.0 + ['~1', '0.2.3'], // >=1.0.0 <2.0.0 + ['~>1', '2.2.3'], + ['~1.0', '1.1.0'], // >=1.0.0 <1.1.0 + ['<1', '1.0.0'], + ['>=1.2', '1.1.1'], + ['1', '2.0.0beta', true], + ['~v0.5.4-beta', '0.5.4-alpha'], + ['=0.7.x', '0.8.2'], + ['>=0.7.x', '0.6.2'], + ['<0.7.x', '0.7.2'], + ['<1.2.3', '1.2.3-beta'], + ['=1.2.3', '1.2.3-beta'], + ['>1.2', '1.2.8'], + ['^1.2.3', '2.0.0-alpha'], + ['^1.2.3', '1.2.2'], + ['^1.2', '1.1.9'], + ['*', 'v1.2.3-foo', true], + // invalid ranges never satisfied! + ['blerg', '1.2.3'], + ['git+https://user:password0123@github.com/foo', '123.0.0', true], + ['^1.2.3', '2.0.0-pre'] + ].forEach(function(v) { + var range = v[0]; + var ver = v[1]; + var loose = v[2]; + var found = satisfies(ver, range, loose); + t.ok(!found, ver + ' not satisfied by ' + range); + }); + t.end(); +}); + +test('\nincrement versions test', function(t) { +// [version, inc, result, identifier] +// inc(version, inc) -> result + [['1.2.3', 'major', '2.0.0'], + ['1.2.3', 'minor', '1.3.0'], + ['1.2.3', 'patch', '1.2.4'], + ['1.2.3tag', 'major', '2.0.0', true], + ['1.2.3-tag', 'major', '2.0.0'], + ['1.2.3', 'fake', null], + ['1.2.0-0', 'patch', '1.2.0'], + ['fake', 'major', null], + ['1.2.3-4', 'major', '2.0.0'], + ['1.2.3-4', 'minor', '1.3.0'], + ['1.2.3-4', 'patch', '1.2.3'], + ['1.2.3-alpha.0.beta', 'major', '2.0.0'], + ['1.2.3-alpha.0.beta', 'minor', '1.3.0'], + ['1.2.3-alpha.0.beta', 'patch', '1.2.3'], + ['1.2.4', 'prerelease', '1.2.5-0'], + ['1.2.3-0', 'prerelease', '1.2.3-1'], + ['1.2.3-alpha.0', 'prerelease', '1.2.3-alpha.1'], + ['1.2.3-alpha.1', 'prerelease', '1.2.3-alpha.2'], + ['1.2.3-alpha.2', 'prerelease', '1.2.3-alpha.3'], + ['1.2.3-alpha.0.beta', 'prerelease', '1.2.3-alpha.1.beta'], + ['1.2.3-alpha.1.beta', 'prerelease', '1.2.3-alpha.2.beta'], + ['1.2.3-alpha.2.beta', 'prerelease', '1.2.3-alpha.3.beta'], + ['1.2.3-alpha.10.0.beta', 'prerelease', '1.2.3-alpha.10.1.beta'], + ['1.2.3-alpha.10.1.beta', 'prerelease', '1.2.3-alpha.10.2.beta'], + ['1.2.3-alpha.10.2.beta', 'prerelease', '1.2.3-alpha.10.3.beta'], + ['1.2.3-alpha.10.beta.0', 'prerelease', '1.2.3-alpha.10.beta.1'], + ['1.2.3-alpha.10.beta.1', 'prerelease', '1.2.3-alpha.10.beta.2'], + ['1.2.3-alpha.10.beta.2', 'prerelease', '1.2.3-alpha.10.beta.3'], + ['1.2.3-alpha.9.beta', 'prerelease', '1.2.3-alpha.10.beta'], + ['1.2.3-alpha.10.beta', 'prerelease', '1.2.3-alpha.11.beta'], + ['1.2.3-alpha.11.beta', 'prerelease', '1.2.3-alpha.12.beta'], + ['1.2.0', 'prepatch', '1.2.1-0'], + ['1.2.0-1', 'prepatch', '1.2.1-0'], + ['1.2.0', 'preminor', '1.3.0-0'], + ['1.2.3-1', 'preminor', '1.3.0-0'], + ['1.2.0', 'premajor', '2.0.0-0'], + ['1.2.3-1', 'premajor', '2.0.0-0'], + ['1.2.0-1', 'minor', '1.2.0'], + ['1.0.0-1', 'major', '1.0.0'], + + ['1.2.3', 'major', '2.0.0', false, 'dev'], + ['1.2.3', 'minor', '1.3.0', false, 'dev'], + ['1.2.3', 'patch', '1.2.4', false, 'dev'], + ['1.2.3tag', 'major', '2.0.0', true, 'dev'], + ['1.2.3-tag', 'major', '2.0.0', false, 'dev'], + ['1.2.3', 'fake', null, false, 'dev'], + ['1.2.0-0', 'patch', '1.2.0', false, 'dev'], + ['fake', 'major', null, false, 'dev'], + ['1.2.3-4', 'major', '2.0.0', false, 'dev'], + ['1.2.3-4', 'minor', '1.3.0', false, 'dev'], + ['1.2.3-4', 'patch', '1.2.3', false, 'dev'], + ['1.2.3-alpha.0.beta', 'major', '2.0.0', false, 'dev'], + ['1.2.3-alpha.0.beta', 'minor', '1.3.0', false, 'dev'], + ['1.2.3-alpha.0.beta', 'patch', '1.2.3', false, 'dev'], + ['1.2.4', 'prerelease', '1.2.5-dev.0', false, 'dev'], + ['1.2.3-0', 'prerelease', '1.2.3-dev.0', false, 'dev'], + ['1.2.3-alpha.0', 'prerelease', '1.2.3-dev.0', false, 'dev'], + ['1.2.3-alpha.0', 'prerelease', '1.2.3-alpha.1', false, 'alpha'], + ['1.2.3-alpha.0.beta', 'prerelease', '1.2.3-dev.0', false, 'dev'], + ['1.2.3-alpha.0.beta', 'prerelease', '1.2.3-alpha.1.beta', false, 'alpha'], + ['1.2.3-alpha.10.0.beta', 'prerelease', '1.2.3-dev.0', false, 'dev'], + ['1.2.3-alpha.10.0.beta', 'prerelease', '1.2.3-alpha.10.1.beta', false, 'alpha'], + ['1.2.3-alpha.10.1.beta', 'prerelease', '1.2.3-alpha.10.2.beta', false, 'alpha'], + ['1.2.3-alpha.10.2.beta', 'prerelease', '1.2.3-alpha.10.3.beta', false, 'alpha'], + ['1.2.3-alpha.10.beta.0', 'prerelease', '1.2.3-dev.0', false, 'dev'], + ['1.2.3-alpha.10.beta.0', 'prerelease', '1.2.3-alpha.10.beta.1', false, 'alpha'], + ['1.2.3-alpha.10.beta.1', 'prerelease', '1.2.3-alpha.10.beta.2', false, 'alpha'], + ['1.2.3-alpha.10.beta.2', 'prerelease', '1.2.3-alpha.10.beta.3', false, 'alpha'], + ['1.2.3-alpha.9.beta', 'prerelease', '1.2.3-dev.0', false, 'dev'], + ['1.2.3-alpha.9.beta', 'prerelease', '1.2.3-alpha.10.beta', false, 'alpha'], + ['1.2.3-alpha.10.beta', 'prerelease', '1.2.3-alpha.11.beta', false, 'alpha'], + ['1.2.3-alpha.11.beta', 'prerelease', '1.2.3-alpha.12.beta', false, 'alpha'], + ['1.2.0', 'prepatch', '1.2.1-dev.0', false, 'dev'], + ['1.2.0-1', 'prepatch', '1.2.1-dev.0', false, 'dev'], + ['1.2.0', 'preminor', '1.3.0-dev.0', false, 'dev'], + ['1.2.3-1', 'preminor', '1.3.0-dev.0', false, 'dev'], + ['1.2.0', 'premajor', '2.0.0-dev.0', false, 'dev'], + ['1.2.3-1', 'premajor', '2.0.0-dev.0', false, 'dev'], + ['1.2.0-1', 'minor', '1.2.0', false, 'dev'], + ['1.0.0-1', 'major', '1.0.0', false, 'dev'], + ['1.2.3-dev.bar', 'prerelease', '1.2.3-dev.0', false, 'dev'] + + ].forEach(function(v) { + var pre = v[0]; + var what = v[1]; + var wanted = v[2]; + var loose = v[3]; + var id = v[4]; + var found = inc(pre, what, loose, id); + var cmd = 'inc(' + pre + ', ' + what + ', ' + id + ')'; + t.equal(found, wanted, cmd + ' === ' + wanted); + + var parsed = semver.parse(pre, loose); + if (wanted) { + parsed.inc(what, id); + t.equal(parsed.version, wanted, cmd + ' object version updated'); + t.equal(parsed.raw, wanted, cmd + ' object raw field updated'); + } else if (parsed) { + t.throws(function () { + parsed.inc(what, id) + }) + } else { + t.equal(parsed, null) + } + }); + + t.end(); +}); + +test('\ndiff versions test', function(t) { +// [version1, version2, result] +// diff(version1, version2) -> result + [['1.2.3', '0.2.3', 'major'], + ['1.4.5', '0.2.3', 'major'], + ['1.2.3', '2.0.0-pre', 'premajor'], + ['1.2.3', '1.3.3', 'minor'], + ['1.0.1', '1.1.0-pre', 'preminor'], + ['1.2.3', '1.2.4', 'patch'], + ['1.2.3', '1.2.4-pre', 'prepatch'], + ['0.0.1', '0.0.1-pre', 'prerelease'], + ['0.0.1', '0.0.1-pre-2', 'prerelease'], + ['1.1.0', '1.1.0-pre', 'prerelease'], + ['1.1.0-pre-1', '1.1.0-pre-2', 'prerelease'], + ['1.0.0', '1.0.0', null] + + ].forEach(function(v) { + var version1 = v[0]; + var version2 = v[1]; + var wanted = v[2]; + var found = diff(version1, version2); + var cmd = 'diff(' + version1 + ', ' + version2 + ')'; + t.equal(found, wanted, cmd + ' === ' + wanted); + }); + + t.end(); +}); + +test('\nvalid range test', function(t) { + // [range, result] + // validRange(range) -> result + // translate ranges into their canonical form + [['1.0.0 - 2.0.0', '>=1.0.0 <=2.0.0'], + ['1.0.0', '1.0.0'], + ['>=*', '*'], + ['', '*'], + ['*', '*'], + ['*', '*'], + ['>=1.0.0', '>=1.0.0'], + ['>1.0.0', '>1.0.0'], + ['<=2.0.0', '<=2.0.0'], + ['1', '>=1.0.0 <2.0.0'], + ['<=2.0.0', '<=2.0.0'], + ['<=2.0.0', '<=2.0.0'], + ['<2.0.0', '<2.0.0'], + ['<2.0.0', '<2.0.0'], + ['>= 1.0.0', '>=1.0.0'], + ['>= 1.0.0', '>=1.0.0'], + ['>= 1.0.0', '>=1.0.0'], + ['> 1.0.0', '>1.0.0'], + ['> 1.0.0', '>1.0.0'], + ['<= 2.0.0', '<=2.0.0'], + ['<= 2.0.0', '<=2.0.0'], + ['<= 2.0.0', '<=2.0.0'], + ['< 2.0.0', '<2.0.0'], + ['< 2.0.0', '<2.0.0'], + ['>=0.1.97', '>=0.1.97'], + ['>=0.1.97', '>=0.1.97'], + ['0.1.20 || 1.2.4', '0.1.20||1.2.4'], + ['>=0.2.3 || <0.0.1', '>=0.2.3||<0.0.1'], + ['>=0.2.3 || <0.0.1', '>=0.2.3||<0.0.1'], + ['>=0.2.3 || <0.0.1', '>=0.2.3||<0.0.1'], + ['||', '||'], + ['2.x.x', '>=2.0.0 <3.0.0'], + ['1.2.x', '>=1.2.0 <1.3.0'], + ['1.2.x || 2.x', '>=1.2.0 <1.3.0||>=2.0.0 <3.0.0'], + ['1.2.x || 2.x', '>=1.2.0 <1.3.0||>=2.0.0 <3.0.0'], + ['x', '*'], + ['2.*.*', '>=2.0.0 <3.0.0'], + ['1.2.*', '>=1.2.0 <1.3.0'], + ['1.2.* || 2.*', '>=1.2.0 <1.3.0||>=2.0.0 <3.0.0'], + ['*', '*'], + ['2', '>=2.0.0 <3.0.0'], + ['2.3', '>=2.3.0 <2.4.0'], + ['~2.4', '>=2.4.0 <2.5.0'], + ['~2.4', '>=2.4.0 <2.5.0'], + ['~>3.2.1', '>=3.2.1 <3.3.0'], + ['~1', '>=1.0.0 <2.0.0'], + ['~>1', '>=1.0.0 <2.0.0'], + ['~> 1', '>=1.0.0 <2.0.0'], + ['~1.0', '>=1.0.0 <1.1.0'], + ['~ 1.0', '>=1.0.0 <1.1.0'], + ['^0', '>=0.0.0 <1.0.0'], + ['^ 1', '>=1.0.0 <2.0.0'], + ['^0.1', '>=0.1.0 <0.2.0'], + ['^1.0', '>=1.0.0 <2.0.0'], + ['^1.2', '>=1.2.0 <2.0.0'], + ['^0.0.1', '>=0.0.1 <0.0.2'], + ['^0.0.1-beta', '>=0.0.1-beta <0.0.2'], + ['^0.1.2', '>=0.1.2 <0.2.0'], + ['^1.2.3', '>=1.2.3 <2.0.0'], + ['^1.2.3-beta.4', '>=1.2.3-beta.4 <2.0.0'], + ['<1', '<1.0.0'], + ['< 1', '<1.0.0'], + ['>=1', '>=1.0.0'], + ['>= 1', '>=1.0.0'], + ['<1.2', '<1.2.0'], + ['< 1.2', '<1.2.0'], + ['1', '>=1.0.0 <2.0.0'], + ['>01.02.03', '>1.2.3', true], + ['>01.02.03', null], + ['~1.2.3beta', '>=1.2.3-beta <1.3.0', true], + ['~1.2.3beta', null], + ['^ 1.2 ^ 1', '>=1.2.0 <2.0.0 >=1.0.0 <2.0.0'] + ].forEach(function(v) { + var pre = v[0]; + var wanted = v[1]; + var loose = v[2]; + var found = validRange(pre, loose); + + t.equal(found, wanted, 'validRange(' + pre + ') === ' + wanted); + }); + + t.end(); +}); + +test('\ncomparators test', function(t) { + // [range, comparators] + // turn range into a set of individual comparators + [['1.0.0 - 2.0.0', [['>=1.0.0', '<=2.0.0']]], + ['1.0.0', [['1.0.0']]], + ['>=*', [['']]], + ['', [['']]], + ['*', [['']]], + ['*', [['']]], + ['>=1.0.0', [['>=1.0.0']]], + ['>=1.0.0', [['>=1.0.0']]], + ['>=1.0.0', [['>=1.0.0']]], + ['>1.0.0', [['>1.0.0']]], + ['>1.0.0', [['>1.0.0']]], + ['<=2.0.0', [['<=2.0.0']]], + ['1', [['>=1.0.0', '<2.0.0']]], + ['<=2.0.0', [['<=2.0.0']]], + ['<=2.0.0', [['<=2.0.0']]], + ['<2.0.0', [['<2.0.0']]], + ['<2.0.0', [['<2.0.0']]], + ['>= 1.0.0', [['>=1.0.0']]], + ['>= 1.0.0', [['>=1.0.0']]], + ['>= 1.0.0', [['>=1.0.0']]], + ['> 1.0.0', [['>1.0.0']]], + ['> 1.0.0', [['>1.0.0']]], + ['<= 2.0.0', [['<=2.0.0']]], + ['<= 2.0.0', [['<=2.0.0']]], + ['<= 2.0.0', [['<=2.0.0']]], + ['< 2.0.0', [['<2.0.0']]], + ['<\t2.0.0', [['<2.0.0']]], + ['>=0.1.97', [['>=0.1.97']]], + ['>=0.1.97', [['>=0.1.97']]], + ['0.1.20 || 1.2.4', [['0.1.20'], ['1.2.4']]], + ['>=0.2.3 || <0.0.1', [['>=0.2.3'], ['<0.0.1']]], + ['>=0.2.3 || <0.0.1', [['>=0.2.3'], ['<0.0.1']]], + ['>=0.2.3 || <0.0.1', [['>=0.2.3'], ['<0.0.1']]], + ['||', [[''], ['']]], + ['2.x.x', [['>=2.0.0', '<3.0.0']]], + ['1.2.x', [['>=1.2.0', '<1.3.0']]], + ['1.2.x || 2.x', [['>=1.2.0', '<1.3.0'], ['>=2.0.0', '<3.0.0']]], + ['1.2.x || 2.x', [['>=1.2.0', '<1.3.0'], ['>=2.0.0', '<3.0.0']]], + ['x', [['']]], + ['2.*.*', [['>=2.0.0', '<3.0.0']]], + ['1.2.*', [['>=1.2.0', '<1.3.0']]], + ['1.2.* || 2.*', [['>=1.2.0', '<1.3.0'], ['>=2.0.0', '<3.0.0']]], + ['1.2.* || 2.*', [['>=1.2.0', '<1.3.0'], ['>=2.0.0', '<3.0.0']]], + ['*', [['']]], + ['2', [['>=2.0.0', '<3.0.0']]], + ['2.3', [['>=2.3.0', '<2.4.0']]], + ['~2.4', [['>=2.4.0', '<2.5.0']]], + ['~2.4', [['>=2.4.0', '<2.5.0']]], + ['~>3.2.1', [['>=3.2.1', '<3.3.0']]], + ['~1', [['>=1.0.0', '<2.0.0']]], + ['~>1', [['>=1.0.0', '<2.0.0']]], + ['~> 1', [['>=1.0.0', '<2.0.0']]], + ['~1.0', [['>=1.0.0', '<1.1.0']]], + ['~ 1.0', [['>=1.0.0', '<1.1.0']]], + ['~ 1.0.3', [['>=1.0.3', '<1.1.0']]], + ['~> 1.0.3', [['>=1.0.3', '<1.1.0']]], + ['<1', [['<1.0.0']]], + ['< 1', [['<1.0.0']]], + ['>=1', [['>=1.0.0']]], + ['>= 1', [['>=1.0.0']]], + ['<1.2', [['<1.2.0']]], + ['< 1.2', [['<1.2.0']]], + ['1', [['>=1.0.0', '<2.0.0']]], + ['1 2', [['>=1.0.0', '<2.0.0', '>=2.0.0', '<3.0.0']]], + ['1.2 - 3.4.5', [['>=1.2.0', '<=3.4.5']]], + ['1.2.3 - 3.4', [['>=1.2.3', '<3.5.0']]], + ['1.2.3 - 3', [['>=1.2.3', '<4.0.0']]], + ['>*', [['<0.0.0']]], + ['<*', [['<0.0.0']]] + ].forEach(function(v) { + var pre = v[0]; + var wanted = v[1]; + var found = toComparators(v[0]); + var jw = JSON.stringify(wanted); + t.equivalent(found, wanted, 'toComparators(' + pre + ') === ' + jw); + }); + + t.end(); +}); + +test('\ninvalid version numbers', function(t) { + ['1.2.3.4', + 'NOT VALID', + 1.2, + null, + 'Infinity.NaN.Infinity' + ].forEach(function(v) { + t.throws(function() { + new SemVer(v); + }, {name:'TypeError', message:'Invalid Version: ' + v}); + }); + + t.end(); +}); + +test('\nstrict vs loose version numbers', function(t) { + [['=1.2.3', '1.2.3'], + ['01.02.03', '1.2.3'], + ['1.2.3-beta.01', '1.2.3-beta.1'], + [' =1.2.3', '1.2.3'], + ['1.2.3foo', '1.2.3-foo'] + ].forEach(function(v) { + var loose = v[0]; + var strict = v[1]; + t.throws(function() { + new SemVer(loose); + }); + var lv = new SemVer(loose, true); + t.equal(lv.version, strict); + t.ok(eq(loose, strict, true)); + t.throws(function() { + eq(loose, strict); + }); + t.throws(function() { + new SemVer(strict).compare(loose); + }); + }); + t.end(); +}); + +test('\nstrict vs loose ranges', function(t) { + [['>=01.02.03', '>=1.2.3'], + ['~1.02.03beta', '>=1.2.3-beta <1.3.0'] + ].forEach(function(v) { + var loose = v[0]; + var comps = v[1]; + t.throws(function() { + new Range(loose); + }); + t.equal(new Range(loose, true).range, comps); + }); + t.end(); +}); + +test('\nmax satisfying', function(t) { + [[['1.2.3', '1.2.4'], '1.2', '1.2.4'], + [['1.2.4', '1.2.3'], '1.2', '1.2.4'], + [['1.2.3', '1.2.4', '1.2.5', '1.2.6'], '~1.2.3', '1.2.6'], + [['1.1.0', '1.2.0', '1.2.1', '1.3.0', '2.0.0b1', '2.0.0b2', '2.0.0b3', '2.0.0', '2.1.0'], '~2.0.0', '2.0.0', true] + ].forEach(function(v) { + var versions = v[0]; + var range = v[1]; + var expect = v[2]; + var loose = v[3]; + var actual = semver.maxSatisfying(versions, range, loose); + t.equal(actual, expect); + }); + t.end(); +}); diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/ltr.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/ltr.js new file mode 100644 index 0000000000..0f7167d658 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/ltr.js @@ -0,0 +1,181 @@ +var tap = require('tap'); +var test = tap.test; +var semver = require('../semver.js'); +var ltr = semver.ltr; + +test('\nltr tests', function(t) { + // [range, version, loose] + // Version should be less than range + [ + ['~1.2.2', '1.2.1'], + ['~0.6.1-1', '0.6.1-0'], + ['1.0.0 - 2.0.0', '0.0.1'], + ['1.0.0-beta.2', '1.0.0-beta.1'], + ['1.0.0', '0.0.0'], + ['>=2.0.0', '1.1.1'], + ['>=2.0.0', '1.2.9'], + ['>2.0.0', '2.0.0'], + ['0.1.20 || 1.2.4', '0.1.5'], + ['2.x.x', '1.0.0'], + ['1.2.x', '1.1.0'], + ['1.2.x || 2.x', '1.0.0'], + ['2.*.*', '1.0.1'], + ['1.2.*', '1.1.3'], + ['1.2.* || 2.*', '1.1.9999'], + ['2', '1.0.0'], + ['2.3', '2.2.2'], + ['~2.4', '2.3.0'], // >=2.4.0 <2.5.0 + ['~2.4', '2.3.5'], + ['~>3.2.1', '3.2.0'], // >=3.2.1 <3.3.0 + ['~1', '0.2.3'], // >=1.0.0 <2.0.0 + ['~>1', '0.2.4'], + ['~> 1', '0.2.3'], + ['~1.0', '0.1.2'], // >=1.0.0 <1.1.0 + ['~ 1.0', '0.1.0'], + ['>1.2', '1.2.0'], + ['> 1.2', '1.2.1'], + ['1', '0.0.0beta', true], + ['~v0.5.4-pre', '0.5.4-alpha'], + ['~v0.5.4-pre', '0.5.4-alpha'], + ['=0.7.x', '0.6.0'], + ['=0.7.x', '0.6.0-asdf'], + ['>=0.7.x', '0.6.0'], + ['~1.2.2', '1.2.1'], + ['1.0.0 - 2.0.0', '0.2.3'], + ['1.0.0', '0.0.1'], + ['>=2.0.0', '1.0.0'], + ['>=2.0.0', '1.9999.9999'], + ['>=2.0.0', '1.2.9'], + ['>2.0.0', '2.0.0'], + ['>2.0.0', '1.2.9'], + ['2.x.x', '1.1.3'], + ['1.2.x', '1.1.3'], + ['1.2.x || 2.x', '1.1.3'], + ['2.*.*', '1.1.3'], + ['1.2.*', '1.1.3'], + ['1.2.* || 2.*', '1.1.3'], + ['2', '1.9999.9999'], + ['2.3', '2.2.1'], + ['~2.4', '2.3.0'], // >=2.4.0 <2.5.0 + ['~>3.2.1', '2.3.2'], // >=3.2.1 <3.3.0 + ['~1', '0.2.3'], // >=1.0.0 <2.0.0 + ['~>1', '0.2.3'], + ['~1.0', '0.0.0'], // >=1.0.0 <1.1.0 + ['>1', '1.0.0'], + ['2', '1.0.0beta', true], + ['>1', '1.0.0beta', true], + ['> 1', '1.0.0beta', true], + ['=0.7.x', '0.6.2'], + ['=0.7.x', '0.7.0-asdf'], + ['^1', '1.0.0-0'], + ['>=0.7.x', '0.7.0-asdf'], + ['1', '1.0.0beta', true], + ['>=0.7.x', '0.6.2'], + ['>1.2.3', '1.3.0-alpha'] + ].forEach(function(tuple) { + var range = tuple[0]; + var version = tuple[1]; + var loose = tuple[2] || false; + var msg = 'ltr(' + version + ', ' + range + ', ' + loose + ')'; + t.ok(ltr(version, range, loose), msg); + }); + t.end(); +}); + +test('\nnegative ltr tests', function(t) { + // [range, version, loose] + // Version should NOT be less than range + [ + ['~ 1.0', '1.1.0'], + ['~0.6.1-1', '0.6.1-1'], + ['1.0.0 - 2.0.0', '1.2.3'], + ['1.0.0 - 2.0.0', '2.9.9'], + ['1.0.0', '1.0.0'], + ['>=*', '0.2.4'], + ['', '1.0.0', true], + ['*', '1.2.3'], + ['>=1.0.0', '1.0.0'], + ['>=1.0.0', '1.0.1'], + ['>=1.0.0', '1.1.0'], + ['>1.0.0', '1.0.1'], + ['>1.0.0', '1.1.0'], + ['<=2.0.0', '2.0.0'], + ['<=2.0.0', '1.9999.9999'], + ['<=2.0.0', '0.2.9'], + ['<2.0.0', '1.9999.9999'], + ['<2.0.0', '0.2.9'], + ['>= 1.0.0', '1.0.0'], + ['>= 1.0.0', '1.0.1'], + ['>= 1.0.0', '1.1.0'], + ['> 1.0.0', '1.0.1'], + ['> 1.0.0', '1.1.0'], + ['<= 2.0.0', '2.0.0'], + ['<= 2.0.0', '1.9999.9999'], + ['<= 2.0.0', '0.2.9'], + ['< 2.0.0', '1.9999.9999'], + ['<\t2.0.0', '0.2.9'], + ['>=0.1.97', 'v0.1.97'], + ['>=0.1.97', '0.1.97'], + ['0.1.20 || 1.2.4', '1.2.4'], + ['0.1.20 || >1.2.4', '1.2.4'], + ['0.1.20 || 1.2.4', '1.2.3'], + ['0.1.20 || 1.2.4', '0.1.20'], + ['>=0.2.3 || <0.0.1', '0.0.0'], + ['>=0.2.3 || <0.0.1', '0.2.3'], + ['>=0.2.3 || <0.0.1', '0.2.4'], + ['||', '1.3.4'], + ['2.x.x', '2.1.3'], + ['1.2.x', '1.2.3'], + ['1.2.x || 2.x', '2.1.3'], + ['1.2.x || 2.x', '1.2.3'], + ['x', '1.2.3'], + ['2.*.*', '2.1.3'], + ['1.2.*', '1.2.3'], + ['1.2.* || 2.*', '2.1.3'], + ['1.2.* || 2.*', '1.2.3'], + ['1.2.* || 2.*', '1.2.3'], + ['*', '1.2.3'], + ['2', '2.1.2'], + ['2.3', '2.3.1'], + ['~2.4', '2.4.0'], // >=2.4.0 <2.5.0 + ['~2.4', '2.4.5'], + ['~>3.2.1', '3.2.2'], // >=3.2.1 <3.3.0 + ['~1', '1.2.3'], // >=1.0.0 <2.0.0 + ['~>1', '1.2.3'], + ['~> 1', '1.2.3'], + ['~1.0', '1.0.2'], // >=1.0.0 <1.1.0 + ['~ 1.0', '1.0.2'], + ['>=1', '1.0.0'], + ['>= 1', '1.0.0'], + ['<1.2', '1.1.1'], + ['< 1.2', '1.1.1'], + ['~v0.5.4-pre', '0.5.5'], + ['~v0.5.4-pre', '0.5.4'], + ['=0.7.x', '0.7.2'], + ['>=0.7.x', '0.7.2'], + ['<=0.7.x', '0.6.2'], + ['>0.2.3 >0.2.4 <=0.2.5', '0.2.5'], + ['>=0.2.3 <=0.2.4', '0.2.4'], + ['1.0.0 - 2.0.0', '2.0.0'], + ['^3.0.0', '4.0.0'], + ['^1.0.0 || ~2.0.1', '2.0.0'], + ['^0.1.0 || ~3.0.1 || 5.0.0', '3.2.0'], + ['^0.1.0 || ~3.0.1 || 5.0.0', '1.0.0beta', true], + ['^0.1.0 || ~3.0.1 || 5.0.0', '5.0.0-0', true], + ['^0.1.0 || ~3.0.1 || >4 <=5.0.0', '3.5.0'], + ['^1.0.0alpha', '1.0.0beta', true], + ['~1.0.0alpha', '1.0.0beta', true], + ['^1.0.0-alpha', '1.0.0beta', true], + ['~1.0.0-alpha', '1.0.0beta', true], + ['^1.0.0-alpha', '1.0.0-beta'], + ['~1.0.0-alpha', '1.0.0-beta'], + ['=0.1.0', '1.0.0'] + ].forEach(function(tuple) { + var range = tuple[0]; + var version = tuple[1]; + var loose = tuple[2] || false; + var msg = '!ltr(' + version + ', ' + range + ', ' + loose + ')'; + t.notOk(ltr(version, range, loose), msg); + }); + t.end(); +}); diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/major-minor-patch.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/major-minor-patch.js new file mode 100644 index 0000000000..e9d4039c8b --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/node_modules/semver/test/major-minor-patch.js @@ -0,0 +1,72 @@ +var tap = require('tap'); +var test = tap.test; +var semver = require('../semver.js'); + +test('\nmajor tests', function(t) { + // [range, version] + // Version should be detectable despite extra characters + [ + ['1.2.3', 1], + [' 1.2.3 ', 1], + [' 2.2.3-4 ', 2], + [' 3.2.3-pre ', 3], + ['v5.2.3', 5], + [' v8.2.3 ', 8], + ['\t13.2.3', 13], + ['=21.2.3', 21, true], + ['v=34.2.3', 34, true] + ].forEach(function(tuple) { + var range = tuple[0]; + var version = tuple[1]; + var loose = tuple[2] || false; + var msg = 'major(' + range + ') = ' + version; + t.equal(semver.major(range, loose), version, msg); + }); + t.end(); +}); + +test('\nminor tests', function(t) { + // [range, version] + // Version should be detectable despite extra characters + [ + ['1.1.3', 1], + [' 1.1.3 ', 1], + [' 1.2.3-4 ', 2], + [' 1.3.3-pre ', 3], + ['v1.5.3', 5], + [' v1.8.3 ', 8], + ['\t1.13.3', 13], + ['=1.21.3', 21, true], + ['v=1.34.3', 34, true] + ].forEach(function(tuple) { + var range = tuple[0]; + var version = tuple[1]; + var loose = tuple[2] || false; + var msg = 'minor(' + range + ') = ' + version; + t.equal(semver.minor(range, loose), version, msg); + }); + t.end(); +}); + +test('\npatch tests', function(t) { + // [range, version] + // Version should be detectable despite extra characters + [ + ['1.2.1', 1], + [' 1.2.1 ', 1], + [' 1.2.2-4 ', 2], + [' 1.2.3-pre ', 3], + ['v1.2.5', 5], + [' v1.2.8 ', 8], + ['\t1.2.13', 13], + ['=1.2.21', 21, true], + ['v=1.2.34', 34, true] + ].forEach(function(tuple) { + var range = tuple[0]; + var version = tuple[1]; + var loose = tuple[2] || false; + var msg = 'patch(' + range + ') = ' + version; + t.equal(semver.patch(range, loose), version, msg); + }); + t.end(); +}); diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/package.json b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/package.json new file mode 100644 index 0000000000..b57e81b1b4 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/package.json @@ -0,0 +1,65 @@ +{ + "_from": "agent-base@2", + "_id": "agent-base@2.0.1", + "_integrity": "sha1-vY+ehqjrIh//oHvRS+/VXfFCgV4=", + "_location": "/pacote/make-fetch-happen/https-proxy-agent/agent-base", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "agent-base@2", + "name": "agent-base", + "escapedName": "agent-base", + "rawSpec": "2", + "saveSpec": null, + "fetchSpec": "2" + }, + "_requiredBy": [ + "/pacote/make-fetch-happen/https-proxy-agent" + ], + "_resolved": "https://registry.npmjs.org/agent-base/-/agent-base-2.0.1.tgz", + "_shasum": "bd8f9e86a8eb221fffa07bd14befd55df142815e", + "_shrinkwrap": null, + "_spec": "agent-base@2", + "_where": "/Users/zkat/Documents/code/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent", + "author": { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io/" + }, + "bin": null, + "bugs": { + "url": "https://github.com/TooTallNate/node-agent-base/issues" + }, + "bundleDependencies": false, + "dependencies": { + "extend": "~3.0.0", + "semver": "~5.0.1" + }, + "deprecated": false, + "description": "Turn a function into an `http.Agent` instance", + "devDependencies": { + "mocha": "2" + }, + "homepage": "https://github.com/TooTallNate/node-agent-base#readme", + "keywords": [ + "http", + "agent", + "base", + "barebones", + "https" + ], + "license": "MIT", + "main": "agent.js", + "name": "agent-base", + "optionalDependencies": {}, + "peerDependencies": {}, + "repository": { + "type": "git", + "url": "git://github.com/TooTallNate/node-agent-base.git" + }, + "scripts": { + "test": "mocha --reporter spec" + }, + "version": "2.0.1" +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/patch-core.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/patch-core.js new file mode 100644 index 0000000000..7cdacafa3e --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/patch-core.js @@ -0,0 +1,54 @@ +var url = require('url'); +var http = require('http'); +var https = require('https'); +var semver = require('semver'); +var inherits = require('util').inherits; + + +// we only need to patch the `http.request()` and +// `http.ClientRequest` on older versions of Node.js +if (semver.lt(process.version, '0.11.8')) { + // subclass the native ClientRequest to include the + // passed in `options` object. + http.ClientRequest = (function (_ClientRequest) { + function ClientRequest (options, cb) { + this._options = options; + _ClientRequest.call(this, options, cb); + } + inherits(ClientRequest, _ClientRequest); + + return ClientRequest; + })(http.ClientRequest); + + + // need to re-define the `request()` method, since on node v0.8/v0.10 + // the closure-local ClientRequest is used, rather than the monkey + // patched version we have created here. + http.request = (function (request) { + return function (options, cb) { + if (typeof options === 'string') { + options = url.parse(options); + } + if (options.protocol && options.protocol !== 'http:') { + throw new Error('Protocol:' + options.protocol + ' not supported.'); + } + return new http.ClientRequest(options, cb); + }; + })(http.request); +} + + +// this currently needs to be applied to all Node.js versions +// (v0.8.x, v0.10.x, v0.12.x), in order to determine if the `req` +// is an HTTP or HTTPS request. There is currently no PR attempting +// to move this property upstream. +https.request = (function (request) { + return function (options, cb) { + if (typeof options === 'string') { + options = url.parse(options); + } + if (null == options.port) options.port = 443; + options.secureEndpoint = true; + return request.call(https, options, cb); + }; +})(https.request); diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/test/ssl-cert-snakeoil.key b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/test/ssl-cert-snakeoil.key new file mode 100644 index 0000000000..fd12501220 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/test/ssl-cert-snakeoil.key @@ -0,0 +1,15 @@ +-----BEGIN RSA PRIVATE KEY----- +MIICWwIBAAKBgQCzURxIqzer0ACAbX/lHdsn4Gd9PLKrf7EeDYfIdV0HZKPD8WDr +bBx2/fBu0OW2sjnzv/SVZbJ0DAuPE/p0+eT0qb2qC10iz9iTD7ribd7gxhirVb8y +b3fBjXsxc8V8p4Ny1LcvNSqCjwUbJqdRogfoJeTiqPM58z5sNzuv5iq7iwIDAQAB +AoGAPMQy4olrP0UotlzlJ36bowLP70ffgHCwU+/f4NWs5fF78c3du0oSx1w820Dd +Z7E0JF8bgnlJJTxjumPZz0RUCugrEHBKJmzEz3cxF5E3+7NvteZcjKn9D67RrM5x +1/uSZ9cqKE9cYvY4fSuHx18diyZ4axR/wB1Pea2utjjDM+ECQQDb9ZbmmaWMiRpQ +5Up+loxP7BZNPsEVsm+DVJmEFbaFgGfncWBqSIqnPNjMwTwj0OigTwCAEGPkfRVW +T0pbYWCxAkEA0LK7SCTwzyDmhASUalk0x+3uCAA6ryFdwJf/wd8TRAvVOmkTEldX +uJ7ldLvfrONYO3v56uKTU/SoNdZYzKtO+wJAX2KM4ctXYy5BXztPpr2acz4qHa1N +Bh+vBAC34fOYhyQ76r3b1btHhWZ5jbFuZwm9F2erC94Ps5IaoqcX07DSwQJAPKGw +h2U0EPkd/3zVIZCJJQya+vgWFIs9EZcXVtvYXQyTBkVApTN66MhBIYjzkub5205J +bVQmOV37AKklY1DhwQJAA1wos0cYxro02edzatxd0DIR2r4qqOqLkw6BhYHhq6HJ +ZvIcQkHqdSXzdETFc01I1znDGGIrJHcnvKWgBPoEUg== +-----END RSA PRIVATE KEY----- diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/test/ssl-cert-snakeoil.pem b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/test/ssl-cert-snakeoil.pem new file mode 100644 index 0000000000..b115a5e914 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/test/ssl-cert-snakeoil.pem @@ -0,0 +1,12 @@ +-----BEGIN CERTIFICATE----- +MIIB1TCCAT4CCQDV5mPlzm9+izANBgkqhkiG9w0BAQUFADAvMS0wKwYDVQQDEyQ3 +NTI3YmQ3Ny1hYjNlLTQ3NGItYWNlNy1lZWQ2MDUzOTMxZTcwHhcNMTUwNzA2MjI0 +NTA3WhcNMjUwNzAzMjI0NTA3WjAvMS0wKwYDVQQDEyQ3NTI3YmQ3Ny1hYjNlLTQ3 +NGItYWNlNy1lZWQ2MDUzOTMxZTcwgZ8wDQYJKoZIhvcNAQEBBQADgY0AMIGJAoGB +ALNRHEirN6vQAIBtf+Ud2yfgZ308sqt/sR4Nh8h1XQdko8PxYOtsHHb98G7Q5bay +OfO/9JVlsnQMC48T+nT55PSpvaoLXSLP2JMPuuJt3uDGGKtVvzJvd8GNezFzxXyn +g3LUty81KoKPBRsmp1GiB+gl5OKo8znzPmw3O6/mKruLAgMBAAEwDQYJKoZIhvcN +AQEFBQADgYEACzoHUF8UV2Z6541Q2wKEA0UFUzmUjf/E1XwBO+1P15ZZ64uw34B4 +1RwMPtAo9RY/PmICTWtNxWGxkzwb2JtDWtnxVER/lF8k2XcXPE76fxTHJF/BKk9J +QU8OTD1dd9gHCBviQB9TqntRZ5X7axjtuWjb2umY+owBYzAHZkp1HKI= +-----END CERTIFICATE----- diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/test/test.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/test/test.js new file mode 100644 index 0000000000..f87d308f8e --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/agent-base/test/test.js @@ -0,0 +1,300 @@ + +/** + * Module dependencies. + */ + +var fs = require('fs'); +var url = require('url'); +var net = require('net'); +var tls = require('tls'); +var http = require('http'); +var https = require('https'); +var assert = require('assert'); +var events = require('events'); +var Agent = require('../'); + +describe('Agent', function () { + describe('"error" event', function () { + it('should be invoked on `http.ClientRequest` instance if passed to callback function on the first tick', function (done) { + var agent = new Agent(function (req, opts, fn) { + fn(new Error('is this caught?')); + }); + var info = url.parse('http://127.0.0.1/foo'); + info.agent = agent; + var req = http.get(info); + req.on('error', function (err) { + assert.equal('is this caught?', err.message); + done(); + }); + }); + it('should be invoked on `http.ClientRequest` instance if passed to callback function after the first tick', function (done) { + var agent = new Agent(function (req, opts, fn) { + setTimeout(function () { + fn(new Error('is this caught?')); + }, 10); + }); + var info = url.parse('http://127.0.0.1/foo'); + info.agent = agent; + var req = http.get(info); + req.on('error', function (err) { + assert.equal('is this caught?', err.message); + done(); + }); + }); + }); + describe('artificial "streams"', function () { + it('should send a GET request', function (done) { + var stream = new events.EventEmitter(); + + // needed for the `http` module to call .write() on the stream + stream.writable = true; + + stream.write = function (str) { + assert(0 == str.indexOf('GET / HTTP/1.1')); + done(); + }; + + var opts = { + method: 'GET', + host: '127.0.0.1', + path: '/', + port: 80, + agent: new Agent(function (req, opts, fn) { + fn(null, stream); + }) + }; + var req = http.request(opts); + req.end(); + }); + it('should receive a GET response', function (done) { + var stream = new events.EventEmitter(); + var opts = { + method: 'GET', + host: '127.0.0.1', + path: '/', + port: 80, + agent: new Agent(function (req, opts, fn) { + fn(null, stream); + }) + }; + var req = http.request(opts, function (res) { + assert.equal('0.9', res.httpVersion); + assert.equal(111, res.statusCode); + assert.equal('bar', res.headers.foo); + done(); + }); + req.end(); + + // have to nextTick() since `http.ClientRequest` doesn't *actually* + // attach the listeners to the "stream" until the next tick :\ + process.nextTick(function () { + var buf = new Buffer('HTTP/0.9 111\r\n' + + 'Foo: bar\r\n' + + 'Set-Cookie: 1\r\n' + + 'Set-Cookie: 2\r\n\r\n'); + if ('function' == typeof stream.ondata) { + // node <= v0.11.3 + stream.ondata(buf, 0, buf.length); + } else { + // node > v0.11.3 + stream.emit('data', buf); + } + }); + }); + }); +}); + +describe('"http" module', function () { + var server; + var port; + + // setup test HTTP server + before(function (done) { + server = http.createServer(); + server.listen(0, function () { + port = server.address().port; + done(); + }); + }); + + // shut down test HTTP server + after(function (done) { + server.once('close', function () { + done(); + }); + server.close(); + }); + + it('should work for basic HTTP requests', function (done) { + var called = false; + var agent = new Agent(function (req, opts, fn) { + called = true; + var socket = net.connect(opts); + fn(null, socket); + }); + + // add HTTP server "request" listener + var gotReq = false; + server.once('request', function (req, res) { + gotReq = true; + res.setHeader('X-Foo', 'bar'); + res.setHeader('X-Url', req.url); + res.end(); + }); + + var info = url.parse('http://127.0.0.1:' + port + '/foo'); + info.agent = agent; + http.get(info, function (res) { + assert.equal('bar', res.headers['x-foo']); + assert.equal('/foo', res.headers['x-url']); + assert(gotReq); + assert(called); + done(); + }); + }); + + it('should set the `Connection: close` response header', function (done) { + var called = false; + var agent = new Agent(function (req, opts, fn) { + called = true; + var socket = net.connect(opts); + fn(null, socket); + }); + + // add HTTP server "request" listener + var gotReq = false; + server.once('request', function (req, res) { + gotReq = true; + res.setHeader('X-Url', req.url); + assert.equal('close', req.headers.connection); + res.end(); + }); + + var info = url.parse('http://127.0.0.1:' + port + '/bar'); + info.agent = agent; + http.get(info, function (res) { + assert.equal('/bar', res.headers['x-url']); + assert.equal('close', res.headers.connection); + assert(gotReq); + assert(called); + done(); + }); + }); + + it('should pass through options from `http.request()`', function (done) { + var agent = new Agent(function (req, opts, fn) { + assert.equal('google.com', opts.host); + assert.equal('bar', opts.foo); + done(); + }); + + http.get({ + host: 'google.com', + foo: 'bar', + agent: agent + }); + }); + + it('should default to port 80', function (done) { + var agent = new Agent(function (req, opts, fn) { + assert.equal(80, opts.port); + done(); + }); + + // (probably) not hitting a real HTTP server here, + // so no need to add a httpServer request listener + http.get({ + host: '127.0.0.1', + path: '/foo', + agent: agent + }); + }); +}); + +describe('"https" module', function () { + var server; + var port; + + // setup test HTTPS server + before(function (done) { + var options = { + key: fs.readFileSync(__dirname + '/ssl-cert-snakeoil.key'), + cert: fs.readFileSync(__dirname + '/ssl-cert-snakeoil.pem') + }; + server = https.createServer(options); + server.listen(0, function () { + port = server.address().port; + done(); + }); + }); + + // shut down test HTTP server + after(function (done) { + server.once('close', function () { + done(); + }); + server.close(); + }); + + it('should work for basic HTTPS requests', function (done) { + var called = false; + var agent = new Agent(function (req, opts, fn) { + called = true; + assert(opts.secureEndpoint); + var socket = tls.connect(opts); + fn(null, socket); + }); + + // add HTTPS server "request" listener + var gotReq = false; + server.once('request', function (req, res) { + gotReq = true; + res.setHeader('X-Foo', 'bar'); + res.setHeader('X-Url', req.url); + res.end(); + }); + + var info = url.parse('https://127.0.0.1:' + port + '/foo'); + info.agent = agent; + info.rejectUnauthorized = false; + https.get(info, function (res) { + assert.equal('bar', res.headers['x-foo']); + assert.equal('/foo', res.headers['x-url']); + assert(gotReq); + assert(called); + done(); + }); + }); + + it('should pass through options from `https.request()`', function (done) { + var agent = new Agent(function (req, opts, fn) { + assert.equal('google.com', opts.host); + assert.equal('bar', opts.foo); + done(); + }); + + https.get({ + host: 'google.com', + foo: 'bar', + agent: agent + }); + }); + + it('should default to port 443', function (done) { + var agent = new Agent(function (req, opts, fn) { + assert.equal(true, opts.secureEndpoint); + assert.equal(false, opts.rejectUnauthorized); + assert.equal(443, opts.port); + done(); + }); + + // (probably) not hitting a real HTTPS server here, + // so no need to add a httpsServer request listener + https.get({ + host: '127.0.0.1', + path: '/foo', + agent: agent, + rejectUnauthorized: false + }); + }); +}); diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/.coveralls.yml b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/.coveralls.yml new file mode 100644 index 0000000000..20a7068581 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/.npmignore b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/.npmignore new file mode 100644 index 0000000000..5f60eecc84 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/.travis.yml b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/.travis.yml new file mode 100644 index 0000000000..6c6090c3b0 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/.travis.yml @@ -0,0 +1,14 @@ + +language: node_js +node_js: + - "6" + - "5" + - "4" + +install: + - make node_modules + +script: + - make lint + - make test + - make coveralls diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/CHANGELOG.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/CHANGELOG.md new file mode 100644 index 0000000000..a9def50cf8 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/CHANGELOG.md @@ -0,0 +1,350 @@ + +2.6.6 / 2017-04-27 +================== + + * Fix: regression from removal of undefined check (@thebigredgeek) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/LICENSE b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/LICENSE new file mode 100644 index 0000000000..54a5d93f4d --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/LICENSE @@ -0,0 +1,18 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/Makefile b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/Makefile new file mode 100644 index 0000000000..584da8bf93 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/Makefile @@ -0,0 +1,50 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +.FORCE: + +install: node_modules + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +lint: .FORCE + eslint browser.js debug.js index.js node.js + +test-node: .FORCE + istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + +test-browser: .FORCE + mkdir -p dist + + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + + karma start --single-run + rimraf dist + +test: .FORCE + concurrently \ + "make test-node" \ + "make test-browser" + +coveralls: + cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +.PHONY: all install clean distclean diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/README.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/README.md new file mode 100644 index 0000000000..9b70a382f9 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/README.md @@ -0,0 +1,312 @@ +# debug +[](https://travis-ci.org/visionmedia/debug) [](https://coveralls.io/github/visionmedia/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers) +[](#sponsors) + + + +A tiny node.js debugging utility modelled after node core's debugging technique. + +**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)** + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + +  + +  + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + + Note that PowerShell uses different syntax to set environment variables. + + ```cmd + $env:DEBUG = "*,-not_this" + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + +  + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + +  + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Environment Variables + + When running through Node.js, you can set a few environment variables that will + change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disabled specific debugging namespaces. | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + + __Note:__ The environment variables beginning with `DEBUG_` end up being + converted into an Options object that gets used with `%o`/`%O` formatters. + See the Node.js documentation for + [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) + for the complete list. + +## Formatters + + + Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + +### Custom formatters + + You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + +## Browser support + You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), + or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), + if you don't want to build it yourself. + + Debug's enable state is currently persisted by `localStorage`. + Consider the situation shown below where you have `worker:a` and `worker:b`, + and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + +  + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + +<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a> + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + +<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a> + +## License + +(The MIT License) + +Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/component.json b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/component.json new file mode 100644 index 0000000000..0705b91aa7 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.6.6", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/karma.conf.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/karma.conf.js new file mode 100644 index 0000000000..103a82d15b --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node.js new file mode 100644 index 0000000000..7fc36fe6db --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/index.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/index.js new file mode 100644 index 0000000000..e904c7054b --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/index.js @@ -0,0 +1,149 @@ +/** + * Helpers. + */ + +var s = 1000 +var m = s * 60 +var h = m * 60 +var d = h * 24 +var y = d * 365.25 + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function (val, options) { + options = options || {} + var type = typeof val + if (type === 'string' && val.length > 0) { + return parse(val) + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? + fmtLong(val) : + fmtShort(val) + } + throw new Error('val is not a non-empty string or a valid number. val=' + JSON.stringify(val)) +} + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str) + if (str.length > 10000) { + return + } + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(str) + if (!match) { + return + } + var n = parseFloat(match[1]) + var type = (match[2] || 'ms').toLowerCase() + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y + case 'days': + case 'day': + case 'd': + return n * d + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n + default: + return undefined + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + if (ms >= d) { + return Math.round(ms / d) + 'd' + } + if (ms >= h) { + return Math.round(ms / h) + 'h' + } + if (ms >= m) { + return Math.round(ms / m) + 'm' + } + if (ms >= s) { + return Math.round(ms / s) + 's' + } + return ms + 'ms' +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + return plural(ms, d, 'day') || + plural(ms, h, 'hour') || + plural(ms, m, 'minute') || + plural(ms, s, 'second') || + ms + ' ms' +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) { + return + } + if (ms < n * 1.5) { + return Math.floor(ms / n) + ' ' + name + } + return Math.ceil(ms / n) + ' ' + name + 's' +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/license.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/license.md new file mode 100644 index 0000000000..69b61253a3 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/package.json b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/package.json new file mode 100644 index 0000000000..e1a8785c3d --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/package.json @@ -0,0 +1,72 @@ +{ + "_from": "ms@0.7.3", + "_id": "ms@0.7.3", + "_integrity": "sha1-cIFVpeROM/X9D8U+gdDUCpG+H/8=", + "_location": "/pacote/make-fetch-happen/https-proxy-agent/debug/ms", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ms@0.7.3", + "name": "ms", + "escapedName": "ms", + "rawSpec": "0.7.3", + "saveSpec": null, + "fetchSpec": "0.7.3" + }, + "_requiredBy": [ + "/pacote/make-fetch-happen/https-proxy-agent/debug" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.3.tgz", + "_shasum": "708155a5e44e33f5fd0fc53e81d0d40a91be1fff", + "_shrinkwrap": null, + "_spec": "ms@0.7.3", + "_where": "/Users/zkat/Documents/code/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug", + "bin": null, + "bugs": { + "url": "https://github.com/zeit/ms/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "ms/index.js": "index.js" + } + }, + "dependencies": {}, + "deprecated": false, + "description": "Tiny milisecond conversion utility", + "devDependencies": { + "expect.js": "0.3.1", + "mocha": "3.0.2", + "serve": "5.0.1", + "xo": "0.17.0" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/zeit/ms#readme", + "license": "MIT", + "main": "./index", + "name": "ms", + "optionalDependencies": {}, + "peerDependencies": {}, + "repository": { + "type": "git", + "url": "git+https://github.com/zeit/ms.git" + }, + "scripts": { + "test": "xo && mocha test/index.js", + "test-browser": "serve ./test" + }, + "version": "0.7.3", + "xo": { + "space": true, + "semicolon": false, + "envs": [ + "mocha" + ], + "rules": { + "complexity": 0 + } + } +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/readme.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/readme.md new file mode 100644 index 0000000000..5b475707d8 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/node_modules/ms/readme.md @@ -0,0 +1,52 @@ +# ms + +[](https://travis-ci.org/zeit/ms) +[](https://github.com/sindresorhus/xo) +[](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +``` + +### Convert from milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +### Time format written-out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [node](https://nodejs.org) and in the browser. +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. + +## Caught a bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/package.json b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/package.json new file mode 100644 index 0000000000..49f3bb4fd4 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/package.json @@ -0,0 +1,91 @@ +{ + "_from": "debug@2", + "_id": "debug@2.6.6", + "_integrity": "sha1-qfpvvpykPPHnn3O3XAGJy7fW21o=", + "_location": "/pacote/make-fetch-happen/https-proxy-agent/debug", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "debug@2", + "name": "debug", + "escapedName": "debug", + "rawSpec": "2", + "saveSpec": null, + "fetchSpec": "2" + }, + "_requiredBy": [ + "/pacote/make-fetch-happen/https-proxy-agent" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.6.tgz", + "_shasum": "a9fa6fbe9ca43cf1e79f73b75c0189cbb7d6db5a", + "_shrinkwrap": null, + "_spec": "debug@2", + "_where": "/Users/zkat/Documents/code/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "bin": null, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + }, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + } + ], + "dependencies": { + "ms": "0.7.3" + }, + "deprecated": false, + "description": "small debugging utility", + "devDependencies": { + "browserify": "9.0.3", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "homepage": "https://github.com/visionmedia/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "optionalDependencies": {}, + "peerDependencies": {}, + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "version": "2.6.6" +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/browser.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/browser.js new file mode 100644 index 0000000000..053f4b898c --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/browser.js @@ -0,0 +1,185 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/debug.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/debug.js new file mode 100644 index 0000000000..6a5e3fc94c --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/debug.js @@ -0,0 +1,202 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + return debug; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/index.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/index.js new file mode 100644 index 0000000000..e12cf4d58c --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process !== 'undefined' && process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/node.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/node.js new file mode 100644 index 0000000000..3c7407b6b7 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/debug/src/node.js @@ -0,0 +1,241 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; + +if (1 !== fd && 2 !== fd) { + util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')() +} + +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .replace(/\s*\n\s*/g, ' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to `stream`. + */ + +function log() { + return stream.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = util._extend({}, exports.inspectOpts); +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/.jscs.json b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/.jscs.json new file mode 100644 index 0000000000..b1c6a99f97 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/.jscs.json @@ -0,0 +1,174 @@ +{ + "es3": true, + + "additionalRules": [], + + "requireSemicolons": true, + + "disallowMultipleSpaces": true, + + "disallowIdentifierNames": [], + + "requireCurlyBraces": { + "allExcept": [], + "keywords": ["if", "else", "for", "while", "do", "try", "catch"] + }, + + "requireSpaceAfterKeywords": ["if", "else", "for", "while", "do", "switch", "return", "try", "catch", "function"], + + "disallowSpaceAfterKeywords": [], + + "disallowSpaceBeforeComma": true, + "disallowSpaceAfterComma": false, + "disallowSpaceBeforeSemicolon": true, + + "disallowNodeTypes": [ + "DebuggerStatement", + "LabeledStatement", + "SwitchCase", + "SwitchStatement", + "WithStatement" + ], + + "requireObjectKeysOnNewLine": { "allExcept": ["sameLine"] }, + + "requireSpacesInAnonymousFunctionExpression": { "beforeOpeningRoundBrace": true, "beforeOpeningCurlyBrace": true }, + "requireSpacesInNamedFunctionExpression": { "beforeOpeningCurlyBrace": true }, + "disallowSpacesInNamedFunctionExpression": { "beforeOpeningRoundBrace": true }, + "requireSpacesInFunctionDeclaration": { "beforeOpeningCurlyBrace": true }, + "disallowSpacesInFunctionDeclaration": { "beforeOpeningRoundBrace": true }, + + "requireSpaceBetweenArguments": true, + + "disallowSpacesInsideParentheses": true, + + "disallowSpacesInsideArrayBrackets": true, + + "disallowQuotedKeysInObjects": { "allExcept": ["reserved"] }, + + "disallowSpaceAfterObjectKeys": true, + + "requireCommaBeforeLineBreak": true, + + "disallowSpaceAfterPrefixUnaryOperators": ["++", "--", "+", "-", "~", "!"], + "requireSpaceAfterPrefixUnaryOperators": [], + + "disallowSpaceBeforePostfixUnaryOperators": ["++", "--"], + "requireSpaceBeforePostfixUnaryOperators": [], + + "disallowSpaceBeforeBinaryOperators": [], + "requireSpaceBeforeBinaryOperators": ["+", "-", "/", "*", "=", "==", "===", "!=", "!=="], + + "requireSpaceAfterBinaryOperators": ["+", "-", "/", "*", "=", "==", "===", "!=", "!=="], + "disallowSpaceAfterBinaryOperators": [], + + "disallowImplicitTypeConversion": ["binary", "string"], + + "disallowKeywords": ["with", "eval"], + + "requireKeywordsOnNewLine": [], + "disallowKeywordsOnNewLine": ["else"], + + "requireLineFeedAtFileEnd": true, + + "disallowTrailingWhitespace": true, + + "disallowTrailingComma": true, + + "excludeFiles": ["node_modules/**", "vendor/**"], + + "disallowMultipleLineStrings": true, + + "requireDotNotation": { "allExcept": ["keywords"] }, + + "requireParenthesesAroundIIFE": true, + + "validateLineBreaks": "LF", + + "validateQuoteMarks": { + "escape": true, + "mark": "'" + }, + + "disallowOperatorBeforeLineBreak": [], + + "requireSpaceBeforeKeywords": [ + "do", + "for", + "if", + "else", + "switch", + "case", + "try", + "catch", + "finally", + "while", + "with", + "return" + ], + + "validateAlignedFunctionParameters": { + "lineBreakAfterOpeningBraces": true, + "lineBreakBeforeClosingBraces": true + }, + + "requirePaddingNewLinesBeforeExport": true, + + "validateNewlineAfterArrayElements": { + "maximum": 6 + }, + + "requirePaddingNewLinesAfterUseStrict": true, + + "disallowArrowFunctions": true, + + "disallowMultiLineTernary": true, + + "validateOrderInObjectKeys": false, + + "disallowIdenticalDestructuringNames": true, + + "disallowNestedTernaries": { "maxLevel": 1 }, + + "requireSpaceAfterComma": { "allExcept": ["trailing"] }, + "requireAlignedMultilineParams": false, + + "requireSpacesInGenerator": { + "afterStar": true + }, + + "disallowSpacesInGenerator": { + "beforeStar": true + }, + + "disallowVar": false, + + "requireArrayDestructuring": false, + + "requireEnhancedObjectLiterals": false, + + "requireObjectDestructuring": false, + + "requireEarlyReturn": false, + + "requireCapitalizedConstructorsNew": { + "allExcept": ["Function", "String", "Object", "Symbol", "Number", "Date", "RegExp", "Error", "Boolean", "Array"] + }, + + "requireImportAlphabetized": false, + + "requireSpaceBeforeObjectValues": true, + "requireSpaceBeforeDestructuredValues": true, + + "disallowSpacesInsideTemplateStringPlaceholders": true, + + "disallowArrayDestructuringReturn": false, + + "requireNewlineBeforeSingleStatementsInIf": false, + + "disallowUnusedVariables": true, + + "requireSpacesInsideImportedObjectBraces": true, + + "requireUseStrict": true +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/.npmignore b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/.npmignore new file mode 100644 index 0000000000..30d74d2584 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/.npmignore @@ -0,0 +1 @@ +test
\ No newline at end of file diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/.travis.yml b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/.travis.yml new file mode 100644 index 0000000000..6bf696c87b --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/.travis.yml @@ -0,0 +1,179 @@ +language: node_js +os: + - linux +node_js: + - "7.9" + - "6.10" + - "5.12" + - "4.8" + - "iojs-v3.3" + - "iojs-v2.5" + - "iojs-v1.8" + - "0.12" + - "0.10" + - "0.8" +before_install: + - 'if [ "${TRAVIS_NODE_VERSION}" = "0.6" ]; then npm install -g npm@1.3 ; elif [ "${TRAVIS_NODE_VERSION}" != "0.9" ]; then case "$(npm --version)" in 1.*) npm install -g npm@1.4.28 ;; 2.*) npm install -g npm@2 ;; esac ; fi' + - 'if [ "${TRAVIS_NODE_VERSION}" != "0.6" ] && [ "${TRAVIS_NODE_VERSION}" != "0.9" ]; then npm install -g npm; fi' +install: + - 'if [ "${TRAVIS_NODE_VERSION}" = "0.6" ]; then nvm install 0.8 && npm install -g npm@1.3 && npm install -g npm@1.4.28 && npm install -g npm@2 && npm install && nvm use "${TRAVIS_NODE_VERSION}"; else npm install; fi;' +script: + - 'if [ -n "${PRETEST-}" ]; then npm run pretest ; fi' + - 'if [ -n "${POSTTEST-}" ]; then npm run posttest ; fi' + - 'if [ -n "${COVERAGE-}" ]; then npm run coverage ; fi' + - 'if [ -n "${TEST-}" ]; then npm run tests-only ; fi' +sudo: false +env: + - TEST=true +matrix: + fast_finish: true + include: + - node_js: "node" + env: PRETEST=true + - node_js: "node" + env: COVERAGE=true + - node_js: "7.8" + env: TEST=true ALLOW_FAILURE=true + - node_js: "7.7" + env: TEST=true ALLOW_FAILURE=true + - node_js: "7.6" + env: TEST=true ALLOW_FAILURE=true + - node_js: "7.5" + env: TEST=true ALLOW_FAILURE=true + - node_js: "7.4" + env: TEST=true ALLOW_FAILURE=true + - node_js: "7.3" + env: TEST=true ALLOW_FAILURE=true + - node_js: "7.2" + env: TEST=true ALLOW_FAILURE=true + - node_js: "7.1" + env: TEST=true ALLOW_FAILURE=true + - node_js: "7.0" + env: TEST=true ALLOW_FAILURE=true + - node_js: "6.9" + env: TEST=true ALLOW_FAILURE=true + - node_js: "6.8" + env: TEST=true ALLOW_FAILURE=true + - node_js: "6.7" + env: TEST=true ALLOW_FAILURE=true + - node_js: "6.6" + env: TEST=true ALLOW_FAILURE=true + - node_js: "6.5" + env: TEST=true ALLOW_FAILURE=true + - node_js: "6.4" + env: TEST=true ALLOW_FAILURE=true + - node_js: "6.3" + env: TEST=true ALLOW_FAILURE=true + - node_js: "6.2" + env: TEST=true ALLOW_FAILURE=true + - node_js: "6.1" + env: TEST=true ALLOW_FAILURE=true + - node_js: "6.0" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.11" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.10" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.9" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.8" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.7" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.6" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.5" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.4" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.3" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.2" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.1" + env: TEST=true ALLOW_FAILURE=true + - node_js: "5.0" + env: TEST=true ALLOW_FAILURE=true + - node_js: "4.7" + env: TEST=true ALLOW_FAILURE=true + - node_js: "4.6" + env: TEST=true ALLOW_FAILURE=true + - node_js: "4.5" + env: TEST=true ALLOW_FAILURE=true + - node_js: "4.4" + env: TEST=true ALLOW_FAILURE=true + - node_js: "4.3" + env: TEST=true ALLOW_FAILURE=true + - node_js: "4.2" + env: TEST=true ALLOW_FAILURE=true + - node_js: "4.1" + env: TEST=true ALLOW_FAILURE=true + - node_js: "4.0" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v3.2" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v3.1" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v3.0" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v2.4" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v2.3" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v2.2" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v2.1" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v2.0" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v1.7" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v1.6" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v1.5" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v1.4" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v1.3" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v1.2" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v1.1" + env: TEST=true ALLOW_FAILURE=true + - node_js: "iojs-v1.0" + env: TEST=true ALLOW_FAILURE=true + - node_js: "0.11" + env: TEST=true ALLOW_FAILURE=true + - node_js: "0.9" + env: TEST=true ALLOW_FAILURE=true + - node_js: "0.6" + env: TEST=true ALLOW_FAILURE=true + - node_js: "0.4" + env: TEST=true ALLOW_FAILURE=true + ##- node_js: "7" + #env: TEST=true + #os: osx + #- node_js: "6" + #env: TEST=true + #os: osx + #- node_js: "5" + #env: TEST=true + #os: osx + #- node_js: "4" + #env: TEST=true + #os: osx + #- node_js: "iojs" + #env: TEST=true + #os: osx + #- node_js: "0.12" + #env: TEST=true + #os: osx + #- node_js: "0.10" + #env: TEST=true + #os: osx + #- node_js: "0.8" + #env: TEST=true + #os: osx + allow_failures: + - os: osx + - env: TEST=true ALLOW_FAILURE=true diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/CHANGELOG.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/CHANGELOG.md new file mode 100644 index 0000000000..7d2e5f3a50 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/CHANGELOG.md @@ -0,0 +1,76 @@ +3.0.1 / 2017-04-27 +================== + * [Fix] deep extending should work with a non-object (#46) + * [Dev Deps] update `tape`, `eslint`, `@ljharb/eslint-config` + * [Tests] up to `node` `v7.9`, `v6.10`, `v4.8`; improve matrix + * [Docs] Switch from vb.teelaun.ch to versionbadg.es for the npm version badge SVG. + * [Docs] Add example to readme (#34) + +3.0.0 / 2015-07-01 +================== + * [Possible breaking change] Use global "strict" directive (#32) + * [Tests] `int` is an ES3 reserved word + * [Tests] Test up to `io.js` `v2.3` + * [Tests] Add `npm run eslint` + * [Dev Deps] Update `covert`, `jscs` + +2.0.1 / 2015-04-25 +================== + * Use an inline `isArray` check, for ES3 browsers. (#27) + * Some old browsers fail when an identifier is `toString` + * Test latest `node` and `io.js` versions on `travis-ci`; speed up builds + * Add license info to package.json (#25) + * Update `tape`, `jscs` + * Adding a CHANGELOG + +2.0.0 / 2014-10-01 +================== + * Increase code coverage to 100%; run code coverage as part of tests + * Add `npm run lint`; Run linter as part of tests + * Remove nodeType and setInterval checks in isPlainObject + * Updating `tape`, `jscs`, `covert` + * General style and README cleanup + +1.3.0 / 2014-06-20 +================== + * Add component.json for browser support (#18) + * Use SVG for badges in README (#16) + * Updating `tape`, `covert` + * Updating travis-ci to work with multiple node versions + * Fix `deep === false` bug (returning target as {}) (#14) + * Fixing constructor checks in isPlainObject + * Adding additional test coverage + * Adding `npm run coverage` + * Add LICENSE (#13) + * Adding a warning about `false`, per #11 + * General style and whitespace cleanup + +1.2.1 / 2013-09-14 +================== + * Fixing hasOwnProperty bugs that would only have shown up in specific browsers. Fixes #8 + * Updating `tape` + +1.2.0 / 2013-09-02 +================== + * Updating the README: add badges + * Adding a missing variable reference. + * Using `tape` instead of `buster` for tests; add more tests (#7) + * Adding node 0.10 to Travis CI (#6) + * Enabling "npm test" and cleaning up package.json (#5) + * Add Travis CI. + +1.1.3 / 2012-12-06 +================== + * Added unit tests. + * Ensure extend function is named. (Looks nicer in a stack trace.) + * README cleanup. + +1.1.1 / 2012-11-07 +================== + * README cleanup. + * Added installation instructions. + * Added a missing semicolon + +1.0.0 / 2012-04-08 +================== + * Initial commit diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/LICENSE b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/LICENSE new file mode 100644 index 0000000000..92d41503d3 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/LICENSE @@ -0,0 +1,22 @@ +The MIT License (MIT) + +Copyright (c) 2014 Stefan Thomas + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/README.md b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/README.md new file mode 100644 index 0000000000..947dda6aeb --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/README.md @@ -0,0 +1,80 @@ +[![Build Status][travis-svg]][travis-url] +[![dependency status][deps-svg]][deps-url] +[![dev dependency status][dev-deps-svg]][dev-deps-url] + +# extend() for Node.js <sup>[![Version Badge][npm-version-png]][npm-url]</sup> + +`node-extend` is a port of the classic extend() method from jQuery. It behaves as you expect. It is simple, tried and true. + +Notes: + +* Since Node.js >= 4, + [`Object.assign`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/assign) + now offers the same functionality natively (but without the "deep copy" option). + See [ECMAScript 2015 (ES6) in Node.js](https://nodejs.org/en/docs/es6). +* Some native implementations of `Object.assign` in both Node.js and many + browsers (since NPM modules are for the browser too) may not be fully + spec-compliant. + Check [`object.assign`](https://www.npmjs.com/package/object.assign) module for + a compliant candidate. + +## Installation + +This package is available on [npm][npm-url] as: `extend` + +``` sh +npm install extend +``` + +## Usage + +**Syntax:** extend **(** [`deep`], `target`, `object1`, [`objectN`] **)** + +*Extend one object with one or more others, returning the modified object.* + +**Example:** + +``` js +var extend = require('extend'); +extend(targetObject, object1, object2); +``` + +Keep in mind that the target object will be modified, and will be returned from extend(). + +If a boolean true is specified as the first argument, extend performs a deep copy, recursively copying any objects it finds. Otherwise, the copy will share structure with the original object(s). +Undefined properties are not copied. However, properties inherited from the object's prototype will be copied over. +Warning: passing `false` as the first argument is not supported. + +### Arguments + +* `deep` *Boolean* (optional) +If set, the merge becomes recursive (i.e. deep copy). +* `target` *Object* +The object to extend. +* `object1` *Object* +The object that will be merged into the first. +* `objectN` *Object* (Optional) +More objects to merge into the first. + +## License + +`node-extend` is licensed under the [MIT License][mit-license-url]. + +## Acknowledgements + +All credit to the jQuery authors for perfecting this amazing utility. + +Ported to Node.js by [Stefan Thomas][github-justmoon] with contributions by [Jonathan Buchanan][github-insin] and [Jordan Harband][github-ljharb]. + +[travis-svg]: https://travis-ci.org/justmoon/node-extend.svg +[travis-url]: https://travis-ci.org/justmoon/node-extend +[npm-url]: https://npmjs.org/package/extend +[mit-license-url]: http://opensource.org/licenses/MIT +[github-justmoon]: https://github.com/justmoon +[github-insin]: https://github.com/insin +[github-ljharb]: https://github.com/ljharb +[npm-version-png]: http://versionbadg.es/justmoon/node-extend.svg +[deps-svg]: https://david-dm.org/justmoon/node-extend.svg +[deps-url]: https://david-dm.org/justmoon/node-extend +[dev-deps-svg]: https://david-dm.org/justmoon/node-extend/dev-status.svg +[dev-deps-url]: https://david-dm.org/justmoon/node-extend#info=devDependencies diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/component.json b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/component.json new file mode 100644 index 0000000000..0f76b59305 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/component.json @@ -0,0 +1,31 @@ +{ + "name": "extend", + "author": "Stefan Thomas <justmoon@members.fsf.org> (http://www.justmoon.net)", + "version": "3.0.0", + "description": "Port of jQuery.extend for node.js and the browser.", + "scripts": [ + "index.js" + ], + "contributors": [ + { + "name": "Jordan Harband", + "url": "https://github.com/ljharb" + } + ], + "keywords": [ + "extend", + "clone", + "merge" + ], + "repository" : { + "type": "git", + "url": "https://github.com/justmoon/node-extend.git" + }, + "dependencies": { + }, + "devDependencies": { + "tape" : "~3.0.0", + "covert": "~0.4.0", + "jscs": "~1.6.2" + } +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/index.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/index.js new file mode 100644 index 0000000000..bbe53f6608 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/index.js @@ -0,0 +1,86 @@ +'use strict'; + +var hasOwn = Object.prototype.hasOwnProperty; +var toStr = Object.prototype.toString; + +var isArray = function isArray(arr) { + if (typeof Array.isArray === 'function') { + return Array.isArray(arr); + } + + return toStr.call(arr) === '[object Array]'; +}; + +var isPlainObject = function isPlainObject(obj) { + if (!obj || toStr.call(obj) !== '[object Object]') { + return false; + } + + var hasOwnConstructor = hasOwn.call(obj, 'constructor'); + var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf'); + // Not own constructor property must be Object + if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) { + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + var key; + for (key in obj) { /**/ } + + return typeof key === 'undefined' || hasOwn.call(obj, key); +}; + +module.exports = function extend() { + var options, name, src, copy, copyIsArray, clone; + var target = arguments[0]; + var i = 1; + var length = arguments.length; + var deep = false; + + // Handle a deep copy situation + if (typeof target === 'boolean') { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + if (target == null || (typeof target !== 'object' && typeof target !== 'function')) { + target = {}; + } + + for (; i < length; ++i) { + options = arguments[i]; + // Only deal with non-null/undefined values + if (options != null) { + // Extend the base object + for (name in options) { + src = target[name]; + copy = options[name]; + + // Prevent never-ending loop + if (target !== copy) { + // Recurse if we're merging plain objects or arrays + if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) { + if (copyIsArray) { + copyIsArray = false; + clone = src && isArray(src) ? src : []; + } else { + clone = src && isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[name] = extend(deep, clone, copy); + + // Don't bring in undefined values + } else if (typeof copy !== 'undefined') { + target[name] = copy; + } + } + } + } + } + + // Return the modified object + return target; +}; diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/package.json b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/package.json new file mode 100644 index 0000000000..ae1374362f --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/node_modules/extend/package.json @@ -0,0 +1,79 @@ +{ + "_from": "extend@3", + "_id": "extend@3.0.1", + "_integrity": "sha1-p1Xqe8Gt/MWjHOfnYtuq3F5jZEQ=", + "_location": "/pacote/make-fetch-happen/https-proxy-agent/extend", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "extend@3", + "name": "extend", + "escapedName": "extend", + "rawSpec": "3", + "saveSpec": null, + "fetchSpec": "3" + }, + "_requiredBy": [ + "/pacote/make-fetch-happen/https-proxy-agent", + "/pacote/make-fetch-happen/https-proxy-agent/agent-base" + ], + "_resolved": "https://registry.npmjs.org/extend/-/extend-3.0.1.tgz", + "_shasum": "a755ea7bc1adfcc5a31ce7e762dbaadc5e636444", + "_shrinkwrap": null, + "_spec": "extend@3", + "_where": "/Users/zkat/Documents/code/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent", + "author": { + "name": "Stefan Thomas", + "email": "justmoon@members.fsf.org", + "url": "http://www.justmoon.net" + }, + "bin": null, + "bugs": { + "url": "https://github.com/justmoon/node-extend/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Jordan Harband", + "url": "https://github.com/ljharb" + } + ], + "dependencies": {}, + "deprecated": false, + "description": "Port of jQuery.extend for node.js and the browser", + "devDependencies": { + "@ljharb/eslint-config": "^11.0.0", + "covert": "^1.1.0", + "eslint": "^3.19.0", + "jscs": "^3.0.7", + "tape": "^4.6.3" + }, + "homepage": "https://github.com/justmoon/node-extend#readme", + "keywords": [ + "extend", + "clone", + "merge" + ], + "license": "MIT", + "main": "index", + "name": "extend", + "optionalDependencies": {}, + "peerDependencies": {}, + "repository": { + "type": "git", + "url": "git+https://github.com/justmoon/node-extend.git" + }, + "scripts": { + "coverage": "covert test/index.js", + "coverage-quiet": "covert test/index.js --quiet", + "eslint": "eslint *.js */*.js", + "jscs": "jscs *.js */*.js", + "lint": "npm run jscs && npm run eslint", + "posttest": "npm run coverage-quiet", + "pretest": "npm run lint", + "test": "npm run tests-only", + "tests-only": "node test" + }, + "version": "3.0.1" +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/package.json b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/package.json new file mode 100644 index 0000000000..51ff9397f8 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/package.json @@ -0,0 +1,67 @@ +{ + "_from": "https-proxy-agent@^1.0.0", + "_id": "https-proxy-agent@1.0.0", + "_integrity": "sha1-NffabEjOTdv6JkiRrFk+5f+GceY=", + "_location": "/pacote/make-fetch-happen/https-proxy-agent", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "https-proxy-agent@^1.0.0", + "name": "https-proxy-agent", + "escapedName": "https-proxy-agent", + "rawSpec": "^1.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.0" + }, + "_requiredBy": [ + "/pacote/make-fetch-happen" + ], + "_resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-1.0.0.tgz", + "_shasum": "35f7da6c48ce4ddbfa264891ac593ee5ff8671e6", + "_shrinkwrap": null, + "_spec": "https-proxy-agent@^1.0.0", + "_where": "/Users/zkat/Documents/code/npm/node_modules/pacote/node_modules/make-fetch-happen", + "author": { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io/" + }, + "bin": null, + "bugs": { + "url": "https://github.com/TooTallNate/node-https-proxy-agent/issues" + }, + "bundleDependencies": false, + "dependencies": { + "agent-base": "2", + "debug": "2", + "extend": "3" + }, + "deprecated": false, + "description": "An HTTP(s) proxy `http.Agent` implementation for HTTPS", + "devDependencies": { + "mocha": "2", + "proxy": "~0.2.3", + "semver": "~2.2.1" + }, + "homepage": "https://github.com/TooTallNate/node-https-proxy-agent#readme", + "keywords": [ + "https", + "proxy", + "endpoint", + "agent" + ], + "license": "MIT", + "main": "https-proxy-agent.js", + "name": "https-proxy-agent", + "optionalDependencies": {}, + "peerDependencies": {}, + "repository": { + "type": "git", + "url": "git://github.com/TooTallNate/node-https-proxy-agent.git" + }, + "scripts": { + "test": "mocha --reporter spec" + }, + "version": "1.0.0" +} diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/test/ssl-cert-snakeoil.key b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/test/ssl-cert-snakeoil.key new file mode 100644 index 0000000000..fd12501220 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/test/ssl-cert-snakeoil.key @@ -0,0 +1,15 @@ +-----BEGIN RSA PRIVATE KEY----- +MIICWwIBAAKBgQCzURxIqzer0ACAbX/lHdsn4Gd9PLKrf7EeDYfIdV0HZKPD8WDr +bBx2/fBu0OW2sjnzv/SVZbJ0DAuPE/p0+eT0qb2qC10iz9iTD7ribd7gxhirVb8y +b3fBjXsxc8V8p4Ny1LcvNSqCjwUbJqdRogfoJeTiqPM58z5sNzuv5iq7iwIDAQAB +AoGAPMQy4olrP0UotlzlJ36bowLP70ffgHCwU+/f4NWs5fF78c3du0oSx1w820Dd +Z7E0JF8bgnlJJTxjumPZz0RUCugrEHBKJmzEz3cxF5E3+7NvteZcjKn9D67RrM5x +1/uSZ9cqKE9cYvY4fSuHx18diyZ4axR/wB1Pea2utjjDM+ECQQDb9ZbmmaWMiRpQ +5Up+loxP7BZNPsEVsm+DVJmEFbaFgGfncWBqSIqnPNjMwTwj0OigTwCAEGPkfRVW +T0pbYWCxAkEA0LK7SCTwzyDmhASUalk0x+3uCAA6ryFdwJf/wd8TRAvVOmkTEldX +uJ7ldLvfrONYO3v56uKTU/SoNdZYzKtO+wJAX2KM4ctXYy5BXztPpr2acz4qHa1N +Bh+vBAC34fOYhyQ76r3b1btHhWZ5jbFuZwm9F2erC94Ps5IaoqcX07DSwQJAPKGw +h2U0EPkd/3zVIZCJJQya+vgWFIs9EZcXVtvYXQyTBkVApTN66MhBIYjzkub5205J +bVQmOV37AKklY1DhwQJAA1wos0cYxro02edzatxd0DIR2r4qqOqLkw6BhYHhq6HJ +ZvIcQkHqdSXzdETFc01I1znDGGIrJHcnvKWgBPoEUg== +-----END RSA PRIVATE KEY----- diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/test/ssl-cert-snakeoil.pem b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/test/ssl-cert-snakeoil.pem new file mode 100644 index 0000000000..b115a5e914 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/test/ssl-cert-snakeoil.pem @@ -0,0 +1,12 @@ +-----BEGIN CERTIFICATE----- +MIIB1TCCAT4CCQDV5mPlzm9+izANBgkqhkiG9w0BAQUFADAvMS0wKwYDVQQDEyQ3 +NTI3YmQ3Ny1hYjNlLTQ3NGItYWNlNy1lZWQ2MDUzOTMxZTcwHhcNMTUwNzA2MjI0 +NTA3WhcNMjUwNzAzMjI0NTA3WjAvMS0wKwYDVQQDEyQ3NTI3YmQ3Ny1hYjNlLTQ3 +NGItYWNlNy1lZWQ2MDUzOTMxZTcwgZ8wDQYJKoZIhvcNAQEBBQADgY0AMIGJAoGB +ALNRHEirN6vQAIBtf+Ud2yfgZ308sqt/sR4Nh8h1XQdko8PxYOtsHHb98G7Q5bay +OfO/9JVlsnQMC48T+nT55PSpvaoLXSLP2JMPuuJt3uDGGKtVvzJvd8GNezFzxXyn +g3LUty81KoKPBRsmp1GiB+gl5OKo8znzPmw3O6/mKruLAgMBAAEwDQYJKoZIhvcN +AQEFBQADgYEACzoHUF8UV2Z6541Q2wKEA0UFUzmUjf/E1XwBO+1P15ZZ64uw34B4 +1RwMPtAo9RY/PmICTWtNxWGxkzwb2JtDWtnxVER/lF8k2XcXPE76fxTHJF/BKk9J +QU8OTD1dd9gHCBviQB9TqntRZ5X7axjtuWjb2umY+owBYzAHZkp1HKI= +-----END CERTIFICATE----- diff --git a/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/test/test.js b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/test/test.js new file mode 100644 index 0000000000..2ee6724ea1 --- /dev/null +++ b/deps/npm/node_modules/pacote/node_modules/make-fetch-happen/node_modules/https-proxy-agent/test/test.js @@ -0,0 +1,293 @@ + +/** + * Module dependencies. + */ + +var fs = require('fs'); +var url = require('url'); +var http = require('http'); +var https = require('https'); +var assert = require('assert'); +var Proxy = require('proxy'); +var Semver = require('semver'); +var version = new Semver(process.version); +var HttpsProxyAgent = require('../'); + +describe('HttpsProxyAgent', function () { + + var server; + var serverPort; + + var sslServer; + var sslServerPort; + + var proxy; + var proxyPort; + + var sslProxy; + var sslProxyPort; + + before(function (done) { + // setup target HTTP server + server = http.createServer(); + server.listen(function () { + serverPort = server.address().port; + done(); + }); + }); + + before(function (done) { + // setup HTTP proxy server + proxy = Proxy(); + proxy.listen(function () { + proxyPort = proxy.address().port; + done(); + }); + }); + + before(function (done) { + // setup target HTTPS server + var options = { + key: fs.readFileSync(__dirname + '/ssl-cert-snakeoil.key'), + cert: fs.readFileSync(__dirname + '/ssl-cert-snakeoil.pem') + }; + sslServer = https.createServer(options); + sslServer.listen(function () { + sslServerPort = sslServer.address().port; + done(); + }); + }); + + before(function (done) { + // setup SSL HTTP proxy server + var options = { + key: fs.readFileSync(__dirname + '/ssl-cert-snakeoil.key'), + cert: fs.readFileSync(__dirname + '/ssl-cert-snakeoil.pem') + }; + sslProxy = Proxy(https.createServer(options)); + sslProxy.listen(function () { + sslProxyPort = sslProxy.address().port; + done(); + }); + }); + + // shut down test HTTP server + after(function (done) { + server.once('close', function () { done(); }); + server.close(); + }); + + after(function (done) { + proxy.once('close', function () { done(); }); + proxy.close(); + }); + + after(function (done) { + sslServer.once('close', function () { done(); }); + sslServer.close(); + }); + + after(function (done) { + sslProxy.once('close', function () { done(); }); + sslProxy.close(); + }); + + describe('constructor', function () { + it('should throw an Error if no "proxy" argument is given', function () { + assert.throws(function () { + new HttpsProxyAgent(); + }); + }); + it('should accept a "string" proxy argument', function () { + var agent = new HttpsProxyAgent('http://127.0.0.1:' + proxyPort); + assert.equal('127.0.0.1', agent.proxy.host); + assert.equal(proxyPort, agent.proxy.port); + }); + it('should accept a `url.parse()` result object argument', function () { + var opts = url.parse('http://127.0.0.1:' + proxyPort); + var agent = new HttpsProxyAgent(opts); + assert.equal('127.0.0.1', agent.proxy.host); + assert.equal(proxyPort, agent.proxy.port); + }); + describe('secureProxy', function () { + it('should default to `false`', function () { + var agent = new HttpsProxyAgent({ port: proxyPort }); + assert.equal(false, agent.secureProxy); + }); + it('should be `false` when "http:" protocol is used', function () { + var agent = new HttpsProxyAgent({ port: proxyPort, protocol: 'http:' }); + assert.equal(false, agent.secureProxy); + }); + it('should be `true` when "https:" protocol is used', function () { + var agent = new HttpsProxyAgent({ port: proxyPort, protocol: 'https:' }); + assert.equal(true, agent.secureProxy); + }); + it('should be `true` when "https" protocol is used', function () { + var agent = new HttpsProxyAgent({ port: proxyPort, protocol: 'https' }); + assert.equal(true, agent.secureProxy); + }); + }); + }); + + describe('"http" module', function () { + + beforeEach(function () { + delete proxy.authenticate; + }); + + it('should work over an HTTP proxy', function (done) { + server.once('request', function (req, res) { + res.end(JSON.stringify(req.headers)); + }); + + var proxy = process.env.HTTP_PROXY || process.env.http_proxy || 'http://127.0.0.1:' + proxyPort; + var agent = new HttpsProxyAgent(proxy); + + var opts = url.parse('http://127.0.0.1:' + serverPort); + opts.agent = agent; + + var req = http.get(opts, function (res) { + var data = ''; + res.setEncoding('utf8'); + res.on('data', function (b) { + data += b; + }); + res.on('end', function () { + data = JSON.parse(data); + assert.equal('127.0.0.1:' + serverPort, data.host); + done(); + }); + }); + req.once('error', done); + }); + it('should work over an HTTPS proxy', function (done) { + server.once('request', function (req, res) { + res.end(JSON.stringify(req.headers)); + }); + + var proxy = process.env.HTTPS_PROXY || process.env.https_proxy || 'https://127.0.0.1:' + sslProxyPort; + proxy = url.parse(proxy); + proxy.rejectUnauthorized = false; + var agent = new HttpsProxyAgent(proxy); + + var opts = url.parse('http://127.0.0.1:' + serverPort); + opts.agent = agent; + + http.get(opts, function (res) { + var data = ''; + res.setEncoding('utf8'); + res.on('data', function (b) { + data += b; + }); + res.on('end', function () { + data = JSON.parse(data); + console.log(data); + assert.equal('127.0.0.1:' + serverPort, data.host); + done(); + }); + }); + }); + it('should receive the 407 authorization code on the `http.ClientResponse`', function (done) { + // set a proxy authentication function for this test + proxy.authenticate = function (req, fn) { + // reject all requests + fn(null, false); + }; + + var proxyUri = process.env.HTTP_PROXY || process.env.http_proxy || 'http://127.0.0.1:' + proxyPort; + var agent = new HttpsProxyAgent(proxyUri); + + var opts = {}; + // `host` and `port` don't really matter since the proxy will reject anyways + opts.host = '127.0.0.1'; + opts.port = 80; + opts.agent = agent; + + var req = http.get(opts, function (res) { + assert.equal(407, res.statusCode); + assert('proxy-authenticate' in res.headers); + done(); + }); + }); + it('should emit an "error" event on the `http.ClientRequest` if the proxy does not exist', function (done) { + // port 4 is a reserved, but "unassigned" port + var proxyUri = 'http://127.0.0.1:4'; + var agent = new HttpsProxyAgent(proxyUri); + + var opts = url.parse('http://nodejs.org'); + opts.agent = agent; + + var req = http.get(opts); + req.once('error', function (err) { + assert.equal('ECONNREFUSED', err.code); + req.abort(); + done(); + }); + }); + }); + + describe('"https" module', function () { + it('should work over an HTTP proxy', function (done) { + sslServer.once('request', function (req, res) { + res.end(JSON.stringify(req.headers)); + }); + + var proxy = process.env.HTTP_PROXY || process.env.http_proxy || 'http://127.0.0.1:' + proxyPort; + var agent = new HttpsProxyAgent(proxy); + + var opts = url.parse('https://127.0.0.1:' + sslServerPort); + opts.rejectUnauthorized = false; + opts.agent = agent; + + https.get(opts, function (res) { + var data = ''; + res.setEncoding('utf8'); + res.on('data', function (b) { + data += b; + }); + res.on('end', function () { + data = JSON.parse(data); + assert.equal('127.0.0.1:' + sslServerPort, data.host); + done(); + }); + }); + }); + + if (version.compare('0.11.3') < 0 || version.compare('0.11.8') >= 0) { + // This test is disabled on node >= 0.11.3 && < 0.11.8, since it segfaults :( + // See: https://github.com/joyent/node/issues/6204 + + it('should work over an HTTPS proxy', function (done) { + sslServer.once('request', function (req, res) { + res.end(JSON.stringify(req.headers)); + }); + + var proxy = process.env.HTTPS_PROXY || process.env.https_proxy || 'https://127.0.0.1:' + sslProxyPort; + proxy = url.parse(proxy); + proxy.rejectUnauthorized = false; + var agent = new HttpsProxyAgent(proxy); + + var opts = url.parse('https://127.0.0.1:' + sslServerPort); + opts.agent = agent; + opts.rejectUnauthorized = false; + + https.get(opts, function (res) { + var data = ''; + res.setEncoding('utf8'); + res.on('data', function (b) { + data += b; + }); + res.on('end', function () { + data = JSON.parse(data); + assert.equal('127.0.0.1:' + sslServerPort, data.host); + done(); + }); + }); + }); + } else { + it('should work over an HTTPS proxy'); + } + + }); + +}); |