commit 706c07fa1d069290992bd31d53b0c89324992f9c
parent c3ca556affe2f514aeb7fd052fe6d626d9319e99
Author: Florian Dold <florian.dold@gmail.com>
Date: Thu, 28 Nov 2019 00:46:34 +0100
implement JS-only Taler, remove emscripten
Diffstat:
28 files changed, 3612 insertions(+), 5703 deletions(-)
diff --git a/emscripten/README b/emscripten/README
@@ -1,4 +0,0 @@
-The taler-emscripten-lib.js is compiled from C using emscripten.
-
-See https://git.taler.net/libtalerutil-emscripten.git for automated build
-instructions and the functions exported from this module.
diff --git a/emscripten/taler-emscripten-lib.js b/emscripten/taler-emscripten-lib.js
@@ -1,21 +0,0 @@
-
-var TalerEmscriptenLib = (function() {
- var _scriptDir = typeof document !== 'undefined' && document.currentScript ? document.currentScript.src : undefined;
- return (
-function(TalerEmscriptenLib) {
- TalerEmscriptenLib = TalerEmscriptenLib || {};
-
-var Module=typeof TalerEmscriptenLib!=="undefined"?TalerEmscriptenLib:{};var moduleOverrides={};var key;for(key in Module){if(Module.hasOwnProperty(key)){moduleOverrides[key]=Module[key]}}var arguments_=[];var thisProgram="./this.program";var quit_=function(status,toThrow){throw toThrow};var ENVIRONMENT_IS_WEB=false;var ENVIRONMENT_IS_WORKER=false;var ENVIRONMENT_IS_NODE=false;var ENVIRONMENT_HAS_NODE=false;var ENVIRONMENT_IS_SHELL=false;ENVIRONMENT_IS_WEB=typeof window==="object";ENVIRONMENT_IS_WORKER=typeof importScripts==="function";ENVIRONMENT_HAS_NODE=typeof process==="object"&&typeof process.versions==="object"&&typeof process.versions.node==="string";ENVIRONMENT_IS_NODE=ENVIRONMENT_HAS_NODE&&!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_WORKER;ENVIRONMENT_IS_SHELL=!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_NODE&&!ENVIRONMENT_IS_WORKER;if(Module["ENVIRONMENT"]){throw new Error("Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -s ENVIRONMENT=web or -s ENVIRONMENT=node)")}var scriptDirectory="";function locateFile(path){if(Module["locateFile"]){return Module["locateFile"](path,scriptDirectory)}return scriptDirectory+path}var read_,readAsync,readBinary,setWindowTitle;if(ENVIRONMENT_IS_NODE){scriptDirectory=__dirname+"/";var nodeFS;var nodePath;read_=function shell_read(filename,binary){var ret;if(!nodeFS)nodeFS=require("fs");if(!nodePath)nodePath=require("path");filename=nodePath["normalize"](filename);ret=nodeFS["readFileSync"](filename);return binary?ret:ret.toString()};readBinary=function readBinary(filename){var ret=read_(filename,true);if(!ret.buffer){ret=new Uint8Array(ret)}assert(ret.buffer);return ret};if(process["argv"].length>1){thisProgram=process["argv"][1].replace(/\\/g,"/")}arguments_=process["argv"].slice(2);process["on"]("uncaughtException",function(ex){if(!(ex instanceof ExitStatus)){throw ex}});process["on"]("unhandledRejection",abort);quit_=function(status){process["exit"](status)};Module["inspect"]=function(){return"[Emscripten Module object]"}}else if(ENVIRONMENT_IS_SHELL){if(typeof read!="undefined"){read_=function shell_read(f){return read(f)}}readBinary=function readBinary(f){var data;if(typeof readbuffer==="function"){return new Uint8Array(readbuffer(f))}data=read(f,"binary");assert(typeof data==="object");return data};if(typeof scriptArgs!="undefined"){arguments_=scriptArgs}else if(typeof arguments!="undefined"){arguments_=arguments}if(typeof quit==="function"){quit_=function(status){quit(status)}}if(typeof print!=="undefined"){if(typeof console==="undefined")console={};console.log=print;console.warn=console.error=typeof printErr!=="undefined"?printErr:print}}else if(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER){if(ENVIRONMENT_IS_WORKER){scriptDirectory=self.location.href}else if(document.currentScript){scriptDirectory=document.currentScript.src}if(_scriptDir){scriptDirectory=_scriptDir}if(scriptDirectory.indexOf("blob:")!==0){scriptDirectory=scriptDirectory.substr(0,scriptDirectory.lastIndexOf("/")+1)}else{scriptDirectory=""}read_=function shell_read(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.send(null);return xhr.responseText};if(ENVIRONMENT_IS_WORKER){readBinary=function readBinary(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.responseType="arraybuffer";xhr.send(null);return new Uint8Array(xhr.response)}}readAsync=function readAsync(url,onload,onerror){var xhr=new XMLHttpRequest;xhr.open("GET",url,true);xhr.responseType="arraybuffer";xhr.onload=function xhr_onload(){if(xhr.status==200||xhr.status==0&&xhr.response){onload(xhr.response);return}onerror()};xhr.onerror=onerror;xhr.send(null)};setWindowTitle=function(title){document.title=title}}else{throw new Error("environment detection error")}var out=Module["print"]||console.log.bind(console);var err=Module["printErr"]||console.warn.bind(console);for(key in moduleOverrides){if(moduleOverrides.hasOwnProperty(key)){Module[key]=moduleOverrides[key]}}moduleOverrides=null;if(Module["arguments"])arguments_=Module["arguments"];if(!Object.getOwnPropertyDescriptor(Module,"arguments"))Object.defineProperty(Module,"arguments",{get:function(){abort("Module.arguments has been replaced with plain arguments_")}});if(Module["thisProgram"])thisProgram=Module["thisProgram"];if(!Object.getOwnPropertyDescriptor(Module,"thisProgram"))Object.defineProperty(Module,"thisProgram",{get:function(){abort("Module.thisProgram has been replaced with plain thisProgram")}});if(Module["quit"])quit_=Module["quit"];if(!Object.getOwnPropertyDescriptor(Module,"quit"))Object.defineProperty(Module,"quit",{get:function(){abort("Module.quit has been replaced with plain quit_")}});assert(typeof Module["memoryInitializerPrefixURL"]==="undefined","Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead");assert(typeof Module["pthreadMainPrefixURL"]==="undefined","Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead");assert(typeof Module["cdInitializerPrefixURL"]==="undefined","Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead");assert(typeof Module["filePackagePrefixURL"]==="undefined","Module.filePackagePrefixURL option was removed, use Module.locateFile instead");assert(typeof Module["read"]==="undefined","Module.read option was removed (modify read_ in JS)");assert(typeof Module["readAsync"]==="undefined","Module.readAsync option was removed (modify readAsync in JS)");assert(typeof Module["readBinary"]==="undefined","Module.readBinary option was removed (modify readBinary in JS)");assert(typeof Module["setWindowTitle"]==="undefined","Module.setWindowTitle option was removed (modify setWindowTitle in JS)");if(!Object.getOwnPropertyDescriptor(Module,"read"))Object.defineProperty(Module,"read",{get:function(){abort("Module.read has been replaced with plain read_")}});if(!Object.getOwnPropertyDescriptor(Module,"readAsync"))Object.defineProperty(Module,"readAsync",{get:function(){abort("Module.readAsync has been replaced with plain readAsync")}});if(!Object.getOwnPropertyDescriptor(Module,"readBinary"))Object.defineProperty(Module,"readBinary",{get:function(){abort("Module.readBinary has been replaced with plain readBinary")}});stackSave=stackRestore=stackAlloc=function(){abort("cannot use the stack before compiled code is ready to run, and has provided stack access")};function dynamicAlloc(size){assert(DYNAMICTOP_PTR);var ret=HEAP32[DYNAMICTOP_PTR>>2];var end=ret+size+15&-16;if(end>_emscripten_get_heap_size()){abort("failure to dynamicAlloc - memory growth etc. is not supported there, call malloc/sbrk directly")}HEAP32[DYNAMICTOP_PTR>>2]=end;return ret}function getNativeTypeSize(type){switch(type){case"i1":case"i8":return 1;case"i16":return 2;case"i32":return 4;case"i64":return 8;case"float":return 4;case"double":return 8;default:{if(type[type.length-1]==="*"){return 4}else if(type[0]==="i"){var bits=parseInt(type.substr(1));assert(bits%8===0,"getNativeTypeSize invalid bits "+bits+", type "+type);return bits/8}else{return 0}}}}function warnOnce(text){if(!warnOnce.shown)warnOnce.shown={};if(!warnOnce.shown[text]){warnOnce.shown[text]=1;err(text)}}var asm2wasmImports={"f64-rem":function(x,y){return x%y},"debugger":function(){debugger}};var functionPointers=new Array(0);var tempRet0=0;var setTempRet0=function(value){tempRet0=value};var wasmBinary;if(Module["wasmBinary"])wasmBinary=Module["wasmBinary"];if(!Object.getOwnPropertyDescriptor(Module,"wasmBinary"))Object.defineProperty(Module,"wasmBinary",{get:function(){abort("Module.wasmBinary has been replaced with plain wasmBinary")}});if(typeof WebAssembly!=="object"){abort("No WebAssembly support found. Build with -s WASM=0 to target JavaScript instead.")}function setValue(ptr,value,type,noSafe){type=type||"i8";if(type.charAt(type.length-1)==="*")type="i32";switch(type){case"i1":HEAP8[ptr>>0]=value;break;case"i8":HEAP8[ptr>>0]=value;break;case"i16":HEAP16[ptr>>1]=value;break;case"i32":HEAP32[ptr>>2]=value;break;case"i64":tempI64=[value>>>0,(tempDouble=value,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[ptr>>2]=tempI64[0],HEAP32[ptr+4>>2]=tempI64[1];break;case"float":HEAPF32[ptr>>2]=value;break;case"double":HEAPF64[ptr>>3]=value;break;default:abort("invalid type for setValue: "+type)}}function getValue(ptr,type,noSafe){type=type||"i8";if(type.charAt(type.length-1)==="*")type="i32";switch(type){case"i1":return HEAP8[ptr>>0];case"i8":return HEAP8[ptr>>0];case"i16":return HEAP16[ptr>>1];case"i32":return HEAP32[ptr>>2];case"i64":return HEAP32[ptr>>2];case"float":return HEAPF32[ptr>>2];case"double":return HEAPF64[ptr>>3];default:abort("invalid type for getValue: "+type)}return null}var wasmMemory;var wasmTable;var ABORT=false;var EXITSTATUS=0;function assert(condition,text){if(!condition){abort("Assertion failed: "+text)}}function getCFunc(ident){var func=Module["_"+ident];assert(func,"Cannot call unknown function "+ident+", make sure it is exported");return func}function ccall(ident,returnType,argTypes,args,opts){var toC={"string":function(str){var ret=0;if(str!==null&&str!==undefined&&str!==0){var len=(str.length<<2)+1;ret=stackAlloc(len);stringToUTF8(str,ret,len)}return ret},"array":function(arr){var ret=stackAlloc(arr.length);writeArrayToMemory(arr,ret);return ret}};function convertReturnValue(ret){if(returnType==="string")return UTF8ToString(ret);if(returnType==="boolean")return Boolean(ret);return ret}var func=getCFunc(ident);var cArgs=[];var stack=0;assert(returnType!=="array",'Return type should not be "array".');if(args){for(var i=0;i<args.length;i++){var converter=toC[argTypes[i]];if(converter){if(stack===0)stack=stackSave();cArgs[i]=converter(args[i])}else{cArgs[i]=args[i]}}}var ret=func.apply(null,cArgs);assert(!(opts&&opts.async),"async call is only supported with Emterpretify for now, see #9029");ret=convertReturnValue(ret);if(stack!==0)stackRestore(stack);return ret}function cwrap(ident,returnType,argTypes,opts){return function(){return ccall(ident,returnType,argTypes,arguments,opts)}}var ALLOC_NORMAL=0;var ALLOC_NONE=3;function allocate(slab,types,allocator,ptr){var zeroinit,size;if(typeof slab==="number"){zeroinit=true;size=slab}else{zeroinit=false;size=slab.length}var singleType=typeof types==="string"?types:null;var ret;if(allocator==ALLOC_NONE){ret=ptr}else{ret=[_malloc,stackAlloc,dynamicAlloc][allocator](Math.max(size,singleType?1:types.length))}if(zeroinit){var stop;ptr=ret;assert((ret&3)==0);stop=ret+(size&~3);for(;ptr<stop;ptr+=4){HEAP32[ptr>>2]=0}stop=ret+size;while(ptr<stop){HEAP8[ptr++>>0]=0}return ret}if(singleType==="i8"){if(slab.subarray||slab.slice){HEAPU8.set(slab,ret)}else{HEAPU8.set(new Uint8Array(slab),ret)}return ret}var i=0,type,typeSize,previousType;while(i<size){var curr=slab[i];type=singleType||types[i];if(type===0){i++;continue}assert(type,"Must know what type to store in allocate!");if(type=="i64")type="i32";setValue(ret+i,curr,type);if(previousType!==type){typeSize=getNativeTypeSize(type);previousType=type}i+=typeSize}return ret}function getMemory(size){if(!runtimeInitialized)return dynamicAlloc(size);return _malloc(size)}var UTF8Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf8"):undefined;function UTF8ArrayToString(u8Array,idx,maxBytesToRead){var endIdx=idx+maxBytesToRead;var endPtr=idx;while(u8Array[endPtr]&&!(endPtr>=endIdx))++endPtr;if(endPtr-idx>16&&u8Array.subarray&&UTF8Decoder){return UTF8Decoder.decode(u8Array.subarray(idx,endPtr))}else{var str="";while(idx<endPtr){var u0=u8Array[idx++];if(!(u0&128)){str+=String.fromCharCode(u0);continue}var u1=u8Array[idx++]&63;if((u0&224)==192){str+=String.fromCharCode((u0&31)<<6|u1);continue}var u2=u8Array[idx++]&63;if((u0&240)==224){u0=(u0&15)<<12|u1<<6|u2}else{if((u0&248)!=240)warnOnce("Invalid UTF-8 leading byte 0x"+u0.toString(16)+" encountered when deserializing a UTF-8 string on the asm.js/wasm heap to a JS string!");u0=(u0&7)<<18|u1<<12|u2<<6|u8Array[idx++]&63}if(u0<65536){str+=String.fromCharCode(u0)}else{var ch=u0-65536;str+=String.fromCharCode(55296|ch>>10,56320|ch&1023)}}}return str}function UTF8ToString(ptr,maxBytesToRead){return ptr?UTF8ArrayToString(HEAPU8,ptr,maxBytesToRead):""}function stringToUTF8Array(str,outU8Array,outIdx,maxBytesToWrite){if(!(maxBytesToWrite>0))return 0;var startIdx=outIdx;var endIdx=outIdx+maxBytesToWrite-1;for(var i=0;i<str.length;++i){var u=str.charCodeAt(i);if(u>=55296&&u<=57343){var u1=str.charCodeAt(++i);u=65536+((u&1023)<<10)|u1&1023}if(u<=127){if(outIdx>=endIdx)break;outU8Array[outIdx++]=u}else if(u<=2047){if(outIdx+1>=endIdx)break;outU8Array[outIdx++]=192|u>>6;outU8Array[outIdx++]=128|u&63}else if(u<=65535){if(outIdx+2>=endIdx)break;outU8Array[outIdx++]=224|u>>12;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else{if(outIdx+3>=endIdx)break;if(u>=2097152)warnOnce("Invalid Unicode code point 0x"+u.toString(16)+" encountered when serializing a JS string to an UTF-8 string on the asm.js/wasm heap! (Valid unicode code points should be in range 0-0x1FFFFF).");outU8Array[outIdx++]=240|u>>18;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}}outU8Array[outIdx]=0;return outIdx-startIdx}function stringToUTF8(str,outPtr,maxBytesToWrite){assert(typeof maxBytesToWrite=="number","stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!");return stringToUTF8Array(str,HEAPU8,outPtr,maxBytesToWrite)}function lengthBytesUTF8(str){var len=0;for(var i=0;i<str.length;++i){var u=str.charCodeAt(i);if(u>=55296&&u<=57343)u=65536+((u&1023)<<10)|str.charCodeAt(++i)&1023;if(u<=127)++len;else if(u<=2047)len+=2;else if(u<=65535)len+=3;else len+=4}return len}var UTF16Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf-16le"):undefined;function allocateUTF8(str){var size=lengthBytesUTF8(str)+1;var ret=_malloc(size);if(ret)stringToUTF8Array(str,HEAP8,ret,size);return ret}function writeArrayToMemory(array,buffer){assert(array.length>=0,"writeArrayToMemory array must have a length (should be an array or typed array)");HEAP8.set(array,buffer)}function writeAsciiToMemory(str,buffer,dontAddNull){for(var i=0;i<str.length;++i){assert(str.charCodeAt(i)===str.charCodeAt(i)&255);HEAP8[buffer++>>0]=str.charCodeAt(i)}if(!dontAddNull)HEAP8[buffer>>0]=0}var PAGE_SIZE=16384;var WASM_PAGE_SIZE=65536;var buffer,HEAP8,HEAPU8,HEAP16,HEAPU16,HEAP32,HEAPU32,HEAPF32,HEAPF64;function updateGlobalBufferViews(){Module["HEAP8"]=HEAP8=new Int8Array(buffer);Module["HEAP16"]=HEAP16=new Int16Array(buffer);Module["HEAP32"]=HEAP32=new Int32Array(buffer);Module["HEAPU8"]=HEAPU8=new Uint8Array(buffer);Module["HEAPU16"]=HEAPU16=new Uint16Array(buffer);Module["HEAPU32"]=HEAPU32=new Uint32Array(buffer);Module["HEAPF32"]=HEAPF32=new Float32Array(buffer);Module["HEAPF64"]=HEAPF64=new Float64Array(buffer)}var STACK_BASE=75824,STACK_MAX=5318704,DYNAMIC_BASE=5318704,DYNAMICTOP_PTR=75792;assert(STACK_BASE%16===0,"stack must start aligned");assert(DYNAMIC_BASE%16===0,"heap must start aligned");var TOTAL_STACK=5242880;if(Module["TOTAL_STACK"])assert(TOTAL_STACK===Module["TOTAL_STACK"],"the stack size can no longer be determined at runtime");var INITIAL_TOTAL_MEMORY=Module["TOTAL_MEMORY"]||16777216;if(!Object.getOwnPropertyDescriptor(Module,"TOTAL_MEMORY"))Object.defineProperty(Module,"TOTAL_MEMORY",{get:function(){abort("Module.TOTAL_MEMORY has been replaced with plain INITIAL_TOTAL_MEMORY")}});assert(INITIAL_TOTAL_MEMORY>=TOTAL_STACK,"TOTAL_MEMORY should be larger than TOTAL_STACK, was "+INITIAL_TOTAL_MEMORY+"! (TOTAL_STACK="+TOTAL_STACK+")");assert(typeof Int32Array!=="undefined"&&typeof Float64Array!=="undefined"&&Int32Array.prototype.subarray!==undefined&&Int32Array.prototype.set!==undefined,"JS engine does not provide full typed array support");if(Module["wasmMemory"]){wasmMemory=Module["wasmMemory"]}else{wasmMemory=new WebAssembly.Memory({"initial":INITIAL_TOTAL_MEMORY/WASM_PAGE_SIZE,"maximum":INITIAL_TOTAL_MEMORY/WASM_PAGE_SIZE})}if(wasmMemory){buffer=wasmMemory.buffer}INITIAL_TOTAL_MEMORY=buffer.byteLength;assert(INITIAL_TOTAL_MEMORY%WASM_PAGE_SIZE===0);updateGlobalBufferViews();HEAP32[DYNAMICTOP_PTR>>2]=DYNAMIC_BASE;function writeStackCookie(){assert((STACK_MAX&3)==0);HEAPU32[(STACK_MAX>>2)-1]=34821223;HEAPU32[(STACK_MAX>>2)-2]=2310721022}function checkStackCookie(){var cookie1=HEAPU32[(STACK_MAX>>2)-1];var cookie2=HEAPU32[(STACK_MAX>>2)-2];if(cookie1!=34821223||cookie2!=2310721022){abort("Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x"+cookie2.toString(16)+" "+cookie1.toString(16))}if(HEAP32[0]!==1668509029)abort("Runtime error: The application has corrupted its heap memory area (address zero)!")}function abortStackOverflow(allocSize){abort("Stack overflow! Attempted to allocate "+allocSize+" bytes on the stack, but stack has only "+(STACK_MAX-stackSave()+allocSize)+" bytes available!")}HEAP32[0]=1668509029;HEAP16[1]=25459;if(HEAPU8[2]!==115||HEAPU8[3]!==99)throw"Runtime error: expected the system to be little-endian!";function abortFnPtrError(ptr,sig){abort("Invalid function pointer "+ptr+" called with signature '"+sig+"'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this). Build with ASSERTIONS=2 for more info.")}function callRuntimeCallbacks(callbacks){while(callbacks.length>0){var callback=callbacks.shift();if(typeof callback=="function"){callback();continue}var func=callback.func;if(typeof func==="number"){if(callback.arg===undefined){Module["dynCall_v"](func)}else{Module["dynCall_vi"](func,callback.arg)}}else{func(callback.arg===undefined?null:callback.arg)}}}var __ATPRERUN__=[];var __ATINIT__=[];var __ATMAIN__=[];var __ATEXIT__=[];var __ATPOSTRUN__=[];var runtimeInitialized=false;var runtimeExited=false;function preRun(){if(Module["preRun"]){if(typeof Module["preRun"]=="function")Module["preRun"]=[Module["preRun"]];while(Module["preRun"].length){addOnPreRun(Module["preRun"].shift())}}callRuntimeCallbacks(__ATPRERUN__)}function initRuntime(){checkStackCookie();assert(!runtimeInitialized);runtimeInitialized=true;if(!Module["noFSInit"]&&!FS.init.initialized)FS.init();TTY.init();callRuntimeCallbacks(__ATINIT__)}function preMain(){checkStackCookie();FS.ignorePermissions=false;callRuntimeCallbacks(__ATMAIN__)}function postRun(){checkStackCookie();if(Module["postRun"]){if(typeof Module["postRun"]=="function")Module["postRun"]=[Module["postRun"]];while(Module["postRun"].length){addOnPostRun(Module["postRun"].shift())}}callRuntimeCallbacks(__ATPOSTRUN__)}function addOnPreRun(cb){__ATPRERUN__.unshift(cb)}function addOnPostRun(cb){__ATPOSTRUN__.unshift(cb)}assert(Math.imul,"This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");assert(Math.fround,"This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");assert(Math.clz32,"This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");assert(Math.trunc,"This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");var Math_abs=Math.abs;var Math_ceil=Math.ceil;var Math_floor=Math.floor;var Math_min=Math.min;var runDependencies=0;var runDependencyWatcher=null;var dependenciesFulfilled=null;var runDependencyTracking={};function getUniqueRunDependency(id){var orig=id;while(1){if(!runDependencyTracking[id])return id;id=orig+Math.random()}return id}function addRunDependency(id){runDependencies++;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}if(id){assert(!runDependencyTracking[id]);runDependencyTracking[id]=1;if(runDependencyWatcher===null&&typeof setInterval!=="undefined"){runDependencyWatcher=setInterval(function(){if(ABORT){clearInterval(runDependencyWatcher);runDependencyWatcher=null;return}var shown=false;for(var dep in runDependencyTracking){if(!shown){shown=true;err("still waiting on run dependencies:")}err("dependency: "+dep)}if(shown){err("(end of list)")}},1e4)}}else{err("warning: run dependency added without ID")}}function removeRunDependency(id){runDependencies--;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}if(id){assert(runDependencyTracking[id]);delete runDependencyTracking[id]}else{err("warning: run dependency removed without ID")}if(runDependencies==0){if(runDependencyWatcher!==null){clearInterval(runDependencyWatcher);runDependencyWatcher=null}if(dependenciesFulfilled){var callback=dependenciesFulfilled;dependenciesFulfilled=null;callback()}}}Module["preloadedImages"]={};Module["preloadedAudios"]={};var dataURIPrefix="data:application/octet-stream;base64,";function isDataURI(filename){return String.prototype.startsWith?filename.startsWith(dataURIPrefix):filename.indexOf(dataURIPrefix)===0}var wasmBinaryFile="taler-emscripten-lib.wasm";if(!isDataURI(wasmBinaryFile)){wasmBinaryFile=locateFile(wasmBinaryFile)}function getBinary(){try{if(wasmBinary){return new Uint8Array(wasmBinary)}if(readBinary){return readBinary(wasmBinaryFile)}else{throw"both async and sync fetching of the wasm failed"}}catch(err){abort(err)}}function getBinaryPromise(){if(!wasmBinary&&(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER)&&typeof fetch==="function"){return fetch(wasmBinaryFile,{credentials:"same-origin"}).then(function(response){if(!response["ok"]){throw"failed to load wasm binary file at '"+wasmBinaryFile+"'"}return response["arrayBuffer"]()}).catch(function(){return getBinary()})}return new Promise(function(resolve,reject){resolve(getBinary())})}function createWasm(env){var info={"env":env,"global":{"NaN":NaN,Infinity:Infinity},"global.Math":Math,"asm2wasm":asm2wasmImports};function receiveInstance(instance,module){var exports=instance.exports;Module["asm"]=exports;removeRunDependency("wasm-instantiate")}addRunDependency("wasm-instantiate");var trueModule=Module;function receiveInstantiatedSource(output){assert(Module===trueModule,"the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?");trueModule=null;receiveInstance(output["instance"])}function instantiateArrayBuffer(receiver){return getBinaryPromise().then(function(binary){return WebAssembly.instantiate(binary,info)}).then(receiver,function(reason){err("failed to asynchronously prepare wasm: "+reason);abort(reason)})}function instantiateAsync(){if(!wasmBinary&&typeof WebAssembly.instantiateStreaming==="function"&&!isDataURI(wasmBinaryFile)&&typeof fetch==="function"){fetch(wasmBinaryFile,{credentials:"same-origin"}).then(function(response){var result=WebAssembly.instantiateStreaming(response,info);return result.then(receiveInstantiatedSource,function(reason){err("wasm streaming compile failed: "+reason);err("falling back to ArrayBuffer instantiation");instantiateArrayBuffer(receiveInstantiatedSource)})})}else{return instantiateArrayBuffer(receiveInstantiatedSource)}}if(Module["instantiateWasm"]){try{var exports=Module["instantiateWasm"](info,receiveInstance);return exports}catch(e){err("Module.instantiateWasm callback failed with error: "+e);return false}}instantiateAsync();return{}}Module["asm"]=function(global,env,providedBuffer){env["memory"]=wasmMemory;env["table"]=wasmTable=new WebAssembly.Table({"initial":152,"maximum":152,"element":"anyfunc"});env["__memory_base"]=1024;env["__table_base"]=0;var exports=createWasm(env);assert(exports,"binaryen setup failed (no wasm support?)");return exports};var tempDouble;var tempI64;__ATINIT__.push({func:function(){globalCtors()}});var tempDoublePtr=75808;assert(tempDoublePtr%8==0);function demangle(func){warnOnce("warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling");return func}function demangleAll(text){var regex=/__Z[\w\d_]+/g;return text.replace(regex,function(x){var y=demangle(x);return x===y?x:y+" ["+x+"]"})}function jsStackTrace(){var err=new Error;if(!err.stack){try{throw new Error(0)}catch(e){err=e}if(!err.stack){return"(no stack trace available)"}}return err.stack.toString()}function stackTrace(){var js=jsStackTrace();if(Module["extraStackTrace"])js+="\n"+Module["extraStackTrace"]();return demangleAll(js)}function ___assert_fail(condition,filename,line,func){abort("Assertion failed: "+UTF8ToString(condition)+", at: "+[filename?UTF8ToString(filename):"unknown filename",line,func?UTF8ToString(func):"unknown function"])}var ENV={};function ___buildEnvironment(environ){var MAX_ENV_VALUES=64;var TOTAL_ENV_SIZE=1024;var poolPtr;var envPtr;if(!___buildEnvironment.called){___buildEnvironment.called=true;ENV["USER"]=ENV["LOGNAME"]="web_user";ENV["PATH"]="/";ENV["PWD"]="/";ENV["HOME"]="/home/web_user";ENV["LANG"]="C.UTF-8";ENV["LANG"]=(typeof navigator==="object"&&navigator.languages&&navigator.languages[0]||"C").replace("-","_")+".UTF-8";ENV["_"]=thisProgram;poolPtr=getMemory(TOTAL_ENV_SIZE);envPtr=getMemory(MAX_ENV_VALUES*4);HEAP32[envPtr>>2]=poolPtr;HEAP32[environ>>2]=envPtr}else{envPtr=HEAP32[environ>>2];poolPtr=HEAP32[envPtr>>2]}var strings=[];var totalSize=0;for(var key in ENV){if(typeof ENV[key]==="string"){var line=key+"="+ENV[key];strings.push(line);totalSize+=line.length}}if(totalSize>TOTAL_ENV_SIZE){throw new Error("Environment size exceeded TOTAL_ENV_SIZE!")}var ptrSize=4;for(var i=0;i<strings.length;i++){var line=strings[i];writeAsciiToMemory(line,poolPtr);HEAP32[envPtr+i*ptrSize>>2]=poolPtr;poolPtr+=line.length+1}HEAP32[envPtr+strings.length*ptrSize>>2]=0}function ___lock(){}var PATH={splitPath:function(filename){var splitPathRe=/^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;return splitPathRe.exec(filename).slice(1)},normalizeArray:function(parts,allowAboveRoot){var up=0;for(var i=parts.length-1;i>=0;i--){var last=parts[i];if(last==="."){parts.splice(i,1)}else if(last===".."){parts.splice(i,1);up++}else if(up){parts.splice(i,1);up--}}if(allowAboveRoot){for(;up;up--){parts.unshift("..")}}return parts},normalize:function(path){var isAbsolute=path.charAt(0)==="/",trailingSlash=path.substr(-1)==="/";path=PATH.normalizeArray(path.split("/").filter(function(p){return!!p}),!isAbsolute).join("/");if(!path&&!isAbsolute){path="."}if(path&&trailingSlash){path+="/"}return(isAbsolute?"/":"")+path},dirname:function(path){var result=PATH.splitPath(path),root=result[0],dir=result[1];if(!root&&!dir){return"."}if(dir){dir=dir.substr(0,dir.length-1)}return root+dir},basename:function(path){if(path==="/")return"/";var lastSlash=path.lastIndexOf("/");if(lastSlash===-1)return path;return path.substr(lastSlash+1)},extname:function(path){return PATH.splitPath(path)[3]},join:function(){var paths=Array.prototype.slice.call(arguments,0);return PATH.normalize(paths.join("/"))},join2:function(l,r){return PATH.normalize(l+"/"+r)}};function ___setErrNo(value){if(Module["___errno_location"])HEAP32[Module["___errno_location"]()>>2]=value;else err("failed to set errno from JS");return value}var PATH_FS={resolve:function(){var resolvedPath="",resolvedAbsolute=false;for(var i=arguments.length-1;i>=-1&&!resolvedAbsolute;i--){var path=i>=0?arguments[i]:FS.cwd();if(typeof path!=="string"){throw new TypeError("Arguments to path.resolve must be strings")}else if(!path){return""}resolvedPath=path+"/"+resolvedPath;resolvedAbsolute=path.charAt(0)==="/"}resolvedPath=PATH.normalizeArray(resolvedPath.split("/").filter(function(p){return!!p}),!resolvedAbsolute).join("/");return(resolvedAbsolute?"/":"")+resolvedPath||"."},relative:function(from,to){from=PATH_FS.resolve(from).substr(1);to=PATH_FS.resolve(to).substr(1);function trim(arr){var start=0;for(;start<arr.length;start++){if(arr[start]!=="")break}var end=arr.length-1;for(;end>=0;end--){if(arr[end]!=="")break}if(start>end)return[];return arr.slice(start,end-start+1)}var fromParts=trim(from.split("/"));var toParts=trim(to.split("/"));var length=Math.min(fromParts.length,toParts.length);var samePartsLength=length;for(var i=0;i<length;i++){if(fromParts[i]!==toParts[i]){samePartsLength=i;break}}var outputParts=[];for(var i=samePartsLength;i<fromParts.length;i++){outputParts.push("..")}outputParts=outputParts.concat(toParts.slice(samePartsLength));return outputParts.join("/")}};var TTY={ttys:[],init:function(){},shutdown:function(){},register:function(dev,ops){TTY.ttys[dev]={input:[],output:[],ops:ops};FS.registerDevice(dev,TTY.stream_ops)},stream_ops:{open:function(stream){var tty=TTY.ttys[stream.node.rdev];if(!tty){throw new FS.ErrnoError(19)}stream.tty=tty;stream.seekable=false},close:function(stream){stream.tty.ops.flush(stream.tty)},flush:function(stream){stream.tty.ops.flush(stream.tty)},read:function(stream,buffer,offset,length,pos){if(!stream.tty||!stream.tty.ops.get_char){throw new FS.ErrnoError(6)}var bytesRead=0;for(var i=0;i<length;i++){var result;try{result=stream.tty.ops.get_char(stream.tty)}catch(e){throw new FS.ErrnoError(5)}if(result===undefined&&bytesRead===0){throw new FS.ErrnoError(11)}if(result===null||result===undefined)break;bytesRead++;buffer[offset+i]=result}if(bytesRead){stream.node.timestamp=Date.now()}return bytesRead},write:function(stream,buffer,offset,length,pos){if(!stream.tty||!stream.tty.ops.put_char){throw new FS.ErrnoError(6)}try{for(var i=0;i<length;i++){stream.tty.ops.put_char(stream.tty,buffer[offset+i])}}catch(e){throw new FS.ErrnoError(5)}if(length){stream.node.timestamp=Date.now()}return i}},default_tty_ops:{get_char:function(tty){if(!tty.input.length){var result=null;if(ENVIRONMENT_IS_NODE){var BUFSIZE=256;var buf=Buffer.alloc?Buffer.alloc(BUFSIZE):new Buffer(BUFSIZE);var bytesRead=0;var isPosixPlatform=process.platform!="win32";var fd=process.stdin.fd;if(isPosixPlatform){var usingDevice=false;try{fd=fs.openSync("/dev/stdin","r");usingDevice=true}catch(e){}}try{bytesRead=fs.readSync(fd,buf,0,BUFSIZE,null)}catch(e){if(e.toString().indexOf("EOF")!=-1)bytesRead=0;else throw e}if(usingDevice){fs.closeSync(fd)}if(bytesRead>0){result=buf.slice(0,bytesRead).toString("utf-8")}else{result=null}}else if(typeof window!="undefined"&&typeof window.prompt=="function"){result=window.prompt("Input: ");if(result!==null){result+="\n"}}else if(typeof readline=="function"){result=readline();if(result!==null){result+="\n"}}if(!result){return null}tty.input=intArrayFromString(result,true)}return tty.input.shift()},put_char:function(tty,val){if(val===null||val===10){out(UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}},flush:function(tty){if(tty.output&&tty.output.length>0){out(UTF8ArrayToString(tty.output,0));tty.output=[]}}},default_tty1_ops:{put_char:function(tty,val){if(val===null||val===10){err(UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}},flush:function(tty){if(tty.output&&tty.output.length>0){err(UTF8ArrayToString(tty.output,0));tty.output=[]}}}};var MEMFS={ops_table:null,mount:function(mount){return MEMFS.createNode(null,"/",16384|511,0)},createNode:function(parent,name,mode,dev){if(FS.isBlkdev(mode)||FS.isFIFO(mode)){throw new FS.ErrnoError(1)}if(!MEMFS.ops_table){MEMFS.ops_table={dir:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,lookup:MEMFS.node_ops.lookup,mknod:MEMFS.node_ops.mknod,rename:MEMFS.node_ops.rename,unlink:MEMFS.node_ops.unlink,rmdir:MEMFS.node_ops.rmdir,readdir:MEMFS.node_ops.readdir,symlink:MEMFS.node_ops.symlink},stream:{llseek:MEMFS.stream_ops.llseek}},file:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:{llseek:MEMFS.stream_ops.llseek,read:MEMFS.stream_ops.read,write:MEMFS.stream_ops.write,allocate:MEMFS.stream_ops.allocate,mmap:MEMFS.stream_ops.mmap,msync:MEMFS.stream_ops.msync}},link:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,readlink:MEMFS.node_ops.readlink},stream:{}},chrdev:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:FS.chrdev_stream_ops}}}var node=FS.createNode(parent,name,mode,dev);if(FS.isDir(node.mode)){node.node_ops=MEMFS.ops_table.dir.node;node.stream_ops=MEMFS.ops_table.dir.stream;node.contents={}}else if(FS.isFile(node.mode)){node.node_ops=MEMFS.ops_table.file.node;node.stream_ops=MEMFS.ops_table.file.stream;node.usedBytes=0;node.contents=null}else if(FS.isLink(node.mode)){node.node_ops=MEMFS.ops_table.link.node;node.stream_ops=MEMFS.ops_table.link.stream}else if(FS.isChrdev(node.mode)){node.node_ops=MEMFS.ops_table.chrdev.node;node.stream_ops=MEMFS.ops_table.chrdev.stream}node.timestamp=Date.now();if(parent){parent.contents[name]=node}return node},getFileDataAsRegularArray:function(node){if(node.contents&&node.contents.subarray){var arr=[];for(var i=0;i<node.usedBytes;++i)arr.push(node.contents[i]);return arr}return node.contents},getFileDataAsTypedArray:function(node){if(!node.contents)return new Uint8Array;if(node.contents.subarray)return node.contents.subarray(0,node.usedBytes);return new Uint8Array(node.contents)},expandFileStorage:function(node,newCapacity){var prevCapacity=node.contents?node.contents.length:0;if(prevCapacity>=newCapacity)return;var CAPACITY_DOUBLING_MAX=1024*1024;newCapacity=Math.max(newCapacity,prevCapacity*(prevCapacity<CAPACITY_DOUBLING_MAX?2:1.125)|0);if(prevCapacity!=0)newCapacity=Math.max(newCapacity,256);var oldContents=node.contents;node.contents=new Uint8Array(newCapacity);if(node.usedBytes>0)node.contents.set(oldContents.subarray(0,node.usedBytes),0);return},resizeFileStorage:function(node,newSize){if(node.usedBytes==newSize)return;if(newSize==0){node.contents=null;node.usedBytes=0;return}if(!node.contents||node.contents.subarray){var oldContents=node.contents;node.contents=new Uint8Array(new ArrayBuffer(newSize));if(oldContents){node.contents.set(oldContents.subarray(0,Math.min(newSize,node.usedBytes)))}node.usedBytes=newSize;return}if(!node.contents)node.contents=[];if(node.contents.length>newSize)node.contents.length=newSize;else while(node.contents.length<newSize)node.contents.push(0);node.usedBytes=newSize},node_ops:{getattr:function(node){var attr={};attr.dev=FS.isChrdev(node.mode)?node.id:1;attr.ino=node.id;attr.mode=node.mode;attr.nlink=1;attr.uid=0;attr.gid=0;attr.rdev=node.rdev;if(FS.isDir(node.mode)){attr.size=4096}else if(FS.isFile(node.mode)){attr.size=node.usedBytes}else if(FS.isLink(node.mode)){attr.size=node.link.length}else{attr.size=0}attr.atime=new Date(node.timestamp);attr.mtime=new Date(node.timestamp);attr.ctime=new Date(node.timestamp);attr.blksize=4096;attr.blocks=Math.ceil(attr.size/attr.blksize);return attr},setattr:function(node,attr){if(attr.mode!==undefined){node.mode=attr.mode}if(attr.timestamp!==undefined){node.timestamp=attr.timestamp}if(attr.size!==undefined){MEMFS.resizeFileStorage(node,attr.size)}},lookup:function(parent,name){throw FS.genericErrors[2]},mknod:function(parent,name,mode,dev){return MEMFS.createNode(parent,name,mode,dev)},rename:function(old_node,new_dir,new_name){if(FS.isDir(old_node.mode)){var new_node;try{new_node=FS.lookupNode(new_dir,new_name)}catch(e){}if(new_node){for(var i in new_node.contents){throw new FS.ErrnoError(39)}}}delete old_node.parent.contents[old_node.name];old_node.name=new_name;new_dir.contents[new_name]=old_node;old_node.parent=new_dir},unlink:function(parent,name){delete parent.contents[name]},rmdir:function(parent,name){var node=FS.lookupNode(parent,name);for(var i in node.contents){throw new FS.ErrnoError(39)}delete parent.contents[name]},readdir:function(node){var entries=[".",".."];for(var key in node.contents){if(!node.contents.hasOwnProperty(key)){continue}entries.push(key)}return entries},symlink:function(parent,newname,oldpath){var node=MEMFS.createNode(parent,newname,511|40960,0);node.link=oldpath;return node},readlink:function(node){if(!FS.isLink(node.mode)){throw new FS.ErrnoError(22)}return node.link}},stream_ops:{read:function(stream,buffer,offset,length,position){var contents=stream.node.contents;if(position>=stream.node.usedBytes)return 0;var size=Math.min(stream.node.usedBytes-position,length);assert(size>=0);if(size>8&&contents.subarray){buffer.set(contents.subarray(position,position+size),offset)}else{for(var i=0;i<size;i++)buffer[offset+i]=contents[position+i]}return size},write:function(stream,buffer,offset,length,position,canOwn){if(!length)return 0;var node=stream.node;node.timestamp=Date.now();if(buffer.subarray&&(!node.contents||node.contents.subarray)){if(canOwn){assert(position===0,"canOwn must imply no weird position inside the file");node.contents=buffer.subarray(offset,offset+length);node.usedBytes=length;return length}else if(node.usedBytes===0&&position===0){node.contents=new Uint8Array(buffer.subarray(offset,offset+length));node.usedBytes=length;return length}else if(position+length<=node.usedBytes){node.contents.set(buffer.subarray(offset,offset+length),position);return length}}MEMFS.expandFileStorage(node,position+length);if(node.contents.subarray&&buffer.subarray)node.contents.set(buffer.subarray(offset,offset+length),position);else{for(var i=0;i<length;i++){node.contents[position+i]=buffer[offset+i]}}node.usedBytes=Math.max(node.usedBytes,position+length);return length},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){position+=stream.node.usedBytes}}if(position<0){throw new FS.ErrnoError(22)}return position},allocate:function(stream,offset,length){MEMFS.expandFileStorage(stream.node,offset+length);stream.node.usedBytes=Math.max(stream.node.usedBytes,offset+length)},mmap:function(stream,buffer,offset,length,position,prot,flags){if(!FS.isFile(stream.node.mode)){throw new FS.ErrnoError(19)}var ptr;var allocated;var contents=stream.node.contents;if(!(flags&2)&&(contents.buffer===buffer||contents.buffer===buffer.buffer)){allocated=false;ptr=contents.byteOffset}else{if(position>0||position+length<stream.node.usedBytes){if(contents.subarray){contents=contents.subarray(position,position+length)}else{contents=Array.prototype.slice.call(contents,position,position+length)}}allocated=true;var fromHeap=buffer.buffer==HEAP8.buffer;ptr=_malloc(length);if(!ptr){throw new FS.ErrnoError(12)}(fromHeap?HEAP8:buffer).set(contents,ptr)}return{ptr:ptr,allocated:allocated}},msync:function(stream,buffer,offset,length,mmapFlags){if(!FS.isFile(stream.node.mode)){throw new FS.ErrnoError(19)}if(mmapFlags&2){return 0}var bytesWritten=MEMFS.stream_ops.write(stream,buffer,0,length,offset,false);return 0}}};var IDBFS={dbs:{},indexedDB:function(){if(typeof indexedDB!=="undefined")return indexedDB;var ret=null;if(typeof window==="object")ret=window.indexedDB||window.mozIndexedDB||window.webkitIndexedDB||window.msIndexedDB;assert(ret,"IDBFS used, but indexedDB not supported");return ret},DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function(mount){return MEMFS.mount.apply(null,arguments)},syncfs:function(mount,populate,callback){IDBFS.getLocalSet(mount,function(err,local){if(err)return callback(err);IDBFS.getRemoteSet(mount,function(err,remote){if(err)return callback(err);var src=populate?remote:local;var dst=populate?local:remote;IDBFS.reconcile(src,dst,callback)})})},getDB:function(name,callback){var db=IDBFS.dbs[name];if(db){return callback(null,db)}var req;try{req=IDBFS.indexedDB().open(name,IDBFS.DB_VERSION)}catch(e){return callback(e)}if(!req){return callback("Unable to connect to IndexedDB")}req.onupgradeneeded=function(e){var db=e.target.result;var transaction=e.target.transaction;var fileStore;if(db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)){fileStore=transaction.objectStore(IDBFS.DB_STORE_NAME)}else{fileStore=db.createObjectStore(IDBFS.DB_STORE_NAME)}if(!fileStore.indexNames.contains("timestamp")){fileStore.createIndex("timestamp","timestamp",{unique:false})}};req.onsuccess=function(){db=req.result;IDBFS.dbs[name]=db;callback(null,db)};req.onerror=function(e){callback(this.error);e.preventDefault()}},getLocalSet:function(mount,callback){var entries={};function isRealDir(p){return p!=="."&&p!==".."}function toAbsolute(root){return function(p){return PATH.join2(root,p)}}var check=FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));while(check.length){var path=check.pop();var stat;try{stat=FS.stat(path)}catch(e){return callback(e)}if(FS.isDir(stat.mode)){check.push.apply(check,FS.readdir(path).filter(isRealDir).map(toAbsolute(path)))}entries[path]={timestamp:stat.mtime}}return callback(null,{type:"local",entries:entries})},getRemoteSet:function(mount,callback){var entries={};IDBFS.getDB(mount.mountpoint,function(err,db){if(err)return callback(err);try{var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readonly");transaction.onerror=function(e){callback(this.error);e.preventDefault()};var store=transaction.objectStore(IDBFS.DB_STORE_NAME);var index=store.index("timestamp");index.openKeyCursor().onsuccess=function(event){var cursor=event.target.result;if(!cursor){return callback(null,{type:"remote",db:db,entries:entries})}entries[cursor.primaryKey]={timestamp:cursor.key};cursor.continue()}}catch(e){return callback(e)}})},loadLocalEntry:function(path,callback){var stat,node;try{var lookup=FS.lookupPath(path);node=lookup.node;stat=FS.stat(path)}catch(e){return callback(e)}if(FS.isDir(stat.mode)){return callback(null,{timestamp:stat.mtime,mode:stat.mode})}else if(FS.isFile(stat.mode)){node.contents=MEMFS.getFileDataAsTypedArray(node);return callback(null,{timestamp:stat.mtime,mode:stat.mode,contents:node.contents})}else{return callback(new Error("node type not supported"))}},storeLocalEntry:function(path,entry,callback){try{if(FS.isDir(entry.mode)){FS.mkdir(path,entry.mode)}else if(FS.isFile(entry.mode)){FS.writeFile(path,entry.contents,{canOwn:true})}else{return callback(new Error("node type not supported"))}FS.chmod(path,entry.mode);FS.utime(path,entry.timestamp,entry.timestamp)}catch(e){return callback(e)}callback(null)},removeLocalEntry:function(path,callback){try{var lookup=FS.lookupPath(path);var stat=FS.stat(path);if(FS.isDir(stat.mode)){FS.rmdir(path)}else if(FS.isFile(stat.mode)){FS.unlink(path)}}catch(e){return callback(e)}callback(null)},loadRemoteEntry:function(store,path,callback){var req=store.get(path);req.onsuccess=function(event){callback(null,event.target.result)};req.onerror=function(e){callback(this.error);e.preventDefault()}},storeRemoteEntry:function(store,path,entry,callback){var req=store.put(entry,path);req.onsuccess=function(){callback(null)};req.onerror=function(e){callback(this.error);e.preventDefault()}},removeRemoteEntry:function(store,path,callback){var req=store.delete(path);req.onsuccess=function(){callback(null)};req.onerror=function(e){callback(this.error);e.preventDefault()}},reconcile:function(src,dst,callback){var total=0;var create=[];Object.keys(src.entries).forEach(function(key){var e=src.entries[key];var e2=dst.entries[key];if(!e2||e.timestamp>e2.timestamp){create.push(key);total++}});var remove=[];Object.keys(dst.entries).forEach(function(key){var e=dst.entries[key];var e2=src.entries[key];if(!e2){remove.push(key);total++}});if(!total){return callback(null)}var errored=false;var db=src.type==="remote"?src.db:dst.db;var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readwrite");var store=transaction.objectStore(IDBFS.DB_STORE_NAME);function done(err){if(err&&!errored){errored=true;return callback(err)}}transaction.onerror=function(e){done(this.error);e.preventDefault()};transaction.oncomplete=function(e){if(!errored){callback(null)}};create.sort().forEach(function(path){if(dst.type==="local"){IDBFS.loadRemoteEntry(store,path,function(err,entry){if(err)return done(err);IDBFS.storeLocalEntry(path,entry,done)})}else{IDBFS.loadLocalEntry(path,function(err,entry){if(err)return done(err);IDBFS.storeRemoteEntry(store,path,entry,done)})}});remove.sort().reverse().forEach(function(path){if(dst.type==="local"){IDBFS.removeLocalEntry(path,done)}else{IDBFS.removeRemoteEntry(store,path,done)}})}};var NODEFS={isWindows:false,staticInit:function(){NODEFS.isWindows=!!process.platform.match(/^win/);var flags=process["binding"]("constants");if(flags["fs"]){flags=flags["fs"]}NODEFS.flagsForNodeMap={1024:flags["O_APPEND"],64:flags["O_CREAT"],128:flags["O_EXCL"],0:flags["O_RDONLY"],2:flags["O_RDWR"],4096:flags["O_SYNC"],512:flags["O_TRUNC"],1:flags["O_WRONLY"]}},bufferFrom:function(arrayBuffer){return Buffer.alloc?Buffer.from(arrayBuffer):new Buffer(arrayBuffer)},mount:function(mount){assert(ENVIRONMENT_HAS_NODE);return NODEFS.createNode(null,"/",NODEFS.getMode(mount.opts.root),0)},createNode:function(parent,name,mode,dev){if(!FS.isDir(mode)&&!FS.isFile(mode)&&!FS.isLink(mode)){throw new FS.ErrnoError(22)}var node=FS.createNode(parent,name,mode);node.node_ops=NODEFS.node_ops;node.stream_ops=NODEFS.stream_ops;return node},getMode:function(path){var stat;try{stat=fs.lstatSync(path);if(NODEFS.isWindows){stat.mode=stat.mode|(stat.mode&292)>>2}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}return stat.mode},realPath:function(node){var parts=[];while(node.parent!==node){parts.push(node.name);node=node.parent}parts.push(node.mount.opts.root);parts.reverse();return PATH.join.apply(null,parts)},flagsForNode:function(flags){flags&=~2097152;flags&=~2048;flags&=~32768;flags&=~524288;var newFlags=0;for(var k in NODEFS.flagsForNodeMap){if(flags&k){newFlags|=NODEFS.flagsForNodeMap[k];flags^=k}}if(!flags){return newFlags}else{throw new FS.ErrnoError(22)}},node_ops:{getattr:function(node){var path=NODEFS.realPath(node);var stat;try{stat=fs.lstatSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}if(NODEFS.isWindows&&!stat.blksize){stat.blksize=4096}if(NODEFS.isWindows&&!stat.blocks){stat.blocks=(stat.size+stat.blksize-1)/stat.blksize|0}return{dev:stat.dev,ino:stat.ino,mode:stat.mode,nlink:stat.nlink,uid:stat.uid,gid:stat.gid,rdev:stat.rdev,size:stat.size,atime:stat.atime,mtime:stat.mtime,ctime:stat.ctime,blksize:stat.blksize,blocks:stat.blocks}},setattr:function(node,attr){var path=NODEFS.realPath(node);try{if(attr.mode!==undefined){fs.chmodSync(path,attr.mode);node.mode=attr.mode}if(attr.timestamp!==undefined){var date=new Date(attr.timestamp);fs.utimesSync(path,date,date)}if(attr.size!==undefined){fs.truncateSync(path,attr.size)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},lookup:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);var mode=NODEFS.getMode(path);return NODEFS.createNode(parent,name,mode)},mknod:function(parent,name,mode,dev){var node=NODEFS.createNode(parent,name,mode,dev);var path=NODEFS.realPath(node);try{if(FS.isDir(node.mode)){fs.mkdirSync(path,node.mode)}else{fs.writeFileSync(path,"",{mode:node.mode})}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}return node},rename:function(oldNode,newDir,newName){var oldPath=NODEFS.realPath(oldNode);var newPath=PATH.join2(NODEFS.realPath(newDir),newName);try{fs.renameSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},unlink:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.unlinkSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},rmdir:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.rmdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},readdir:function(node){var path=NODEFS.realPath(node);try{return fs.readdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},symlink:function(parent,newName,oldPath){var newPath=PATH.join2(NODEFS.realPath(parent),newName);try{fs.symlinkSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},readlink:function(node){var path=NODEFS.realPath(node);try{path=fs.readlinkSync(path);path=NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root),path);return path}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}}},stream_ops:{open:function(stream){var path=NODEFS.realPath(stream.node);try{if(FS.isFile(stream.node.mode)){stream.nfd=fs.openSync(path,NODEFS.flagsForNode(stream.flags))}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},close:function(stream){try{if(FS.isFile(stream.node.mode)&&stream.nfd){fs.closeSync(stream.nfd)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},read:function(stream,buffer,offset,length,position){if(length===0)return 0;try{return fs.readSync(stream.nfd,NODEFS.bufferFrom(buffer.buffer),offset,length,position)}catch(e){throw new FS.ErrnoError(-e.errno)}},write:function(stream,buffer,offset,length,position){try{return fs.writeSync(stream.nfd,NODEFS.bufferFrom(buffer.buffer),offset,length,position)}catch(e){throw new FS.ErrnoError(-e.errno)}},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){try{var stat=fs.fstatSync(stream.nfd);position+=stat.size}catch(e){throw new FS.ErrnoError(-e.errno)}}}if(position<0){throw new FS.ErrnoError(22)}return position}}};var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function(mount){assert(ENVIRONMENT_IS_WORKER);if(!WORKERFS.reader)WORKERFS.reader=new FileReaderSync;var root=WORKERFS.createNode(null,"/",WORKERFS.DIR_MODE,0);var createdParents={};function ensureParent(path){var parts=path.split("/");var parent=root;for(var i=0;i<parts.length-1;i++){var curr=parts.slice(0,i+1).join("/");if(!createdParents[curr]){createdParents[curr]=WORKERFS.createNode(parent,parts[i],WORKERFS.DIR_MODE,0)}parent=createdParents[curr]}return parent}function base(path){var parts=path.split("/");return parts[parts.length-1]}Array.prototype.forEach.call(mount.opts["files"]||[],function(file){WORKERFS.createNode(ensureParent(file.name),base(file.name),WORKERFS.FILE_MODE,0,file,file.lastModifiedDate)});(mount.opts["blobs"]||[]).forEach(function(obj){WORKERFS.createNode(ensureParent(obj["name"]),base(obj["name"]),WORKERFS.FILE_MODE,0,obj["data"])});(mount.opts["packages"]||[]).forEach(function(pack){pack["metadata"].files.forEach(function(file){var name=file.filename.substr(1);WORKERFS.createNode(ensureParent(name),base(name),WORKERFS.FILE_MODE,0,pack["blob"].slice(file.start,file.end))})});return root},createNode:function(parent,name,mode,dev,contents,mtime){var node=FS.createNode(parent,name,mode);node.mode=mode;node.node_ops=WORKERFS.node_ops;node.stream_ops=WORKERFS.stream_ops;node.timestamp=(mtime||new Date).getTime();assert(WORKERFS.FILE_MODE!==WORKERFS.DIR_MODE);if(mode===WORKERFS.FILE_MODE){node.size=contents.size;node.contents=contents}else{node.size=4096;node.contents={}}if(parent){parent.contents[name]=node}return node},node_ops:{getattr:function(node){return{dev:1,ino:undefined,mode:node.mode,nlink:1,uid:0,gid:0,rdev:undefined,size:node.size,atime:new Date(node.timestamp),mtime:new Date(node.timestamp),ctime:new Date(node.timestamp),blksize:4096,blocks:Math.ceil(node.size/4096)}},setattr:function(node,attr){if(attr.mode!==undefined){node.mode=attr.mode}if(attr.timestamp!==undefined){node.timestamp=attr.timestamp}},lookup:function(parent,name){throw new FS.ErrnoError(2)},mknod:function(parent,name,mode,dev){throw new FS.ErrnoError(1)},rename:function(oldNode,newDir,newName){throw new FS.ErrnoError(1)},unlink:function(parent,name){throw new FS.ErrnoError(1)},rmdir:function(parent,name){throw new FS.ErrnoError(1)},readdir:function(node){var entries=[".",".."];for(var key in node.contents){if(!node.contents.hasOwnProperty(key)){continue}entries.push(key)}return entries},symlink:function(parent,newName,oldPath){throw new FS.ErrnoError(1)},readlink:function(node){throw new FS.ErrnoError(1)}},stream_ops:{read:function(stream,buffer,offset,length,position){if(position>=stream.node.size)return 0;var chunk=stream.node.contents.slice(position,position+length);var ab=WORKERFS.reader.readAsArrayBuffer(chunk);buffer.set(new Uint8Array(ab),offset);return chunk.size},write:function(stream,buffer,offset,length,position){throw new FS.ErrnoError(5)},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){position+=stream.node.size}}if(position<0){throw new FS.ErrnoError(22)}return position}}};var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function(e){if(!(e instanceof FS.ErrnoError))throw e+" : "+stackTrace();return ___setErrNo(e.errno)},lookupPath:function(path,opts){path=PATH_FS.resolve(FS.cwd(),path);opts=opts||{};if(!path)return{path:"",node:null};var defaults={follow_mount:true,recurse_count:0};for(var key in defaults){if(opts[key]===undefined){opts[key]=defaults[key]}}if(opts.recurse_count>8){throw new FS.ErrnoError(40)}var parts=PATH.normalizeArray(path.split("/").filter(function(p){return!!p}),false);var current=FS.root;var current_path="/";for(var i=0;i<parts.length;i++){var islast=i===parts.length-1;if(islast&&opts.parent){break}current=FS.lookupNode(current,parts[i]);current_path=PATH.join2(current_path,parts[i]);if(FS.isMountpoint(current)){if(!islast||islast&&opts.follow_mount){current=current.mounted.root}}if(!islast||opts.follow){var count=0;while(FS.isLink(current.mode)){var link=FS.readlink(current_path);current_path=PATH_FS.resolve(PATH.dirname(current_path),link);var lookup=FS.lookupPath(current_path,{recurse_count:opts.recurse_count});current=lookup.node;if(count++>40){throw new FS.ErrnoError(40)}}}}return{path:current_path,node:current}},getPath:function(node){var path;while(true){if(FS.isRoot(node)){var mount=node.mount.mountpoint;if(!path)return mount;return mount[mount.length-1]!=="/"?mount+"/"+path:mount+path}path=path?node.name+"/"+path:node.name;node=node.parent}},hashName:function(parentid,name){var hash=0;for(var i=0;i<name.length;i++){hash=(hash<<5)-hash+name.charCodeAt(i)|0}return(parentid+hash>>>0)%FS.nameTable.length},hashAddNode:function(node){var hash=FS.hashName(node.parent.id,node.name);node.name_next=FS.nameTable[hash];FS.nameTable[hash]=node},hashRemoveNode:function(node){var hash=FS.hashName(node.parent.id,node.name);if(FS.nameTable[hash]===node){FS.nameTable[hash]=node.name_next}else{var current=FS.nameTable[hash];while(current){if(current.name_next===node){current.name_next=node.name_next;break}current=current.name_next}}},lookupNode:function(parent,name){var err=FS.mayLookup(parent);if(err){throw new FS.ErrnoError(err,parent)}var hash=FS.hashName(parent.id,name);for(var node=FS.nameTable[hash];node;node=node.name_next){var nodeName=node.name;if(node.parent.id===parent.id&&nodeName===name){return node}}return FS.lookup(parent,name)},createNode:function(parent,name,mode,rdev){if(!FS.FSNode){FS.FSNode=function(parent,name,mode,rdev){if(!parent){parent=this}this.parent=parent;this.mount=parent.mount;this.mounted=null;this.id=FS.nextInode++;this.name=name;this.mode=mode;this.node_ops={};this.stream_ops={};this.rdev=rdev};FS.FSNode.prototype={};var readMode=292|73;var writeMode=146;Object.defineProperties(FS.FSNode.prototype,{read:{get:function(){return(this.mode&readMode)===readMode},set:function(val){val?this.mode|=readMode:this.mode&=~readMode}},write:{get:function(){return(this.mode&writeMode)===writeMode},set:function(val){val?this.mode|=writeMode:this.mode&=~writeMode}},isFolder:{get:function(){return FS.isDir(this.mode)}},isDevice:{get:function(){return FS.isChrdev(this.mode)}}})}var node=new FS.FSNode(parent,name,mode,rdev);FS.hashAddNode(node);return node},destroyNode:function(node){FS.hashRemoveNode(node)},isRoot:function(node){return node===node.parent},isMountpoint:function(node){return!!node.mounted},isFile:function(mode){return(mode&61440)===32768},isDir:function(mode){return(mode&61440)===16384},isLink:function(mode){return(mode&61440)===40960},isChrdev:function(mode){return(mode&61440)===8192},isBlkdev:function(mode){return(mode&61440)===24576},isFIFO:function(mode){return(mode&61440)===4096},isSocket:function(mode){return(mode&49152)===49152},flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function(str){var flags=FS.flagModes[str];if(typeof flags==="undefined"){throw new Error("Unknown file open mode: "+str)}return flags},flagsToPermissionString:function(flag){var perms=["r","w","rw"][flag&3];if(flag&512){perms+="w"}return perms},nodePermissions:function(node,perms){if(FS.ignorePermissions){return 0}if(perms.indexOf("r")!==-1&&!(node.mode&292)){return 13}else if(perms.indexOf("w")!==-1&&!(node.mode&146)){return 13}else if(perms.indexOf("x")!==-1&&!(node.mode&73)){return 13}return 0},mayLookup:function(dir){var err=FS.nodePermissions(dir,"x");if(err)return err;if(!dir.node_ops.lookup)return 13;return 0},mayCreate:function(dir,name){try{var node=FS.lookupNode(dir,name);return 17}catch(e){}return FS.nodePermissions(dir,"wx")},mayDelete:function(dir,name,isdir){var node;try{node=FS.lookupNode(dir,name)}catch(e){return e.errno}var err=FS.nodePermissions(dir,"wx");if(err){return err}if(isdir){if(!FS.isDir(node.mode)){return 20}if(FS.isRoot(node)||FS.getPath(node)===FS.cwd()){return 16}}else{if(FS.isDir(node.mode)){return 21}}return 0},mayOpen:function(node,flags){if(!node){return 2}if(FS.isLink(node.mode)){return 40}else if(FS.isDir(node.mode)){if(FS.flagsToPermissionString(flags)!=="r"||flags&512){return 21}}return FS.nodePermissions(node,FS.flagsToPermissionString(flags))},MAX_OPEN_FDS:4096,nextfd:function(fd_start,fd_end){fd_start=fd_start||0;fd_end=fd_end||FS.MAX_OPEN_FDS;for(var fd=fd_start;fd<=fd_end;fd++){if(!FS.streams[fd]){return fd}}throw new FS.ErrnoError(24)},getStream:function(fd){return FS.streams[fd]},createStream:function(stream,fd_start,fd_end){if(!FS.FSStream){FS.FSStream=function(){};FS.FSStream.prototype={};Object.defineProperties(FS.FSStream.prototype,{object:{get:function(){return this.node},set:function(val){this.node=val}},isRead:{get:function(){return(this.flags&2097155)!==1}},isWrite:{get:function(){return(this.flags&2097155)!==0}},isAppend:{get:function(){return this.flags&1024}}})}var newStream=new FS.FSStream;for(var p in stream){newStream[p]=stream[p]}stream=newStream;var fd=FS.nextfd(fd_start,fd_end);stream.fd=fd;FS.streams[fd]=stream;return stream},closeStream:function(fd){FS.streams[fd]=null},chrdev_stream_ops:{open:function(stream){var device=FS.getDevice(stream.node.rdev);stream.stream_ops=device.stream_ops;if(stream.stream_ops.open){stream.stream_ops.open(stream)}},llseek:function(){throw new FS.ErrnoError(29)}},major:function(dev){return dev>>8},minor:function(dev){return dev&255},makedev:function(ma,mi){return ma<<8|mi},registerDevice:function(dev,ops){FS.devices[dev]={stream_ops:ops}},getDevice:function(dev){return FS.devices[dev]},getMounts:function(mount){var mounts=[];var check=[mount];while(check.length){var m=check.pop();mounts.push(m);check.push.apply(check,m.mounts)}return mounts},syncfs:function(populate,callback){if(typeof populate==="function"){callback=populate;populate=false}FS.syncFSRequests++;if(FS.syncFSRequests>1){console.log("warning: "+FS.syncFSRequests+" FS.syncfs operations in flight at once, probably just doing extra work")}var mounts=FS.getMounts(FS.root.mount);var completed=0;function doCallback(err){assert(FS.syncFSRequests>0);FS.syncFSRequests--;return callback(err)}function done(err){if(err){if(!done.errored){done.errored=true;return doCallback(err)}return}if(++completed>=mounts.length){doCallback(null)}}mounts.forEach(function(mount){if(!mount.type.syncfs){return done(null)}mount.type.syncfs(mount,populate,done)})},mount:function(type,opts,mountpoint){var root=mountpoint==="/";var pseudo=!mountpoint;var node;if(root&&FS.root){throw new FS.ErrnoError(16)}else if(!root&&!pseudo){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});mountpoint=lookup.path;node=lookup.node;if(FS.isMountpoint(node)){throw new FS.ErrnoError(16)}if(!FS.isDir(node.mode)){throw new FS.ErrnoError(20)}}var mount={type:type,opts:opts,mountpoint:mountpoint,mounts:[]};var mountRoot=type.mount(mount);mountRoot.mount=mount;mount.root=mountRoot;if(root){FS.root=mountRoot}else if(node){node.mounted=mount;if(node.mount){node.mount.mounts.push(mount)}}return mountRoot},unmount:function(mountpoint){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});if(!FS.isMountpoint(lookup.node)){throw new FS.ErrnoError(22)}var node=lookup.node;var mount=node.mounted;var mounts=FS.getMounts(mount);Object.keys(FS.nameTable).forEach(function(hash){var current=FS.nameTable[hash];while(current){var next=current.name_next;if(mounts.indexOf(current.mount)!==-1){FS.destroyNode(current)}current=next}});node.mounted=null;var idx=node.mount.mounts.indexOf(mount);assert(idx!==-1);node.mount.mounts.splice(idx,1)},lookup:function(parent,name){return parent.node_ops.lookup(parent,name)},mknod:function(path,mode,dev){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);if(!name||name==="."||name===".."){throw new FS.ErrnoError(22)}var err=FS.mayCreate(parent,name);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.mknod){throw new FS.ErrnoError(1)}return parent.node_ops.mknod(parent,name,mode,dev)},create:function(path,mode){mode=mode!==undefined?mode:438;mode&=4095;mode|=32768;return FS.mknod(path,mode,0)},mkdir:function(path,mode){mode=mode!==undefined?mode:511;mode&=511|512;mode|=16384;return FS.mknod(path,mode,0)},mkdirTree:function(path,mode){var dirs=path.split("/");var d="";for(var i=0;i<dirs.length;++i){if(!dirs[i])continue;d+="/"+dirs[i];try{FS.mkdir(d,mode)}catch(e){if(e.errno!=17)throw e}}},mkdev:function(path,mode,dev){if(typeof dev==="undefined"){dev=mode;mode=438}mode|=8192;return FS.mknod(path,mode,dev)},symlink:function(oldpath,newpath){if(!PATH_FS.resolve(oldpath)){throw new FS.ErrnoError(2)}var lookup=FS.lookupPath(newpath,{parent:true});var parent=lookup.node;if(!parent){throw new FS.ErrnoError(2)}var newname=PATH.basename(newpath);var err=FS.mayCreate(parent,newname);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.symlink){throw new FS.ErrnoError(1)}return parent.node_ops.symlink(parent,newname,oldpath)},rename:function(old_path,new_path){var old_dirname=PATH.dirname(old_path);var new_dirname=PATH.dirname(new_path);var old_name=PATH.basename(old_path);var new_name=PATH.basename(new_path);var lookup,old_dir,new_dir;try{lookup=FS.lookupPath(old_path,{parent:true});old_dir=lookup.node;lookup=FS.lookupPath(new_path,{parent:true});new_dir=lookup.node}catch(e){throw new FS.ErrnoError(16)}if(!old_dir||!new_dir)throw new FS.ErrnoError(2);if(old_dir.mount!==new_dir.mount){throw new FS.ErrnoError(18)}var old_node=FS.lookupNode(old_dir,old_name);var relative=PATH_FS.relative(old_path,new_dirname);if(relative.charAt(0)!=="."){throw new FS.ErrnoError(22)}relative=PATH_FS.relative(new_path,old_dirname);if(relative.charAt(0)!=="."){throw new FS.ErrnoError(39)}var new_node;try{new_node=FS.lookupNode(new_dir,new_name)}catch(e){}if(old_node===new_node){return}var isdir=FS.isDir(old_node.mode);var err=FS.mayDelete(old_dir,old_name,isdir);if(err){throw new FS.ErrnoError(err)}err=new_node?FS.mayDelete(new_dir,new_name,isdir):FS.mayCreate(new_dir,new_name);if(err){throw new FS.ErrnoError(err)}if(!old_dir.node_ops.rename){throw new FS.ErrnoError(1)}if(FS.isMountpoint(old_node)||new_node&&FS.isMountpoint(new_node)){throw new FS.ErrnoError(16)}if(new_dir!==old_dir){err=FS.nodePermissions(old_dir,"w");if(err){throw new FS.ErrnoError(err)}}try{if(FS.trackingDelegate["willMovePath"]){FS.trackingDelegate["willMovePath"](old_path,new_path)}}catch(e){console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: "+e.message)}FS.hashRemoveNode(old_node);try{old_dir.node_ops.rename(old_node,new_dir,new_name)}catch(e){throw e}finally{FS.hashAddNode(old_node)}try{if(FS.trackingDelegate["onMovePath"])FS.trackingDelegate["onMovePath"](old_path,new_path)}catch(e){console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: "+e.message)}},rmdir:function(path){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);var node=FS.lookupNode(parent,name);var err=FS.mayDelete(parent,name,true);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.rmdir){throw new FS.ErrnoError(1)}if(FS.isMountpoint(node)){throw new FS.ErrnoError(16)}try{if(FS.trackingDelegate["willDeletePath"]){FS.trackingDelegate["willDeletePath"](path)}}catch(e){console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: "+e.message)}parent.node_ops.rmdir(parent,name);FS.destroyNode(node);try{if(FS.trackingDelegate["onDeletePath"])FS.trackingDelegate["onDeletePath"](path)}catch(e){console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: "+e.message)}},readdir:function(path){var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;if(!node.node_ops.readdir){throw new FS.ErrnoError(20)}return node.node_ops.readdir(node)},unlink:function(path){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);var node=FS.lookupNode(parent,name);var err=FS.mayDelete(parent,name,false);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.unlink){throw new FS.ErrnoError(1)}if(FS.isMountpoint(node)){throw new FS.ErrnoError(16)}try{if(FS.trackingDelegate["willDeletePath"]){FS.trackingDelegate["willDeletePath"](path)}}catch(e){console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: "+e.message)}parent.node_ops.unlink(parent,name);FS.destroyNode(node);try{if(FS.trackingDelegate["onDeletePath"])FS.trackingDelegate["onDeletePath"](path)}catch(e){console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: "+e.message)}},readlink:function(path){var lookup=FS.lookupPath(path);var link=lookup.node;if(!link){throw new FS.ErrnoError(2)}if(!link.node_ops.readlink){throw new FS.ErrnoError(22)}return PATH_FS.resolve(FS.getPath(link.parent),link.node_ops.readlink(link))},stat:function(path,dontFollow){var lookup=FS.lookupPath(path,{follow:!dontFollow});var node=lookup.node;if(!node){throw new FS.ErrnoError(2)}if(!node.node_ops.getattr){throw new FS.ErrnoError(1)}return node.node_ops.getattr(node)},lstat:function(path){return FS.stat(path,true)},chmod:function(path,mode,dontFollow){var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:!dontFollow});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(1)}node.node_ops.setattr(node,{mode:mode&4095|node.mode&~4095,timestamp:Date.now()})},lchmod:function(path,mode){FS.chmod(path,mode,true)},fchmod:function(fd,mode){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(9)}FS.chmod(stream.node,mode)},chown:function(path,uid,gid,dontFollow){var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:!dontFollow});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(1)}node.node_ops.setattr(node,{timestamp:Date.now()})},lchown:function(path,uid,gid){FS.chown(path,uid,gid,true)},fchown:function(fd,uid,gid){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(9)}FS.chown(stream.node,uid,gid)},truncate:function(path,len){if(len<0){throw new FS.ErrnoError(22)}var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:true});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(1)}if(FS.isDir(node.mode)){throw new FS.ErrnoError(21)}if(!FS.isFile(node.mode)){throw new FS.ErrnoError(22)}var err=FS.nodePermissions(node,"w");if(err){throw new FS.ErrnoError(err)}node.node_ops.setattr(node,{size:len,timestamp:Date.now()})},ftruncate:function(fd,len){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(9)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(22)}FS.truncate(stream.node,len)},utime:function(path,atime,mtime){var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;node.node_ops.setattr(node,{timestamp:Math.max(atime,mtime)})},open:function(path,flags,mode,fd_start,fd_end){if(path===""){throw new FS.ErrnoError(2)}flags=typeof flags==="string"?FS.modeStringToFlags(flags):flags;mode=typeof mode==="undefined"?438:mode;if(flags&64){mode=mode&4095|32768}else{mode=0}var node;if(typeof path==="object"){node=path}else{path=PATH.normalize(path);try{var lookup=FS.lookupPath(path,{follow:!(flags&131072)});node=lookup.node}catch(e){}}var created=false;if(flags&64){if(node){if(flags&128){throw new FS.ErrnoError(17)}}else{node=FS.mknod(path,mode,0);created=true}}if(!node){throw new FS.ErrnoError(2)}if(FS.isChrdev(node.mode)){flags&=~512}if(flags&65536&&!FS.isDir(node.mode)){throw new FS.ErrnoError(20)}if(!created){var err=FS.mayOpen(node,flags);if(err){throw new FS.ErrnoError(err)}}if(flags&512){FS.truncate(node,0)}flags&=~(128|512);var stream=FS.createStream({node:node,path:FS.getPath(node),flags:flags,seekable:true,position:0,stream_ops:node.stream_ops,ungotten:[],error:false},fd_start,fd_end);if(stream.stream_ops.open){stream.stream_ops.open(stream)}if(Module["logReadFiles"]&&!(flags&1)){if(!FS.readFiles)FS.readFiles={};if(!(path in FS.readFiles)){FS.readFiles[path]=1;console.log("FS.trackingDelegate error on read file: "+path)}}try{if(FS.trackingDelegate["onOpenFile"]){var trackingFlags=0;if((flags&2097155)!==1){trackingFlags|=FS.tracking.openFlags.READ}if((flags&2097155)!==0){trackingFlags|=FS.tracking.openFlags.WRITE}FS.trackingDelegate["onOpenFile"](path,trackingFlags)}}catch(e){console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: "+e.message)}return stream},close:function(stream){if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if(stream.getdents)stream.getdents=null;try{if(stream.stream_ops.close){stream.stream_ops.close(stream)}}catch(e){throw e}finally{FS.closeStream(stream.fd)}stream.fd=null},isClosed:function(stream){return stream.fd===null},llseek:function(stream,offset,whence){if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if(!stream.seekable||!stream.stream_ops.llseek){throw new FS.ErrnoError(29)}if(whence!=0&&whence!=1&&whence!=2){throw new FS.ErrnoError(22)}stream.position=stream.stream_ops.llseek(stream,offset,whence);stream.ungotten=[];return stream.position},read:function(stream,buffer,offset,length,position){if(length<0||position<0){throw new FS.ErrnoError(22)}if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if((stream.flags&2097155)===1){throw new FS.ErrnoError(9)}if(FS.isDir(stream.node.mode)){throw new FS.ErrnoError(21)}if(!stream.stream_ops.read){throw new FS.ErrnoError(22)}var seeking=typeof position!=="undefined";if(!seeking){position=stream.position}else if(!stream.seekable){throw new FS.ErrnoError(29)}var bytesRead=stream.stream_ops.read(stream,buffer,offset,length,position);if(!seeking)stream.position+=bytesRead;return bytesRead},write:function(stream,buffer,offset,length,position,canOwn){if(length<0||position<0){throw new FS.ErrnoError(22)}if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(9)}if(FS.isDir(stream.node.mode)){throw new FS.ErrnoError(21)}if(!stream.stream_ops.write){throw new FS.ErrnoError(22)}if(stream.flags&1024){FS.llseek(stream,0,2)}var seeking=typeof position!=="undefined";if(!seeking){position=stream.position}else if(!stream.seekable){throw new FS.ErrnoError(29)}var bytesWritten=stream.stream_ops.write(stream,buffer,offset,length,position,canOwn);if(!seeking)stream.position+=bytesWritten;try{if(stream.path&&FS.trackingDelegate["onWriteToFile"])FS.trackingDelegate["onWriteToFile"](stream.path)}catch(e){console.log("FS.trackingDelegate['onWriteToFile']('"+stream.path+"') threw an exception: "+e.message)}return bytesWritten},allocate:function(stream,offset,length){if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if(offset<0||length<=0){throw new FS.ErrnoError(22)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(9)}if(!FS.isFile(stream.node.mode)&&!FS.isDir(stream.node.mode)){throw new FS.ErrnoError(19)}if(!stream.stream_ops.allocate){throw new FS.ErrnoError(95)}stream.stream_ops.allocate(stream,offset,length)},mmap:function(stream,buffer,offset,length,position,prot,flags){if((prot&2)!==0&&(flags&2)===0&&(stream.flags&2097155)!==2){throw new FS.ErrnoError(13)}if((stream.flags&2097155)===1){throw new FS.ErrnoError(13)}if(!stream.stream_ops.mmap){throw new FS.ErrnoError(19)}return stream.stream_ops.mmap(stream,buffer,offset,length,position,prot,flags)},msync:function(stream,buffer,offset,length,mmapFlags){if(!stream||!stream.stream_ops.msync){return 0}return stream.stream_ops.msync(stream,buffer,offset,length,mmapFlags)},munmap:function(stream){return 0},ioctl:function(stream,cmd,arg){if(!stream.stream_ops.ioctl){throw new FS.ErrnoError(25)}return stream.stream_ops.ioctl(stream,cmd,arg)},readFile:function(path,opts){opts=opts||{};opts.flags=opts.flags||"r";opts.encoding=opts.encoding||"binary";if(opts.encoding!=="utf8"&&opts.encoding!=="binary"){throw new Error('Invalid encoding type "'+opts.encoding+'"')}var ret;var stream=FS.open(path,opts.flags);var stat=FS.stat(path);var length=stat.size;var buf=new Uint8Array(length);FS.read(stream,buf,0,length,0);if(opts.encoding==="utf8"){ret=UTF8ArrayToString(buf,0)}else if(opts.encoding==="binary"){ret=buf}FS.close(stream);return ret},writeFile:function(path,data,opts){opts=opts||{};opts.flags=opts.flags||"w";var stream=FS.open(path,opts.flags,opts.mode);if(typeof data==="string"){var buf=new Uint8Array(lengthBytesUTF8(data)+1);var actualNumBytes=stringToUTF8Array(data,buf,0,buf.length);FS.write(stream,buf,0,actualNumBytes,undefined,opts.canOwn)}else if(ArrayBuffer.isView(data)){FS.write(stream,data,0,data.byteLength,undefined,opts.canOwn)}else{throw new Error("Unsupported data type")}FS.close(stream)},cwd:function(){return FS.currentPath},chdir:function(path){var lookup=FS.lookupPath(path,{follow:true});if(lookup.node===null){throw new FS.ErrnoError(2)}if(!FS.isDir(lookup.node.mode)){throw new FS.ErrnoError(20)}var err=FS.nodePermissions(lookup.node,"x");if(err){throw new FS.ErrnoError(err)}FS.currentPath=lookup.path},createDefaultDirectories:function(){FS.mkdir("/tmp");FS.mkdir("/home");FS.mkdir("/home/web_user")},createDefaultDevices:function(){FS.mkdir("/dev");FS.registerDevice(FS.makedev(1,3),{read:function(){return 0},write:function(stream,buffer,offset,length,pos){return length}});FS.mkdev("/dev/null",FS.makedev(1,3));TTY.register(FS.makedev(5,0),TTY.default_tty_ops);TTY.register(FS.makedev(6,0),TTY.default_tty1_ops);FS.mkdev("/dev/tty",FS.makedev(5,0));FS.mkdev("/dev/tty1",FS.makedev(6,0));var random_device;if(typeof crypto==="object"&&typeof crypto["getRandomValues"]==="function"){var randomBuffer=new Uint8Array(1);random_device=function(){crypto.getRandomValues(randomBuffer);return randomBuffer[0]}}else if(ENVIRONMENT_IS_NODE){try{var crypto_module=require("crypto");random_device=function(){return crypto_module["randomBytes"](1)[0]}}catch(e){}}else{}if(!random_device){random_device=function(){abort("no cryptographic support found for random_device. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: function(array) { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };")}}FS.createDevice("/dev","random",random_device);FS.createDevice("/dev","urandom",random_device);FS.mkdir("/dev/shm");FS.mkdir("/dev/shm/tmp")},createSpecialDirectories:function(){FS.mkdir("/proc");FS.mkdir("/proc/self");FS.mkdir("/proc/self/fd");FS.mount({mount:function(){var node=FS.createNode("/proc/self","fd",16384|511,73);node.node_ops={lookup:function(parent,name){var fd=+name;var stream=FS.getStream(fd);if(!stream)throw new FS.ErrnoError(9);var ret={parent:null,mount:{mountpoint:"fake"},node_ops:{readlink:function(){return stream.path}}};ret.parent=ret;return ret}};return node}},{},"/proc/self/fd")},createStandardStreams:function(){if(Module["stdin"]){FS.createDevice("/dev","stdin",Module["stdin"])}else{FS.symlink("/dev/tty","/dev/stdin")}if(Module["stdout"]){FS.createDevice("/dev","stdout",null,Module["stdout"])}else{FS.symlink("/dev/tty","/dev/stdout")}if(Module["stderr"]){FS.createDevice("/dev","stderr",null,Module["stderr"])}else{FS.symlink("/dev/tty1","/dev/stderr")}var stdin=FS.open("/dev/stdin","r");var stdout=FS.open("/dev/stdout","w");var stderr=FS.open("/dev/stderr","w");assert(stdin.fd===0,"invalid handle for stdin ("+stdin.fd+")");assert(stdout.fd===1,"invalid handle for stdout ("+stdout.fd+")");assert(stderr.fd===2,"invalid handle for stderr ("+stderr.fd+")")},ensureErrnoError:function(){if(FS.ErrnoError)return;FS.ErrnoError=function ErrnoError(errno,node){this.node=node;this.setErrno=function(errno){this.errno=errno;for(var key in ERRNO_CODES){if(ERRNO_CODES[key]===errno){this.code=key;break}}};this.setErrno(errno);this.message=ERRNO_MESSAGES[errno];if(this.stack)Object.defineProperty(this,"stack",{value:(new Error).stack,writable:true});if(this.stack)this.stack=demangleAll(this.stack)};FS.ErrnoError.prototype=new Error;FS.ErrnoError.prototype.constructor=FS.ErrnoError;[2].forEach(function(code){FS.genericErrors[code]=new FS.ErrnoError(code);FS.genericErrors[code].stack="<generic error, no stack>"})},staticInit:function(){FS.ensureErrnoError();FS.nameTable=new Array(4096);FS.mount(MEMFS,{},"/");FS.createDefaultDirectories();FS.createDefaultDevices();FS.createSpecialDirectories();FS.filesystems={"MEMFS":MEMFS,"IDBFS":IDBFS,"NODEFS":NODEFS,"WORKERFS":WORKERFS}},init:function(input,output,error){assert(!FS.init.initialized,"FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)");FS.init.initialized=true;FS.ensureErrnoError();Module["stdin"]=input||Module["stdin"];Module["stdout"]=output||Module["stdout"];Module["stderr"]=error||Module["stderr"];FS.createStandardStreams()},quit:function(){FS.init.initialized=false;var fflush=Module["_fflush"];if(fflush)fflush(0);for(var i=0;i<FS.streams.length;i++){var stream=FS.streams[i];if(!stream){continue}FS.close(stream)}},getMode:function(canRead,canWrite){var mode=0;if(canRead)mode|=292|73;if(canWrite)mode|=146;return mode},joinPath:function(parts,forceRelative){var path=PATH.join.apply(null,parts);if(forceRelative&&path[0]=="/")path=path.substr(1);return path},absolutePath:function(relative,base){return PATH_FS.resolve(base,relative)},standardizePath:function(path){return PATH.normalize(path)},findObject:function(path,dontResolveLastLink){var ret=FS.analyzePath(path,dontResolveLastLink);if(ret.exists){return ret.object}else{___setErrNo(ret.error);return null}},analyzePath:function(path,dontResolveLastLink){try{var lookup=FS.lookupPath(path,{follow:!dontResolveLastLink});path=lookup.path}catch(e){}var ret={isRoot:false,exists:false,error:0,name:null,path:null,object:null,parentExists:false,parentPath:null,parentObject:null};try{var lookup=FS.lookupPath(path,{parent:true});ret.parentExists=true;ret.parentPath=lookup.path;ret.parentObject=lookup.node;ret.name=PATH.basename(path);lookup=FS.lookupPath(path,{follow:!dontResolveLastLink});ret.exists=true;ret.path=lookup.path;ret.object=lookup.node;ret.name=lookup.node.name;ret.isRoot=lookup.path==="/"}catch(e){ret.error=e.errno}return ret},createFolder:function(parent,name,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(canRead,canWrite);return FS.mkdir(path,mode)},createPath:function(parent,path,canRead,canWrite){parent=typeof parent==="string"?parent:FS.getPath(parent);var parts=path.split("/").reverse();while(parts.length){var part=parts.pop();if(!part)continue;var current=PATH.join2(parent,part);try{FS.mkdir(current)}catch(e){}parent=current}return current},createFile:function(parent,name,properties,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(canRead,canWrite);return FS.create(path,mode)},createDataFile:function(parent,name,data,canRead,canWrite,canOwn){var path=name?PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name):parent;var mode=FS.getMode(canRead,canWrite);var node=FS.create(path,mode);if(data){if(typeof data==="string"){var arr=new Array(data.length);for(var i=0,len=data.length;i<len;++i)arr[i]=data.charCodeAt(i);data=arr}FS.chmod(node,mode|146);var stream=FS.open(node,"w");FS.write(stream,data,0,data.length,0,canOwn);FS.close(stream);FS.chmod(node,mode)}return node},createDevice:function(parent,name,input,output){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(!!input,!!output);if(!FS.createDevice.major)FS.createDevice.major=64;var dev=FS.makedev(FS.createDevice.major++,0);FS.registerDevice(dev,{open:function(stream){stream.seekable=false},close:function(stream){if(output&&output.buffer&&output.buffer.length){output(10)}},read:function(stream,buffer,offset,length,pos){var bytesRead=0;for(var i=0;i<length;i++){var result;try{result=input()}catch(e){throw new FS.ErrnoError(5)}if(result===undefined&&bytesRead===0){throw new FS.ErrnoError(11)}if(result===null||result===undefined)break;bytesRead++;buffer[offset+i]=result}if(bytesRead){stream.node.timestamp=Date.now()}return bytesRead},write:function(stream,buffer,offset,length,pos){for(var i=0;i<length;i++){try{output(buffer[offset+i])}catch(e){throw new FS.ErrnoError(5)}}if(length){stream.node.timestamp=Date.now()}return i}});return FS.mkdev(path,mode,dev)},createLink:function(parent,name,target,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);return FS.symlink(target,path)},forceLoadFile:function(obj){if(obj.isDevice||obj.isFolder||obj.link||obj.contents)return true;var success=true;if(typeof XMLHttpRequest!=="undefined"){throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.")}else if(read_){try{obj.contents=intArrayFromString(read_(obj.url),true);obj.usedBytes=obj.contents.length}catch(e){success=false}}else{throw new Error("Cannot load without read() or XMLHttpRequest.")}if(!success)___setErrNo(5);return success},createLazyFile:function(parent,name,url,canRead,canWrite){function LazyUint8Array(){this.lengthKnown=false;this.chunks=[]}LazyUint8Array.prototype.get=function LazyUint8Array_get(idx){if(idx>this.length-1||idx<0){return undefined}var chunkOffset=idx%this.chunkSize;var chunkNum=idx/this.chunkSize|0;return this.getter(chunkNum)[chunkOffset]};LazyUint8Array.prototype.setDataGetter=function LazyUint8Array_setDataGetter(getter){this.getter=getter};LazyUint8Array.prototype.cacheLength=function LazyUint8Array_cacheLength(){var xhr=new XMLHttpRequest;xhr.open("HEAD",url,false);xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);var datalength=Number(xhr.getResponseHeader("Content-length"));var header;var hasByteServing=(header=xhr.getResponseHeader("Accept-Ranges"))&&header==="bytes";var usesGzip=(header=xhr.getResponseHeader("Content-Encoding"))&&header==="gzip";var chunkSize=1024*1024;if(!hasByteServing)chunkSize=datalength;var doXHR=function(from,to){if(from>to)throw new Error("invalid range ("+from+", "+to+") or no bytes requested!");if(to>datalength-1)throw new Error("only "+datalength+" bytes available! programmer error!");var xhr=new XMLHttpRequest;xhr.open("GET",url,false);if(datalength!==chunkSize)xhr.setRequestHeader("Range","bytes="+from+"-"+to);if(typeof Uint8Array!="undefined")xhr.responseType="arraybuffer";if(xhr.overrideMimeType){xhr.overrideMimeType("text/plain; charset=x-user-defined")}xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);if(xhr.response!==undefined){return new Uint8Array(xhr.response||[])}else{return intArrayFromString(xhr.responseText||"",true)}};var lazyArray=this;lazyArray.setDataGetter(function(chunkNum){var start=chunkNum*chunkSize;var end=(chunkNum+1)*chunkSize-1;end=Math.min(end,datalength-1);if(typeof lazyArray.chunks[chunkNum]==="undefined"){lazyArray.chunks[chunkNum]=doXHR(start,end)}if(typeof lazyArray.chunks[chunkNum]==="undefined")throw new Error("doXHR failed!");return lazyArray.chunks[chunkNum]});if(usesGzip||!datalength){chunkSize=datalength=1;datalength=this.getter(0).length;chunkSize=datalength;console.log("LazyFiles on gzip forces download of the whole file when length is accessed")}this._length=datalength;this._chunkSize=chunkSize;this.lengthKnown=true};if(typeof XMLHttpRequest!=="undefined"){if(!ENVIRONMENT_IS_WORKER)throw"Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";var lazyArray=new LazyUint8Array;Object.defineProperties(lazyArray,{length:{get:function(){if(!this.lengthKnown){this.cacheLength()}return this._length}},chunkSize:{get:function(){if(!this.lengthKnown){this.cacheLength()}return this._chunkSize}}});var properties={isDevice:false,contents:lazyArray}}else{var properties={isDevice:false,url:url}}var node=FS.createFile(parent,name,properties,canRead,canWrite);if(properties.contents){node.contents=properties.contents}else if(properties.url){node.contents=null;node.url=properties.url}Object.defineProperties(node,{usedBytes:{get:function(){return this.contents.length}}});var stream_ops={};var keys=Object.keys(node.stream_ops);keys.forEach(function(key){var fn=node.stream_ops[key];stream_ops[key]=function forceLoadLazyFile(){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(5)}return fn.apply(null,arguments)}});stream_ops.read=function stream_ops_read(stream,buffer,offset,length,position){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(5)}var contents=stream.node.contents;if(position>=contents.length)return 0;var size=Math.min(contents.length-position,length);assert(size>=0);if(contents.slice){for(var i=0;i<size;i++){buffer[offset+i]=contents[position+i]}}else{for(var i=0;i<size;i++){buffer[offset+i]=contents.get(position+i)}}return size};node.stream_ops=stream_ops;return node},createPreloadedFile:function(parent,name,url,canRead,canWrite,onload,onerror,dontCreateFile,canOwn,preFinish){Browser.init();var fullname=name?PATH_FS.resolve(PATH.join2(parent,name)):parent;var dep=getUniqueRunDependency("cp "+fullname);function processData(byteArray){function finish(byteArray){if(preFinish)preFinish();if(!dontCreateFile){FS.createDataFile(parent,name,byteArray,canRead,canWrite,canOwn)}if(onload)onload();removeRunDependency(dep)}var handled=false;Module["preloadPlugins"].forEach(function(plugin){if(handled)return;if(plugin["canHandle"](fullname)){plugin["handle"](byteArray,fullname,finish,function(){if(onerror)onerror();removeRunDependency(dep)});handled=true}});if(!handled)finish(byteArray)}addRunDependency(dep);if(typeof url=="string"){Browser.asyncLoad(url,function(byteArray){processData(byteArray)},onerror)}else{processData(url)}},indexedDB:function(){return window.indexedDB||window.mozIndexedDB||window.webkitIndexedDB||window.msIndexedDB},DB_NAME:function(){return"EM_FS_"+window.location.pathname},DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function(paths,onload,onerror){onload=onload||function(){};onerror=onerror||function(){};var indexedDB=FS.indexedDB();try{var openRequest=indexedDB.open(FS.DB_NAME(),FS.DB_VERSION)}catch(e){return onerror(e)}openRequest.onupgradeneeded=function openRequest_onupgradeneeded(){console.log("creating db");var db=openRequest.result;db.createObjectStore(FS.DB_STORE_NAME)};openRequest.onsuccess=function openRequest_onsuccess(){var db=openRequest.result;var transaction=db.transaction([FS.DB_STORE_NAME],"readwrite");var files=transaction.objectStore(FS.DB_STORE_NAME);var ok=0,fail=0,total=paths.length;function finish(){if(fail==0)onload();else onerror()}paths.forEach(function(path){var putRequest=files.put(FS.analyzePath(path).object.contents,path);putRequest.onsuccess=function putRequest_onsuccess(){ok++;if(ok+fail==total)finish()};putRequest.onerror=function putRequest_onerror(){fail++;if(ok+fail==total)finish()}});transaction.onerror=onerror};openRequest.onerror=onerror},loadFilesFromDB:function(paths,onload,onerror){onload=onload||function(){};onerror=onerror||function(){};var indexedDB=FS.indexedDB();try{var openRequest=indexedDB.open(FS.DB_NAME(),FS.DB_VERSION)}catch(e){return onerror(e)}openRequest.onupgradeneeded=onerror;openRequest.onsuccess=function openRequest_onsuccess(){var db=openRequest.result;try{var transaction=db.transaction([FS.DB_STORE_NAME],"readonly")}catch(e){onerror(e);return}var files=transaction.objectStore(FS.DB_STORE_NAME);var ok=0,fail=0,total=paths.length;function finish(){if(fail==0)onload();else onerror()}paths.forEach(function(path){var getRequest=files.get(path);getRequest.onsuccess=function getRequest_onsuccess(){if(FS.analyzePath(path).exists){FS.unlink(path)}FS.createDataFile(PATH.dirname(path),PATH.basename(path),getRequest.result,true,true,true);ok++;if(ok+fail==total)finish()};getRequest.onerror=function getRequest_onerror(){fail++;if(ok+fail==total)finish()}});transaction.onerror=onerror};openRequest.onerror=onerror}};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function(dirfd,path){if(path[0]!=="/"){var dir;if(dirfd===-100){dir=FS.cwd()}else{var dirstream=FS.getStream(dirfd);if(!dirstream)throw new FS.ErrnoError(9);dir=dirstream.path}path=PATH.join2(dir,path)}return path},doStat:function(func,path,buf){try{var stat=func(path)}catch(e){if(e&&e.node&&PATH.normalize(path)!==PATH.normalize(FS.getPath(e.node))){return-20}throw e}HEAP32[buf>>2]=stat.dev;HEAP32[buf+4>>2]=0;HEAP32[buf+8>>2]=stat.ino;HEAP32[buf+12>>2]=stat.mode;HEAP32[buf+16>>2]=stat.nlink;HEAP32[buf+20>>2]=stat.uid;HEAP32[buf+24>>2]=stat.gid;HEAP32[buf+28>>2]=stat.rdev;HEAP32[buf+32>>2]=0;tempI64=[stat.size>>>0,(tempDouble=stat.size,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[buf+40>>2]=tempI64[0],HEAP32[buf+44>>2]=tempI64[1];HEAP32[buf+48>>2]=4096;HEAP32[buf+52>>2]=stat.blocks;HEAP32[buf+56>>2]=stat.atime.getTime()/1e3|0;HEAP32[buf+60>>2]=0;HEAP32[buf+64>>2]=stat.mtime.getTime()/1e3|0;HEAP32[buf+68>>2]=0;HEAP32[buf+72>>2]=stat.ctime.getTime()/1e3|0;HEAP32[buf+76>>2]=0;tempI64=[stat.ino>>>0,(tempDouble=stat.ino,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[buf+80>>2]=tempI64[0],HEAP32[buf+84>>2]=tempI64[1];return 0},doMsync:function(addr,stream,len,flags){var buffer=new Uint8Array(HEAPU8.subarray(addr,addr+len));FS.msync(stream,buffer,0,len,flags)},doMkdir:function(path,mode){path=PATH.normalize(path);if(path[path.length-1]==="/")path=path.substr(0,path.length-1);FS.mkdir(path,mode,0);return 0},doMknod:function(path,mode,dev){switch(mode&61440){case 32768:case 8192:case 24576:case 4096:case 49152:break;default:return-22}FS.mknod(path,mode,dev);return 0},doReadlink:function(path,buf,bufsize){if(bufsize<=0)return-22;var ret=FS.readlink(path);var len=Math.min(bufsize,lengthBytesUTF8(ret));var endChar=HEAP8[buf+len];stringToUTF8(ret,buf,bufsize+1);HEAP8[buf+len]=endChar;return len},doAccess:function(path,amode){if(amode&~7){return-22}var node;var lookup=FS.lookupPath(path,{follow:true});node=lookup.node;if(!node){return-2}var perms="";if(amode&4)perms+="r";if(amode&2)perms+="w";if(amode&1)perms+="x";if(perms&&FS.nodePermissions(node,perms)){return-13}return 0},doDup:function(path,flags,suggestFD){var suggest=FS.getStream(suggestFD);if(suggest)FS.close(suggest);return FS.open(path,flags,0,suggestFD,suggestFD).fd},doReadv:function(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i<iovcnt;i++){var ptr=HEAP32[iov+i*8>>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.read(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr;if(curr<len)break}return ret},doWritev:function(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i<iovcnt;i++){var ptr=HEAP32[iov+i*8>>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.write(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr}return ret},varargs:0,get:function(varargs){SYSCALLS.varargs+=4;var ret=HEAP32[SYSCALLS.varargs-4>>2];return ret},getStr:function(){var ret=UTF8ToString(SYSCALLS.get());return ret},getStreamFromFD:function(){var stream=FS.getStream(SYSCALLS.get());if(!stream)throw new FS.ErrnoError(9);return stream},get64:function(){var low=SYSCALLS.get(),high=SYSCALLS.get();if(low>=0)assert(high===0);else assert(high===-1);return low},getZero:function(){assert(SYSCALLS.get()===0)}};function ___syscall140(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),offset_high=SYSCALLS.get(),offset_low=SYSCALLS.get(),result=SYSCALLS.get(),whence=SYSCALLS.get();var HIGH_OFFSET=4294967296;var offset=offset_high*HIGH_OFFSET+(offset_low>>>0);var DOUBLE_LIMIT=9007199254740992;if(offset<=-DOUBLE_LIMIT||offset>=DOUBLE_LIMIT){return-75}FS.llseek(stream,offset,whence);tempI64=[stream.position>>>0,(tempDouble=stream.position,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[result>>2]=tempI64[0],HEAP32[result+4>>2]=tempI64[1];if(stream.getdents&&offset===0&&whence===0)stream.getdents=null;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall142(which,varargs){SYSCALLS.varargs=varargs;try{var nfds=SYSCALLS.get(),readfds=SYSCALLS.get(),writefds=SYSCALLS.get(),exceptfds=SYSCALLS.get(),timeout=SYSCALLS.get();assert(nfds<=64,"nfds must be less than or equal to 64");assert(!exceptfds,"exceptfds not supported");var total=0;var srcReadLow=readfds?HEAP32[readfds>>2]:0,srcReadHigh=readfds?HEAP32[readfds+4>>2]:0;var srcWriteLow=writefds?HEAP32[writefds>>2]:0,srcWriteHigh=writefds?HEAP32[writefds+4>>2]:0;var srcExceptLow=exceptfds?HEAP32[exceptfds>>2]:0,srcExceptHigh=exceptfds?HEAP32[exceptfds+4>>2]:0;var dstReadLow=0,dstReadHigh=0;var dstWriteLow=0,dstWriteHigh=0;var dstExceptLow=0,dstExceptHigh=0;var allLow=(readfds?HEAP32[readfds>>2]:0)|(writefds?HEAP32[writefds>>2]:0)|(exceptfds?HEAP32[exceptfds>>2]:0);var allHigh=(readfds?HEAP32[readfds+4>>2]:0)|(writefds?HEAP32[writefds+4>>2]:0)|(exceptfds?HEAP32[exceptfds+4>>2]:0);var check=function(fd,low,high,val){return fd<32?low&val:high&val};for(var fd=0;fd<nfds;fd++){var mask=1<<fd%32;if(!check(fd,allLow,allHigh,mask)){continue}var stream=FS.getStream(fd);if(!stream)throw new FS.ErrnoError(9);var flags=SYSCALLS.DEFAULT_POLLMASK;if(stream.stream_ops.poll){flags=stream.stream_ops.poll(stream)}if(flags&1&&check(fd,srcReadLow,srcReadHigh,mask)){fd<32?dstReadLow=dstReadLow|mask:dstReadHigh=dstReadHigh|mask;total++}if(flags&4&&check(fd,srcWriteLow,srcWriteHigh,mask)){fd<32?dstWriteLow=dstWriteLow|mask:dstWriteHigh=dstWriteHigh|mask;total++}if(flags&2&&check(fd,srcExceptLow,srcExceptHigh,mask)){fd<32?dstExceptLow=dstExceptLow|mask:dstExceptHigh=dstExceptHigh|mask;total++}}if(readfds){HEAP32[readfds>>2]=dstReadLow;HEAP32[readfds+4>>2]=dstReadHigh}if(writefds){HEAP32[writefds>>2]=dstWriteLow;HEAP32[writefds+4>>2]=dstWriteHigh}if(exceptfds){HEAP32[exceptfds>>2]=dstExceptLow;HEAP32[exceptfds+4>>2]=dstExceptHigh}return total}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall145(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doReadv(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall146(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doWritev(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function __emscripten_syscall_mmap2(addr,len,prot,flags,fd,off){off<<=12;var ptr;var allocated=false;if((flags&16)!==0&&addr%PAGE_SIZE!==0){return-22}if((flags&32)!==0){ptr=_memalign(PAGE_SIZE,len);if(!ptr)return-12;_memset(ptr,0,len);allocated=true}else{var info=FS.getStream(fd);if(!info)return-9;var res=FS.mmap(info,HEAPU8,addr,len,off,prot,flags);ptr=res.ptr;allocated=res.allocated}SYSCALLS.mappings[ptr]={malloc:ptr,len:len,allocated:allocated,fd:fd,flags:flags};return ptr}function ___syscall192(which,varargs){SYSCALLS.varargs=varargs;try{var addr=SYSCALLS.get(),len=SYSCALLS.get(),prot=SYSCALLS.get(),flags=SYSCALLS.get(),fd=SYSCALLS.get(),off=SYSCALLS.get();return __emscripten_syscall_mmap2(addr,len,prot,flags,fd,off)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall194(which,varargs){SYSCALLS.varargs=varargs;try{var fd=SYSCALLS.get(),zero=SYSCALLS.getZero(),length=SYSCALLS.get64();FS.ftruncate(fd,length);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall195(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),buf=SYSCALLS.get();return SYSCALLS.doStat(FS.stat,path,buf)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall197(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),buf=SYSCALLS.get();return SYSCALLS.doStat(FS.stat,stream.path,buf)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall202(which,varargs){SYSCALLS.varargs=varargs;try{return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall199(a0,a1){return ___syscall202(a0,a1)}var PROCINFO={ppid:1,pid:42,sid:42,pgid:42};function ___syscall20(which,varargs){SYSCALLS.varargs=varargs;try{return PROCINFO.pid}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall201(a0,a1){return ___syscall202(a0,a1)}function ___syscall221(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),cmd=SYSCALLS.get();switch(cmd){case 0:{var arg=SYSCALLS.get();if(arg<0){return-22}var newStream;newStream=FS.open(stream.path,stream.flags,0,arg);return newStream.fd}case 1:case 2:return 0;case 3:return stream.flags;case 4:{var arg=SYSCALLS.get();stream.flags|=arg;return 0}case 12:{var arg=SYSCALLS.get();var offset=0;HEAP16[arg+offset>>1]=2;return 0}case 13:case 14:return 0;case 16:case 8:return-22;case 9:___setErrNo(22);return-1;default:{return-22}}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall3(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),buf=SYSCALLS.get(),count=SYSCALLS.get();return FS.read(stream,HEAP8,buf,count)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall33(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),amode=SYSCALLS.get();return SYSCALLS.doAccess(path,amode)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall4(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),buf=SYSCALLS.get(),count=SYSCALLS.get();return FS.write(stream,HEAP8,buf,count)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall5(which,varargs){SYSCALLS.varargs=varargs;try{var pathname=SYSCALLS.getStr(),flags=SYSCALLS.get(),mode=SYSCALLS.get();var stream=FS.open(pathname,flags,mode);return stream.fd}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall54(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),op=SYSCALLS.get();switch(op){case 21509:case 21505:{if(!stream.tty)return-25;return 0}case 21510:case 21511:case 21512:case 21506:case 21507:case 21508:{if(!stream.tty)return-25;return 0}case 21519:{if(!stream.tty)return-25;var argp=SYSCALLS.get();HEAP32[argp>>2]=0;return 0}case 21520:{if(!stream.tty)return-25;return-22}case 21531:{var argp=SYSCALLS.get();return FS.ioctl(stream,op,argp)}case 21523:{if(!stream.tty)return-25;return 0}case 21524:{if(!stream.tty)return-25;return 0}default:abort("bad ioctl syscall "+op)}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall6(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD();FS.close(stream);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall64(which,varargs){SYSCALLS.varargs=varargs;try{return PROCINFO.ppid}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall77(which,varargs){SYSCALLS.varargs=varargs;try{var who=SYSCALLS.get(),usage=SYSCALLS.get();_memset(usage,0,136);HEAP32[usage>>2]=1;HEAP32[usage+4>>2]=2;HEAP32[usage+8>>2]=3;HEAP32[usage+12>>2]=4;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function __emscripten_syscall_munmap(addr,len){if(addr===-1||len===0){return-22}var info=SYSCALLS.mappings[addr];if(!info)return 0;if(len===info.len){var stream=FS.getStream(info.fd);SYSCALLS.doMsync(addr,stream,len,info.flags);FS.munmap(stream);SYSCALLS.mappings[addr]=null;if(info.allocated){_free(info.malloc)}}return 0}function ___syscall91(which,varargs){SYSCALLS.varargs=varargs;try{var addr=SYSCALLS.get(),len=SYSCALLS.get();return __emscripten_syscall_munmap(addr,len)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___unlock(){}function _abort(){Module["abort"]()}function _atexit(func,arg){__ATEXIT__.unshift({func:func,arg:arg})}function _clock(){if(_clock.start===undefined)_clock.start=Date.now();return(Date.now()-_clock.start)*(1e6/1e3)|0}function _emscripten_get_heap_size(){return HEAP8.length}function _getenv(name){if(name===0)return 0;name=UTF8ToString(name);if(!ENV.hasOwnProperty(name))return 0;if(_getenv.ret)_free(_getenv.ret);_getenv.ret=allocateUTF8(ENV[name]);return _getenv.ret}function _gettimeofday(ptr){var now=Date.now();HEAP32[ptr>>2]=now/1e3|0;HEAP32[ptr+4>>2]=now%1e3*1e3|0;return 0}function _llvm_stackrestore(p){var self=_llvm_stacksave;var ret=self.LLVM_SAVEDSTACKS[p];self.LLVM_SAVEDSTACKS.splice(p,1);stackRestore(ret)}function _llvm_stacksave(){var self=_llvm_stacksave;if(!self.LLVM_SAVEDSTACKS){self.LLVM_SAVEDSTACKS=[]}self.LLVM_SAVEDSTACKS.push(stackSave());return self.LLVM_SAVEDSTACKS.length-1}var ___tm_current=75648;var ___tm_timezone=(stringToUTF8("GMT",75696,4),75696);function _tzset(){if(_tzset.called)return;_tzset.called=true;HEAP32[__get_timezone()>>2]=(new Date).getTimezoneOffset()*60;var winter=new Date(2e3,0,1);var summer=new Date(2e3,6,1);HEAP32[__get_daylight()>>2]=Number(winter.getTimezoneOffset()!=summer.getTimezoneOffset());function extractZone(date){var match=date.toTimeString().match(/\(([A-Za-z ]+)\)$/);return match?match[1]:"GMT"}var winterName=extractZone(winter);var summerName=extractZone(summer);var winterNamePtr=allocate(intArrayFromString(winterName),"i8",ALLOC_NORMAL);var summerNamePtr=allocate(intArrayFromString(summerName),"i8",ALLOC_NORMAL);if(summer.getTimezoneOffset()<winter.getTimezoneOffset()){HEAP32[__get_tzname()>>2]=winterNamePtr;HEAP32[__get_tzname()+4>>2]=summerNamePtr}else{HEAP32[__get_tzname()>>2]=summerNamePtr;HEAP32[__get_tzname()+4>>2]=winterNamePtr}}function _localtime_r(time,tmPtr){_tzset();var date=new Date(HEAP32[time>>2]*1e3);HEAP32[tmPtr>>2]=date.getSeconds();HEAP32[tmPtr+4>>2]=date.getMinutes();HEAP32[tmPtr+8>>2]=date.getHours();HEAP32[tmPtr+12>>2]=date.getDate();HEAP32[tmPtr+16>>2]=date.getMonth();HEAP32[tmPtr+20>>2]=date.getFullYear()-1900;HEAP32[tmPtr+24>>2]=date.getDay();var start=new Date(date.getFullYear(),0,1);var yday=(date.getTime()-start.getTime())/(1e3*60*60*24)|0;HEAP32[tmPtr+28>>2]=yday;HEAP32[tmPtr+36>>2]=-(date.getTimezoneOffset()*60);var summerOffset=new Date(2e3,6,1).getTimezoneOffset();var winterOffset=start.getTimezoneOffset();var dst=(summerOffset!=winterOffset&&date.getTimezoneOffset()==Math.min(winterOffset,summerOffset))|0;HEAP32[tmPtr+32>>2]=dst;var zonePtr=HEAP32[__get_tzname()+(dst?4:0)>>2];HEAP32[tmPtr+40>>2]=zonePtr;return tmPtr}function _localtime(time){return _localtime_r(time,___tm_current)}function _emscripten_memcpy_big(dest,src,num){HEAPU8.set(HEAPU8.subarray(src,src+num),dest)}function abortOnCannotGrowMemory(requestedSize){abort("Cannot enlarge memory arrays to size "+requestedSize+" bytes (OOM). Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value "+HEAP8.length+", (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ")}function _emscripten_resize_heap(requestedSize){abortOnCannotGrowMemory(requestedSize)}function __isLeapYear(year){return year%4===0&&(year%100!==0||year%400===0)}function __arraySum(array,index){var sum=0;for(var i=0;i<=index;sum+=array[i++]);return sum}var __MONTH_DAYS_LEAP=[31,29,31,30,31,30,31,31,30,31,30,31];var __MONTH_DAYS_REGULAR=[31,28,31,30,31,30,31,31,30,31,30,31];function __addDays(date,days){var newDate=new Date(date.getTime());while(days>0){var leap=__isLeapYear(newDate.getFullYear());var currentMonth=newDate.getMonth();var daysInCurrentMonth=(leap?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR)[currentMonth];if(days>daysInCurrentMonth-newDate.getDate()){days-=daysInCurrentMonth-newDate.getDate()+1;newDate.setDate(1);if(currentMonth<11){newDate.setMonth(currentMonth+1)}else{newDate.setMonth(0);newDate.setFullYear(newDate.getFullYear()+1)}}else{newDate.setDate(newDate.getDate()+days);return newDate}}return newDate}function _strftime(s,maxsize,format,tm){var tm_zone=HEAP32[tm+40>>2];var date={tm_sec:HEAP32[tm>>2],tm_min:HEAP32[tm+4>>2],tm_hour:HEAP32[tm+8>>2],tm_mday:HEAP32[tm+12>>2],tm_mon:HEAP32[tm+16>>2],tm_year:HEAP32[tm+20>>2],tm_wday:HEAP32[tm+24>>2],tm_yday:HEAP32[tm+28>>2],tm_isdst:HEAP32[tm+32>>2],tm_gmtoff:HEAP32[tm+36>>2],tm_zone:tm_zone?UTF8ToString(tm_zone):""};var pattern=UTF8ToString(format);var EXPANSION_RULES_1={"%c":"%a %b %d %H:%M:%S %Y","%D":"%m/%d/%y","%F":"%Y-%m-%d","%h":"%b","%r":"%I:%M:%S %p","%R":"%H:%M","%T":"%H:%M:%S","%x":"%m/%d/%y","%X":"%H:%M:%S","%Ec":"%c","%EC":"%C","%Ex":"%m/%d/%y","%EX":"%H:%M:%S","%Ey":"%y","%EY":"%Y","%Od":"%d","%Oe":"%e","%OH":"%H","%OI":"%I","%Om":"%m","%OM":"%M","%OS":"%S","%Ou":"%u","%OU":"%U","%OV":"%V","%Ow":"%w","%OW":"%W","%Oy":"%y"};for(var rule in EXPANSION_RULES_1){pattern=pattern.replace(new RegExp(rule,"g"),EXPANSION_RULES_1[rule])}var WEEKDAYS=["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"];var MONTHS=["January","February","March","April","May","June","July","August","September","October","November","December"];function leadingSomething(value,digits,character){var str=typeof value==="number"?value.toString():value||"";while(str.length<digits){str=character[0]+str}return str}function leadingNulls(value,digits){return leadingSomething(value,digits,"0")}function compareByDay(date1,date2){function sgn(value){return value<0?-1:value>0?1:0}var compare;if((compare=sgn(date1.getFullYear()-date2.getFullYear()))===0){if((compare=sgn(date1.getMonth()-date2.getMonth()))===0){compare=sgn(date1.getDate()-date2.getDate())}}return compare}function getFirstWeekStartDate(janFourth){switch(janFourth.getDay()){case 0:return new Date(janFourth.getFullYear()-1,11,29);case 1:return janFourth;case 2:return new Date(janFourth.getFullYear(),0,3);case 3:return new Date(janFourth.getFullYear(),0,2);case 4:return new Date(janFourth.getFullYear(),0,1);case 5:return new Date(janFourth.getFullYear()-1,11,31);case 6:return new Date(janFourth.getFullYear()-1,11,30)}}function getWeekBasedYear(date){var thisDate=__addDays(new Date(date.tm_year+1900,0,1),date.tm_yday);var janFourthThisYear=new Date(thisDate.getFullYear(),0,4);var janFourthNextYear=new Date(thisDate.getFullYear()+1,0,4);var firstWeekStartThisYear=getFirstWeekStartDate(janFourthThisYear);var firstWeekStartNextYear=getFirstWeekStartDate(janFourthNextYear);if(compareByDay(firstWeekStartThisYear,thisDate)<=0){if(compareByDay(firstWeekStartNextYear,thisDate)<=0){return thisDate.getFullYear()+1}else{return thisDate.getFullYear()}}else{return thisDate.getFullYear()-1}}var EXPANSION_RULES_2={"%a":function(date){return WEEKDAYS[date.tm_wday].substring(0,3)},"%A":function(date){return WEEKDAYS[date.tm_wday]},"%b":function(date){return MONTHS[date.tm_mon].substring(0,3)},"%B":function(date){return MONTHS[date.tm_mon]},"%C":function(date){var year=date.tm_year+1900;return leadingNulls(year/100|0,2)},"%d":function(date){return leadingNulls(date.tm_mday,2)},"%e":function(date){return leadingSomething(date.tm_mday,2," ")},"%g":function(date){return getWeekBasedYear(date).toString().substring(2)},"%G":function(date){return getWeekBasedYear(date)},"%H":function(date){return leadingNulls(date.tm_hour,2)},"%I":function(date){var twelveHour=date.tm_hour;if(twelveHour==0)twelveHour=12;else if(twelveHour>12)twelveHour-=12;return leadingNulls(twelveHour,2)},"%j":function(date){return leadingNulls(date.tm_mday+__arraySum(__isLeapYear(date.tm_year+1900)?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,date.tm_mon-1),3)},"%m":function(date){return leadingNulls(date.tm_mon+1,2)},"%M":function(date){return leadingNulls(date.tm_min,2)},"%n":function(){return"\n"},"%p":function(date){if(date.tm_hour>=0&&date.tm_hour<12){return"AM"}else{return"PM"}},"%S":function(date){return leadingNulls(date.tm_sec,2)},"%t":function(){return"\t"},"%u":function(date){return date.tm_wday||7},"%U":function(date){var janFirst=new Date(date.tm_year+1900,0,1);var firstSunday=janFirst.getDay()===0?janFirst:__addDays(janFirst,7-janFirst.getDay());var endDate=new Date(date.tm_year+1900,date.tm_mon,date.tm_mday);if(compareByDay(firstSunday,endDate)<0){var februaryFirstUntilEndMonth=__arraySum(__isLeapYear(endDate.getFullYear())?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,endDate.getMonth()-1)-31;var firstSundayUntilEndJanuary=31-firstSunday.getDate();var days=firstSundayUntilEndJanuary+februaryFirstUntilEndMonth+endDate.getDate();return leadingNulls(Math.ceil(days/7),2)}return compareByDay(firstSunday,janFirst)===0?"01":"00"},"%V":function(date){var janFourthThisYear=new Date(date.tm_year+1900,0,4);var janFourthNextYear=new Date(date.tm_year+1901,0,4);var firstWeekStartThisYear=getFirstWeekStartDate(janFourthThisYear);var firstWeekStartNextYear=getFirstWeekStartDate(janFourthNextYear);var endDate=__addDays(new Date(date.tm_year+1900,0,1),date.tm_yday);if(compareByDay(endDate,firstWeekStartThisYear)<0){return"53"}if(compareByDay(firstWeekStartNextYear,endDate)<=0){return"01"}var daysDifference;if(firstWeekStartThisYear.getFullYear()<date.tm_year+1900){daysDifference=date.tm_yday+32-firstWeekStartThisYear.getDate()}else{daysDifference=date.tm_yday+1-firstWeekStartThisYear.getDate()}return leadingNulls(Math.ceil(daysDifference/7),2)},"%w":function(date){return date.tm_wday},"%W":function(date){var janFirst=new Date(date.tm_year,0,1);var firstMonday=janFirst.getDay()===1?janFirst:__addDays(janFirst,janFirst.getDay()===0?1:7-janFirst.getDay()+1);var endDate=new Date(date.tm_year+1900,date.tm_mon,date.tm_mday);if(compareByDay(firstMonday,endDate)<0){var februaryFirstUntilEndMonth=__arraySum(__isLeapYear(endDate.getFullYear())?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,endDate.getMonth()-1)-31;var firstMondayUntilEndJanuary=31-firstMonday.getDate();var days=firstMondayUntilEndJanuary+februaryFirstUntilEndMonth+endDate.getDate();return leadingNulls(Math.ceil(days/7),2)}return compareByDay(firstMonday,janFirst)===0?"01":"00"},"%y":function(date){return(date.tm_year+1900).toString().substring(2)},"%Y":function(date){return date.tm_year+1900},"%z":function(date){var off=date.tm_gmtoff;var ahead=off>=0;off=Math.abs(off)/60;off=off/60*100+off%60;return(ahead?"+":"-")+String("0000"+off).slice(-4)},"%Z":function(date){return date.tm_zone},"%%":function(){return"%"}};for(var rule in EXPANSION_RULES_2){if(pattern.indexOf(rule)>=0){pattern=pattern.replace(new RegExp(rule,"g"),EXPANSION_RULES_2[rule](date))}}var bytes=intArrayFromString(pattern,false);if(bytes.length>maxsize){return 0}writeArrayToMemory(bytes,s);return bytes.length-1}function _sysconf(name){switch(name){case 30:return PAGE_SIZE;case 85:var maxHeapSize=2*1024*1024*1024-65536;maxHeapSize=HEAPU8.length;return maxHeapSize/PAGE_SIZE;case 132:case 133:case 12:case 137:case 138:case 15:case 235:case 16:case 17:case 18:case 19:case 20:case 149:case 13:case 10:case 236:case 153:case 9:case 21:case 22:case 159:case 154:case 14:case 77:case 78:case 139:case 80:case 81:case 82:case 68:case 67:case 164:case 11:case 29:case 47:case 48:case 95:case 52:case 51:case 46:return 200809;case 79:return 0;case 27:case 246:case 127:case 128:case 23:case 24:case 160:case 161:case 181:case 182:case 242:case 183:case 184:case 243:case 244:case 245:case 165:case 178:case 179:case 49:case 50:case 168:case 169:case 175:case 170:case 171:case 172:case 97:case 76:case 32:case 173:case 35:return-1;case 176:case 177:case 7:case 155:case 8:case 157:case 125:case 126:case 92:case 93:case 129:case 130:case 131:case 94:case 91:return 1;case 74:case 60:case 69:case 70:case 4:return 1024;case 31:case 42:case 72:return 32;case 87:case 26:case 33:return 2147483647;case 34:case 1:return 47839;case 38:case 36:return 99;case 43:case 37:return 2048;case 0:return 2097152;case 3:return 65536;case 28:return 32768;case 44:return 32767;case 75:return 16384;case 39:return 1e3;case 89:return 700;case 71:return 256;case 40:return 255;case 2:return 100;case 180:return 64;case 25:return 20;case 5:return 16;case 6:return 6;case 73:return 4;case 84:{if(typeof navigator==="object")return navigator["hardwareConcurrency"]||1;return 1}}___setErrNo(22);return-1}function _time(ptr){var ret=Date.now()/1e3|0;if(ptr){HEAP32[ptr>>2]=ret}return ret}FS.staticInit();if(ENVIRONMENT_HAS_NODE){var fs=require("fs");var NODEJS_PATH=require("path");NODEFS.staticInit()}function intArrayFromString(stringy,dontAddNull,length){var len=length>0?length:lengthBytesUTF8(stringy)+1;var u8array=new Array(len);var numBytesWritten=stringToUTF8Array(stringy,u8array,0,u8array.length);if(dontAddNull)u8array.length=numBytesWritten;return u8array}function nullFunc_ii(x){abortFnPtrError(x,"ii")}function nullFunc_iidiiii(x){abortFnPtrError(x,"iidiiii")}function nullFunc_iii(x){abortFnPtrError(x,"iii")}function nullFunc_iiii(x){abortFnPtrError(x,"iiii")}function nullFunc_iiiii(x){abortFnPtrError(x,"iiiii")}function nullFunc_jiji(x){abortFnPtrError(x,"jiji")}function nullFunc_v(x){abortFnPtrError(x,"v")}function nullFunc_vi(x){abortFnPtrError(x,"vi")}function nullFunc_vii(x){abortFnPtrError(x,"vii")}function nullFunc_viii(x){abortFnPtrError(x,"viii")}function nullFunc_viiii(x){abortFnPtrError(x,"viiii")}function nullFunc_viiiii(x){abortFnPtrError(x,"viiiii")}function nullFunc_viiiiii(x){abortFnPtrError(x,"viiiiii")}var asmGlobalArg={};var asmLibraryArg={"v":setTempRet0,"b":abortStackOverflow,"ca":nullFunc_ii,"W":nullFunc_iidiiii,"N":nullFunc_iii,"G":nullFunc_iiii,"A":nullFunc_iiiii,"u":nullFunc_jiji,"t":nullFunc_v,"s":nullFunc_vi,"r":nullFunc_vii,"ba":nullFunc_viii,"aa":nullFunc_viiii,"$":nullFunc_viiiii,"_":nullFunc_viiiiii,"k":___assert_fail,"Z":___buildEnvironment,"l":___lock,"q":___setErrNo,"Y":___syscall140,"X":___syscall142,"V":___syscall145,"p":___syscall146,"U":___syscall192,"T":___syscall194,"S":___syscall195,"R":___syscall197,"Q":___syscall199,"P":___syscall20,"O":___syscall201,"d":___syscall221,"M":___syscall3,"L":___syscall33,"K":___syscall4,"o":___syscall5,"n":___syscall54,"j":___syscall6,"J":___syscall64,"I":___syscall77,"H":___syscall91,"h":___unlock,"c":_abort,"F":_atexit,"m":_clock,"E":_emscripten_get_heap_size,"D":_emscripten_memcpy_big,"C":_emscripten_resize_heap,"B":_getenv,"g":_gettimeofday,"e":_llvm_stackrestore,"f":_llvm_stacksave,"z":_localtime,"y":_strftime,"x":_sysconf,"i":_time,"w":abortOnCannotGrowMemory,"a":DYNAMICTOP_PTR};var asm=Module["asm"](asmGlobalArg,asmLibraryArg,buffer);Module["asm"]=asm;var _GNUNET_CRYPTO_ecc_ecdh=Module["_GNUNET_CRYPTO_ecc_ecdh"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["da"].apply(null,arguments)};var _GNUNET_CRYPTO_ecdh_eddsa=Module["_GNUNET_CRYPTO_ecdh_eddsa"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ea"].apply(null,arguments)};var _GNUNET_CRYPTO_ecdhe_key_create=Module["_GNUNET_CRYPTO_ecdhe_key_create"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["fa"].apply(null,arguments)};var _GNUNET_CRYPTO_ecdhe_key_get_public=Module["_GNUNET_CRYPTO_ecdhe_key_get_public"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ga"].apply(null,arguments)};var _GNUNET_CRYPTO_ecdsa_key_create=Module["_GNUNET_CRYPTO_ecdsa_key_create"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ha"].apply(null,arguments)};var _GNUNET_CRYPTO_eddsa_key_create=Module["_GNUNET_CRYPTO_eddsa_key_create"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ia"].apply(null,arguments)};var _GNUNET_CRYPTO_eddsa_key_get_public=Module["_GNUNET_CRYPTO_eddsa_key_get_public"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ja"].apply(null,arguments)};var _GNUNET_CRYPTO_eddsa_sign=Module["_GNUNET_CRYPTO_eddsa_sign"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ka"].apply(null,arguments)};var _GNUNET_CRYPTO_eddsa_verify=Module["_GNUNET_CRYPTO_eddsa_verify"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["la"].apply(null,arguments)};var _GNUNET_CRYPTO_hash=Module["_GNUNET_CRYPTO_hash"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ma"].apply(null,arguments)};var _GNUNET_CRYPTO_hash_context_abort=Module["_GNUNET_CRYPTO_hash_context_abort"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["na"].apply(null,arguments)};var _GNUNET_CRYPTO_hash_context_finish=Module["_GNUNET_CRYPTO_hash_context_finish"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["oa"].apply(null,arguments)};var _GNUNET_CRYPTO_hash_context_read=Module["_GNUNET_CRYPTO_hash_context_read"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["pa"].apply(null,arguments)};var _GNUNET_CRYPTO_hash_context_start=Module["_GNUNET_CRYPTO_hash_context_start"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["qa"].apply(null,arguments)};var _GNUNET_CRYPTO_hash_create_random=Module["_GNUNET_CRYPTO_hash_create_random"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ra"].apply(null,arguments)};var _GNUNET_CRYPTO_hkdf=Module["_GNUNET_CRYPTO_hkdf"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["sa"].apply(null,arguments)};var _GNUNET_CRYPTO_kdf=Module["_GNUNET_CRYPTO_kdf"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ta"].apply(null,arguments)};var _GNUNET_CRYPTO_random_block=Module["_GNUNET_CRYPTO_random_block"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ua"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_blind=Module["_GNUNET_CRYPTO_rsa_blind"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["va"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_private_key_create=Module["_GNUNET_CRYPTO_rsa_private_key_create"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["wa"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_private_key_decode=Module["_GNUNET_CRYPTO_rsa_private_key_decode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["xa"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_private_key_encode=Module["_GNUNET_CRYPTO_rsa_private_key_encode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ya"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_private_key_free=Module["_GNUNET_CRYPTO_rsa_private_key_free"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["za"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_private_key_get_public=Module["_GNUNET_CRYPTO_rsa_private_key_get_public"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Aa"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_public_key_decode=Module["_GNUNET_CRYPTO_rsa_public_key_decode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ba"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_public_key_encode=Module["_GNUNET_CRYPTO_rsa_public_key_encode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ca"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_public_key_free=Module["_GNUNET_CRYPTO_rsa_public_key_free"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Da"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_sign_blinded=Module["_GNUNET_CRYPTO_rsa_sign_blinded"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ea"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_signature_decode=Module["_GNUNET_CRYPTO_rsa_signature_decode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Fa"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_signature_encode=Module["_GNUNET_CRYPTO_rsa_signature_encode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ga"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_signature_free=Module["_GNUNET_CRYPTO_rsa_signature_free"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ha"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_unblind=Module["_GNUNET_CRYPTO_rsa_unblind"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ia"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_verify=Module["_GNUNET_CRYPTO_rsa_verify"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ja"].apply(null,arguments)};var _GNUNET_CRYPTO_symmetric_decrypt=Module["_GNUNET_CRYPTO_symmetric_decrypt"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ka"].apply(null,arguments)};var _GNUNET_CRYPTO_symmetric_encrypt=Module["_GNUNET_CRYPTO_symmetric_encrypt"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["La"].apply(null,arguments)};var _GNUNET_STRINGS_data_to_string_alloc=Module["_GNUNET_STRINGS_data_to_string_alloc"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ma"].apply(null,arguments)};var _GNUNET_STRINGS_string_to_data=Module["_GNUNET_STRINGS_string_to_data"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Na"].apply(null,arguments)};var _TALER_WRALL_ecdhe_public_key_from_private=Module["_TALER_WRALL_ecdhe_public_key_from_private"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Oa"].apply(null,arguments)};var _TALER_WRALL_ecdsa_public_key_from_private=Module["_TALER_WRALL_ecdsa_public_key_from_private"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Pa"].apply(null,arguments)};var _TALER_WRALL_eddsa_public_key_from_private=Module["_TALER_WRALL_eddsa_public_key_from_private"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Qa"].apply(null,arguments)};var _TALER_WRALL_get_amount=Module["_TALER_WRALL_get_amount"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ra"].apply(null,arguments)};var _TALER_WRALL_purpose_create=Module["_TALER_WRALL_purpose_create"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Sa"].apply(null,arguments)};var _TALER_WR_get_currency=Module["_TALER_WR_get_currency"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ta"].apply(null,arguments)};var _TALER_WR_get_fraction=Module["_TALER_WR_get_fraction"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ua"].apply(null,arguments)};var _TALER_WR_get_value=Module["_TALER_WR_get_value"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Va"].apply(null,arguments)};var _TALER_amount_add=Module["_TALER_amount_add"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Wa"].apply(null,arguments)};var _TALER_amount_cmp=Module["_TALER_amount_cmp"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Xa"].apply(null,arguments)};var _TALER_amount_get_zero=Module["_TALER_amount_get_zero"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ya"].apply(null,arguments)};var _TALER_amount_hton=Module["_TALER_amount_hton"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Za"].apply(null,arguments)};var _TALER_amount_normalize=Module["_TALER_amount_normalize"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["_a"].apply(null,arguments)};var _TALER_amount_ntoh=Module["_TALER_amount_ntoh"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["$a"].apply(null,arguments)};var _TALER_amount_subtract=Module["_TALER_amount_subtract"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ab"].apply(null,arguments)};var _TALER_setup_fresh_coin=Module["_TALER_setup_fresh_coin"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["bb"].apply(null,arguments)};var ___errno_location=Module["___errno_location"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["cb"].apply(null,arguments)};var __get_daylight=Module["__get_daylight"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["db"].apply(null,arguments)};var __get_timezone=Module["__get_timezone"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["eb"].apply(null,arguments)};var __get_tzname=Module["__get_tzname"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["fb"].apply(null,arguments)};var _fflush=Module["_fflush"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["gb"].apply(null,arguments)};var _free=Module["_free"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["hb"].apply(null,arguments)};var _malloc=Module["_malloc"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ib"].apply(null,arguments)};var _memalign=Module["_memalign"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["jb"].apply(null,arguments)};var _memmove=Module["_memmove"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["kb"].apply(null,arguments)};var _memset=Module["_memset"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["lb"].apply(null,arguments)};var establishStackSpace=Module["establishStackSpace"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ob"].apply(null,arguments)};var globalCtors=Module["globalCtors"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["pb"].apply(null,arguments)};var stackAlloc=Module["stackAlloc"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["qb"].apply(null,arguments)};var stackRestore=Module["stackRestore"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["rb"].apply(null,arguments)};var stackSave=Module["stackSave"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["sb"].apply(null,arguments)};var dynCall_v=Module["dynCall_v"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["mb"].apply(null,arguments)};var dynCall_vi=Module["dynCall_vi"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["nb"].apply(null,arguments)};Module["asm"]=asm;if(!Object.getOwnPropertyDescriptor(Module,"intArrayFromString"))Module["intArrayFromString"]=function(){abort("'intArrayFromString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"intArrayToString"))Module["intArrayToString"]=function(){abort("'intArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};Module["ccall"]=ccall;Module["cwrap"]=cwrap;Module["setValue"]=setValue;Module["getValue"]=getValue;if(!Object.getOwnPropertyDescriptor(Module,"allocate"))Module["allocate"]=function(){abort("'allocate' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getMemory"))Module["getMemory"]=function(){abort("'getMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"AsciiToString"))Module["AsciiToString"]=function(){abort("'AsciiToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stringToAscii"))Module["stringToAscii"]=function(){abort("'stringToAscii' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"UTF8ArrayToString"))Module["UTF8ArrayToString"]=function(){abort("'UTF8ArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};Module["UTF8ToString"]=UTF8ToString;if(!Object.getOwnPropertyDescriptor(Module,"stringToUTF8Array"))Module["stringToUTF8Array"]=function(){abort("'stringToUTF8Array' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};Module["stringToUTF8"]=stringToUTF8;if(!Object.getOwnPropertyDescriptor(Module,"lengthBytesUTF8"))Module["lengthBytesUTF8"]=function(){abort("'lengthBytesUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"UTF16ToString"))Module["UTF16ToString"]=function(){abort("'UTF16ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stringToUTF16"))Module["stringToUTF16"]=function(){abort("'stringToUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"lengthBytesUTF16"))Module["lengthBytesUTF16"]=function(){abort("'lengthBytesUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"UTF32ToString"))Module["UTF32ToString"]=function(){abort("'UTF32ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stringToUTF32"))Module["stringToUTF32"]=function(){abort("'stringToUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"lengthBytesUTF32"))Module["lengthBytesUTF32"]=function(){abort("'lengthBytesUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"allocateUTF8"))Module["allocateUTF8"]=function(){abort("'allocateUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stackTrace"))Module["stackTrace"]=function(){abort("'stackTrace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addOnPreRun"))Module["addOnPreRun"]=function(){abort("'addOnPreRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addOnInit"))Module["addOnInit"]=function(){abort("'addOnInit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addOnPreMain"))Module["addOnPreMain"]=function(){abort("'addOnPreMain' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addOnExit"))Module["addOnExit"]=function(){abort("'addOnExit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addOnPostRun"))Module["addOnPostRun"]=function(){abort("'addOnPostRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"writeStringToMemory"))Module["writeStringToMemory"]=function(){abort("'writeStringToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"writeArrayToMemory"))Module["writeArrayToMemory"]=function(){abort("'writeArrayToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"writeAsciiToMemory"))Module["writeAsciiToMemory"]=function(){abort("'writeAsciiToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addRunDependency"))Module["addRunDependency"]=function(){abort("'addRunDependency' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"removeRunDependency"))Module["removeRunDependency"]=function(){abort("'removeRunDependency' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"ENV"))Module["ENV"]=function(){abort("'ENV' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"FS"))Module["FS"]=function(){abort("'FS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createFolder"))Module["FS_createFolder"]=function(){abort("'FS_createFolder' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createPath"))Module["FS_createPath"]=function(){abort("'FS_createPath' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createDataFile"))Module["FS_createDataFile"]=function(){abort("'FS_createDataFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createPreloadedFile"))Module["FS_createPreloadedFile"]=function(){abort("'FS_createPreloadedFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createLazyFile"))Module["FS_createLazyFile"]=function(){abort("'FS_createLazyFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createLink"))Module["FS_createLink"]=function(){abort("'FS_createLink' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createDevice"))Module["FS_createDevice"]=function(){abort("'FS_createDevice' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_unlink"))Module["FS_unlink"]=function(){abort("'FS_unlink' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"GL"))Module["GL"]=function(){abort("'GL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"dynamicAlloc"))Module["dynamicAlloc"]=function(){abort("'dynamicAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"warnOnce"))Module["warnOnce"]=function(){abort("'warnOnce' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"loadDynamicLibrary"))Module["loadDynamicLibrary"]=function(){abort("'loadDynamicLibrary' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"loadWebAssemblyModule"))Module["loadWebAssemblyModule"]=function(){abort("'loadWebAssemblyModule' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getLEB"))Module["getLEB"]=function(){abort("'getLEB' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getFunctionTables"))Module["getFunctionTables"]=function(){abort("'getFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"alignFunctionTables"))Module["alignFunctionTables"]=function(){abort("'alignFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"registerFunctions"))Module["registerFunctions"]=function(){abort("'registerFunctions' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addFunction"))Module["addFunction"]=function(){abort("'addFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"removeFunction"))Module["removeFunction"]=function(){abort("'removeFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getFuncWrapper"))Module["getFuncWrapper"]=function(){abort("'getFuncWrapper' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"prettyPrint"))Module["prettyPrint"]=function(){abort("'prettyPrint' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"makeBigInt"))Module["makeBigInt"]=function(){abort("'makeBigInt' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"dynCall"))Module["dynCall"]=function(){abort("'dynCall' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getCompilerSetting"))Module["getCompilerSetting"]=function(){abort("'getCompilerSetting' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stackSave"))Module["stackSave"]=function(){abort("'stackSave' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stackRestore"))Module["stackRestore"]=function(){abort("'stackRestore' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stackAlloc"))Module["stackAlloc"]=function(){abort("'stackAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"establishStackSpace"))Module["establishStackSpace"]=function(){abort("'establishStackSpace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"print"))Module["print"]=function(){abort("'print' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"printErr"))Module["printErr"]=function(){abort("'printErr' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getTempRet0"))Module["getTempRet0"]=function(){abort("'getTempRet0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"setTempRet0"))Module["setTempRet0"]=function(){abort("'setTempRet0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"callMain"))Module["callMain"]=function(){abort("'callMain' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"Pointer_stringify"))Module["Pointer_stringify"]=function(){abort("'Pointer_stringify' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"writeStackCookie"))Module["writeStackCookie"]=function(){abort("'writeStackCookie' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"checkStackCookie"))Module["checkStackCookie"]=function(){abort("'checkStackCookie' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"abortStackOverflow"))Module["abortStackOverflow"]=function(){abort("'abortStackOverflow' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"ALLOC_NORMAL"))Object.defineProperty(Module,"ALLOC_NORMAL",{get:function(){abort("'ALLOC_NORMAL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")}});if(!Object.getOwnPropertyDescriptor(Module,"ALLOC_STACK"))Object.defineProperty(Module,"ALLOC_STACK",{get:function(){abort("'ALLOC_STACK' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")}});if(!Object.getOwnPropertyDescriptor(Module,"ALLOC_DYNAMIC"))Object.defineProperty(Module,"ALLOC_DYNAMIC",{get:function(){abort("'ALLOC_DYNAMIC' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")}});if(!Object.getOwnPropertyDescriptor(Module,"ALLOC_NONE"))Object.defineProperty(Module,"ALLOC_NONE",{get:function(){abort("'ALLOC_NONE' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")}});Module["then"]=function(func){if(Module["calledRun"]){func(Module)}else{var old=Module["onRuntimeInitialized"];Module["onRuntimeInitialized"]=function(){if(old)old();func(Module)}}return Module};function ExitStatus(status){this.name="ExitStatus";this.message="Program terminated with exit("+status+")";this.status=status}dependenciesFulfilled=function runCaller(){if(!Module["calledRun"])run();if(!Module["calledRun"])dependenciesFulfilled=runCaller};function run(args){args=args||arguments_;if(runDependencies>0){return}writeStackCookie();preRun();if(runDependencies>0)return;if(Module["calledRun"])return;function doRun(){if(Module["calledRun"])return;Module["calledRun"]=true;if(ABORT)return;initRuntime();preMain();if(Module["onRuntimeInitialized"])Module["onRuntimeInitialized"]();assert(!Module["_main"],'compiled without a main, but one is present. if you added it from JS, use Module["onRuntimeInitialized"]');postRun()}if(Module["setStatus"]){Module["setStatus"]("Running...");setTimeout(function(){setTimeout(function(){Module["setStatus"]("")},1);doRun()},1)}else{doRun()}checkStackCookie()}Module["run"]=run;var abortDecorators=[];function abort(what){if(Module["onAbort"]){Module["onAbort"](what)}what+="";out(what);err(what);ABORT=true;EXITSTATUS=1;var extra="";var output="abort("+what+") at "+stackTrace()+extra;if(abortDecorators){abortDecorators.forEach(function(decorator){output=decorator(output,what)})}throw output}Module["abort"]=abort;if(Module["preInit"]){if(typeof Module["preInit"]=="function")Module["preInit"]=[Module["preInit"]];while(Module["preInit"].length>0){Module["preInit"].pop()()}}run();
-
-
- return TalerEmscriptenLib
-}
-);
-})();
-if (typeof exports === 'object' && typeof module === 'object')
- module.exports = TalerEmscriptenLib;
- else if (typeof define === 'function' && define['amd'])
- define([], function() { return TalerEmscriptenLib; });
- else if (typeof exports === 'object')
- exports["TalerEmscriptenLib"] = TalerEmscriptenLib;
-
-\ No newline at end of file
diff --git a/emscripten/taler-emscripten-lib.wasm b/emscripten/taler-emscripten-lib.wasm
Binary files differ.
diff --git a/src/crypto/browserWorkerEntry.ts b/src/crypto/browserWorkerEntry.ts
@@ -23,61 +23,11 @@
*/
import { CryptoImplementation } from "./cryptoImplementation";
-import { EmscEnvironment } from "./emscInterface";
const worker: Worker = (self as any) as Worker;
-class BrowserEmscriptenLoader {
- private cachedEmscEnvironment: EmscEnvironment | undefined = undefined;
- private cachedEmscEnvironmentPromise:
- | Promise<EmscEnvironment>
- | undefined = undefined;
-
- async getEmscriptenEnvironment(): Promise<EmscEnvironment> {
-
- if (this.cachedEmscEnvironment) {
- return this.cachedEmscEnvironment;
- }
-
- if (this.cachedEmscEnvironmentPromise) {
- return this.cachedEmscEnvironmentPromise;
- }
-
- console.log("loading emscripten lib with 'importScripts'");
- // @ts-ignore
- self.TalerEmscriptenLib = {};
- // @ts-ignore
- importScripts('/emscripten/taler-emscripten-lib.js')
- // @ts-ignore
- if (!self.TalerEmscriptenLib) {
- throw Error("can't import taler emscripten lib");
- }
- const locateFile = (path: string, scriptDir: string) => {
- console.log("locating file", "path", path, "scriptDir", scriptDir);
- // This is quite hacky and assumes that our scriptDir is dist/
- return scriptDir + "../emscripten/" + path;
- };
- console.log("instantiating TalerEmscriptenLib");
- // @ts-ignore
- const lib = self.TalerEmscriptenLib({ locateFile });
- return new Promise((resolve, reject) => {
- lib.then((mod: any) => {
- this.cachedEmscEnvironmentPromise = undefined;
- const emsc = new EmscEnvironment(mod);
- this.cachedEmscEnvironment = new EmscEnvironment(mod);
- console.log("emscripten module fully loaded");
- resolve(emsc);
- });
- });
- }
-}
-
-let loader = new BrowserEmscriptenLoader();
-
async function handleRequest(operation: string, id: number, args: string[]) {
- let emsc = await loader.getEmscriptenEnvironment();
-
- const impl = new CryptoImplementation(emsc);
+ const impl = new CryptoImplementation();
if (!(operation in impl)) {
console.error(`crypto operation '${operation}' not found`);
diff --git a/src/crypto/cryptoApi-test.ts b/src/crypto/cryptoApi-test.ts
@@ -1,117 +0,0 @@
-/*
- This file is part of TALER
- (C) 2017 Inria and GNUnet e.V.
-
- TALER is free software; you can redistribute it and/or modify it under the
- terms of the GNU General Public License as published by the Free Software
- Foundation; either version 3, or (at your option) any later version.
-
- TALER is distributed in the hope that it will be useful, but WITHOUT ANY
- WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
- A PARTICULAR PURPOSE. See the GNU General Public License for more details.
-
- You should have received a copy of the GNU General Public License along with
- TALER; see the file COPYING. If not, see <http://www.gnu.org/licenses/>
- */
-
-// tslint:disable:max-line-length
-
-import test from "ava";
-
-import {
- DenominationRecord,
- DenominationStatus,
- ReserveRecord,
- ReserveRecordStatus,
-} from "../dbTypes";
-
-import { CryptoApi } from "./cryptoApi";
-import { NodeCryptoWorkerFactory } from "./nodeProcessWorker";
-
-const masterPub1: string =
- "CQQZ9DY3MZ1ARMN5K1VKDETS04Y2QCKMMCFHZSWJWWVN82BTTH00";
-
-const denomValid1: DenominationRecord = {
- denomPub:
- "51R7ARKCD5HJTTV5F4G0M818E9SP280A40G2GVH04CR30GHS84R3JHHP6GSM2D9Q6514CGT568R32C9J6CWM4DSH64TM4DSM851K0CA48CVKAC1P6H144C2160T46DHK8CVM4HJ274S38C1M6S338D9N6GWM8DT684T3JCT36S13EC9G88R3EGHQ8S0KJGSQ60SKGD216N33AGJ2651K2E9S60TMCD1N75244HHQ6X33EDJ570R3GGJ2651MACA38D130DA560VK4HHJ68WK2CA26GW3ECSH6D13EC9S88VK2GT66WVK8D9G750K0D9R8RRK4DHQ71332GHK8D23GE26710M2H9K6WVK8HJ38MVKEGA66N23AC9H88VKACT58MV3CCSJ6H1K4DT38GRK0C9M8N33CE1R60V4AHA38H1KECSH6S33JH9N8GRKGH1K68S36GH354520818CMG26C1H60R30C935452081918G2J2G0",
- denomPubHash: "dummy",
- exchangeBaseUrl: "https://exchange.example.com/",
- feeDeposit: {
- currency: "PUDOS",
- fraction: 10000,
- value: 0,
- },
- feeRefresh: {
- currency: "PUDOS",
- fraction: 10000,
- value: 0,
- },
- feeRefund: {
- currency: "PUDOS",
- fraction: 10000,
- value: 0,
- },
- feeWithdraw: {
- currency: "PUDOS",
- fraction: 10000,
- value: 0,
- },
- isOffered: true,
- masterSig:
- "CJFJCQ48Q45PSGJ5KY94N6M2TPARESM2E15BSPBD95YVVPEARAEQ6V6G4Z2XBMS0QM0F3Y9EYVP276FCS90EQ1578ZC8JHFBZ3NGP3G",
- stampExpireDeposit: "/Date(1851580381)/",
- stampExpireLegal: "/Date(1567756381)/",
- stampExpireWithdraw: "/Date(2482300381)/",
- stampStart: "/Date(1473148381)/",
- status: DenominationStatus.Unverified,
- value: {
- currency: "PUDOS",
- fraction: 100000,
- value: 0,
- },
-};
-
-const denomInvalid1 = JSON.parse(JSON.stringify(denomValid1));
-denomInvalid1.value.value += 1;
-
-test("string hashing", async t => {
- const crypto = new CryptoApi(new NodeCryptoWorkerFactory());
- const s = await crypto.hashString("hello taler");
- const sh =
- "8RDMADB3YNF3QZBS3V467YZVJAMC2QAQX0TZGVZ6Q5PFRRAJFT70HHN0QF661QR9QWKYMMC7YEMPD679D2RADXCYK8Y669A2A5MKQFR";
- t.true(s === sh);
- t.pass();
-});
-
-test("precoin creation", async t => {
- const crypto = new CryptoApi(new NodeCryptoWorkerFactory());
- const { priv, pub } = await crypto.createEddsaKeypair();
- const r: ReserveRecord = {
- created: { t_ms: 0 },
- currentAmount: null,
- exchangeBaseUrl: "https://example.com/exchange",
- hasPayback: false,
- precoinAmount: { currency: "PUDOS", value: 0, fraction: 0 },
- requestedAmount: { currency: "PUDOS", value: 0, fraction: 0 },
- reservePriv: priv,
- reservePub: pub,
- timestampConfirmed: undefined,
- timestampReserveInfoPosted: undefined,
- exchangeWire: "payto://foo",
- reserveStatus: ReserveRecordStatus.UNCONFIRMED,
- };
-
- const precoin = await crypto.createPreCoin(denomValid1, r);
- t.truthy(precoin);
- t.pass();
-});
-
-test("denom validation", async t => {
- const crypto = new CryptoApi(new NodeCryptoWorkerFactory());
- let v: boolean;
- v = await crypto.isValidDenom(denomValid1, masterPub1);
- t.true(v);
- v = await crypto.isValidDenom(denomInvalid1, masterPub1);
- t.true(!v);
- t.pass();
-});
diff --git a/src/crypto/cryptoImplementation.ts b/src/crypto/cryptoImplementation.ts
@@ -14,10 +14,9 @@
TALER; see the file COPYING. If not, see <http://www.gnu.org/licenses/>
*/
-
/**
* Synchronous implementation of crypto-related functions for the wallet.
- *
+ *
* The functionality is parameterized over an Emscripten environment.
*/
@@ -38,19 +37,118 @@ import {
} from "../dbTypes";
import { CoinPaySig, ContractTerms, PaybackRequest } from "../talerTypes";
-import { BenchmarkResult, CoinWithDenom, PayCoinInfo } from "../walletTypes";
-import { canonicalJson } from "../helpers";
-import { EmscEnvironment } from "./emscInterface";
-import * as native from "./emscInterface";
+import {
+ BenchmarkResult,
+ CoinWithDenom,
+ PayCoinInfo,
+ Timestamp,
+} from "../walletTypes";
+import { canonicalJson, getTalerStampSec } from "../helpers";
import { AmountJson } from "../amounts";
import * as Amounts from "../amounts";
import * as timer from "../timer";
-import { getRandomBytes, encodeCrock } from "./talerCrypto";
+import {
+ getRandomBytes,
+ encodeCrock,
+ decodeCrock,
+ createEddsaKeyPair,
+ createBlindingKeySecret,
+ hash,
+ rsaBlind,
+ eddsaVerify,
+ eddsaSign,
+ rsaUnblind,
+ stringToBytes,
+ createHashContext,
+ createEcdheKeyPair,
+ keyExchangeEcdheEddsa,
+ setupRefreshPlanchet,
+} from "./talerCrypto";
+import { randomBytes } from "./primitives/nacl-fast";
+
+enum SignaturePurpose {
+ RESERVE_WITHDRAW = 1200,
+ WALLET_COIN_DEPOSIT = 1201,
+ MASTER_DENOMINATION_KEY_VALIDITY = 1025,
+ WALLET_COIN_MELT = 1202,
+ TEST = 4242,
+ MERCHANT_PAYMENT_OK = 1104,
+ MASTER_WIRE_FEES = 1028,
+ WALLET_COIN_PAYBACK = 1203,
+ WALLET_COIN_LINK = 1204,
+}
+
+function amountToBuffer(amount: AmountJson): Uint8Array {
+ const buffer = new ArrayBuffer(8 + 4 + 12);
+ const dvbuf = new DataView(buffer);
+ const u8buf = new Uint8Array(buffer);
+ const te = new TextEncoder();
+ const curr = te.encode(amount.currency);
+ dvbuf.setBigUint64(0, BigInt(amount.value));
+ dvbuf.setUint32(8, amount.fraction);
+ u8buf.set(curr, 8 + 4);
+
+ return u8buf;
+}
+
+function timestampToBuffer(ts: Timestamp): Uint8Array {
+ const b = new ArrayBuffer(8);
+ const v = new DataView(b);
+ const s = BigInt(ts.t_ms) * BigInt(1000);
+ v.setBigUint64(0, s);
+ return new Uint8Array(b);
+}
+
+function talerTimestampStringToBuffer(ts: string): Uint8Array {
+ const t_sec = getTalerStampSec(ts);
+ if (t_sec === null || t_sec === undefined) {
+ // Should have been validated before!
+ throw Error("invalid timestamp");
+ }
+ const buffer = new ArrayBuffer(8);
+ const dvbuf = new DataView(buffer);
+ const s = BigInt(t_sec) * BigInt(1000 * 1000);
+ dvbuf.setBigUint64(0, s);
+ return new Uint8Array(buffer);
+}
+
+class SignaturePurposeBuilder {
+ private chunks: Uint8Array[] = [];
+
+ constructor(private purposeNum: number) {}
+
+ put(bytes: Uint8Array): SignaturePurposeBuilder {
+ this.chunks.push(Uint8Array.from(bytes));
+ return this;
+ }
+
+ build(): Uint8Array {
+ let payloadLen = 0;
+ for (let c of this.chunks) {
+ payloadLen += c.byteLength;
+ }
+ const buf = new ArrayBuffer(4 + 4 + payloadLen);
+ const u8buf = new Uint8Array(buf);
+ let p = 8;
+ for (let c of this.chunks) {
+ u8buf.set(c, p);
+ p += c.byteLength;
+ }
+ const dvbuf = new DataView(buf);
+ dvbuf.setUint32(0, payloadLen + 4 + 4);
+ dvbuf.setUint32(4, this.purposeNum);
+ return u8buf;
+ }
+}
+
+function buildSigPS(purposeNum: number): SignaturePurposeBuilder {
+ return new SignaturePurposeBuilder(purposeNum);
+}
export class CryptoImplementation {
static enableTracing: boolean = false;
- constructor(private emsc: EmscEnvironment) {}
+ constructor() {}
/**
* Create a pre-coin of the given denomination to be withdrawn from then given
@@ -60,54 +158,39 @@ export class CryptoImplementation {
denom: DenominationRecord,
reserve: ReserveRecord,
): PreCoinRecord {
- const reservePriv = new native.EddsaPrivateKey(this.emsc);
- reservePriv.loadCrock(reserve.reservePriv);
- const reservePub = new native.EddsaPublicKey(this.emsc);
- reservePub.loadCrock(reserve.reservePub);
- const denomPub = native.RsaPublicKey.fromCrock(this.emsc, denom.denomPub);
- const coinPriv = native.EddsaPrivateKey.create(this.emsc);
- const coinPub = coinPriv.getPublicKey();
- const blindingFactor = native.RsaBlindingKeySecret.create(this.emsc);
- const pubHash: native.HashCode = coinPub.hash();
- const ev = native.rsaBlind(pubHash, blindingFactor, denomPub);
-
- if (!ev) {
- throw Error("couldn't blind (malicious exchange key?)");
- }
-
- if (!denom.feeWithdraw) {
- throw Error("Field fee_withdraw missing");
- }
-
- const amountWithFee = new native.Amount(this.emsc, denom.value);
- amountWithFee.add(new native.Amount(this.emsc, denom.feeWithdraw));
- const withdrawFee = new native.Amount(this.emsc, denom.feeWithdraw);
-
- const denomPubHash = denomPub.encode().hash();
-
- // Signature
- const withdrawRequest = new native.WithdrawRequestPS(this.emsc, {
- amount_with_fee: amountWithFee.toNbo(),
- h_coin_envelope: ev.hash(),
- h_denomination_pub: denomPubHash,
- reserve_pub: reservePub,
- withdraw_fee: withdrawFee.toNbo(),
- });
-
- const sig = native.eddsaSign(withdrawRequest.toPurpose(), reservePriv);
+ const reservePub = decodeCrock(reserve.reservePub);
+ const reservePriv = decodeCrock(reserve.reservePriv);
+ const denomPub = decodeCrock(denom.denomPub);
+ const coinKeyPair = createEddsaKeyPair();
+ const blindingFactor = createBlindingKeySecret();
+ const coinPubHash = hash(coinKeyPair.eddsaPub);
+ const ev = rsaBlind(coinPubHash, blindingFactor, denomPub);
+ const amountWithFee = Amounts.add(denom.value, denom.feeWithdraw).amount;
+ const denomPubHash = hash(denomPub);
+ const evHash = hash(ev);
+
+ const withdrawRequest = buildSigPS(SignaturePurpose.RESERVE_WITHDRAW)
+ .put(reservePub)
+ .put(amountToBuffer(amountWithFee))
+ .put(amountToBuffer(denom.feeWithdraw))
+ .put(denomPubHash)
+ .put(evHash)
+ .build();
+
+ const sig = eddsaSign(withdrawRequest, reservePriv);
const preCoin: PreCoinRecord = {
- blindingKey: blindingFactor.toCrock(),
- coinEv: ev.toCrock(),
- coinPriv: coinPriv.toCrock(),
- coinPub: coinPub.toCrock(),
+ blindingKey: encodeCrock(blindingFactor),
+ coinEv: encodeCrock(ev),
+ coinPriv: encodeCrock(coinKeyPair.eddsaPriv),
+ coinPub: encodeCrock(coinKeyPair.eddsaPub),
coinValue: denom.value,
- denomPub: denomPub.toCrock(),
- denomPubHash: denomPubHash.toCrock(),
+ denomPub: encodeCrock(denomPub),
+ denomPubHash: encodeCrock(denomPubHash),
exchangeBaseUrl: reserve.exchangeBaseUrl,
isFromTip: false,
- reservePub: reservePub.toCrock(),
- withdrawSig: sig.toCrock(),
+ reservePub: encodeCrock(reservePub),
+ withdrawSig: encodeCrock(sig),
};
return preCoin;
}
@@ -116,32 +199,20 @@ export class CryptoImplementation {
* Create a planchet used for tipping, including the private keys.
*/
createTipPlanchet(denom: DenominationRecord): TipPlanchet {
- const denomPub = native.RsaPublicKey.fromCrock(this.emsc, denom.denomPub);
- const coinPriv = native.EddsaPrivateKey.create(this.emsc);
- const coinPub = coinPriv.getPublicKey();
- const blindingFactor = native.RsaBlindingKeySecret.create(this.emsc);
- const pubHash: native.HashCode = coinPub.hash();
- const ev = native.rsaBlind(pubHash, blindingFactor, denomPub);
-
- if (!ev) {
- throw Error("couldn't blind (malicious exchange key?)");
- }
-
- if (!denom.feeWithdraw) {
- throw Error("Field fee_withdraw missing");
- }
+ const denomPub = decodeCrock(denom.denomPub);
+ const coinKeyPair = createEddsaKeyPair();
+ const blindingFactor = createBlindingKeySecret();
+ const coinPubHash = hash(coinKeyPair.eddsaPub);
+ const ev = rsaBlind(coinPubHash, blindingFactor, denomPub);
const tipPlanchet: TipPlanchet = {
- blindingKey: blindingFactor.toCrock(),
- coinEv: ev.toCrock(),
- coinPriv: coinPriv.toCrock(),
- coinPub: coinPub.toCrock(),
+ blindingKey: encodeCrock(blindingFactor),
+ coinEv: encodeCrock(ev),
+ coinPriv: encodeCrock(coinKeyPair.eddsaPriv),
+ coinPub: encodeCrock(coinKeyPair.eddsaPub),
coinValue: denom.value,
- denomPub: denomPub.encode().toCrock(),
- denomPubHash: denomPub
- .encode()
- .hash()
- .toCrock(),
+ denomPub: encodeCrock(denomPub),
+ denomPubHash: encodeCrock(hash(denomPub)),
};
return tipPlanchet;
}
@@ -150,22 +221,18 @@ export class CryptoImplementation {
* Create and sign a message to request payback for a coin.
*/
createPaybackRequest(coin: CoinRecord): PaybackRequest {
- const p = new native.PaybackRequestPS(this.emsc, {
- coin_blind: native.RsaBlindingKeySecret.fromCrock(
- this.emsc,
- coin.blindingKey,
- ),
- coin_pub: native.EddsaPublicKey.fromCrock(this.emsc, coin.coinPub),
- h_denom_pub: native.RsaPublicKey.fromCrock(this.emsc, coin.denomPub)
- .encode()
- .hash(),
- });
- const coinPriv = native.EddsaPrivateKey.fromCrock(this.emsc, coin.coinPriv);
- const coinSig = native.eddsaSign(p.toPurpose(), coinPriv);
+ const p = buildSigPS(SignaturePurpose.WALLET_COIN_PAYBACK)
+ .put(decodeCrock(coin.coinPub))
+ .put(decodeCrock(coin.denomPubHash))
+ .put(decodeCrock(coin.blindingKey))
+ .build();
+
+ const coinPriv = decodeCrock(coin.coinPriv);
+ const coinSig = eddsaSign(p, coinPriv);
const paybackRequest: PaybackRequest = {
coin_blind_key_secret: coin.blindingKey,
coin_pub: coin.coinPub,
- coin_sig: coinSig.toCrock(),
+ coin_sig: encodeCrock(coinSig),
denom_pub: coin.denomPub,
denom_sig: coin.denomSig,
};
@@ -180,114 +247,72 @@ export class CryptoImplementation {
contractHash: string,
merchantPub: string,
): boolean {
- const p = new native.PaymentSignaturePS(this.emsc, {
- contract_hash: native.HashCode.fromCrock(this.emsc, contractHash),
- });
- const nativeSig = new native.EddsaSignature(this.emsc);
- nativeSig.loadCrock(sig);
- const nativePub = native.EddsaPublicKey.fromCrock(this.emsc, merchantPub);
- return native.eddsaVerify(
- native.SignaturePurpose.MERCHANT_PAYMENT_OK,
- p.toPurpose(),
- nativeSig,
- nativePub,
- );
+ const p = buildSigPS(SignaturePurpose.MERCHANT_PAYMENT_OK)
+ .put(decodeCrock(contractHash))
+ .build();
+ const sigBytes = decodeCrock(sig);
+ const pubBytes = decodeCrock(merchantPub);
+ return eddsaVerify(p, sigBytes, pubBytes);
}
/**
* Check if a wire fee is correctly signed.
*/
isValidWireFee(type: string, wf: WireFee, masterPub: string): boolean {
- const p = new native.MasterWireFeePS(this.emsc, {
- closing_fee: new native.Amount(this.emsc, wf.closingFee).toNbo(),
- end_date: native.AbsoluteTimeNbo.fromStampSeconds(this.emsc, (wf.endStamp.t_ms / 1000)),
- h_wire_method: native.ByteArray.fromStringWithNull(
- this.emsc,
- type,
- ).hash(),
- start_date: native.AbsoluteTimeNbo.fromStampSeconds(
- this.emsc,
- Math.floor(wf.startStamp.t_ms / 1000),
- ),
- wire_fee: new native.Amount(this.emsc, wf.wireFee).toNbo(),
- });
-
- const nativeSig = new native.EddsaSignature(this.emsc);
- nativeSig.loadCrock(wf.sig);
- const nativePub = native.EddsaPublicKey.fromCrock(this.emsc, masterPub);
-
- return native.eddsaVerify(
- native.SignaturePurpose.MASTER_WIRE_FEES,
- p.toPurpose(),
- nativeSig,
- nativePub,
- );
+ const p = buildSigPS(SignaturePurpose.MASTER_WIRE_FEES)
+ .put(hash(stringToBytes(type + "\0")))
+ .put(timestampToBuffer(wf.startStamp))
+ .put(timestampToBuffer(wf.endStamp))
+ .put(amountToBuffer(wf.wireFee))
+ .build();
+ const sig = decodeCrock(wf.sig);
+ const pub = decodeCrock(masterPub);
+ return eddsaVerify(p, sig, pub);
}
/**
* Check if the signature of a denomination is valid.
*/
isValidDenom(denom: DenominationRecord, masterPub: string): boolean {
- const p = new native.DenominationKeyValidityPS(this.emsc, {
- denom_hash: native.RsaPublicKey.fromCrock(this.emsc, denom.denomPub)
- .encode()
- .hash(),
- expire_legal: native.AbsoluteTimeNbo.fromTalerString(
- this.emsc,
- denom.stampExpireLegal,
- ),
- expire_spend: native.AbsoluteTimeNbo.fromTalerString(
- this.emsc,
- denom.stampExpireDeposit,
- ),
- expire_withdraw: native.AbsoluteTimeNbo.fromTalerString(
- this.emsc,
- denom.stampExpireWithdraw,
- ),
- fee_deposit: new native.Amount(this.emsc, denom.feeDeposit).toNbo(),
- fee_refresh: new native.Amount(this.emsc, denom.feeRefresh).toNbo(),
- fee_refund: new native.Amount(this.emsc, denom.feeRefund).toNbo(),
- fee_withdraw: new native.Amount(this.emsc, denom.feeWithdraw).toNbo(),
- master: native.EddsaPublicKey.fromCrock(this.emsc, masterPub),
- start: native.AbsoluteTimeNbo.fromTalerString(
- this.emsc,
- denom.stampStart,
- ),
- value: new native.Amount(this.emsc, denom.value).toNbo(),
- });
-
- const nativeSig = new native.EddsaSignature(this.emsc);
- nativeSig.loadCrock(denom.masterSig);
-
- const nativePub = native.EddsaPublicKey.fromCrock(this.emsc, masterPub);
-
- return native.eddsaVerify(
- native.SignaturePurpose.MASTER_DENOMINATION_KEY_VALIDITY,
- p.toPurpose(),
- nativeSig,
- nativePub,
- );
+ const p = buildSigPS(SignaturePurpose.MASTER_DENOMINATION_KEY_VALIDITY)
+ .put(decodeCrock(masterPub))
+ .put(timestampToBuffer(denom.stampStart))
+ .put(timestampToBuffer(denom.stampExpireWithdraw))
+ .put(timestampToBuffer(denom.stampExpireDeposit))
+ .put(timestampToBuffer(denom.stampExpireLegal))
+ .put(amountToBuffer(denom.value))
+ .put(amountToBuffer(denom.feeWithdraw))
+ .put(amountToBuffer(denom.feeDeposit))
+ .put(amountToBuffer(denom.feeRefresh))
+ .put(amountToBuffer(denom.feeRefund))
+ .put(decodeCrock(denom.denomPubHash))
+ .build();
+ const sig = decodeCrock(denom.masterSig);
+ const pub = decodeCrock(masterPub);
+ return eddsaVerify(p, sig, pub);
}
/**
* Create a new EdDSA key pair.
*/
createEddsaKeypair(): { priv: string; pub: string } {
- const priv = native.EddsaPrivateKey.create(this.emsc);
- const pub = priv.getPublicKey();
- return { priv: priv.toCrock(), pub: pub.toCrock() };
+ const pair = createEddsaKeyPair();
+ return {
+ priv: encodeCrock(pair.eddsaPriv),
+ pub: encodeCrock(pair.eddsaPub),
+ };
}
/**
* Unblind a blindly signed value.
*/
rsaUnblind(sig: string, bk: string, pk: string): string {
- const denomSig = native.rsaUnblind(
- native.RsaSignature.fromCrock(this.emsc, sig),
- native.RsaBlindingKeySecret.fromCrock(this.emsc, bk),
- native.RsaPublicKey.fromCrock(this.emsc, pk),
+ const denomSig = rsaUnblind(
+ decodeCrock(sig),
+ decodeCrock(pk),
+ decodeCrock(bk),
);
- return denomSig.encode().toCrock();
+ return encodeCrock(denomSig);
}
/**
@@ -315,79 +340,54 @@ export class CryptoImplementation {
.amount;
const total = Amounts.add(fees, totalAmount).amount;
- const amountSpent = native.Amount.getZero(
- this.emsc,
- cds[0].coin.currentAmount.currency,
- );
- const amountRemaining = new native.Amount(this.emsc, total);
+ let amountSpent = Amounts.getZero(cds[0].coin.currentAmount.currency);
+ let amountRemaining = total;
+
for (const cd of cds) {
- let coinSpend: native.Amount;
const originalCoin = { ...cd.coin };
if (amountRemaining.value === 0 && amountRemaining.fraction === 0) {
break;
}
- if (
- amountRemaining.cmp(
- new native.Amount(this.emsc, cd.coin.currentAmount),
- ) < 0
- ) {
- coinSpend = new native.Amount(this.emsc, amountRemaining.toJson());
+ let coinSpend: AmountJson;
+ if (Amounts.cmp(amountRemaining, cd.coin.currentAmount) < 0) {
+ coinSpend = amountRemaining;
} else {
- coinSpend = new native.Amount(this.emsc, cd.coin.currentAmount);
+ coinSpend = cd.coin.currentAmount;
}
- amountSpent.add(coinSpend);
- amountRemaining.sub(coinSpend);
+ amountSpent = Amounts.add(amountSpent, coinSpend).amount;
- const feeDeposit: native.Amount = new native.Amount(
- this.emsc,
- cd.denom.feeDeposit,
- );
+ const feeDeposit = cd.denom.feeDeposit;
// Give the merchant at least the deposit fee, otherwise it'll reject
// the coin.
- if (coinSpend.cmp(feeDeposit) < 0) {
+
+ if (Amounts.cmp(coinSpend, feeDeposit) < 0) {
coinSpend = feeDeposit;
}
- const newAmount = new native.Amount(this.emsc, cd.coin.currentAmount);
- newAmount.sub(coinSpend);
- cd.coin.currentAmount = newAmount.toJson();
+ const newAmount = Amounts.sub(cd.coin.currentAmount, coinSpend).amount;
+ cd.coin.currentAmount = newAmount;
cd.coin.status = CoinStatus.Dirty;
- const d = new native.DepositRequestPS(this.emsc, {
- amount_with_fee: coinSpend.toNbo(),
- coin_pub: native.EddsaPublicKey.fromCrock(this.emsc, cd.coin.coinPub),
- deposit_fee: new native.Amount(this.emsc, cd.denom.feeDeposit).toNbo(),
- h_contract: native.HashCode.fromCrock(this.emsc, contractTermsHash),
- h_wire: native.HashCode.fromCrock(this.emsc, contractTerms.H_wire),
- merchant: native.EddsaPublicKey.fromCrock(
- this.emsc,
- contractTerms.merchant_pub,
- ),
- refund_deadline: native.AbsoluteTimeNbo.fromTalerString(
- this.emsc,
- contractTerms.refund_deadline,
- ),
- timestamp: native.AbsoluteTimeNbo.fromTalerString(
- this.emsc,
- contractTerms.timestamp,
- ),
- });
-
- const coinSig = native
- .eddsaSign(
- d.toPurpose(),
- native.EddsaPrivateKey.fromCrock(this.emsc, cd.coin.coinPriv),
- )
- .toCrock();
+ const d = buildSigPS(SignaturePurpose.WALLET_COIN_DEPOSIT)
+ .put(decodeCrock(contractTermsHash))
+ .put(decodeCrock(contractTerms.H_wire))
+ .put(talerTimestampStringToBuffer(contractTerms.timestamp))
+ .put(talerTimestampStringToBuffer(contractTerms.refund_deadline))
+ .put(amountToBuffer(coinSpend))
+ .put(amountToBuffer(cd.denom.feeDeposit))
+ .put(decodeCrock(contractTerms.merchant_pub))
+ .put(decodeCrock(cd.coin.coinPub))
+ .build();
+ const coinSig = eddsaSign(d, decodeCrock(cd.coin.coinPriv));
const s: CoinPaySig = {
coin_pub: cd.coin.coinPub,
- coin_sig: coinSig,
- contribution: Amounts.toString(coinSpend.toJson()),
+ coin_sig: encodeCrock(coinSig),
+ contribution: Amounts.toString(coinSpend),
denom_pub: cd.coin.denomPub,
exchange_url: cd.denom.exchangeBaseUrl,
ub_sig: cd.coin.denomSig,
@@ -419,7 +419,7 @@ export class CryptoImplementation {
// melt fee
valueWithFee = Amounts.add(valueWithFee, meltFee).amount;
- const sessionHc = new native.HashContext(this.emsc);
+ const sessionHc = createHashContext();
const transferPubs: string[] = [];
const transferPrivs: string[] = [];
@@ -427,79 +427,57 @@ export class CryptoImplementation {
const preCoinsForGammas: RefreshPreCoinRecord[][] = [];
for (let i = 0; i < kappa; i++) {
- const t = native.EcdhePrivateKey.create(this.emsc);
- const pub = t.getPublicKey();
- sessionHc.read(pub);
- transferPrivs.push(t.toCrock());
- transferPubs.push(pub.toCrock());
+ const transferKeyPair = createEcdheKeyPair();
+ sessionHc.update(transferKeyPair.ecdhePub);
+ transferPrivs.push(encodeCrock(transferKeyPair.ecdhePriv));
+ transferPubs.push(encodeCrock(transferKeyPair.ecdhePub));
}
for (const denom of newCoinDenoms) {
- const r = native.RsaPublicKey.fromCrock(this.emsc, denom.denomPub);
- sessionHc.read(r.encode());
+ const r = decodeCrock(denom.denomPub);
+ sessionHc.update(r);
}
- sessionHc.read(
- native.EddsaPublicKey.fromCrock(this.emsc, meltCoin.coinPub),
- );
- sessionHc.read(new native.Amount(this.emsc, valueWithFee).toNbo());
+ sessionHc.update(decodeCrock(meltCoin.coinPub));
+ sessionHc.update(amountToBuffer(valueWithFee));
for (let i = 0; i < kappa; i++) {
const preCoins: RefreshPreCoinRecord[] = [];
for (let j = 0; j < newCoinDenoms.length; j++) {
- const transferPriv = native.EcdhePrivateKey.fromCrock(
- this.emsc,
- transferPrivs[i],
- );
- const oldCoinPub = native.EddsaPublicKey.fromCrock(
- this.emsc,
- meltCoin.coinPub,
- );
- const transferSecret = native.ecdhEddsa(transferPriv, oldCoinPub);
-
- const fresh = native.setupFreshCoin(transferSecret, j);
-
- const coinPriv = fresh.priv;
- const coinPub = coinPriv.getPublicKey();
- const blindingFactor = fresh.blindingKey;
- const pubHash: native.HashCode = coinPub.hash();
- const denomPub = native.RsaPublicKey.fromCrock(
- this.emsc,
- newCoinDenoms[j].denomPub,
- );
- const ev = native.rsaBlind(pubHash, blindingFactor, denomPub);
- if (!ev) {
- throw Error("couldn't blind (malicious exchange key?)");
- }
+ const transferPriv = decodeCrock(transferPrivs[i]);
+ const oldCoinPub = decodeCrock(meltCoin.coinPub);
+ const transferSecret = keyExchangeEcdheEddsa(transferPriv, oldCoinPub);
+
+ const fresh = setupRefreshPlanchet(transferSecret, j);
+
+ const coinPriv = fresh.coinPriv;
+ const coinPub = fresh.coinPub;
+ const blindingFactor = fresh.bks;
+ const pubHash = hash(coinPub);
+ const denomPub = decodeCrock(newCoinDenoms[j].denomPub);
+ const ev = rsaBlind(pubHash, blindingFactor, denomPub);
const preCoin: RefreshPreCoinRecord = {
- blindingKey: blindingFactor.toCrock(),
- coinEv: ev.toCrock(),
- privateKey: coinPriv.toCrock(),
- publicKey: coinPub.toCrock(),
+ blindingKey: encodeCrock(blindingFactor),
+ coinEv: encodeCrock(ev),
+ privateKey: encodeCrock(coinPriv),
+ publicKey: encodeCrock(coinPub),
};
preCoins.push(preCoin);
- sessionHc.read(ev);
+ sessionHc.update(ev);
}
preCoinsForGammas.push(preCoins);
}
- const sessionHash = new native.HashCode(this.emsc);
- sessionHash.alloc();
- sessionHc.finish(sessionHash);
+ const sessionHash = sessionHc.finish();
- const confirmData = new native.RefreshMeltCoinAffirmationPS(this.emsc, {
- amount_with_fee: new native.Amount(this.emsc, valueWithFee).toNbo(),
- coin_pub: native.EddsaPublicKey.fromCrock(this.emsc, meltCoin.coinPub),
- melt_fee: new native.Amount(this.emsc, meltFee).toNbo(),
- session_hash: sessionHash,
- });
+ const confirmData = buildSigPS(SignaturePurpose.WALLET_COIN_MELT)
+ .put(sessionHash)
+ .put(amountToBuffer(valueWithFee))
+ .put(amountToBuffer(meltFee))
+ .put(decodeCrock(meltCoin.coinPub))
+ .build();
- const confirmSig: string = native
- .eddsaSign(
- confirmData.toPurpose(),
- native.EddsaPrivateKey.fromCrock(this.emsc, meltCoin.coinPriv),
- )
- .toCrock();
+ const confirmSig = eddsaSign(confirmData, decodeCrock(meltCoin.coinPriv));
let valueOutput = Amounts.getZero(newCoinDenoms[0].value.currency);
for (const denom of newCoinDenoms) {
@@ -510,10 +488,10 @@ export class CryptoImplementation {
const refreshSession: RefreshSessionRecord = {
refreshSessionId,
- confirmSig,
+ confirmSig: encodeCrock(confirmSig),
exchangeBaseUrl,
finished: false,
- hash: sessionHash.toCrock(),
+ hash: encodeCrock(sessionHash),
meltCoinPub: meltCoin.coinPub,
newDenomHashes: newCoinDenoms.map(d => d.denomPubHash),
newDenoms: newCoinDenoms.map(d => d.denomPub),
@@ -532,18 +510,16 @@ export class CryptoImplementation {
* Hash a string including the zero terminator.
*/
hashString(str: string): string {
- const b = native.ByteArray.fromStringWithNull(this.emsc, str);
- return b.hash().toCrock();
+ const ts = new TextEncoder();
+ const b = ts.encode(str + "\0");
+ return encodeCrock(hash(b));
}
/**
* Hash a denomination public key.
*/
hashDenomPub(denomPub: string): string {
- return native.RsaPublicKey.fromCrock(this.emsc, denomPub)
- .encode()
- .hash()
- .toCrock();
+ return encodeCrock(hash(decodeCrock(denomPub)));
}
signCoinLink(
@@ -553,20 +529,16 @@ export class CryptoImplementation {
transferPub: string,
coinEv: string,
): string {
- const coinEvHash = native.ByteArray.fromCrock(this.emsc, coinEv).hash();
-
- const coinLink = new native.CoinLinkSignaturePS(this.emsc, {
- coin_envelope_hash: coinEvHash,
- h_denom_pub: native.HashCode.fromCrock(this.emsc, newDenomHash),
- old_coin_pub: native.EddsaPublicKey.fromCrock(this.emsc, oldCoinPub),
- transfer_pub: native.EcdhePublicKey.fromCrock(this.emsc, transferPub),
- });
-
- const coinPriv = native.EddsaPrivateKey.fromCrock(this.emsc, oldCoinPriv);
-
- const sig = native.eddsaSign(coinLink.toPurpose(), coinPriv);
-
- return sig.toCrock();
+ const coinEvHash = hash(decodeCrock(coinEv));
+ const coinLink = buildSigPS(SignaturePurpose.WALLET_COIN_LINK)
+ .put(decodeCrock(newDenomHash))
+ .put(decodeCrock(oldCoinPub))
+ .put(decodeCrock(transferPub))
+ .put(coinEvHash)
+ .build();
+ const coinPriv = decodeCrock(oldCoinPriv);
+ const sig = eddsaSign(coinLink, coinPriv);
+ return encodeCrock(sig);
}
benchmark(repetitions: number): BenchmarkResult {
@@ -578,165 +550,40 @@ export class CryptoImplementation {
}
let time_hash_big = 0;
- const ba = new native.ByteArray(this.emsc, 4096);
for (let i = 0; i < repetitions; i++) {
- ba.randomize(native.RandomQuality.WEAK);
+ const ba = randomBytes(4096);
const start = timer.performanceNow();
- ba.hash();
+ hash(ba);
time_hash_big += timer.performanceNow() - start;
}
let time_eddsa_create = 0;
for (let i = 0; i < repetitions; i++) {
const start = timer.performanceNow();
- const priv: native.EddsaPrivateKey = native.EddsaPrivateKey.create(
- this.emsc,
- );
+ const pair = createEddsaKeyPair();
time_eddsa_create += timer.performanceNow() - start;
- priv.destroy();
}
let time_eddsa_sign = 0;
- const eddsaPriv: native.EddsaPrivateKey = native.EddsaPrivateKey.create(
- this.emsc,
- );
- const eddsaPub: native.EddsaPublicKey = eddsaPriv.getPublicKey();
- const h: native.HashCode = new native.HashCode(this.emsc);
- h.alloc();
- h.random(native.RandomQuality.WEAK);
+ const p = randomBytes(4096);
- const ps = new native.PaymentSignaturePS(this.emsc, {
- contract_hash: h,
- });
-
- const p = ps.toPurpose();
+ const pair = createEddsaKeyPair();
for (let i = 0; i < repetitions; i++) {
const start = timer.performanceNow();
- native.eddsaSign(p, eddsaPriv);
+ eddsaSign(p, pair.eddsaPriv);
time_eddsa_sign += timer.performanceNow() - start;
}
- const eddsaSig = native.eddsaSign(p, eddsaPriv);
-
- let time_ecdsa_create = 0;
- for (let i = 0; i < repetitions; i++) {
- const start = timer.performanceNow();
- const priv: native.EcdsaPrivateKey = native.EcdsaPrivateKey.create(
- this.emsc,
- );
- time_ecdsa_create += timer.performanceNow() - start;
- priv.destroy();
- }
+ const sig = eddsaSign(p, pair.eddsaPriv);
let time_eddsa_verify = 0;
for (let i = 0; i < repetitions; i++) {
const start = timer.performanceNow();
- native.eddsaVerify(
- native.SignaturePurpose.MERCHANT_PAYMENT_OK,
- p,
- eddsaSig,
- eddsaPub,
- );
+ eddsaVerify(p, sig, pair.eddsaPub);
time_eddsa_verify += timer.performanceNow() - start;
}
- /* rsa 2048 */
-
- let time_rsa_2048_blind = 0;
- const rsaPriv2048: native.RsaPrivateKey = native.RsaPrivateKey.create(
- this.emsc,
- 2048,
- );
- const rsaPub2048 = rsaPriv2048.getPublicKey();
- const blindingSecret2048 = native.RsaBlindingKeySecret.create(this.emsc);
- for (let i = 0; i < repetitions; i++) {
- const start = timer.performanceNow();
- native.rsaBlind(h, blindingSecret2048, rsaPub2048);
- time_rsa_2048_blind += timer.performanceNow() - start;
- }
-
- const blindedMessage2048 = native.rsaBlind(
- h,
- blindingSecret2048,
- rsaPub2048,
- );
- if (!blindedMessage2048) {
- throw Error("should not happen");
- }
- const rsaBlindSig2048 = native.rsaSignBlinded(
- rsaPriv2048,
- blindedMessage2048,
- );
-
- let time_rsa_2048_unblind = 0;
- for (let i = 0; i < repetitions; i++) {
- const start = timer.performanceNow();
- native.rsaUnblind(rsaBlindSig2048, blindingSecret2048, rsaPub2048);
- time_rsa_2048_unblind += timer.performanceNow() - start;
- }
-
- const unblindedSig2048 = native.rsaUnblind(
- rsaBlindSig2048,
- blindingSecret2048,
- rsaPub2048,
- );
-
- let time_rsa_2048_verify = 0;
- for (let i = 0; i < repetitions; i++) {
- const start = timer.performanceNow();
- native.rsaVerify(h, unblindedSig2048, rsaPub2048);
- time_rsa_2048_verify += timer.performanceNow() - start;
- }
-
- /* rsa 4096 */
-
- let time_rsa_4096_blind = 0;
- const rsaPriv4096: native.RsaPrivateKey = native.RsaPrivateKey.create(
- this.emsc,
- 4096,
- );
- const rsaPub4096 = rsaPriv4096.getPublicKey();
- const blindingSecret4096 = native.RsaBlindingKeySecret.create(this.emsc);
- for (let i = 0; i < repetitions; i++) {
- const start = timer.performanceNow();
- native.rsaBlind(h, blindingSecret4096, rsaPub4096);
- time_rsa_4096_blind += timer.performanceNow() - start;
- }
-
- const blindedMessage4096 = native.rsaBlind(
- h,
- blindingSecret4096,
- rsaPub4096,
- );
- if (!blindedMessage4096) {
- throw Error("should not happen");
- }
- const rsaBlindSig4096 = native.rsaSignBlinded(
- rsaPriv4096,
- blindedMessage4096,
- );
-
- let time_rsa_4096_unblind = 0;
- for (let i = 0; i < repetitions; i++) {
- const start = timer.performanceNow();
- native.rsaUnblind(rsaBlindSig4096, blindingSecret4096, rsaPub4096);
- time_rsa_4096_unblind += timer.performanceNow() - start;
- }
-
- const unblindedSig4096 = native.rsaUnblind(
- rsaBlindSig4096,
- blindingSecret4096,
- rsaPub4096,
- );
-
- let time_rsa_4096_verify = 0;
- for (let i = 0; i < repetitions; i++) {
- const start = timer.performanceNow();
- native.rsaVerify(h, unblindedSig4096, rsaPub4096);
- time_rsa_4096_verify += timer.performanceNow() - start;
- }
-
return {
repetitions,
time: {
@@ -745,13 +592,6 @@ export class CryptoImplementation {
eddsa_create: time_eddsa_create,
eddsa_sign: time_eddsa_sign,
eddsa_verify: time_eddsa_verify,
- ecdsa_create: time_ecdsa_create,
- rsa_2048_blind: time_rsa_2048_blind,
- rsa_2048_unblind: time_rsa_2048_unblind,
- rsa_2048_verify: time_rsa_2048_verify,
- rsa_4096_blind: time_rsa_4096_blind,
- rsa_4096_unblind: time_rsa_4096_unblind,
- rsa_4096_verify: time_rsa_4096_verify,
},
};
}
diff --git a/src/crypto/emscInterface-test.ts b/src/crypto/emscInterface-test.ts
@@ -1,176 +0,0 @@
-/*
- This file is part of TALER
- (C) 2017 Inria and GNUnet e.V.
-
- TALER is free software; you can redistribute it and/or modify it under the
- terms of the GNU General Public License as published by the Free Software
- Foundation; either version 3, or (at your option) any later version.
-
- TALER is distributed in the hope that it will be useful, but WITHOUT ANY
- WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
- A PARTICULAR PURPOSE. See the GNU General Public License for more details.
-
- You should have received a copy of the GNU General Public License along with
- TALER; see the file COPYING. If not, see <http://www.gnu.org/licenses/>
- */
-
-// tslint:disable:max-line-length
-
-import test from "ava";
-import { NodeEmscriptenLoader } from "./nodeEmscriptenLoader";
-import * as native from "./emscInterface";
-
-import { encodeCrock, decodeCrock } from "./talerCrypto";
-import { timestampCheck } from "../helpers";
-
-
-test("string hashing", async (t) => {
- const loader = new NodeEmscriptenLoader();
- const emsc = await loader.getEmscriptenEnvironment();
-
- const x = native.ByteArray.fromStringWithNull(emsc, "hello taler");
- const h = "8RDMADB3YNF3QZBS3V467YZVJAMC2QAQX0TZGVZ6Q5PFRRAJFT70HHN0QF661QR9QWKYMMC7YEMPD679D2RADXCYK8Y669A2A5MKQFR";
- const hc = x.hash().toCrock();
- console.log(`# hc ${hc}`);
- t.true(h === hc, "must equal");
-
- const te = new TextEncoder();
-
- const x2 = te.encode("hello taler\0");
-
- t.pass();
-});
-
-
-test("signing", async (t) => {
- const loader = new NodeEmscriptenLoader();
- const emsc = await loader.getEmscriptenEnvironment();
-
- const x = native.ByteArray.fromStringWithNull(emsc, "hello taler");
- const priv = native.EddsaPrivateKey.create(emsc);
- const pub = priv.getPublicKey();
- const purpose = new native.EccSignaturePurpose(emsc, native.SignaturePurpose.TEST, x);
-
- const purposeDataCrock = purpose.toCrock();
- const privCrock = priv.toCrock();
- const pubCrock = pub.toCrock();
- const sig = native.eddsaSign(purpose, priv);
- console.time("a");
- for (let i = 0; i < 5000; i++) {
- const sig = native.eddsaSign(purpose, priv);
- }
- console.timeEnd("a");
- t.true(native.eddsaVerify(native.SignaturePurpose.TEST, purpose, sig, pub));
-
- const d2 = new Uint8Array(decodeCrock(purposeDataCrock));
- console.log("sig1:", sig.toCrock());
-
- t.pass();
-});
-
-
-test("signing-fixed-data", async (t) => {
- const loader = new NodeEmscriptenLoader();
- const emsc = await loader.getEmscriptenEnvironment();
-
- const x = native.ByteArray.fromStringWithNull(emsc, "hello taler");
- const purpose = new native.EccSignaturePurpose(emsc, native.SignaturePurpose.TEST, x);
- const privStr = "G9R8KRRCAFKPD0KW7PW48CC2T03VQ8K2AN9J6J6K2YW27J5MHN90";
- const pubStr = "YHCZB442FQFJ0ET20MWA8YJ53M61EZGJ6QKV1KTJZMRNXDY45WT0";
- const sigStr = "7V6XY4QGC1406GPMT305MZQ1HDCR7R0S5BP02GTGDQFPSXB6YD2YDN5ZS7NJQCNP61Y39MRHXNXQ1Z15JY4CJY4CPDA6CKQ3313WG38";
- const priv = native.EddsaPrivateKey.fromCrock(emsc, privStr);
- t.true(privStr === priv.toCrock());
- const pub = priv.getPublicKey();
- t.true(pubStr === pub.toCrock());
- const sig = native.EddsaSignature.fromCrock(emsc, sigStr);
- t.true(sigStr === sig.toCrock());
- const sig2 = native.eddsaSign(purpose, priv);
- t.true(sig.toCrock() === sig2.toCrock());
- t.true(native.eddsaVerify(native.SignaturePurpose.TEST, purpose, sig, pub));
- t.pass();
-});
-
-
-const denomPubStr1 = "51R7ARKCD5HJTTV5F4G0M818E9SP280A40G2GVH04CR30G9R64VK6HHS6MW42DSN8MVKJGHK6WR3CGT18MWMCDSM75138E1K8S0MADSQ68W34DHH6MW4CHA270W4CG9J6GW48DHG8MVK4E9S7523GEA56H0K4E1Q891KCCSG752KGC1M88VMCDSQ6D23CHHG8H33AGHG6MSK8GT26CRKAC1M64V3JCJ56CVKCC228MWMCHA26MS30H1J8MVKEDHJ70TMADHK892KJC1H60TKJDHM710KGGT584T38H9K851KCDHG60W30HJ28CT4CC1G8CR3JGJ28H236DJ28H330H9S890M2D9S8S14AGA369344GA36S248CHS70RKEDSS6MWKGDJ26D136GT465348CSS8S232CHM6GS34C9N8CS3GD9H60W36H1R8MSK2GSQ8MSM6C9R70SKCHHN6MW3ACJ28N0K2CA58RS3GCA26MV42G9P891KAG9Q8N0KGD9M850KEHJ16S130CA27124AE1G852KJCHR6S1KGDSJ8RTKED1S8RR3CCHP68W4CH9Q6GT34GT18GS36EA46N24AGSP6933GCHM60VMAE1S8GV3EHHN74W3GC1J651KEH9N8MSK0CSG6S2KEEA460R32C1M8D144GSR6RWKEC218S0KEGJ4611KEEA36CSKJC2564TM4CSJ6H230E1N74TM8C1P61342CSG60WKCGHH64VK2G9S8CRKAHHK88W30HJ388R3CH1Q6X2K2DHK8GSM4D1Q74WM4HA461146H9S6D33JDJ26D234C9Q6923ECSS60RM6CT46CSKCH1M6S13EH9J8S33GCSN4CMGM81051JJ08SG64R30C1H4CMGM81054520A8A00";
-
-
-test("rsa-encode", async (t) => {
- const loader = new NodeEmscriptenLoader();
- const emsc = await loader.getEmscriptenEnvironment();
-
- const pubHashStr = "JM63YM5X7X547164QJ3MGJZ4WDD47GEQR5DW5SH35G4JFZXEJBHE5JBNZM5K8XN5C4BRW25BE6GSVAYBF790G2BZZ13VW91D41S4DS0";
- const denomPub = native.RsaPublicKey.fromCrock(emsc, denomPubStr1);
- const pubHash = denomPub.encode().hash();
- t.true(pubHashStr === pubHash.toCrock());
- t.pass();
-});
-
-
-test("withdraw-request", async (t) => {
- const loader = new NodeEmscriptenLoader();
- const emsc = await loader.getEmscriptenEnvironment();
-
- const reservePrivStr = "G9R8KRRCAFKPD0KW7PW48CC2T03VQ8K2AN9J6J6K2YW27J5MHN90";
- const reservePriv = native.EddsaPrivateKey.fromCrock(emsc, reservePrivStr);
- const reservePub = reservePriv.getPublicKey();
- const amountWithFee = new native.Amount(emsc, {currency: "KUDOS", value: 1, fraction: 10000});
- amountWithFee.add(new native.Amount(emsc, {currency: "KUDOS", value: 0, fraction: 20000}));
- const withdrawFee = new native.Amount(emsc, {currency: "KUDOS", value: 0, fraction: 20000});
- const denomPub = native.RsaPublicKey.fromCrock(emsc, denomPubStr1);
- const ev = native.ByteArray.fromStringWithNull(emsc, "hello, world");
-
- // Signature
- const withdrawRequest = new native.WithdrawRequestPS(emsc, {
- amount_with_fee: amountWithFee.toNbo(),
- h_coin_envelope: ev.hash(),
- h_denomination_pub: denomPub.encode().hash(),
- reserve_pub: reservePub,
- withdraw_fee: withdrawFee.toNbo(),
- });
-
- const sigStr = "AD3T8W44NV193J19RAN3NAJHPP6RVB0R3NWV7ZK5G8Q946YDK0B6F8YJBNRRBXSPVTKY31S7BVZPJFFTJJRMY61DH51X4JSXK677428";
-
- const sig = native.eddsaSign(withdrawRequest.toPurpose(), reservePriv);
- t.true(native.eddsaVerify(native.SignaturePurpose.RESERVE_WITHDRAW, withdrawRequest.toPurpose(), sig, reservePub));
- t.true(sig.toCrock() === sigStr);
- t.pass();
-});
-
-
-test("currency-conversion", async (t) => {
- const loader = new NodeEmscriptenLoader();
- const emsc = await loader.getEmscriptenEnvironment();
-
- const a1 = new native.Amount(emsc, {currency: "KUDOS", value: 1, fraction: 50000000});
- const a2 = new native.Amount(emsc, {currency: "KUDOS", value: 1, fraction: 50000000});
- a1.add(a2);
- const x = a1.toJson();
- t.true(x.currency === "KUDOS");
- t.true(x.fraction === 0);
- t.true(x.value === 3);
- t.pass();
-});
-
-
-test("ecdsa", async (t) => {
- const loader = new NodeEmscriptenLoader();
- const emsc = await loader.getEmscriptenEnvironment();
-
- const priv = native.EcdsaPrivateKey.create(emsc);
- const pub1 = priv.getPublicKey();
- t.truthy(priv);
- t.truthy(pub1);
- t.pass();
-});
-
-
-test("ecdhe", async (t) => {
- const loader = new NodeEmscriptenLoader();
- const emsc = await loader.getEmscriptenEnvironment();
-
- const priv = native.EcdhePrivateKey.create(emsc);
- const pub = priv.getPublicKey();
- t.truthy(priv);
- t.truthy(pub);
- t.pass();
-});
diff --git a/src/crypto/emscInterface.ts b/src/crypto/emscInterface.ts
@@ -1,1657 +0,0 @@
-/*
- This file is part of TALER
- (C) 2015 GNUnet e.V.
-
- TALER is free software; you can redistribute it and/or modify it under the
- terms of the GNU General Public License as published by the Free Software
- Foundation; either version 3, or (at your option) any later version.
-
- TALER is distributed in the hope that it will be useful, but WITHOUT ANY
- WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR
- A PARTICULAR PURPOSE. See the GNU General Public License for more details.
-
- You should have received a copy of the GNU General Public License along with
- TALER; see the file COPYING. If not, see <http://www.gnu.org/licenses/>
- */
-
-
-/**
- * Medium-level interface to emscripten-compiled modules used
- * by the wallet. Handles memory management by allocating by allocating
- * objects in arenas that then can be disposed of all at once.
- *
- * The high-level interface (using WebWorkers) is exposed in src/cryptoApi.ts.
- */
-
-/**
- * Imports.
- */
-import { AmountJson } from "../amounts";
-
-/**
- * Size of a native pointer. Must match the size
- * use when compiling via emscripten.
- */
-const PTR_SIZE = 4;
-
-const GNUNET_OK = 1;
-
-
-/**
- * Signature of the function that retrieves emscripten
- * function implementations.
- */
-export interface EmscFunGen {
- (name: string,
- ret: string,
- args: string[]): ((...x: Array<number|string>) => any);
- (name: string,
- ret: "number",
- args: string[]): ((...x: Array<number|string>) => number);
- (name: string,
- ret: "void",
- args: string[]): ((...x: Array<number|string>) => void);
- (name: string,
- ret: "string",
- args: string[]): ((...x: Array<number|string>) => string);
-}
-
-
-interface EmscLib {
- cwrap: EmscFunGen;
-
- ccall(name: string, ret: "number"|"string", argTypes: any[], args: any[]): any;
-
- stringToUTF8(s: string, addr: number, maxLength: number): void;
-
- onRuntimeInitialized(f: () => void): void;
-
- readBinary?: (filename: string) => Promise<ArrayBuffer>;
-
- calledRun?: boolean;
-
- _free(ptr: number): void;
-
- _malloc(n: number): number;
-
- UTF8ToString(p: number, len?: number): string;
-
- getValue(ptr: number, type: string, noSafe?: boolean): number;
-
- setValue(ptr: number, value: number, type: string, noSafe?: boolean): void;
-
- writeStringToMemory(s: string, buffer: number, dontAddNull?: boolean): void;
-}
-
-interface EmscFunctions {
- amount_add(a1: number, a2: number, a3: number): number;
- amount_cmp(a1: number, a2: number): number;
- amount_get_zero(a1: string, a2: number): number;
- amount_hton(a1: number, a2: number): void;
- amount_normalize(a1: number): void;
- amount_ntoh(a1: number, a2: number): void;
- amount_subtract(a1: number, a2: number, a3: number): number;
- ecdh_eddsa(a1: number, a2: number, a3: number): number;
- eddsa_sign(a1: number, a2: number, a3: number): number;
- eddsa_verify(a1: number, a2: number, a3: number, a4: number): number;
- free(ptr: number): void;
- get_currency(a: number): string;
- get_fraction(a: number): number;
- get_value(a: number): number;
- hash(a1: number, a2: number, a3: number): void;
- hash_context_abort(ctx: number): void;
- hash_context_finish(a1: number, a2: number): void;
- hash_context_read(a1: number, a2: number, a3: number): void;
- hash_create_random(a1: number, a2: number): void;
- memmove(a1: number, a2: number, a3: number): number;
- random_block(a1: number, a2: number, a3: number): void;
- rsa_blinding_key_free(a1: number): void;
- rsa_public_key_free(a1: number): void;
- rsa_private_key_free(a1: number): void;
- rsa_signature_free(a1: number): void;
- rsa_verify(msgHash: number, sig: number, pubKey: number): number;
- setup_fresh_coin(a1: number, a2: number, a3: number): void;
- string_to_data(a1: number, a2: number, a3: number, a4: number): number;
-}
-
-interface EmscAllocFunctions {
- data_to_string_alloc(a1: number, a2: number): number;
- ecdhe_key_create(): number;
- ecdhe_public_key_from_private(a1: number): number;
- ecdsa_key_create(): number;
- ecdsa_public_key_from_private(a1: number): number;
- eddsa_key_create(): number;
- eddsa_public_key_from_private(a1: number): number;
- /**
- * Note that value_1 and value_2 are the first 64-bit parameter,
- * and not two separate parameters (by the emscripten calling convention).
- */
- get_amount(value_1: number, value_2: number, fraction: number, currency: string): number;
- hash_context_start(): number;
- malloc(size: number): number;
- purpose_create(a1: number, a2: number, a3: number): number;
- rsa_blind(a1: number, a2: number, a3: number, a4: number, a5: number): number;
- rsa_blinding_key_create(a1: number): number;
- rsa_blinding_key_decode(a1: number, a2: number): number;
- rsa_blinding_key_encode(a1: number, a2: number): number;
- rsa_private_key_create(len: number): number;
- rsa_private_key_decode(a1: number, a2: number): number;
- rsa_private_key_encode(a1: number, a2: number): number;
- rsa_private_key_get_public(privKeyPtr: number): number;
- rsa_public_key_decode(a1: number, a2: number): number;
- rsa_public_key_encode(a1: number, a2: number): number;
- rsa_signature_decode(a1: number, a2: number): number;
- rsa_signature_encode(a1: number, a2: number): number;
- rsa_sign_blinded(keyPtr: number, msgPtr: number, msgLen: number): number;
- rsa_unblind(a1: number, a2: number, a3: number): number;
-}
-
-export class EmscEnvironment {
-
- /**
- * Emscripten functions that don't do any memory allocations.
- */
- public funcs: EmscFunctions;
-
- /**
- * Emscripten functions that allocate memory.
- */
- public allocFuncs: EmscAllocFunctions;
-
- public lib: EmscLib;
-
- constructor(lib: EmscLib) {
- const getEmsc: EmscFunGen = (name: string, ret: any, argTypes: any[]) => {
- return (...args: any[]) => {
- return lib.ccall(name, ret, argTypes, args);
- };
- };
- this.lib = lib;
- this.allocFuncs = {
- data_to_string_alloc: getEmsc("GNUNET_STRINGS_data_to_string_alloc", "number", ["number", "number"]),
- ecdhe_key_create: getEmsc("GNUNET_CRYPTO_ecdhe_key_create", "number", []),
- ecdhe_public_key_from_private: getEmsc( "TALER_WRALL_ecdhe_public_key_from_private", "number", ["number"]),
- ecdsa_key_create: getEmsc("GNUNET_CRYPTO_ecdsa_key_create", "number", []),
- ecdsa_public_key_from_private: getEmsc( "TALER_WRALL_ecdsa_public_key_from_private", "number", ["number"]),
- eddsa_key_create: getEmsc("GNUNET_CRYPTO_eddsa_key_create", "number", []),
- eddsa_public_key_from_private: getEmsc( "TALER_WRALL_eddsa_public_key_from_private", "number", ["number"]),
- get_amount: getEmsc("TALER_WRALL_get_amount", "number", ["number", "number", "number", "string"]),
- hash_context_start: getEmsc("GNUNET_CRYPTO_hash_context_start", "number", []),
- malloc: (size: number) => lib._malloc(size),
- purpose_create: getEmsc("TALER_WRALL_purpose_create", "number", ["number", "number", "number"]),
- rsa_blind: getEmsc("GNUNET_CRYPTO_rsa_blind", "number", ["number", "number", "number", "number", "number"]),
- rsa_blinding_key_create: getEmsc("GNUNET_CRYPTO_rsa_blinding_key_create", "number", ["number"]),
- rsa_blinding_key_decode: getEmsc("GNUNET_CRYPTO_rsa_blinding_key_decode", "number", ["number", "number"]),
- rsa_blinding_key_encode: getEmsc("GNUNET_CRYPTO_rsa_blinding_key_encode", "number", ["number", "number"]),
- rsa_private_key_create: getEmsc("GNUNET_CRYPTO_rsa_private_key_create", "number", ["number"]),
- rsa_private_key_decode: getEmsc("GNUNET_CRYPTO_rsa_private_key_decode", "number", ["number", "number"]),
- rsa_private_key_encode: getEmsc("GNUNET_CRYPTO_rsa_private_key_encode", "number", ["number", "number"]),
- rsa_private_key_get_public: getEmsc("GNUNET_CRYPTO_rsa_private_key_get_public", "number", ["number"]),
- rsa_public_key_decode: getEmsc("GNUNET_CRYPTO_rsa_public_key_decode", "number", ["number", "number"]),
- rsa_public_key_encode: getEmsc("GNUNET_CRYPTO_rsa_public_key_encode", "number", ["number", "number"]),
- rsa_signature_decode: getEmsc("GNUNET_CRYPTO_rsa_signature_decode", "number", ["number", "number"]),
- rsa_signature_encode: getEmsc("GNUNET_CRYPTO_rsa_signature_encode", "number", ["number", "number"]),
- rsa_sign_blinded: getEmsc("GNUNET_CRYPTO_rsa_sign_blinded", "number", ["number", "number", "number"]),
- rsa_unblind: getEmsc("GNUNET_CRYPTO_rsa_unblind", "number", ["number", "number", "number"]),
- };
- this.funcs = {
- amount_add: getEmsc("TALER_amount_add", "number", ["number", "number", "number"]),
- amount_cmp: getEmsc("TALER_amount_cmp", "number", ["number", "number"]),
- amount_get_zero: getEmsc("TALER_amount_get_zero", "number", ["string", "number"]),
- amount_hton: getEmsc("TALER_amount_hton", "void", ["number", "number"]),
- amount_normalize: getEmsc("TALER_amount_normalize", "void", ["number"]),
- amount_ntoh: getEmsc("TALER_amount_ntoh", "void", ["number", "number"]),
- amount_subtract: getEmsc("TALER_amount_subtract", "number", ["number", "number", "number"]),
- ecdh_eddsa: getEmsc("GNUNET_CRYPTO_ecdh_eddsa", "number", ["number", "number", "number"]),
- eddsa_sign: getEmsc("GNUNET_CRYPTO_eddsa_sign", "number", ["number", "number", "number"]),
- eddsa_verify: getEmsc("GNUNET_CRYPTO_eddsa_verify", "number", ["number", "number", "number", "number"]),
- free: (ptr: number) => lib._free(ptr),
- get_currency: getEmsc("TALER_WR_get_currency", "string", ["number"]),
- get_fraction: getEmsc("TALER_WR_get_fraction", "number", ["number"]),
- get_value: getEmsc("TALER_WR_get_value", "number", ["number"]),
- hash: getEmsc("GNUNET_CRYPTO_hash", "void", ["number", "number", "number"]),
- hash_context_abort: getEmsc("GNUNET_CRYPTO_hash_context_abort", "void", ["number"]),
- hash_context_finish: getEmsc("GNUNET_CRYPTO_hash_context_finish", "void", ["number", "number"]),
- hash_context_read: getEmsc("GNUNET_CRYPTO_hash_context_read", "void", ["number", "number", "number"]),
- hash_create_random: getEmsc("GNUNET_CRYPTO_hash_create_random", "void", ["number", "number"]),
- memmove: getEmsc("memmove", "number", ["number", "number", "number"]),
- random_block: getEmsc("GNUNET_CRYPTO_random_block", "void", ["number", "number", "number"]),
- rsa_blinding_key_free: getEmsc("GNUNET_CRYPTO_rsa_blinding_key_free", "void", ["number"]),
- rsa_public_key_free: getEmsc("GNUNET_CRYPTO_rsa_public_key_free", "void", ["number"]),
- rsa_private_key_free: getEmsc("GNUNET_CRYPTO_rsa_private_key_free", "void", ["number"]),
- rsa_signature_free: getEmsc("GNUNET_CRYPTO_rsa_signature_free", "void", ["number"]),
- rsa_verify: getEmsc("GNUNET_CRYPTO_rsa_verify", "number", ["number", "number", "number"]),
- setup_fresh_coin: getEmsc("TALER_setup_fresh_coin", "void", ["number", "number", "number"]),
- string_to_data: getEmsc("GNUNET_STRINGS_string_to_data", "number", ["number", "number", "number", "number"]),
- };
- }
-}
-
-
-/**
- * Constants for signatures purposes, define what the signatures vouches for.
- */
-export enum SignaturePurpose {
- RESERVE_WITHDRAW = 1200,
- WALLET_COIN_DEPOSIT = 1201,
- MASTER_DENOMINATION_KEY_VALIDITY = 1025,
- WALLET_COIN_MELT = 1202,
- TEST = 4242,
- MERCHANT_PAYMENT_OK = 1104,
- MASTER_WIRE_FEES = 1028,
- WALLET_COIN_PAYBACK = 1203,
- WALLET_COIN_LINK = 1204,
-}
-
-
-/**
- * Desired quality levels for random numbers.
- */
-export enum RandomQuality {
- WEAK = 0,
- STRONG = 1,
- NONCE = 2,
-}
-
-
-/**
- * Object that is allocated in some arena.
- */
-interface ArenaObject {
- destroy(): void;
-}
-
-
-/**
- * Context for cummulative hashing.
- */
-export class HashContext implements ArenaObject {
- private hashContextPtr: number | undefined;
-
- constructor(private emsc: EmscEnvironment) {
- this.hashContextPtr = emsc.allocFuncs.hash_context_start();
- }
-
- /**
- * Add data to be hashed.
- */
- read(obj: PackedArenaObject): void {
- if (!this.hashContextPtr) {
- throw Error("assertion failed");
- }
- this.emsc.funcs.hash_context_read(this.hashContextPtr, obj.nativePtr, obj.size());
- }
-
- /**
- * Finish the hash computation.
- */
- finish(h: HashCode) {
- if (!this.hashContextPtr) {
- throw Error("assertion failed");
- }
- h.alloc();
- this.emsc.funcs.hash_context_finish(this.hashContextPtr, h.nativePtr);
- }
-
- /**
- * Abort hashing without computing the result.
- */
- destroy(): void {
- if (this.hashContextPtr) {
- this.emsc.funcs.hash_context_abort(this.hashContextPtr);
- }
- this.hashContextPtr = undefined;
- }
-}
-
-
-/**
- * Arena object that points to an allocated block of memory.
- */
-abstract class MallocArenaObject implements ArenaObject {
- protected _nativePtr: number | undefined = undefined;
-
- /**
- * Is this a weak reference to the underlying memory?
- */
- isWeak = false;
-
- destroy(): void {
- if (this._nativePtr && !this.isWeak) {
- this.emsc.funcs.free(this.nativePtr);
- this._nativePtr = undefined;
- }
- }
-
- constructor(public emsc: EmscEnvironment, arena?: Arena) {
- if (!arena) {
- if (arenaStack.length === 0) {
- throw Error("No arena available");
- }
- arena = arenaStack[arenaStack.length - 1];
- }
- arena.put(this);
- }
-
- alloc(size: number) {
- if (this._nativePtr !== undefined) {
- throw Error("Double allocation");
- }
- this.nativePtr = this.emsc.allocFuncs.malloc(size);
- }
-
- set nativePtr(v: number) {
- if (v === undefined) {
- throw Error("Native pointer must be a number or null");
- }
- this._nativePtr = v;
- }
-
- get nativePtr() {
- // We want to allow latent allocation
- // of native wrappers, but we never want to
- // pass 'undefined' to emscripten.
- if (this._nativePtr === undefined) {
- throw Error("Native pointer not initialized");
- }
- return this._nativePtr;
- }
-}
-
-
-/**
- * An arena stores objects that will be deallocated
- * at the same time.
- */
-interface Arena {
- put(obj: ArenaObject): void;
- destroy(): void;
-}
-
-
-/**
- * Arena that must be manually destroyed.
- */
-class SimpleArena implements Arena {
- protected heap: ArenaObject[];
-
- constructor() {
- this.heap = [];
- }
-
- put(obj: ArenaObject) {
- this.heap.push(obj);
- }
-
- destroy() {
- for (const obj of this.heap) {
- obj.destroy();
- }
- this.heap = [];
- }
-}
-
-
-/**
- * Arena that destroys all its objects once control has returned to the message
- * loop.
- */
-class SyncArena extends SimpleArena {
- private isScheduled: boolean;
-
- constructor() {
- super();
- }
-
- pub(obj: MallocArenaObject) {
- super.put(obj);
- if (!this.isScheduled) {
- this.schedule();
- }
- this.heap.push(obj);
- }
-
- private schedule() {
- this.isScheduled = true;
- Promise.resolve().then(() => {
- this.isScheduled = false;
- this.destroy();
- });
- }
-}
-
-export const arenaStack: Arena[] = [];
-arenaStack.push(new SyncArena());
-
-
-/**
- * Representation of monetary value in a given currency.
- */
-export class Amount extends MallocArenaObject {
- constructor(emsc: EmscEnvironment, args?: AmountJson, arena?: Arena) {
- super(emsc, arena);
- if (args) {
- this.nativePtr = emsc.allocFuncs.get_amount(args.value,
- 0,
- args.fraction,
- args.currency);
- } else {
- this.nativePtr = emsc.allocFuncs.get_amount(0, 0, 0, "");
- }
- }
-
- static getZero(emsc: EmscEnvironment, currency: string, a?: Arena): Amount {
- const am = new Amount(emsc, undefined, a);
- const r = emsc.funcs.amount_get_zero(currency, am.nativePtr);
- if (r !== GNUNET_OK) {
- throw Error("invalid currency");
- }
- return am;
- }
-
-
- toNbo(a?: Arena): AmountNbo {
- const x = new AmountNbo(this.emsc, a);
- x.alloc();
- this.emsc.funcs.amount_hton(x.nativePtr, this.nativePtr);
- return x;
- }
-
- fromNbo(nbo: AmountNbo): void {
- this.emsc.funcs.amount_ntoh(this.nativePtr, nbo.nativePtr);
- }
-
- get value() {
- return this.emsc.funcs.get_value(this.nativePtr);
- }
-
- get fraction() {
- return this.emsc.funcs.get_fraction(this.nativePtr);
- }
-
- get currency(): string {
- return this.emsc.funcs.get_currency(this.nativePtr);
- }
-
- toJson(): AmountJson {
- return {
- currency: this.emsc.funcs.get_currency(this.nativePtr),
- fraction: this.emsc.funcs.get_fraction(this.nativePtr),
- value: this.emsc.funcs.get_value(this.nativePtr),
- };
- }
-
- /**
- * Add an amount to this amount.
- */
- add(a: Amount) {
- const res = this.emsc.funcs.amount_add(this.nativePtr, a.nativePtr, this.nativePtr);
- if (res < 1) {
- // Overflow
- return false;
- }
- return true;
- }
-
- /**
- * Perform saturating subtraction on amounts.
- */
- sub(a: Amount) {
- // this = this - a
- const res = this.emsc.funcs.amount_subtract(this.nativePtr, this.nativePtr, a.nativePtr);
- if (res === 0) {
- // Underflow
- return false;
- }
- if (res > 0) {
- return true;
- }
- throw Error("Incompatible currencies");
- }
-
- cmp(a: Amount) {
- // If we don't check this, the c code aborts.
- if (this.currency !== a.currency) {
- throw Error(`incomparable currencies (${this.currency} and ${a.currency})`);
- }
- return this.emsc.funcs.amount_cmp(this.nativePtr, a.nativePtr);
- }
-
- normalize() {
- this.emsc.funcs.amount_normalize(this.nativePtr);
- }
-}
-
-
-/**
- * Count the UTF-8 characters in a JavaScript string.
- */
-function countUtf8Bytes(str: string): number {
- let s = str.length;
- // JavaScript strings are UTF-16 arrays
- for (let i = str.length - 1; i >= 0; i--) {
- const code = str.charCodeAt(i);
- if (code > 0x7f && code <= 0x7ff) {
- // We need an extra byte in utf-8 here
- s++;
- } else if (code > 0x7ff && code <= 0xffff) {
- // We need two extra bytes in utf-8 here
- s += 2;
- }
- // Skip over the other surrogate
- if (code >= 0xDC00 && code <= 0xDFFF) {
- i--;
- }
- }
- return s;
-}
-
-
-/**
- * Managed reference to a contiguous block of memory in the Emscripten heap.
- * Can be converted from / to a serialized representation.
- * Should contain only data, not pointers.
- */
-abstract class PackedArenaObject extends MallocArenaObject {
- abstract size(): number;
-
- constructor(emsc: EmscEnvironment, a?: Arena) {
- super(emsc, a);
- }
-
- randomize(qual: RandomQuality = RandomQuality.STRONG): void {
- this.emsc.funcs.random_block(qual, this.nativePtr, this.size());
- }
-
- toCrock(): string {
- const d = this.emsc.allocFuncs.data_to_string_alloc(this.nativePtr, this.size());
- const s = this.emsc.lib.UTF8ToString(d);
- this.emsc.funcs.free(d);
- return s;
- }
-
- toJson(): any {
- // Per default, the json encoding of
- // packed arena objects is just the crockford encoding.
- // Subclasses typically want to override this.
- return this.toCrock();
- }
-
- loadCrock(s: string) {
- this.alloc();
- // We need to get the javascript string
- // to the emscripten heap first.
- const buf = ByteArray.fromStringWithNull(this.emsc, s);
- const res = this.emsc.funcs.string_to_data(buf.nativePtr,
- s.length,
- this.nativePtr,
- this.size());
- buf.destroy();
- if (res < 1) {
- throw {error: "wrong encoding"};
- }
- }
-
- alloc() {
- // FIXME: should the client be allowed to call alloc multiple times?
- if (!this._nativePtr) {
- this.nativePtr = this.emsc.allocFuncs.malloc(this.size());
- }
- }
-
- hash(): HashCode {
- const x = new HashCode(this.emsc);
- x.alloc();
- this.emsc.funcs.hash(this.nativePtr, this.size(), x.nativePtr);
- return x;
- }
-
- hexdump() {
- const bytes: string[] = [];
- for (let i = 0; i < this.size(); i++) {
- let b = this.emsc.lib.getValue(this.nativePtr + i, "i8");
- b = (b + 256) % 256;
- bytes.push("0".concat(b.toString(16)).slice(-2));
- }
- const lines: string[] = [];
- for (let i = 0; i < bytes.length; i += 8) {
- lines.push(bytes.slice(i, i + 8).join(","));
- }
- return lines.join("\n");
- }
-}
-
-
-/**
- * Amount, encoded for network transmission.
- */
-export class AmountNbo extends PackedArenaObject {
- size() {
- return 24;
- }
-
- toJson(): any {
- const a = new SimpleArena();
- const am = new Amount(this.emsc, undefined, a);
- am.fromNbo(this);
- const json = am.toJson();
- a.destroy();
- return json;
- }
-}
-
-
-/**
- * Create a packed arena object from the base32 crockford encoding.
- */
-function fromCrock<T extends PackedArenaObject>(emsc: EmscEnvironment, s: string, ctor: Ctor<T>): T {
- const x: T = new ctor(emsc);
- x.alloc();
- x.loadCrock(s);
- return x;
-}
-
-
-/**
- * Create a packed arena object from the base32 crockford encoding for objects
- * that have a special decoding function.
- */
-function fromCrockDecoded<T extends MallocArenaObject>(emsc: EmscEnvironment, s: string,
- ctor: Ctor<T>,
- decodeFn: (p: number, s: number) => number): T {
- const obj = new ctor(emsc);
- const buf = ByteArray.fromCrock(emsc, s);
- obj.nativePtr = decodeFn(buf.nativePtr, buf.size());
- buf.destroy();
- return obj;
-}
-
-
-/**
- * Encode an object using a special encoding function.
- */
-function encode<T extends MallocArenaObject>(obj: T, encodeFn: any, arena?: Arena): ByteArray {
- const ptr = obj.emsc.allocFuncs.malloc(PTR_SIZE);
- const len = encodeFn(obj.nativePtr, ptr);
- const res = new ByteArray(obj.emsc, len, undefined, arena);
- res.nativePtr = obj.emsc.lib.getValue(ptr, "*");
- obj.emsc.funcs.free(ptr);
- return res;
-}
-
-
-/**
- * Private EdDSA key.
- */
-export class EddsaPrivateKey extends PackedArenaObject {
- static create(emsc: EmscEnvironment, a?: Arena): EddsaPrivateKey {
- const obj = new EddsaPrivateKey(emsc, a);
- obj.nativePtr = emsc.allocFuncs.eddsa_key_create();
- return obj;
- }
-
- size() {
- return 32;
- }
-
- getPublicKey(a?: Arena): EddsaPublicKey {
- const obj = new EddsaPublicKey(this.emsc, a);
- obj.nativePtr = this.emsc.allocFuncs.eddsa_public_key_from_private(this.nativePtr);
- return obj;
- }
-
- static fromCrock(emsc: EmscEnvironment, s: string): EddsaPrivateKey {
- return fromCrock(emsc, s, this);
- }
-}
-
-
-/**
- * Low-level handle to an EdDSA private key.
- */
-export class EcdsaPrivateKey extends PackedArenaObject {
- static create(emsc: EmscEnvironment, a?: Arena): EcdsaPrivateKey {
- const obj = new EcdsaPrivateKey(emsc, a);
- obj.nativePtr = emsc.allocFuncs.ecdsa_key_create();
- return obj;
- }
-
- size() {
- return 32;
- }
-
- getPublicKey(a?: Arena): EcdsaPublicKey {
- const obj = new EcdsaPublicKey(this.emsc, a);
- obj.nativePtr = this.emsc.allocFuncs.ecdsa_public_key_from_private(this.nativePtr);
- return obj;
- }
-
- static fromCrock(emsc: EmscEnvironment, s: string): EcdsaPrivateKey {
- return fromCrock(emsc, s, this);
- }
-}
-
-
-/**
- * Low-level handle to an ECDHE private key.
- */
-export class EcdhePrivateKey extends PackedArenaObject {
- static create(emsc: EmscEnvironment, a?: Arena): EcdhePrivateKey {
- const obj = new EcdhePrivateKey(emsc, a);
- obj.nativePtr = emsc.allocFuncs.ecdhe_key_create();
- return obj;
- }
-
- size() {
- return 32;
- }
-
- getPublicKey(a?: Arena): EcdhePublicKey {
- const obj = new EcdhePublicKey(this.emsc, a);
- obj.nativePtr = this.emsc.allocFuncs.ecdhe_public_key_from_private(this.nativePtr);
- return obj;
- }
-
- static fromCrock(emsc: EmscEnvironment, s: string): EcdhePrivateKey {
- return fromCrock(emsc, s, this);
- }
-}
-
-
-/**
- * Constructor for a given type.
- */
-interface Ctor<T> {
- new(emsc: EmscEnvironment): T;
-}
-
-
-/**
- * Low-level handle to an EdDSA public key.
- */
-export class EddsaPublicKey extends PackedArenaObject {
- size() {
- return 32;
- }
-
- static fromCrock(emsc: EmscEnvironment, s: string): EddsaPublicKey {
- return fromCrock(emsc, s, this);
- }
-}
-
-/**
- * Low-level handle to an ECDSA public key.
- */
-export class EcdsaPublicKey extends PackedArenaObject {
- size() {
- return 32;
- }
-
- static fromCrock(emsc: EmscEnvironment, s: string): EcdsaPublicKey {
- return fromCrock(emsc, s, this);
- }
-}
-
-
-/**
- * Low-level handle to an ECDHE public key.
- */
-export class EcdhePublicKey extends PackedArenaObject {
- size() {
- return 32;
- }
-
- static fromCrock(emsc: EmscEnvironment, s: string): EcdhePublicKey {
- return fromCrock(emsc, s, this);
- }
-}
-
-
-/**
- * Low-level handle to a blinding key secret.
- */
-export class RsaBlindingKeySecret extends PackedArenaObject {
- size() {
- return 32;
- }
-
- /**
- * Create a random blinding key secret.
- */
- static create(emsc: EmscEnvironment, a?: Arena): RsaBlindingKeySecret {
- const o = new RsaBlindingKeySecret(emsc, a);
- o.alloc();
- o.randomize();
- return o;
- }
-
- static fromCrock(emsc: EmscEnvironment, s: string): RsaBlindingKeySecret {
- return fromCrock(emsc, s, this);
- }
-}
-
-
-/**
- * Low-level handle to a hash code.
- */
-export class HashCode extends PackedArenaObject {
- size() {
- return 64;
- }
-
- static fromCrock(emsc: EmscEnvironment, s: string): HashCode {
- return fromCrock(emsc, s, this);
- }
-
- random(qual: RandomQuality = RandomQuality.STRONG) {
- this.alloc();
- this.emsc.funcs.hash_create_random(qual, this.nativePtr);
- }
-}
-
-
-/**
- * Low-level handle to a byte array.
- */
-export class ByteArray extends PackedArenaObject {
- private allocatedSize: number;
-
- size() {
- return this.allocatedSize;
- }
-
- constructor(public emsc: EmscEnvironment, desiredSize: number, init?: number, a?: Arena) {
- super(emsc, a);
- if (init === undefined) {
- this.nativePtr = this.emsc.allocFuncs.malloc(desiredSize);
- } else {
- this.nativePtr = init;
- }
- this.allocatedSize = desiredSize;
- }
-
- static fromStringWithoutNull(emsc: EmscEnvironment, s: string, a?: Arena): ByteArray {
- // UTF-8 bytes, including 0-terminator
- const terminatedByteLength = countUtf8Bytes(s) + 1;
- const hstr = emsc.allocFuncs.malloc(terminatedByteLength);
- emsc.lib.stringToUTF8(s, hstr, terminatedByteLength);
- return new ByteArray(emsc, terminatedByteLength - 1, hstr, a);
- }
-
- static fromStringWithNull(emsc: EmscEnvironment, s: string, a?: Arena): ByteArray {
- // UTF-8 bytes, including 0-terminator
- const terminatedByteLength = countUtf8Bytes(s) + 1;
- const hstr = emsc.allocFuncs.malloc(terminatedByteLength);
- emsc.lib.stringToUTF8(s, hstr, terminatedByteLength);
- return new ByteArray(emsc, terminatedByteLength, hstr, a);
- }
-
- static fromCrock(emsc: EmscEnvironment, s: string, a?: Arena): ByteArray {
- // this one is a bit more complicated than the other fromCrock functions,
- // since we don't have a fixed size
- const byteLength = countUtf8Bytes(s);
- const hstr = emsc.allocFuncs.malloc(byteLength + 1);
- emsc.lib.stringToUTF8(s, hstr, byteLength + 1);
- const decodedLen = Math.floor((byteLength * 5) / 8);
- const ba = new ByteArray(emsc, decodedLen, undefined, a);
- const res = emsc.funcs.string_to_data(hstr, byteLength, ba.nativePtr, decodedLen);
- emsc.funcs.free(hstr);
- if (res !== GNUNET_OK) {
- throw Error("decoding failed");
- }
- return ba;
- }
-}
-
-
-/**
- * Data to sign, together with a header that includes a purpose id
- * and size.
- */
-export class EccSignaturePurpose extends PackedArenaObject {
- size() {
- return this.payloadSize + 8;
- }
-
- private payloadSize: number;
-
- constructor(emsc: EmscEnvironment,
- purpose: SignaturePurpose,
- payload: PackedArenaObject,
- a?: Arena) {
- super(emsc, a);
- this.nativePtr = emsc.allocFuncs.purpose_create(purpose,
- payload.nativePtr,
- payload.size());
- this.payloadSize = payload.size();
- }
-}
-
-
-abstract class SignatureStruct {
- abstract fieldTypes(): any[];
-
- abstract purpose(): SignaturePurpose;
-
- private members: any = {};
-
- constructor(public emsc: EmscEnvironment, x: { [name: string]: any }) {
- for (const k in x) {
- this.set(k, x[k]);
- }
- }
-
- toPurpose(a?: Arena): EccSignaturePurpose {
- let totalSize = 0;
- for (const f of this.fieldTypes()) {
- const name = f[0];
- const member = this.members[name];
- if (!member) {
- throw Error(`Member ${name} not set`);
- }
- totalSize += member.size();
- }
-
- const buf = this.emsc.allocFuncs.malloc(totalSize);
- let ptr = buf;
- for (const f of this.fieldTypes()) {
- const name = f[0];
- const member = this.members[name];
- const size = member.size();
- this.emsc.funcs.memmove(ptr, member.nativePtr, size);
- ptr += size;
- }
- const ba = new ByteArray(this.emsc, totalSize, buf, a);
- return new EccSignaturePurpose(this.emsc, this.purpose(), ba);
- }
-
-
- toJson() {
- const res: any = {};
- for (const f of this.fieldTypes()) {
- const name = f[0];
- const member = this.members[name];
- if (!member) {
- throw Error(`Member ${name} not set`);
- }
- res[name] = member.toJson();
- }
- res.purpose = this.purpose();
- return res;
- }
-
- protected set(name: string, value: PackedArenaObject) {
- const typemap: any = {};
- for (const f of this.fieldTypes()) {
- typemap[f[0]] = f[1];
- }
- if (!(name in typemap)) {
- throw Error(`Key ${name} not found`);
- }
- if (!(value instanceof typemap[name])) {
- throw Error(`Wrong type for ${name}`);
- }
- this.members[name] = value;
- }
-}
-
-
-/**
- * Arguments to constructor of [[WithdrawRequestPS]].
- */
-export interface WithdrawRequestPS_Args {
- /**
- * Reserve public key.
- */
- reserve_pub: EddsaPublicKey;
- /**
- * Amount with fee.
- */
- amount_with_fee: AmountNbo;
- /**
- * Withdraw fee.
- */
- withdraw_fee: AmountNbo;
- /**
- * Hash of denomination public key.
- */
- h_denomination_pub: HashCode;
- /**
- * Hash of coin envelope.
- */
- h_coin_envelope: HashCode;
-}
-
-
-/**
- * Low-level handle to a WithdrawRequest signature structure.
- */
-export class WithdrawRequestPS extends SignatureStruct {
- constructor(emsc: EmscEnvironment, w: WithdrawRequestPS_Args) {
- super(emsc, w);
- }
-
- purpose() {
- return SignaturePurpose.RESERVE_WITHDRAW;
- }
-
- fieldTypes() {
- return [
- ["reserve_pub", EddsaPublicKey],
- ["amount_with_fee", AmountNbo],
- ["withdraw_fee", AmountNbo],
- ["h_denomination_pub", HashCode],
- ["h_coin_envelope", HashCode],
- ];
- }
-}
-
-
-/**
- * Arguments for constructor or [[PaybackRequestPS]].
- */
-export interface PaybackRequestPS_args {
- coin_pub: EddsaPublicKey;
- h_denom_pub: HashCode;
- coin_blind: RsaBlindingKeySecret;
-}
-
-
-/**
- * Low-level handle to a PaybackRequest signature structure.
- */
-export class PaybackRequestPS extends SignatureStruct {
- constructor(emsc: EmscEnvironment, w: PaybackRequestPS_args) {
- super(emsc, w);
- }
-
- purpose() {
- return SignaturePurpose.WALLET_COIN_PAYBACK;
- }
-
- fieldTypes() {
- return [
- ["coin_pub", EddsaPublicKey],
- ["h_denom_pub", HashCode],
- ["coin_blind", RsaBlindingKeySecret],
- ];
- }
-}
-
-
-/**
- * Arguments for constructor of [[RefreshMeltCoinAffirmationPS]].
- */
-interface RefreshMeltCoinAffirmationPS_Args {
- session_hash: HashCode;
- amount_with_fee: AmountNbo;
- melt_fee: AmountNbo;
- coin_pub: EddsaPublicKey;
-}
-
-/**
- * Low-level handle to a RefreshMeltCoinAffirmationPS signature structure.
- */
-export class RefreshMeltCoinAffirmationPS extends SignatureStruct {
- constructor(emsc: EmscEnvironment, w: RefreshMeltCoinAffirmationPS_Args) {
- super(emsc, w);
- }
-
- purpose() {
- return SignaturePurpose.WALLET_COIN_MELT;
- }
-
- fieldTypes() {
- return [
- ["session_hash", HashCode],
- ["amount_with_fee", AmountNbo],
- ["melt_fee", AmountNbo],
- ["coin_pub", EddsaPublicKey],
- ];
- }
-}
-
-
-/**
- * Arguments for constructor of [[MasterWireFeePS]].
- */
-interface MasterWireFeePS_Args {
- /**
- * Hash of wire method.
- */
- h_wire_method: HashCode;
- /**
- * Start date.
- */
- start_date: AbsoluteTimeNbo;
- /**
- * End date.
- */
- end_date: AbsoluteTimeNbo;
- /**
- * Wire fee.
- */
- wire_fee: AmountNbo;
- /**
- * Closing fee.
- */
- closing_fee: AmountNbo;
-}
-
-
-/**
- * Low-level handle to a structure being signed over.
- */
-export class MasterWireFeePS extends SignatureStruct {
- constructor(emsc: EmscEnvironment, w: MasterWireFeePS_Args) {
- super(emsc, w);
- }
-
- purpose() {
- return SignaturePurpose.MASTER_WIRE_FEES;
- }
-
- fieldTypes() {
- return [
- ["h_wire_method", HashCode],
- ["start_date", AbsoluteTimeNbo],
- ["end_date", AbsoluteTimeNbo],
- ["wire_fee", AmountNbo],
- ["closing_fee", AmountNbo],
- ];
- }
-}
-
-
-/**
- * Low-level handle to an absolute time in network byte order (NBO).
- */
-export class AbsoluteTimeNbo extends PackedArenaObject {
- static fromTalerString(emsc: EmscEnvironment, s: string): AbsoluteTimeNbo {
- const x = new AbsoluteTimeNbo(emsc);
- x.alloc();
- const r = /Date\(([0-9]+)\)/;
- const m = r.exec(s);
- if (!m || m.length !== 2) {
- throw Error();
- }
- const n = parseInt(m[1], 10) * 1000000;
- // XXX: This only works up to 54 bit numbers.
- set64(emsc, x.nativePtr, n);
- return x;
- }
-
- static fromStampSeconds(emsc: EmscEnvironment, stamp: number): AbsoluteTimeNbo {
- const x = new AbsoluteTimeNbo(emsc);
- x.alloc();
- // XXX: This only works up to 54 bit numbers.
- set64(emsc, x.nativePtr, stamp * 1000000);
- return x;
- }
-
-
- size() {
- return 8;
- }
-}
-
-
-// XXX: This only works up to 54 bit numbers.
-function set64(emsc: EmscEnvironment, p: number, n: number) {
- for (let i = 0; i < 8; ++i) {
- emsc.lib.setValue(p + (7 - i), n & 0xFF, "i8");
- n = Math.floor(n / 256);
- }
-}
-
-// XXX: This only works up to 54 bit numbers.
-function set32(emsc: EmscEnvironment, p: number, n: number) {
- for (let i = 0; i < 4; ++i) {
- emsc.lib.setValue(p + (3 - i), n & 0xFF, "i8");
- n = Math.floor(n / 256);
- }
-}
-
-
-/**
- * Low-level handle to an unsigned 64-bit value.
- */
-export class UInt64 extends PackedArenaObject {
- static fromNumber(emsc: EmscEnvironment, n: number): UInt64 {
- const x = new UInt64(emsc);
- x.alloc();
- set64(emsc, x.nativePtr, n);
- return x;
- }
-
- size() {
- return 8;
- }
-}
-
-
-/**
- * Low-level handle to an unsigned 32-bit value.
- */
-export class UInt32 extends PackedArenaObject {
- static fromNumber(emsc: EmscEnvironment, n: number): UInt32 {
- const x = new UInt32(emsc);
- x.alloc();
- set32(emsc, x.nativePtr, n);
- return x;
- }
-
- size() {
- return 4;
- }
-}
-
-
-/**
- * Argument to the constructor of [[DepositRequestPS]].
- */
-export interface DepositRequestPS_Args {
- /**
- * Contract hash.
- */
- h_contract: HashCode;
- /**
- * Wire info hash.
- */
- h_wire: HashCode;
- /**
- * Timestamp.
- */
- timestamp: AbsoluteTimeNbo;
- /**
- * Refund deadline.
- */
- refund_deadline: AbsoluteTimeNbo;
- /**
- * Amount with fee.
- */
- amount_with_fee: AmountNbo;
- /**
- * Deposit fee.
- */
- deposit_fee: AmountNbo;
- /**
- * Merchant public key.
- */
- merchant: EddsaPublicKey;
- /**
- * Public key of the coin being deposited.
- */
- coin_pub: EddsaPublicKey;
-}
-
-
-/**
- * Low-level handle to a struct being signed over.
- */
-export class DepositRequestPS extends SignatureStruct {
- constructor(emsc: EmscEnvironment, w: DepositRequestPS_Args) {
- super(emsc, w);
- }
-
- purpose() {
- return SignaturePurpose.WALLET_COIN_DEPOSIT;
- }
-
- fieldTypes() {
- return [
- ["h_contract", HashCode],
- ["h_wire", HashCode],
- ["timestamp", AbsoluteTimeNbo],
- ["refund_deadline", AbsoluteTimeNbo],
- ["amount_with_fee", AmountNbo],
- ["deposit_fee", AmountNbo],
- ["merchant", EddsaPublicKey],
- ["coin_pub", EddsaPublicKey],
- ];
- }
-}
-
-
-interface CoinLinkSignaturePS_args {
- h_denom_pub: HashCode;
- old_coin_pub: EddsaPublicKey;
- transfer_pub: EcdhePublicKey;
- coin_envelope_hash: HashCode;
-}
-
-
-export class CoinLinkSignaturePS extends SignatureStruct {
- constructor(emsc: EmscEnvironment, w: CoinLinkSignaturePS_args) {
- super(emsc, w);
- }
-
- purpose() {
- return SignaturePurpose.WALLET_COIN_LINK;
- }
-
- fieldTypes() {
- return [
- ["h_denom_pub", HashCode],
- ["old_coin_pub", EddsaPublicKey],
- ["transfer_pub", EcdhePublicKey],
- ["coin_envelope_hash", HashCode],
- ];
- }
-}
-
-
-/**
- * Arguments for constuctor of [[DenominationKeyValidityPS]].
- */
-export interface DenominationKeyValidityPS_args {
- master: EddsaPublicKey;
- start: AbsoluteTimeNbo;
- expire_withdraw: AbsoluteTimeNbo;
- expire_spend: AbsoluteTimeNbo;
- expire_legal: AbsoluteTimeNbo;
- value: AmountNbo;
- fee_withdraw: AmountNbo;
- fee_deposit: AmountNbo;
- fee_refresh: AmountNbo;
- fee_refund: AmountNbo;
- denom_hash: HashCode;
-}
-
-
-/**
- * Low-level handle to a structure being signed over.
- */
-export class DenominationKeyValidityPS extends SignatureStruct {
- constructor(emsc: EmscEnvironment, w: DenominationKeyValidityPS_args) {
- super(emsc, w);
- }
-
- purpose() {
- return SignaturePurpose.MASTER_DENOMINATION_KEY_VALIDITY;
- }
-
- fieldTypes() {
- return [
- ["master", EddsaPublicKey],
- ["start", AbsoluteTimeNbo],
- ["expire_withdraw", AbsoluteTimeNbo],
- ["expire_spend", AbsoluteTimeNbo],
- ["expire_legal", AbsoluteTimeNbo],
- ["value", AmountNbo],
- ["fee_withdraw", AmountNbo],
- ["fee_deposit", AmountNbo],
- ["fee_refresh", AmountNbo],
- ["fee_refund", AmountNbo],
- ["denom_hash", HashCode],
- ];
- }
-}
-
-/**
- * Arguments to constructor of [[PaymentSignaturePS]].
- */
-export interface PaymentSignaturePS_args {
- /**
- * Contract hash.
- */
- contract_hash: HashCode;
-}
-
-
-/**
- * Low-level handle to a structure being signed over.
- */
-export class PaymentSignaturePS extends SignatureStruct {
- constructor(emsc: EmscEnvironment, w: PaymentSignaturePS_args) {
- super(emsc, w);
- }
-
- purpose() {
- return SignaturePurpose.MERCHANT_PAYMENT_OK;
- }
-
- fieldTypes() {
- return [
- ["contract_hash", HashCode],
- ];
- }
-}
-
-
-/**
- * Low-level handle to an RsaPrivateKey.
- */
-export class RsaPrivateKey extends MallocArenaObject {
- static fromCrock(emsc: EmscEnvironment, s: string): RsaPrivateKey {
- return fromCrockDecoded(emsc, s, this, emsc.allocFuncs.rsa_private_key_decode);
- }
-
- static create(emsc: EmscEnvironment, bitLen: number, a?: Arena): RsaPrivateKey {
- const obj = new RsaPrivateKey(emsc, a);
- obj.nativePtr = emsc.allocFuncs.rsa_private_key_create(bitLen);
- return obj;
- }
-
- toCrock() {
- return this.encode().toCrock();
- }
-
-
- getPublicKey(a?: Arena): RsaPublicKey {
- const obj = new RsaPublicKey(this.emsc, a);
- obj.nativePtr = this.emsc.allocFuncs.rsa_private_key_get_public(this.nativePtr);
- return obj;
- }
-
- destroy() {
- this.emsc.funcs.rsa_public_key_free(this.nativePtr);
- this.nativePtr = 0;
- }
-
- encode(arena?: Arena): ByteArray {
- return encode(this, this.emsc.allocFuncs.rsa_private_key_encode);
- }
-}
-
-
-/**
- * Low-level handle to an RsaPublicKey.
- */
-export class RsaPublicKey extends MallocArenaObject {
- static fromCrock(emsc: EmscEnvironment, s: string): RsaPublicKey {
- return fromCrockDecoded(emsc, s, this, emsc.allocFuncs.rsa_public_key_decode);
- }
-
- toCrock() {
- return this.encode().toCrock();
- }
-
- destroy() {
- this.emsc.funcs.rsa_public_key_free(this.nativePtr);
- this.nativePtr = 0;
- }
-
- encode(arena?: Arena): ByteArray {
- return encode(this, this.emsc.allocFuncs.rsa_public_key_encode);
- }
-}
-
-
-/**
- * Low-level handle to an EddsaSignature.
- */
-export class EddsaSignature extends PackedArenaObject {
- size() {
- return 64;
- }
- static fromCrock(emsc: EmscEnvironment, s: string): EddsaSignature {
- return fromCrock(emsc, s, this);
- }
-}
-
-
-/**
- * Low-level handle to an RsaSignature.
- */
-export class RsaSignature extends MallocArenaObject {
- static fromCrock(emsc: EmscEnvironment, s: string, a?: Arena) {
- return fromCrockDecoded(emsc, s, this, emsc.allocFuncs.rsa_signature_decode);
- }
-
- encode(arena?: Arena): ByteArray {
- return encode(this, this.emsc.allocFuncs.rsa_signature_encode);
- }
-
- destroy() {
- this.emsc.funcs.rsa_signature_free(this.nativePtr);
- this.nativePtr = 0;
- }
-}
-
-
-/**
- * Blind a value so it can be blindly signed.
- */
-export function rsaBlind(hashCode: HashCode,
- blindingKey: RsaBlindingKeySecret,
- pkey: RsaPublicKey,
- arena?: Arena): ByteArray|null {
- const emsc: EmscEnvironment = hashCode.emsc;
- const buf_ptr_out = emsc.allocFuncs.malloc(PTR_SIZE);
- const buf_size_out = emsc.allocFuncs.malloc(PTR_SIZE);
- const res = emsc.allocFuncs.rsa_blind(hashCode.nativePtr,
- blindingKey.nativePtr,
- pkey.nativePtr,
- buf_ptr_out,
- buf_size_out);
- const buf_ptr = emsc.lib.getValue(buf_ptr_out, "*");
- const buf_size = emsc.lib.getValue(buf_size_out, "*");
- emsc.funcs.free(buf_ptr_out);
- emsc.funcs.free(buf_size_out);
- if (res !== GNUNET_OK) {
- // malicious key
- return null;
- }
- return new ByteArray(emsc, buf_size, buf_ptr, arena);
-}
-
-
-/**
- * Sign data using EdDSA.
- */
-export function eddsaSign(purpose: EccSignaturePurpose,
- priv: EddsaPrivateKey,
- a?: Arena): EddsaSignature {
- const sig = new EddsaSignature(purpose.emsc, a);
- sig.alloc();
- const res = purpose.emsc.funcs.eddsa_sign(priv.nativePtr, purpose.nativePtr, sig.nativePtr);
- if (res < 1) {
- throw Error("EdDSA signing failed");
- }
- return sig;
-}
-
-
-/**
- * Verify EdDSA-signed data.
- */
-export function eddsaVerify(purposeNum: number,
- verify: EccSignaturePurpose,
- sig: EddsaSignature,
- pub: EddsaPublicKey,
- a?: Arena): boolean {
- const r = verify.emsc.funcs.eddsa_verify(purposeNum,
- verify.nativePtr,
- sig.nativePtr,
- pub.nativePtr);
- return r === GNUNET_OK;
-}
-
-
-export function rsaVerify(h: HashCode,
- sig: RsaSignature,
- pub: RsaPublicKey) {
- const r = h.emsc.funcs.rsa_verify(h.nativePtr,
- sig.nativePtr,
- pub.nativePtr);
- return r === GNUNET_OK;
-}
-
-
-/**
- * Unblind a blindly signed value.
- */
-export function rsaUnblind(sig: RsaSignature,
- bk: RsaBlindingKeySecret,
- pk: RsaPublicKey,
- a?: Arena): RsaSignature {
- const x = new RsaSignature(sig.emsc, a);
- x.nativePtr = sig.emsc.allocFuncs.rsa_unblind(sig.nativePtr,
- bk.nativePtr,
- pk.nativePtr);
- return x;
-}
-
-
-type TransferSecretP = HashCode;
-
-/**
- * A fresh coin generated from a sed.
- */
-export interface FreshCoin {
- /**
- * The coin's private key.
- */
- priv: EddsaPrivateKey;
- /**
- * The blinding key to use for withdrawal.
- */
- blindingKey: RsaBlindingKeySecret;
-}
-
-/**
- * Diffie-Hellman operation between an ECDHE private key
- * and an EdDSA public key.
- */
-export function ecdhEddsa(priv: EcdhePrivateKey,
- pub: EddsaPublicKey): HashCode {
- const h = new HashCode(priv.emsc);
- h.alloc();
- const res = priv.emsc.funcs.ecdh_eddsa(priv.nativePtr, pub.nativePtr, h.nativePtr);
- if (res !== GNUNET_OK) {
- throw Error("ecdh_eddsa failed");
- }
- return h;
-}
-
-export function rsaSignBlinded(priv: RsaPrivateKey,
- msg: ByteArray): RsaSignature {
- const sig = new RsaSignature(priv.emsc);
- sig.nativePtr = priv.emsc.allocFuncs.rsa_sign_blinded (priv.nativePtr,
- msg.nativePtr,
- msg.size());
- return sig;
-}
-
-
-
-/**
- * Derive a fresh coin from the given seed. Used during refreshing.
- */
-export function setupFreshCoin(secretSeed: TransferSecretP,
- coinIndex: number): FreshCoin {
- const emsc: EmscEnvironment = secretSeed.emsc;
- const priv = new EddsaPrivateKey(emsc);
- priv.isWeak = true;
- const blindingKey = new RsaBlindingKeySecret(emsc);
- blindingKey.isWeak = true;
- const buf = new ByteArray(emsc, priv.size() + blindingKey.size());
-
- emsc.funcs.setup_fresh_coin(secretSeed.nativePtr, coinIndex, buf.nativePtr);
-
- priv.nativePtr = buf.nativePtr;
- blindingKey.nativePtr = buf.nativePtr + priv.size();
-
- return { priv, blindingKey };
-}
diff --git a/src/crypto/nacl-fast.ts b/src/crypto/nacl-fast.ts
@@ -1,3036 +0,0 @@
-// Ported in 2014 by Dmitry Chestnykh and Devi Mandiri.
-// TypeScript port in 2019 by Florian Dold.
-// Public domain.
-//
-// Implementation derived from TweetNaCl version 20140427.
-// See for details: http://tweetnacl.cr.yp.to/
-
-const gf = function(init: number[] = []) {
- const r = new Float64Array(16);
- if (init) for (let i = 0; i < init.length; i++) r[i] = init[i];
- return r;
-};
-
-// Pluggable, initialized in high-level API below.
-let randombytes = function(x: Uint8Array, n: number): void {
- throw new Error("no PRNG");
-};
-
-const _0 = new Uint8Array(16);
-const _9 = new Uint8Array(32);
-_9[0] = 9;
-
-// prettier-ignore
-const gf0 = gf();
-const gf1 = gf([1]);
-const _121665 = gf([0xdb41, 1]);
-const D = gf([
- 0x78a3,
- 0x1359,
- 0x4dca,
- 0x75eb,
- 0xd8ab,
- 0x4141,
- 0x0a4d,
- 0x0070,
- 0xe898,
- 0x7779,
- 0x4079,
- 0x8cc7,
- 0xfe73,
- 0x2b6f,
- 0x6cee,
- 0x5203,
-]);
-const D2 = gf([
- 0xf159,
- 0x26b2,
- 0x9b94,
- 0xebd6,
- 0xb156,
- 0x8283,
- 0x149a,
- 0x00e0,
- 0xd130,
- 0xeef3,
- 0x80f2,
- 0x198e,
- 0xfce7,
- 0x56df,
- 0xd9dc,
- 0x2406,
-]);
-const X = gf([
- 0xd51a,
- 0x8f25,
- 0x2d60,
- 0xc956,
- 0xa7b2,
- 0x9525,
- 0xc760,
- 0x692c,
- 0xdc5c,
- 0xfdd6,
- 0xe231,
- 0xc0a4,
- 0x53fe,
- 0xcd6e,
- 0x36d3,
- 0x2169,
-]);
-const Y = gf([
- 0x6658,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
- 0x6666,
-]);
-const I = gf([
- 0xa0b0,
- 0x4a0e,
- 0x1b27,
- 0xc4ee,
- 0xe478,
- 0xad2f,
- 0x1806,
- 0x2f43,
- 0xd7a7,
- 0x3dfb,
- 0x0099,
- 0x2b4d,
- 0xdf0b,
- 0x4fc1,
- 0x2480,
- 0x2b83,
-]);
-
-function ts64(x: Uint8Array, i: number, h: number, l: number) {
- x[i] = (h >> 24) & 0xff;
- x[i + 1] = (h >> 16) & 0xff;
- x[i + 2] = (h >> 8) & 0xff;
- x[i + 3] = h & 0xff;
- x[i + 4] = (l >> 24) & 0xff;
- x[i + 5] = (l >> 16) & 0xff;
- x[i + 6] = (l >> 8) & 0xff;
- x[i + 7] = l & 0xff;
-}
-
-function vn(x: Uint8Array, xi: number, y: Uint8Array, yi: number, n: number) {
- var i,
- d = 0;
- for (i = 0; i < n; i++) d |= x[xi + i] ^ y[yi + i];
- return (1 & ((d - 1) >>> 8)) - 1;
-}
-
-function crypto_verify_16(
- x: Uint8Array,
- xi: number,
- y: Uint8Array,
- yi: number,
-) {
- return vn(x, xi, y, yi, 16);
-}
-
-function crypto_verify_32(
- x: Uint8Array,
- xi: number,
- y: Uint8Array,
- yi: number,
-) {
- return vn(x, xi, y, yi, 32);
-}
-
-// prettier-ignore
-function core_salsa20(o: Uint8Array, p: Uint8Array, k: Uint8Array, c: Uint8Array) {
- var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24,
- j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24,
- j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24,
- j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24,
- j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24,
- j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24,
- j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24,
- j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24,
- j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24,
- j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24,
- j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24,
- j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24,
- j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24,
- j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24,
- j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24,
- j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24;
-
- var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7,
- x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14,
- x15 = j15, u;
-
- for (var i = 0; i < 20; i += 2) {
- u = x0 + x12 | 0;
- x4 ^= u<<7 | u>>>(32-7);
- u = x4 + x0 | 0;
- x8 ^= u<<9 | u>>>(32-9);
- u = x8 + x4 | 0;
- x12 ^= u<<13 | u>>>(32-13);
- u = x12 + x8 | 0;
- x0 ^= u<<18 | u>>>(32-18);
-
- u = x5 + x1 | 0;
- x9 ^= u<<7 | u>>>(32-7);
- u = x9 + x5 | 0;
- x13 ^= u<<9 | u>>>(32-9);
- u = x13 + x9 | 0;
- x1 ^= u<<13 | u>>>(32-13);
- u = x1 + x13 | 0;
- x5 ^= u<<18 | u>>>(32-18);
-
- u = x10 + x6 | 0;
- x14 ^= u<<7 | u>>>(32-7);
- u = x14 + x10 | 0;
- x2 ^= u<<9 | u>>>(32-9);
- u = x2 + x14 | 0;
- x6 ^= u<<13 | u>>>(32-13);
- u = x6 + x2 | 0;
- x10 ^= u<<18 | u>>>(32-18);
-
- u = x15 + x11 | 0;
- x3 ^= u<<7 | u>>>(32-7);
- u = x3 + x15 | 0;
- x7 ^= u<<9 | u>>>(32-9);
- u = x7 + x3 | 0;
- x11 ^= u<<13 | u>>>(32-13);
- u = x11 + x7 | 0;
- x15 ^= u<<18 | u>>>(32-18);
-
- u = x0 + x3 | 0;
- x1 ^= u<<7 | u>>>(32-7);
- u = x1 + x0 | 0;
- x2 ^= u<<9 | u>>>(32-9);
- u = x2 + x1 | 0;
- x3 ^= u<<13 | u>>>(32-13);
- u = x3 + x2 | 0;
- x0 ^= u<<18 | u>>>(32-18);
-
- u = x5 + x4 | 0;
- x6 ^= u<<7 | u>>>(32-7);
- u = x6 + x5 | 0;
- x7 ^= u<<9 | u>>>(32-9);
- u = x7 + x6 | 0;
- x4 ^= u<<13 | u>>>(32-13);
- u = x4 + x7 | 0;
- x5 ^= u<<18 | u>>>(32-18);
-
- u = x10 + x9 | 0;
- x11 ^= u<<7 | u>>>(32-7);
- u = x11 + x10 | 0;
- x8 ^= u<<9 | u>>>(32-9);
- u = x8 + x11 | 0;
- x9 ^= u<<13 | u>>>(32-13);
- u = x9 + x8 | 0;
- x10 ^= u<<18 | u>>>(32-18);
-
- u = x15 + x14 | 0;
- x12 ^= u<<7 | u>>>(32-7);
- u = x12 + x15 | 0;
- x13 ^= u<<9 | u>>>(32-9);
- u = x13 + x12 | 0;
- x14 ^= u<<13 | u>>>(32-13);
- u = x14 + x13 | 0;
- x15 ^= u<<18 | u>>>(32-18);
- }
- x0 = x0 + j0 | 0;
- x1 = x1 + j1 | 0;
- x2 = x2 + j2 | 0;
- x3 = x3 + j3 | 0;
- x4 = x4 + j4 | 0;
- x5 = x5 + j5 | 0;
- x6 = x6 + j6 | 0;
- x7 = x7 + j7 | 0;
- x8 = x8 + j8 | 0;
- x9 = x9 + j9 | 0;
- x10 = x10 + j10 | 0;
- x11 = x11 + j11 | 0;
- x12 = x12 + j12 | 0;
- x13 = x13 + j13 | 0;
- x14 = x14 + j14 | 0;
- x15 = x15 + j15 | 0;
-
- o[ 0] = x0 >>> 0 & 0xff;
- o[ 1] = x0 >>> 8 & 0xff;
- o[ 2] = x0 >>> 16 & 0xff;
- o[ 3] = x0 >>> 24 & 0xff;
-
- o[ 4] = x1 >>> 0 & 0xff;
- o[ 5] = x1 >>> 8 & 0xff;
- o[ 6] = x1 >>> 16 & 0xff;
- o[ 7] = x1 >>> 24 & 0xff;
-
- o[ 8] = x2 >>> 0 & 0xff;
- o[ 9] = x2 >>> 8 & 0xff;
- o[10] = x2 >>> 16 & 0xff;
- o[11] = x2 >>> 24 & 0xff;
-
- o[12] = x3 >>> 0 & 0xff;
- o[13] = x3 >>> 8 & 0xff;
- o[14] = x3 >>> 16 & 0xff;
- o[15] = x3 >>> 24 & 0xff;
-
- o[16] = x4 >>> 0 & 0xff;
- o[17] = x4 >>> 8 & 0xff;
- o[18] = x4 >>> 16 & 0xff;
- o[19] = x4 >>> 24 & 0xff;
-
- o[20] = x5 >>> 0 & 0xff;
- o[21] = x5 >>> 8 & 0xff;
- o[22] = x5 >>> 16 & 0xff;
- o[23] = x5 >>> 24 & 0xff;
-
- o[24] = x6 >>> 0 & 0xff;
- o[25] = x6 >>> 8 & 0xff;
- o[26] = x6 >>> 16 & 0xff;
- o[27] = x6 >>> 24 & 0xff;
-
- o[28] = x7 >>> 0 & 0xff;
- o[29] = x7 >>> 8 & 0xff;
- o[30] = x7 >>> 16 & 0xff;
- o[31] = x7 >>> 24 & 0xff;
-
- o[32] = x8 >>> 0 & 0xff;
- o[33] = x8 >>> 8 & 0xff;
- o[34] = x8 >>> 16 & 0xff;
- o[35] = x8 >>> 24 & 0xff;
-
- o[36] = x9 >>> 0 & 0xff;
- o[37] = x9 >>> 8 & 0xff;
- o[38] = x9 >>> 16 & 0xff;
- o[39] = x9 >>> 24 & 0xff;
-
- o[40] = x10 >>> 0 & 0xff;
- o[41] = x10 >>> 8 & 0xff;
- o[42] = x10 >>> 16 & 0xff;
- o[43] = x10 >>> 24 & 0xff;
-
- o[44] = x11 >>> 0 & 0xff;
- o[45] = x11 >>> 8 & 0xff;
- o[46] = x11 >>> 16 & 0xff;
- o[47] = x11 >>> 24 & 0xff;
-
- o[48] = x12 >>> 0 & 0xff;
- o[49] = x12 >>> 8 & 0xff;
- o[50] = x12 >>> 16 & 0xff;
- o[51] = x12 >>> 24 & 0xff;
-
- o[52] = x13 >>> 0 & 0xff;
- o[53] = x13 >>> 8 & 0xff;
- o[54] = x13 >>> 16 & 0xff;
- o[55] = x13 >>> 24 & 0xff;
-
- o[56] = x14 >>> 0 & 0xff;
- o[57] = x14 >>> 8 & 0xff;
- o[58] = x14 >>> 16 & 0xff;
- o[59] = x14 >>> 24 & 0xff;
-
- o[60] = x15 >>> 0 & 0xff;
- o[61] = x15 >>> 8 & 0xff;
- o[62] = x15 >>> 16 & 0xff;
- o[63] = x15 >>> 24 & 0xff;
-}
-
-function core_hsalsa20(
- o: Uint8Array,
- p: Uint8Array,
- k: Uint8Array,
- c: Uint8Array,
-) {
- var j0 =
- (c[0] & 0xff) |
- ((c[1] & 0xff) << 8) |
- ((c[2] & 0xff) << 16) |
- ((c[3] & 0xff) << 24),
- j1 =
- (k[0] & 0xff) |
- ((k[1] & 0xff) << 8) |
- ((k[2] & 0xff) << 16) |
- ((k[3] & 0xff) << 24),
- j2 =
- (k[4] & 0xff) |
- ((k[5] & 0xff) << 8) |
- ((k[6] & 0xff) << 16) |
- ((k[7] & 0xff) << 24),
- j3 =
- (k[8] & 0xff) |
- ((k[9] & 0xff) << 8) |
- ((k[10] & 0xff) << 16) |
- ((k[11] & 0xff) << 24),
- j4 =
- (k[12] & 0xff) |
- ((k[13] & 0xff) << 8) |
- ((k[14] & 0xff) << 16) |
- ((k[15] & 0xff) << 24),
- j5 =
- (c[4] & 0xff) |
- ((c[5] & 0xff) << 8) |
- ((c[6] & 0xff) << 16) |
- ((c[7] & 0xff) << 24),
- j6 =
- (p[0] & 0xff) |
- ((p[1] & 0xff) << 8) |
- ((p[2] & 0xff) << 16) |
- ((p[3] & 0xff) << 24),
- j7 =
- (p[4] & 0xff) |
- ((p[5] & 0xff) << 8) |
- ((p[6] & 0xff) << 16) |
- ((p[7] & 0xff) << 24),
- j8 =
- (p[8] & 0xff) |
- ((p[9] & 0xff) << 8) |
- ((p[10] & 0xff) << 16) |
- ((p[11] & 0xff) << 24),
- j9 =
- (p[12] & 0xff) |
- ((p[13] & 0xff) << 8) |
- ((p[14] & 0xff) << 16) |
- ((p[15] & 0xff) << 24),
- j10 =
- (c[8] & 0xff) |
- ((c[9] & 0xff) << 8) |
- ((c[10] & 0xff) << 16) |
- ((c[11] & 0xff) << 24),
- j11 =
- (k[16] & 0xff) |
- ((k[17] & 0xff) << 8) |
- ((k[18] & 0xff) << 16) |
- ((k[19] & 0xff) << 24),
- j12 =
- (k[20] & 0xff) |
- ((k[21] & 0xff) << 8) |
- ((k[22] & 0xff) << 16) |
- ((k[23] & 0xff) << 24),
- j13 =
- (k[24] & 0xff) |
- ((k[25] & 0xff) << 8) |
- ((k[26] & 0xff) << 16) |
- ((k[27] & 0xff) << 24),
- j14 =
- (k[28] & 0xff) |
- ((k[29] & 0xff) << 8) |
- ((k[30] & 0xff) << 16) |
- ((k[31] & 0xff) << 24),
- j15 =
- (c[12] & 0xff) |
- ((c[13] & 0xff) << 8) |
- ((c[14] & 0xff) << 16) |
- ((c[15] & 0xff) << 24);
-
- var x0 = j0,
- x1 = j1,
- x2 = j2,
- x3 = j3,
- x4 = j4,
- x5 = j5,
- x6 = j6,
- x7 = j7,
- x8 = j8,
- x9 = j9,
- x10 = j10,
- x11 = j11,
- x12 = j12,
- x13 = j13,
- x14 = j14,
- x15 = j15,
- u;
-
- for (var i = 0; i < 20; i += 2) {
- u = (x0 + x12) | 0;
- x4 ^= (u << 7) | (u >>> (32 - 7));
- u = (x4 + x0) | 0;
- x8 ^= (u << 9) | (u >>> (32 - 9));
- u = (x8 + x4) | 0;
- x12 ^= (u << 13) | (u >>> (32 - 13));
- u = (x12 + x8) | 0;
- x0 ^= (u << 18) | (u >>> (32 - 18));
-
- u = (x5 + x1) | 0;
- x9 ^= (u << 7) | (u >>> (32 - 7));
- u = (x9 + x5) | 0;
- x13 ^= (u << 9) | (u >>> (32 - 9));
- u = (x13 + x9) | 0;
- x1 ^= (u << 13) | (u >>> (32 - 13));
- u = (x1 + x13) | 0;
- x5 ^= (u << 18) | (u >>> (32 - 18));
-
- u = (x10 + x6) | 0;
- x14 ^= (u << 7) | (u >>> (32 - 7));
- u = (x14 + x10) | 0;
- x2 ^= (u << 9) | (u >>> (32 - 9));
- u = (x2 + x14) | 0;
- x6 ^= (u << 13) | (u >>> (32 - 13));
- u = (x6 + x2) | 0;
- x10 ^= (u << 18) | (u >>> (32 - 18));
-
- u = (x15 + x11) | 0;
- x3 ^= (u << 7) | (u >>> (32 - 7));
- u = (x3 + x15) | 0;
- x7 ^= (u << 9) | (u >>> (32 - 9));
- u = (x7 + x3) | 0;
- x11 ^= (u << 13) | (u >>> (32 - 13));
- u = (x11 + x7) | 0;
- x15 ^= (u << 18) | (u >>> (32 - 18));
-
- u = (x0 + x3) | 0;
- x1 ^= (u << 7) | (u >>> (32 - 7));
- u = (x1 + x0) | 0;
- x2 ^= (u << 9) | (u >>> (32 - 9));
- u = (x2 + x1) | 0;
- x3 ^= (u << 13) | (u >>> (32 - 13));
- u = (x3 + x2) | 0;
- x0 ^= (u << 18) | (u >>> (32 - 18));
-
- u = (x5 + x4) | 0;
- x6 ^= (u << 7) | (u >>> (32 - 7));
- u = (x6 + x5) | 0;
- x7 ^= (u << 9) | (u >>> (32 - 9));
- u = (x7 + x6) | 0;
- x4 ^= (u << 13) | (u >>> (32 - 13));
- u = (x4 + x7) | 0;
- x5 ^= (u << 18) | (u >>> (32 - 18));
-
- u = (x10 + x9) | 0;
- x11 ^= (u << 7) | (u >>> (32 - 7));
- u = (x11 + x10) | 0;
- x8 ^= (u << 9) | (u >>> (32 - 9));
- u = (x8 + x11) | 0;
- x9 ^= (u << 13) | (u >>> (32 - 13));
- u = (x9 + x8) | 0;
- x10 ^= (u << 18) | (u >>> (32 - 18));
-
- u = (x15 + x14) | 0;
- x12 ^= (u << 7) | (u >>> (32 - 7));
- u = (x12 + x15) | 0;
- x13 ^= (u << 9) | (u >>> (32 - 9));
- u = (x13 + x12) | 0;
- x14 ^= (u << 13) | (u >>> (32 - 13));
- u = (x14 + x13) | 0;
- x15 ^= (u << 18) | (u >>> (32 - 18));
- }
-
- o[0] = (x0 >>> 0) & 0xff;
- o[1] = (x0 >>> 8) & 0xff;
- o[2] = (x0 >>> 16) & 0xff;
- o[3] = (x0 >>> 24) & 0xff;
-
- o[4] = (x5 >>> 0) & 0xff;
- o[5] = (x5 >>> 8) & 0xff;
- o[6] = (x5 >>> 16) & 0xff;
- o[7] = (x5 >>> 24) & 0xff;
-
- o[8] = (x10 >>> 0) & 0xff;
- o[9] = (x10 >>> 8) & 0xff;
- o[10] = (x10 >>> 16) & 0xff;
- o[11] = (x10 >>> 24) & 0xff;
-
- o[12] = (x15 >>> 0) & 0xff;
- o[13] = (x15 >>> 8) & 0xff;
- o[14] = (x15 >>> 16) & 0xff;
- o[15] = (x15 >>> 24) & 0xff;
-
- o[16] = (x6 >>> 0) & 0xff;
- o[17] = (x6 >>> 8) & 0xff;
- o[18] = (x6 >>> 16) & 0xff;
- o[19] = (x6 >>> 24) & 0xff;
-
- o[20] = (x7 >>> 0) & 0xff;
- o[21] = (x7 >>> 8) & 0xff;
- o[22] = (x7 >>> 16) & 0xff;
- o[23] = (x7 >>> 24) & 0xff;
-
- o[24] = (x8 >>> 0) & 0xff;
- o[25] = (x8 >>> 8) & 0xff;
- o[26] = (x8 >>> 16) & 0xff;
- o[27] = (x8 >>> 24) & 0xff;
-
- o[28] = (x9 >>> 0) & 0xff;
- o[29] = (x9 >>> 8) & 0xff;
- o[30] = (x9 >>> 16) & 0xff;
- o[31] = (x9 >>> 24) & 0xff;
-}
-
-function crypto_core_salsa20(
- out: Uint8Array,
- inp: Uint8Array,
- k: Uint8Array,
- c: Uint8Array,
-) {
- core_salsa20(out, inp, k, c);
-}
-
-function crypto_core_hsalsa20(
- out: Uint8Array,
- inp: Uint8Array,
- k: Uint8Array,
- c: Uint8Array,
-) {
- core_hsalsa20(out, inp, k, c);
-}
-
-var sigma = new Uint8Array([
- 101,
- 120,
- 112,
- 97,
- 110,
- 100,
- 32,
- 51,
- 50,
- 45,
- 98,
- 121,
- 116,
- 101,
- 32,
- 107,
-]);
-// "expand 32-byte k"
-
-function crypto_stream_salsa20_xor(
- c: Uint8Array,
- cpos: number,
- m: Uint8Array,
- mpos: number,
- b: number,
- n: Uint8Array,
- k: Uint8Array,
-) {
- var z = new Uint8Array(16),
- x = new Uint8Array(64);
- var u, i;
- for (i = 0; i < 16; i++) z[i] = 0;
- for (i = 0; i < 8; i++) z[i] = n[i];
- while (b >= 64) {
- crypto_core_salsa20(x, z, k, sigma);
- for (i = 0; i < 64; i++) c[cpos + i] = m[mpos + i] ^ x[i];
- u = 1;
- for (i = 8; i < 16; i++) {
- u = (u + (z[i] & 0xff)) | 0;
- z[i] = u & 0xff;
- u >>>= 8;
- }
- b -= 64;
- cpos += 64;
- mpos += 64;
- }
- if (b > 0) {
- crypto_core_salsa20(x, z, k, sigma);
- for (i = 0; i < b; i++) c[cpos + i] = m[mpos + i] ^ x[i];
- }
- return 0;
-}
-
-function crypto_stream_salsa20(
- c: Uint8Array,
- cpos: number,
- b: number,
- n: Uint8Array,
- k: Uint8Array,
-) {
- var z = new Uint8Array(16),
- x = new Uint8Array(64);
- var u, i;
- for (i = 0; i < 16; i++) z[i] = 0;
- for (i = 0; i < 8; i++) z[i] = n[i];
- while (b >= 64) {
- crypto_core_salsa20(x, z, k, sigma);
- for (i = 0; i < 64; i++) c[cpos + i] = x[i];
- u = 1;
- for (i = 8; i < 16; i++) {
- u = (u + (z[i] & 0xff)) | 0;
- z[i] = u & 0xff;
- u >>>= 8;
- }
- b -= 64;
- cpos += 64;
- }
- if (b > 0) {
- crypto_core_salsa20(x, z, k, sigma);
- for (i = 0; i < b; i++) c[cpos + i] = x[i];
- }
- return 0;
-}
-
-function crypto_stream(
- c: Uint8Array,
- cpos: number,
- d: number,
- n: Uint8Array,
- k: Uint8Array,
-) {
- var s = new Uint8Array(32);
- crypto_core_hsalsa20(s, n, k, sigma);
- var sn = new Uint8Array(8);
- for (var i = 0; i < 8; i++) sn[i] = n[i + 16];
- return crypto_stream_salsa20(c, cpos, d, sn, s);
-}
-
-function crypto_stream_xor(
- c: Uint8Array,
- cpos: number,
- m: Uint8Array,
- mpos: number,
- d: number,
- n: Uint8Array,
- k: Uint8Array,
-) {
- var s = new Uint8Array(32);
- crypto_core_hsalsa20(s, n, k, sigma);
- var sn = new Uint8Array(8);
- for (var i = 0; i < 8; i++) sn[i] = n[i + 16];
- return crypto_stream_salsa20_xor(c, cpos, m, mpos, d, sn, s);
-}
-
-/*
- * Port of Andrew Moon's Poly1305-donna-16. Public domain.
- * https://github.com/floodyberry/poly1305-donna
- */
-
-class poly1305 {
- buffer = new Uint8Array(16);
- r = new Uint16Array(10);
- h = new Uint16Array(10);
- pad = new Uint16Array(8);
- leftover = 0;
- fin = 0;
-
- constructor(key: Uint8Array) {
- var t0, t1, t2, t3, t4, t5, t6, t7;
-
- t0 = (key[0] & 0xff) | ((key[1] & 0xff) << 8);
- this.r[0] = t0 & 0x1fff;
- t1 = (key[2] & 0xff) | ((key[3] & 0xff) << 8);
- this.r[1] = ((t0 >>> 13) | (t1 << 3)) & 0x1fff;
- t2 = (key[4] & 0xff) | ((key[5] & 0xff) << 8);
- this.r[2] = ((t1 >>> 10) | (t2 << 6)) & 0x1f03;
- t3 = (key[6] & 0xff) | ((key[7] & 0xff) << 8);
- this.r[3] = ((t2 >>> 7) | (t3 << 9)) & 0x1fff;
- t4 = (key[8] & 0xff) | ((key[9] & 0xff) << 8);
- this.r[4] = ((t3 >>> 4) | (t4 << 12)) & 0x00ff;
- this.r[5] = (t4 >>> 1) & 0x1ffe;
- t5 = (key[10] & 0xff) | ((key[11] & 0xff) << 8);
- this.r[6] = ((t4 >>> 14) | (t5 << 2)) & 0x1fff;
- t6 = (key[12] & 0xff) | ((key[13] & 0xff) << 8);
- this.r[7] = ((t5 >>> 11) | (t6 << 5)) & 0x1f81;
- t7 = (key[14] & 0xff) | ((key[15] & 0xff) << 8);
- this.r[8] = ((t6 >>> 8) | (t7 << 8)) & 0x1fff;
- this.r[9] = (t7 >>> 5) & 0x007f;
-
- this.pad[0] = (key[16] & 0xff) | ((key[17] & 0xff) << 8);
- this.pad[1] = (key[18] & 0xff) | ((key[19] & 0xff) << 8);
- this.pad[2] = (key[20] & 0xff) | ((key[21] & 0xff) << 8);
- this.pad[3] = (key[22] & 0xff) | ((key[23] & 0xff) << 8);
- this.pad[4] = (key[24] & 0xff) | ((key[25] & 0xff) << 8);
- this.pad[5] = (key[26] & 0xff) | ((key[27] & 0xff) << 8);
- this.pad[6] = (key[28] & 0xff) | ((key[29] & 0xff) << 8);
- this.pad[7] = (key[30] & 0xff) | ((key[31] & 0xff) << 8);
- }
-
- blocks(m: Uint8Array, mpos: number, bytes: number) {
- var hibit = this.fin ? 0 : 1 << 11;
- var t0, t1, t2, t3, t4, t5, t6, t7, c;
- var d0, d1, d2, d3, d4, d5, d6, d7, d8, d9;
-
- var h0 = this.h[0],
- h1 = this.h[1],
- h2 = this.h[2],
- h3 = this.h[3],
- h4 = this.h[4],
- h5 = this.h[5],
- h6 = this.h[6],
- h7 = this.h[7],
- h8 = this.h[8],
- h9 = this.h[9];
-
- var r0 = this.r[0],
- r1 = this.r[1],
- r2 = this.r[2],
- r3 = this.r[3],
- r4 = this.r[4],
- r5 = this.r[5],
- r6 = this.r[6],
- r7 = this.r[7],
- r8 = this.r[8],
- r9 = this.r[9];
-
- while (bytes >= 16) {
- t0 = (m[mpos + 0] & 0xff) | ((m[mpos + 1] & 0xff) << 8);
- h0 += t0 & 0x1fff;
- t1 = (m[mpos + 2] & 0xff) | ((m[mpos + 3] & 0xff) << 8);
- h1 += ((t0 >>> 13) | (t1 << 3)) & 0x1fff;
- t2 = (m[mpos + 4] & 0xff) | ((m[mpos + 5] & 0xff) << 8);
- h2 += ((t1 >>> 10) | (t2 << 6)) & 0x1fff;
- t3 = (m[mpos + 6] & 0xff) | ((m[mpos + 7] & 0xff) << 8);
- h3 += ((t2 >>> 7) | (t3 << 9)) & 0x1fff;
- t4 = (m[mpos + 8] & 0xff) | ((m[mpos + 9] & 0xff) << 8);
- h4 += ((t3 >>> 4) | (t4 << 12)) & 0x1fff;
- h5 += (t4 >>> 1) & 0x1fff;
- t5 = (m[mpos + 10] & 0xff) | ((m[mpos + 11] & 0xff) << 8);
- h6 += ((t4 >>> 14) | (t5 << 2)) & 0x1fff;
- t6 = (m[mpos + 12] & 0xff) | ((m[mpos + 13] & 0xff) << 8);
- h7 += ((t5 >>> 11) | (t6 << 5)) & 0x1fff;
- t7 = (m[mpos + 14] & 0xff) | ((m[mpos + 15] & 0xff) << 8);
- h8 += ((t6 >>> 8) | (t7 << 8)) & 0x1fff;
- h9 += (t7 >>> 5) | hibit;
-
- c = 0;
-
- d0 = c;
- d0 += h0 * r0;
- d0 += h1 * (5 * r9);
- d0 += h2 * (5 * r8);
- d0 += h3 * (5 * r7);
- d0 += h4 * (5 * r6);
- c = d0 >>> 13;
- d0 &= 0x1fff;
- d0 += h5 * (5 * r5);
- d0 += h6 * (5 * r4);
- d0 += h7 * (5 * r3);
- d0 += h8 * (5 * r2);
- d0 += h9 * (5 * r1);
- c += d0 >>> 13;
- d0 &= 0x1fff;
-
- d1 = c;
- d1 += h0 * r1;
- d1 += h1 * r0;
- d1 += h2 * (5 * r9);
- d1 += h3 * (5 * r8);
- d1 += h4 * (5 * r7);
- c = d1 >>> 13;
- d1 &= 0x1fff;
- d1 += h5 * (5 * r6);
- d1 += h6 * (5 * r5);
- d1 += h7 * (5 * r4);
- d1 += h8 * (5 * r3);
- d1 += h9 * (5 * r2);
- c += d1 >>> 13;
- d1 &= 0x1fff;
-
- d2 = c;
- d2 += h0 * r2;
- d2 += h1 * r1;
- d2 += h2 * r0;
- d2 += h3 * (5 * r9);
- d2 += h4 * (5 * r8);
- c = d2 >>> 13;
- d2 &= 0x1fff;
- d2 += h5 * (5 * r7);
- d2 += h6 * (5 * r6);
- d2 += h7 * (5 * r5);
- d2 += h8 * (5 * r4);
- d2 += h9 * (5 * r3);
- c += d2 >>> 13;
- d2 &= 0x1fff;
-
- d3 = c;
- d3 += h0 * r3;
- d3 += h1 * r2;
- d3 += h2 * r1;
- d3 += h3 * r0;
- d3 += h4 * (5 * r9);
- c = d3 >>> 13;
- d3 &= 0x1fff;
- d3 += h5 * (5 * r8);
- d3 += h6 * (5 * r7);
- d3 += h7 * (5 * r6);
- d3 += h8 * (5 * r5);
- d3 += h9 * (5 * r4);
- c += d3 >>> 13;
- d3 &= 0x1fff;
-
- d4 = c;
- d4 += h0 * r4;
- d4 += h1 * r3;
- d4 += h2 * r2;
- d4 += h3 * r1;
- d4 += h4 * r0;
- c = d4 >>> 13;
- d4 &= 0x1fff;
- d4 += h5 * (5 * r9);
- d4 += h6 * (5 * r8);
- d4 += h7 * (5 * r7);
- d4 += h8 * (5 * r6);
- d4 += h9 * (5 * r5);
- c += d4 >>> 13;
- d4 &= 0x1fff;
-
- d5 = c;
- d5 += h0 * r5;
- d5 += h1 * r4;
- d5 += h2 * r3;
- d5 += h3 * r2;
- d5 += h4 * r1;
- c = d5 >>> 13;
- d5 &= 0x1fff;
- d5 += h5 * r0;
- d5 += h6 * (5 * r9);
- d5 += h7 * (5 * r8);
- d5 += h8 * (5 * r7);
- d5 += h9 * (5 * r6);
- c += d5 >>> 13;
- d5 &= 0x1fff;
-
- d6 = c;
- d6 += h0 * r6;
- d6 += h1 * r5;
- d6 += h2 * r4;
- d6 += h3 * r3;
- d6 += h4 * r2;
- c = d6 >>> 13;
- d6 &= 0x1fff;
- d6 += h5 * r1;
- d6 += h6 * r0;
- d6 += h7 * (5 * r9);
- d6 += h8 * (5 * r8);
- d6 += h9 * (5 * r7);
- c += d6 >>> 13;
- d6 &= 0x1fff;
-
- d7 = c;
- d7 += h0 * r7;
- d7 += h1 * r6;
- d7 += h2 * r5;
- d7 += h3 * r4;
- d7 += h4 * r3;
- c = d7 >>> 13;
- d7 &= 0x1fff;
- d7 += h5 * r2;
- d7 += h6 * r1;
- d7 += h7 * r0;
- d7 += h8 * (5 * r9);
- d7 += h9 * (5 * r8);
- c += d7 >>> 13;
- d7 &= 0x1fff;
-
- d8 = c;
- d8 += h0 * r8;
- d8 += h1 * r7;
- d8 += h2 * r6;
- d8 += h3 * r5;
- d8 += h4 * r4;
- c = d8 >>> 13;
- d8 &= 0x1fff;
- d8 += h5 * r3;
- d8 += h6 * r2;
- d8 += h7 * r1;
- d8 += h8 * r0;
- d8 += h9 * (5 * r9);
- c += d8 >>> 13;
- d8 &= 0x1fff;
-
- d9 = c;
- d9 += h0 * r9;
- d9 += h1 * r8;
- d9 += h2 * r7;
- d9 += h3 * r6;
- d9 += h4 * r5;
- c = d9 >>> 13;
- d9 &= 0x1fff;
- d9 += h5 * r4;
- d9 += h6 * r3;
- d9 += h7 * r2;
- d9 += h8 * r1;
- d9 += h9 * r0;
- c += d9 >>> 13;
- d9 &= 0x1fff;
-
- c = ((c << 2) + c) | 0;
- c = (c + d0) | 0;
- d0 = c & 0x1fff;
- c = c >>> 13;
- d1 += c;
-
- h0 = d0;
- h1 = d1;
- h2 = d2;
- h3 = d3;
- h4 = d4;
- h5 = d5;
- h6 = d6;
- h7 = d7;
- h8 = d8;
- h9 = d9;
-
- mpos += 16;
- bytes -= 16;
- }
- this.h[0] = h0;
- this.h[1] = h1;
- this.h[2] = h2;
- this.h[3] = h3;
- this.h[4] = h4;
- this.h[5] = h5;
- this.h[6] = h6;
- this.h[7] = h7;
- this.h[8] = h8;
- this.h[9] = h9;
- }
-
- finish(mac: Uint8Array, macpos: number) {
- var g = new Uint16Array(10);
- var c, mask, f, i;
-
- if (this.leftover) {
- i = this.leftover;
- this.buffer[i++] = 1;
- for (; i < 16; i++) this.buffer[i] = 0;
- this.fin = 1;
- this.blocks(this.buffer, 0, 16);
- }
-
- c = this.h[1] >>> 13;
- this.h[1] &= 0x1fff;
- for (i = 2; i < 10; i++) {
- this.h[i] += c;
- c = this.h[i] >>> 13;
- this.h[i] &= 0x1fff;
- }
- this.h[0] += c * 5;
- c = this.h[0] >>> 13;
- this.h[0] &= 0x1fff;
- this.h[1] += c;
- c = this.h[1] >>> 13;
- this.h[1] &= 0x1fff;
- this.h[2] += c;
-
- g[0] = this.h[0] + 5;
- c = g[0] >>> 13;
- g[0] &= 0x1fff;
- for (i = 1; i < 10; i++) {
- g[i] = this.h[i] + c;
- c = g[i] >>> 13;
- g[i] &= 0x1fff;
- }
- g[9] -= 1 << 13;
-
- mask = (c ^ 1) - 1;
- for (i = 0; i < 10; i++) g[i] &= mask;
- mask = ~mask;
- for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i];
-
- this.h[0] = (this.h[0] | (this.h[1] << 13)) & 0xffff;
- this.h[1] = ((this.h[1] >>> 3) | (this.h[2] << 10)) & 0xffff;
- this.h[2] = ((this.h[2] >>> 6) | (this.h[3] << 7)) & 0xffff;
- this.h[3] = ((this.h[3] >>> 9) | (this.h[4] << 4)) & 0xffff;
- this.h[4] =
- ((this.h[4] >>> 12) | (this.h[5] << 1) | (this.h[6] << 14)) & 0xffff;
- this.h[5] = ((this.h[6] >>> 2) | (this.h[7] << 11)) & 0xffff;
- this.h[6] = ((this.h[7] >>> 5) | (this.h[8] << 8)) & 0xffff;
- this.h[7] = ((this.h[8] >>> 8) | (this.h[9] << 5)) & 0xffff;
-
- f = this.h[0] + this.pad[0];
- this.h[0] = f & 0xffff;
- for (i = 1; i < 8; i++) {
- f = (((this.h[i] + this.pad[i]) | 0) + (f >>> 16)) | 0;
- this.h[i] = f & 0xffff;
- }
-
- mac[macpos + 0] = (this.h[0] >>> 0) & 0xff;
- mac[macpos + 1] = (this.h[0] >>> 8) & 0xff;
- mac[macpos + 2] = (this.h[1] >>> 0) & 0xff;
- mac[macpos + 3] = (this.h[1] >>> 8) & 0xff;
- mac[macpos + 4] = (this.h[2] >>> 0) & 0xff;
- mac[macpos + 5] = (this.h[2] >>> 8) & 0xff;
- mac[macpos + 6] = (this.h[3] >>> 0) & 0xff;
- mac[macpos + 7] = (this.h[3] >>> 8) & 0xff;
- mac[macpos + 8] = (this.h[4] >>> 0) & 0xff;
- mac[macpos + 9] = (this.h[4] >>> 8) & 0xff;
- mac[macpos + 10] = (this.h[5] >>> 0) & 0xff;
- mac[macpos + 11] = (this.h[5] >>> 8) & 0xff;
- mac[macpos + 12] = (this.h[6] >>> 0) & 0xff;
- mac[macpos + 13] = (this.h[6] >>> 8) & 0xff;
- mac[macpos + 14] = (this.h[7] >>> 0) & 0xff;
- mac[macpos + 15] = (this.h[7] >>> 8) & 0xff;
- }
-
- update(m: Uint8Array, mpos: number, bytes: number) {
- var i, want;
-
- if (this.leftover) {
- want = 16 - this.leftover;
- if (want > bytes) want = bytes;
- for (i = 0; i < want; i++) this.buffer[this.leftover + i] = m[mpos + i];
- bytes -= want;
- mpos += want;
- this.leftover += want;
- if (this.leftover < 16) return;
- this.blocks(this.buffer, 0, 16);
- this.leftover = 0;
- }
-
- if (bytes >= 16) {
- want = bytes - (bytes % 16);
- this.blocks(m, mpos, want);
- mpos += want;
- bytes -= want;
- }
-
- if (bytes) {
- for (i = 0; i < bytes; i++) this.buffer[this.leftover + i] = m[mpos + i];
- this.leftover += bytes;
- }
- }
-}
-
-function crypto_onetimeauth(
- out: Uint8Array,
- outpos: number,
- m: Uint8Array,
- mpos: number,
- n: number,
- k: Uint8Array,
-) {
- var s = new poly1305(k);
- s.update(m, mpos, n);
- s.finish(out, outpos);
- return 0;
-}
-
-function crypto_onetimeauth_verify(
- h: Uint8Array,
- hpos: number,
- m: Uint8Array,
- mpos: number,
- n: number,
- k: Uint8Array,
-) {
- var x = new Uint8Array(16);
- crypto_onetimeauth(x, 0, m, mpos, n, k);
- return crypto_verify_16(h, hpos, x, 0);
-}
-
-function crypto_secretbox(
- c: Uint8Array,
- m: Uint8Array,
- d: number,
- n: Uint8Array,
- k: Uint8Array,
-) {
- var i;
- if (d < 32) return -1;
- crypto_stream_xor(c, 0, m, 0, d, n, k);
- crypto_onetimeauth(c, 16, c, 32, d - 32, c);
- for (i = 0; i < 16; i++) c[i] = 0;
- return 0;
-}
-
-function crypto_secretbox_open(
- m: Uint8Array,
- c: Uint8Array,
- d: number,
- n: Uint8Array,
- k: Uint8Array,
-) {
- var i;
- var x = new Uint8Array(32);
- if (d < 32) return -1;
- crypto_stream(x, 0, 32, n, k);
- if (crypto_onetimeauth_verify(c, 16, c, 32, d - 32, x) !== 0) return -1;
- crypto_stream_xor(m, 0, c, 0, d, n, k);
- for (i = 0; i < 32; i++) m[i] = 0;
- return 0;
-}
-
-function set25519(r: Float64Array, a: Float64Array) {
- var i;
- for (i = 0; i < 16; i++) r[i] = a[i] | 0;
-}
-
-function car25519(o: Float64Array) {
- var i,
- v,
- c = 1;
- for (i = 0; i < 16; i++) {
- v = o[i] + c + 65535;
- c = Math.floor(v / 65536);
- o[i] = v - c * 65536;
- }
- o[0] += c - 1 + 37 * (c - 1);
-}
-
-function sel25519(p: Float64Array, q: Float64Array, b: number) {
- var t,
- c = ~(b - 1);
- for (var i = 0; i < 16; i++) {
- t = c & (p[i] ^ q[i]);
- p[i] ^= t;
- q[i] ^= t;
- }
-}
-
-function pack25519(o: Uint8Array, n: Float64Array) {
- var i, j, b;
- var m = gf(),
- t = gf();
- for (i = 0; i < 16; i++) t[i] = n[i];
- car25519(t);
- car25519(t);
- car25519(t);
- for (j = 0; j < 2; j++) {
- m[0] = t[0] - 0xffed;
- for (i = 1; i < 15; i++) {
- m[i] = t[i] - 0xffff - ((m[i - 1] >> 16) & 1);
- m[i - 1] &= 0xffff;
- }
- m[15] = t[15] - 0x7fff - ((m[14] >> 16) & 1);
- b = (m[15] >> 16) & 1;
- m[14] &= 0xffff;
- sel25519(t, m, 1 - b);
- }
- for (i = 0; i < 16; i++) {
- o[2 * i] = t[i] & 0xff;
- o[2 * i + 1] = t[i] >> 8;
- }
-}
-
-function neq25519(a: Float64Array, b: Float64Array) {
- var c = new Uint8Array(32),
- d = new Uint8Array(32);
- pack25519(c, a);
- pack25519(d, b);
- return crypto_verify_32(c, 0, d, 0);
-}
-
-function par25519(a: Float64Array) {
- var d = new Uint8Array(32);
- pack25519(d, a);
- return d[0] & 1;
-}
-
-function unpack25519(o: Float64Array, n: Uint8Array) {
- var i;
- for (i = 0; i < 16; i++) o[i] = n[2 * i] + (n[2 * i + 1] << 8);
- o[15] &= 0x7fff;
-}
-
-function A(o: Float64Array, a: Float64Array, b: Float64Array) {
- for (var i = 0; i < 16; i++) o[i] = a[i] + b[i];
-}
-
-function Z(o: Float64Array, a: Float64Array, b: Float64Array) {
- for (var i = 0; i < 16; i++) o[i] = a[i] - b[i];
-}
-
-function M(o: Float64Array, a: Float64Array, b: Float64Array) {
- var v,
- c,
- t0 = 0,
- t1 = 0,
- t2 = 0,
- t3 = 0,
- t4 = 0,
- t5 = 0,
- t6 = 0,
- t7 = 0,
- t8 = 0,
- t9 = 0,
- t10 = 0,
- t11 = 0,
- t12 = 0,
- t13 = 0,
- t14 = 0,
- t15 = 0,
- t16 = 0,
- t17 = 0,
- t18 = 0,
- t19 = 0,
- t20 = 0,
- t21 = 0,
- t22 = 0,
- t23 = 0,
- t24 = 0,
- t25 = 0,
- t26 = 0,
- t27 = 0,
- t28 = 0,
- t29 = 0,
- t30 = 0,
- b0 = b[0],
- b1 = b[1],
- b2 = b[2],
- b3 = b[3],
- b4 = b[4],
- b5 = b[5],
- b6 = b[6],
- b7 = b[7],
- b8 = b[8],
- b9 = b[9],
- b10 = b[10],
- b11 = b[11],
- b12 = b[12],
- b13 = b[13],
- b14 = b[14],
- b15 = b[15];
-
- v = a[0];
- t0 += v * b0;
- t1 += v * b1;
- t2 += v * b2;
- t3 += v * b3;
- t4 += v * b4;
- t5 += v * b5;
- t6 += v * b6;
- t7 += v * b7;
- t8 += v * b8;
- t9 += v * b9;
- t10 += v * b10;
- t11 += v * b11;
- t12 += v * b12;
- t13 += v * b13;
- t14 += v * b14;
- t15 += v * b15;
- v = a[1];
- t1 += v * b0;
- t2 += v * b1;
- t3 += v * b2;
- t4 += v * b3;
- t5 += v * b4;
- t6 += v * b5;
- t7 += v * b6;
- t8 += v * b7;
- t9 += v * b8;
- t10 += v * b9;
- t11 += v * b10;
- t12 += v * b11;
- t13 += v * b12;
- t14 += v * b13;
- t15 += v * b14;
- t16 += v * b15;
- v = a[2];
- t2 += v * b0;
- t3 += v * b1;
- t4 += v * b2;
- t5 += v * b3;
- t6 += v * b4;
- t7 += v * b5;
- t8 += v * b6;
- t9 += v * b7;
- t10 += v * b8;
- t11 += v * b9;
- t12 += v * b10;
- t13 += v * b11;
- t14 += v * b12;
- t15 += v * b13;
- t16 += v * b14;
- t17 += v * b15;
- v = a[3];
- t3 += v * b0;
- t4 += v * b1;
- t5 += v * b2;
- t6 += v * b3;
- t7 += v * b4;
- t8 += v * b5;
- t9 += v * b6;
- t10 += v * b7;
- t11 += v * b8;
- t12 += v * b9;
- t13 += v * b10;
- t14 += v * b11;
- t15 += v * b12;
- t16 += v * b13;
- t17 += v * b14;
- t18 += v * b15;
- v = a[4];
- t4 += v * b0;
- t5 += v * b1;
- t6 += v * b2;
- t7 += v * b3;
- t8 += v * b4;
- t9 += v * b5;
- t10 += v * b6;
- t11 += v * b7;
- t12 += v * b8;
- t13 += v * b9;
- t14 += v * b10;
- t15 += v * b11;
- t16 += v * b12;
- t17 += v * b13;
- t18 += v * b14;
- t19 += v * b15;
- v = a[5];
- t5 += v * b0;
- t6 += v * b1;
- t7 += v * b2;
- t8 += v * b3;
- t9 += v * b4;
- t10 += v * b5;
- t11 += v * b6;
- t12 += v * b7;
- t13 += v * b8;
- t14 += v * b9;
- t15 += v * b10;
- t16 += v * b11;
- t17 += v * b12;
- t18 += v * b13;
- t19 += v * b14;
- t20 += v * b15;
- v = a[6];
- t6 += v * b0;
- t7 += v * b1;
- t8 += v * b2;
- t9 += v * b3;
- t10 += v * b4;
- t11 += v * b5;
- t12 += v * b6;
- t13 += v * b7;
- t14 += v * b8;
- t15 += v * b9;
- t16 += v * b10;
- t17 += v * b11;
- t18 += v * b12;
- t19 += v * b13;
- t20 += v * b14;
- t21 += v * b15;
- v = a[7];
- t7 += v * b0;
- t8 += v * b1;
- t9 += v * b2;
- t10 += v * b3;
- t11 += v * b4;
- t12 += v * b5;
- t13 += v * b6;
- t14 += v * b7;
- t15 += v * b8;
- t16 += v * b9;
- t17 += v * b10;
- t18 += v * b11;
- t19 += v * b12;
- t20 += v * b13;
- t21 += v * b14;
- t22 += v * b15;
- v = a[8];
- t8 += v * b0;
- t9 += v * b1;
- t10 += v * b2;
- t11 += v * b3;
- t12 += v * b4;
- t13 += v * b5;
- t14 += v * b6;
- t15 += v * b7;
- t16 += v * b8;
- t17 += v * b9;
- t18 += v * b10;
- t19 += v * b11;
- t20 += v * b12;
- t21 += v * b13;
- t22 += v * b14;
- t23 += v * b15;
- v = a[9];
- t9 += v * b0;
- t10 += v * b1;
- t11 += v * b2;
- t12 += v * b3;
- t13 += v * b4;
- t14 += v * b5;
- t15 += v * b6;
- t16 += v * b7;
- t17 += v * b8;
- t18 += v * b9;
- t19 += v * b10;
- t20 += v * b11;
- t21 += v * b12;
- t22 += v * b13;
- t23 += v * b14;
- t24 += v * b15;
- v = a[10];
- t10 += v * b0;
- t11 += v * b1;
- t12 += v * b2;
- t13 += v * b3;
- t14 += v * b4;
- t15 += v * b5;
- t16 += v * b6;
- t17 += v * b7;
- t18 += v * b8;
- t19 += v * b9;
- t20 += v * b10;
- t21 += v * b11;
- t22 += v * b12;
- t23 += v * b13;
- t24 += v * b14;
- t25 += v * b15;
- v = a[11];
- t11 += v * b0;
- t12 += v * b1;
- t13 += v * b2;
- t14 += v * b3;
- t15 += v * b4;
- t16 += v * b5;
- t17 += v * b6;
- t18 += v * b7;
- t19 += v * b8;
- t20 += v * b9;
- t21 += v * b10;
- t22 += v * b11;
- t23 += v * b12;
- t24 += v * b13;
- t25 += v * b14;
- t26 += v * b15;
- v = a[12];
- t12 += v * b0;
- t13 += v * b1;
- t14 += v * b2;
- t15 += v * b3;
- t16 += v * b4;
- t17 += v * b5;
- t18 += v * b6;
- t19 += v * b7;
- t20 += v * b8;
- t21 += v * b9;
- t22 += v * b10;
- t23 += v * b11;
- t24 += v * b12;
- t25 += v * b13;
- t26 += v * b14;
- t27 += v * b15;
- v = a[13];
- t13 += v * b0;
- t14 += v * b1;
- t15 += v * b2;
- t16 += v * b3;
- t17 += v * b4;
- t18 += v * b5;
- t19 += v * b6;
- t20 += v * b7;
- t21 += v * b8;
- t22 += v * b9;
- t23 += v * b10;
- t24 += v * b11;
- t25 += v * b12;
- t26 += v * b13;
- t27 += v * b14;
- t28 += v * b15;
- v = a[14];
- t14 += v * b0;
- t15 += v * b1;
- t16 += v * b2;
- t17 += v * b3;
- t18 += v * b4;
- t19 += v * b5;
- t20 += v * b6;
- t21 += v * b7;
- t22 += v * b8;
- t23 += v * b9;
- t24 += v * b10;
- t25 += v * b11;
- t26 += v * b12;
- t27 += v * b13;
- t28 += v * b14;
- t29 += v * b15;
- v = a[15];
- t15 += v * b0;
- t16 += v * b1;
- t17 += v * b2;
- t18 += v * b3;
- t19 += v * b4;
- t20 += v * b5;
- t21 += v * b6;
- t22 += v * b7;
- t23 += v * b8;
- t24 += v * b9;
- t25 += v * b10;
- t26 += v * b11;
- t27 += v * b12;
- t28 += v * b13;
- t29 += v * b14;
- t30 += v * b15;
-
- t0 += 38 * t16;
- t1 += 38 * t17;
- t2 += 38 * t18;
- t3 += 38 * t19;
- t4 += 38 * t20;
- t5 += 38 * t21;
- t6 += 38 * t22;
- t7 += 38 * t23;
- t8 += 38 * t24;
- t9 += 38 * t25;
- t10 += 38 * t26;
- t11 += 38 * t27;
- t12 += 38 * t28;
- t13 += 38 * t29;
- t14 += 38 * t30;
- // t15 left as is
-
- // first car
- c = 1;
- v = t0 + c + 65535;
- c = Math.floor(v / 65536);
- t0 = v - c * 65536;
- v = t1 + c + 65535;
- c = Math.floor(v / 65536);
- t1 = v - c * 65536;
- v = t2 + c + 65535;
- c = Math.floor(v / 65536);
- t2 = v - c * 65536;
- v = t3 + c + 65535;
- c = Math.floor(v / 65536);
- t3 = v - c * 65536;
- v = t4 + c + 65535;
- c = Math.floor(v / 65536);
- t4 = v - c * 65536;
- v = t5 + c + 65535;
- c = Math.floor(v / 65536);
- t5 = v - c * 65536;
- v = t6 + c + 65535;
- c = Math.floor(v / 65536);
- t6 = v - c * 65536;
- v = t7 + c + 65535;
- c = Math.floor(v / 65536);
- t7 = v - c * 65536;
- v = t8 + c + 65535;
- c = Math.floor(v / 65536);
- t8 = v - c * 65536;
- v = t9 + c + 65535;
- c = Math.floor(v / 65536);
- t9 = v - c * 65536;
- v = t10 + c + 65535;
- c = Math.floor(v / 65536);
- t10 = v - c * 65536;
- v = t11 + c + 65535;
- c = Math.floor(v / 65536);
- t11 = v - c * 65536;
- v = t12 + c + 65535;
- c = Math.floor(v / 65536);
- t12 = v - c * 65536;
- v = t13 + c + 65535;
- c = Math.floor(v / 65536);
- t13 = v - c * 65536;
- v = t14 + c + 65535;
- c = Math.floor(v / 65536);
- t14 = v - c * 65536;
- v = t15 + c + 65535;
- c = Math.floor(v / 65536);
- t15 = v - c * 65536;
- t0 += c - 1 + 37 * (c - 1);
-
- // second car
- c = 1;
- v = t0 + c + 65535;
- c = Math.floor(v / 65536);
- t0 = v - c * 65536;
- v = t1 + c + 65535;
- c = Math.floor(v / 65536);
- t1 = v - c * 65536;
- v = t2 + c + 65535;
- c = Math.floor(v / 65536);
- t2 = v - c * 65536;
- v = t3 + c + 65535;
- c = Math.floor(v / 65536);
- t3 = v - c * 65536;
- v = t4 + c + 65535;
- c = Math.floor(v / 65536);
- t4 = v - c * 65536;
- v = t5 + c + 65535;
- c = Math.floor(v / 65536);
- t5 = v - c * 65536;
- v = t6 + c + 65535;
- c = Math.floor(v / 65536);
- t6 = v - c * 65536;
- v = t7 + c + 65535;
- c = Math.floor(v / 65536);
- t7 = v - c * 65536;
- v = t8 + c + 65535;
- c = Math.floor(v / 65536);
- t8 = v - c * 65536;
- v = t9 + c + 65535;
- c = Math.floor(v / 65536);
- t9 = v - c * 65536;
- v = t10 + c + 65535;
- c = Math.floor(v / 65536);
- t10 = v - c * 65536;
- v = t11 + c + 65535;
- c = Math.floor(v / 65536);
- t11 = v - c * 65536;
- v = t12 + c + 65535;
- c = Math.floor(v / 65536);
- t12 = v - c * 65536;
- v = t13 + c + 65535;
- c = Math.floor(v / 65536);
- t13 = v - c * 65536;
- v = t14 + c + 65535;
- c = Math.floor(v / 65536);
- t14 = v - c * 65536;
- v = t15 + c + 65535;
- c = Math.floor(v / 65536);
- t15 = v - c * 65536;
- t0 += c - 1 + 37 * (c - 1);
-
- o[0] = t0;
- o[1] = t1;
- o[2] = t2;
- o[3] = t3;
- o[4] = t4;
- o[5] = t5;
- o[6] = t6;
- o[7] = t7;
- o[8] = t8;
- o[9] = t9;
- o[10] = t10;
- o[11] = t11;
- o[12] = t12;
- o[13] = t13;
- o[14] = t14;
- o[15] = t15;
-}
-
-function S(o: Float64Array, a: Float64Array) {
- M(o, a, a);
-}
-
-function inv25519(o: Float64Array, i: Float64Array) {
- var c = gf();
- var a;
- for (a = 0; a < 16; a++) c[a] = i[a];
- for (a = 253; a >= 0; a--) {
- S(c, c);
- if (a !== 2 && a !== 4) M(c, c, i);
- }
- for (a = 0; a < 16; a++) o[a] = c[a];
-}
-
-function pow2523(o: Float64Array, i: Float64Array) {
- var c = gf();
- var a;
- for (a = 0; a < 16; a++) c[a] = i[a];
- for (a = 250; a >= 0; a--) {
- S(c, c);
- if (a !== 1) M(c, c, i);
- }
- for (a = 0; a < 16; a++) o[a] = c[a];
-}
-
-function crypto_scalarmult(q: Uint8Array, n: Uint8Array, p: Uint8Array) {
- var z = new Uint8Array(32);
- var x = new Float64Array(80),
- r,
- i;
- var a = gf(),
- b = gf(),
- c = gf(),
- d = gf(),
- e = gf(),
- f = gf();
- for (i = 0; i < 31; i++) z[i] = n[i];
- z[31] = (n[31] & 127) | 64;
- z[0] &= 248;
- unpack25519(x, p);
- for (i = 0; i < 16; i++) {
- b[i] = x[i];
- d[i] = a[i] = c[i] = 0;
- }
- a[0] = d[0] = 1;
- for (i = 254; i >= 0; --i) {
- r = (z[i >>> 3] >>> (i & 7)) & 1;
- sel25519(a, b, r);
- sel25519(c, d, r);
- A(e, a, c);
- Z(a, a, c);
- A(c, b, d);
- Z(b, b, d);
- S(d, e);
- S(f, a);
- M(a, c, a);
- M(c, b, e);
- A(e, a, c);
- Z(a, a, c);
- S(b, a);
- Z(c, d, f);
- M(a, c, _121665);
- A(a, a, d);
- M(c, c, a);
- M(a, d, f);
- M(d, b, x);
- S(b, e);
- sel25519(a, b, r);
- sel25519(c, d, r);
- }
- for (i = 0; i < 16; i++) {
- x[i + 16] = a[i];
- x[i + 32] = c[i];
- x[i + 48] = b[i];
- x[i + 64] = d[i];
- }
- var x32 = x.subarray(32);
- var x16 = x.subarray(16);
- inv25519(x32, x32);
- M(x16, x16, x32);
- pack25519(q, x16);
- return 0;
-}
-
-function crypto_scalarmult_base(q: Uint8Array, n: Uint8Array) {
- return crypto_scalarmult(q, n, _9);
-}
-
-function crypto_box_keypair(y: Uint8Array, x: Uint8Array) {
- randombytes(x, 32);
- return crypto_scalarmult_base(y, x);
-}
-
-function crypto_box_beforenm(k: Uint8Array, y: Uint8Array, x: Uint8Array) {
- var s = new Uint8Array(32);
- crypto_scalarmult(s, x, y);
- return crypto_core_hsalsa20(k, _0, s, sigma);
-}
-
-var crypto_box_afternm = crypto_secretbox;
-var crypto_box_open_afternm = crypto_secretbox_open;
-
-function crypto_box(
- c: Uint8Array,
- m: Uint8Array,
- d: number,
- n: Uint8Array,
- y: Uint8Array,
- x: Uint8Array,
-) {
- var k = new Uint8Array(32);
- crypto_box_beforenm(k, y, x);
- return crypto_box_afternm(c, m, d, n, k);
-}
-
-function crypto_box_open(
- m: Uint8Array,
- c: Uint8Array,
- d: number,
- n: Uint8Array,
- y: Uint8Array,
- x: Uint8Array,
-) {
- var k = new Uint8Array(32);
- crypto_box_beforenm(k, y, x);
- return crypto_box_open_afternm(m, c, d, n, k);
-}
-
-// prettier-ignore
-var K = [
- 0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd,
- 0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc,
- 0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019,
- 0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118,
- 0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe,
- 0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2,
- 0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1,
- 0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694,
- 0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3,
- 0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65,
- 0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483,
- 0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5,
- 0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210,
- 0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4,
- 0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725,
- 0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70,
- 0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926,
- 0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df,
- 0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8,
- 0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b,
- 0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001,
- 0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30,
- 0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910,
- 0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8,
- 0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53,
- 0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8,
- 0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb,
- 0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3,
- 0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60,
- 0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec,
- 0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9,
- 0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b,
- 0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207,
- 0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178,
- 0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6,
- 0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b,
- 0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493,
- 0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c,
- 0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a,
- 0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817
-];
-
-function crypto_hashblocks_hl(
- hh: Int32Array,
- hl: Int32Array,
- m: Uint8Array,
- n: number,
-) {
- var wh = new Int32Array(16),
- wl = new Int32Array(16),
- bh0,
- bh1,
- bh2,
- bh3,
- bh4,
- bh5,
- bh6,
- bh7,
- bl0,
- bl1,
- bl2,
- bl3,
- bl4,
- bl5,
- bl6,
- bl7,
- th,
- tl,
- i,
- j,
- h,
- l,
- a,
- b,
- c,
- d;
-
- var ah0 = hh[0],
- ah1 = hh[1],
- ah2 = hh[2],
- ah3 = hh[3],
- ah4 = hh[4],
- ah5 = hh[5],
- ah6 = hh[6],
- ah7 = hh[7],
- al0 = hl[0],
- al1 = hl[1],
- al2 = hl[2],
- al3 = hl[3],
- al4 = hl[4],
- al5 = hl[5],
- al6 = hl[6],
- al7 = hl[7];
-
- var pos = 0;
- while (n >= 128) {
- for (i = 0; i < 16; i++) {
- j = 8 * i + pos;
- wh[i] = (m[j + 0] << 24) | (m[j + 1] << 16) | (m[j + 2] << 8) | m[j + 3];
- wl[i] = (m[j + 4] << 24) | (m[j + 5] << 16) | (m[j + 6] << 8) | m[j + 7];
- }
- for (i = 0; i < 80; i++) {
- bh0 = ah0;
- bh1 = ah1;
- bh2 = ah2;
- bh3 = ah3;
- bh4 = ah4;
- bh5 = ah5;
- bh6 = ah6;
- bh7 = ah7;
-
- bl0 = al0;
- bl1 = al1;
- bl2 = al2;
- bl3 = al3;
- bl4 = al4;
- bl5 = al5;
- bl6 = al6;
- bl7 = al7;
-
- // add
- h = ah7;
- l = al7;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- // Sigma1
- h =
- ((ah4 >>> 14) | (al4 << (32 - 14))) ^
- ((ah4 >>> 18) | (al4 << (32 - 18))) ^
- ((al4 >>> (41 - 32)) | (ah4 << (32 - (41 - 32))));
- l =
- ((al4 >>> 14) | (ah4 << (32 - 14))) ^
- ((al4 >>> 18) | (ah4 << (32 - 18))) ^
- ((ah4 >>> (41 - 32)) | (al4 << (32 - (41 - 32))));
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- // Ch
- h = (ah4 & ah5) ^ (~ah4 & ah6);
- l = (al4 & al5) ^ (~al4 & al6);
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- // K
- h = K[i * 2];
- l = K[i * 2 + 1];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- // w
- h = wh[i % 16];
- l = wl[i % 16];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- th = (c & 0xffff) | (d << 16);
- tl = (a & 0xffff) | (b << 16);
-
- // add
- h = th;
- l = tl;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- // Sigma0
- h =
- ((ah0 >>> 28) | (al0 << (32 - 28))) ^
- ((al0 >>> (34 - 32)) | (ah0 << (32 - (34 - 32)))) ^
- ((al0 >>> (39 - 32)) | (ah0 << (32 - (39 - 32))));
- l =
- ((al0 >>> 28) | (ah0 << (32 - 28))) ^
- ((ah0 >>> (34 - 32)) | (al0 << (32 - (34 - 32)))) ^
- ((ah0 >>> (39 - 32)) | (al0 << (32 - (39 - 32))));
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- // Maj
- h = (ah0 & ah1) ^ (ah0 & ah2) ^ (ah1 & ah2);
- l = (al0 & al1) ^ (al0 & al2) ^ (al1 & al2);
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- bh7 = (c & 0xffff) | (d << 16);
- bl7 = (a & 0xffff) | (b << 16);
-
- // add
- h = bh3;
- l = bl3;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- h = th;
- l = tl;
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- bh3 = (c & 0xffff) | (d << 16);
- bl3 = (a & 0xffff) | (b << 16);
-
- ah1 = bh0;
- ah2 = bh1;
- ah3 = bh2;
- ah4 = bh3;
- ah5 = bh4;
- ah6 = bh5;
- ah7 = bh6;
- ah0 = bh7;
-
- al1 = bl0;
- al2 = bl1;
- al3 = bl2;
- al4 = bl3;
- al5 = bl4;
- al6 = bl5;
- al7 = bl6;
- al0 = bl7;
-
- if (i % 16 === 15) {
- for (j = 0; j < 16; j++) {
- // add
- h = wh[j];
- l = wl[j];
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- h = wh[(j + 9) % 16];
- l = wl[(j + 9) % 16];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- // sigma0
- th = wh[(j + 1) % 16];
- tl = wl[(j + 1) % 16];
- h =
- ((th >>> 1) | (tl << (32 - 1))) ^
- ((th >>> 8) | (tl << (32 - 8))) ^
- (th >>> 7);
- l =
- ((tl >>> 1) | (th << (32 - 1))) ^
- ((tl >>> 8) | (th << (32 - 8))) ^
- ((tl >>> 7) | (th << (32 - 7)));
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- // sigma1
- th = wh[(j + 14) % 16];
- tl = wl[(j + 14) % 16];
- h =
- ((th >>> 19) | (tl << (32 - 19))) ^
- ((tl >>> (61 - 32)) | (th << (32 - (61 - 32)))) ^
- (th >>> 6);
- l =
- ((tl >>> 19) | (th << (32 - 19))) ^
- ((th >>> (61 - 32)) | (tl << (32 - (61 - 32)))) ^
- ((tl >>> 6) | (th << (32 - 6)));
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- wh[j] = (c & 0xffff) | (d << 16);
- wl[j] = (a & 0xffff) | (b << 16);
- }
- }
- }
-
- // add
- h = ah0;
- l = al0;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- h = hh[0];
- l = hl[0];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- hh[0] = ah0 = (c & 0xffff) | (d << 16);
- hl[0] = al0 = (a & 0xffff) | (b << 16);
-
- h = ah1;
- l = al1;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- h = hh[1];
- l = hl[1];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- hh[1] = ah1 = (c & 0xffff) | (d << 16);
- hl[1] = al1 = (a & 0xffff) | (b << 16);
-
- h = ah2;
- l = al2;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- h = hh[2];
- l = hl[2];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- hh[2] = ah2 = (c & 0xffff) | (d << 16);
- hl[2] = al2 = (a & 0xffff) | (b << 16);
-
- h = ah3;
- l = al3;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- h = hh[3];
- l = hl[3];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- hh[3] = ah3 = (c & 0xffff) | (d << 16);
- hl[3] = al3 = (a & 0xffff) | (b << 16);
-
- h = ah4;
- l = al4;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- h = hh[4];
- l = hl[4];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- hh[4] = ah4 = (c & 0xffff) | (d << 16);
- hl[4] = al4 = (a & 0xffff) | (b << 16);
-
- h = ah5;
- l = al5;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- h = hh[5];
- l = hl[5];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- hh[5] = ah5 = (c & 0xffff) | (d << 16);
- hl[5] = al5 = (a & 0xffff) | (b << 16);
-
- h = ah6;
- l = al6;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- h = hh[6];
- l = hl[6];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- hh[6] = ah6 = (c & 0xffff) | (d << 16);
- hl[6] = al6 = (a & 0xffff) | (b << 16);
-
- h = ah7;
- l = al7;
-
- a = l & 0xffff;
- b = l >>> 16;
- c = h & 0xffff;
- d = h >>> 16;
-
- h = hh[7];
- l = hl[7];
-
- a += l & 0xffff;
- b += l >>> 16;
- c += h & 0xffff;
- d += h >>> 16;
-
- b += a >>> 16;
- c += b >>> 16;
- d += c >>> 16;
-
- hh[7] = ah7 = (c & 0xffff) | (d << 16);
- hl[7] = al7 = (a & 0xffff) | (b << 16);
-
- pos += 128;
- n -= 128;
- }
-
- return n;
-}
-
-function crypto_hash(out: Uint8Array, m: Uint8Array, n: number) {
- const hh = new Int32Array(8);
- const hl = new Int32Array(8);
- const x = new Uint8Array(256);
- let i;
- let b = n;
-
- hh[0] = 0x6a09e667;
- hh[1] = 0xbb67ae85;
- hh[2] = 0x3c6ef372;
- hh[3] = 0xa54ff53a;
- hh[4] = 0x510e527f;
- hh[5] = 0x9b05688c;
- hh[6] = 0x1f83d9ab;
- hh[7] = 0x5be0cd19;
-
- hl[0] = 0xf3bcc908;
- hl[1] = 0x84caa73b;
- hl[2] = 0xfe94f82b;
- hl[3] = 0x5f1d36f1;
- hl[4] = 0xade682d1;
- hl[5] = 0x2b3e6c1f;
- hl[6] = 0xfb41bd6b;
- hl[7] = 0x137e2179;
-
- crypto_hashblocks_hl(hh, hl, m, n);
- n %= 128;
-
- for (i = 0; i < n; i++) x[i] = m[b - n + i];
- x[n] = 128;
-
- n = 256 - 128 * (n < 112 ? 1 : 0);
- x[n - 9] = 0;
- ts64(x, n - 8, (b / 0x20000000) | 0, b << 3);
- crypto_hashblocks_hl(hh, hl, x, n);
-
- for (i = 0; i < 8; i++) ts64(out, 8 * i, hh[i], hl[i]);
-
- return 0;
-}
-
-function add(p: Float64Array[], q: Float64Array[]) {
- var a = gf(),
- b = gf(),
- c = gf(),
- d = gf(),
- e = gf(),
- f = gf(),
- g = gf(),
- h = gf(),
- t = gf();
-
- Z(a, p[1], p[0]);
- Z(t, q[1], q[0]);
- M(a, a, t);
- A(b, p[0], p[1]);
- A(t, q[0], q[1]);
- M(b, b, t);
- M(c, p[3], q[3]);
- M(c, c, D2);
- M(d, p[2], q[2]);
- A(d, d, d);
- Z(e, b, a);
- Z(f, d, c);
- A(g, d, c);
- A(h, b, a);
-
- M(p[0], e, f);
- M(p[1], h, g);
- M(p[2], g, f);
- M(p[3], e, h);
-}
-
-function cswap(p: Float64Array[], q: Float64Array[], b: number) {
- var i;
- for (i = 0; i < 4; i++) {
- sel25519(p[i], q[i], b);
- }
-}
-
-function pack(r: Uint8Array, p: Float64Array[]) {
- var tx = gf(),
- ty = gf(),
- zi = gf();
- inv25519(zi, p[2]);
- M(tx, p[0], zi);
- M(ty, p[1], zi);
- pack25519(r, ty);
- r[31] ^= par25519(tx) << 7;
-}
-
-function scalarmult(p: Float64Array[], q: Float64Array[], s: Uint8Array) {
- var b, i;
- set25519(p[0], gf0);
- set25519(p[1], gf1);
- set25519(p[2], gf1);
- set25519(p[3], gf0);
- for (i = 255; i >= 0; --i) {
- b = (s[(i / 8) | 0] >> (i & 7)) & 1;
- cswap(p, q, b);
- add(q, p);
- add(p, p);
- cswap(p, q, b);
- }
-}
-
-function scalarbase(p: Float64Array[], s: Uint8Array) {
- const q = [gf(), gf(), gf(), gf()];
- set25519(q[0], X);
- set25519(q[1], Y);
- set25519(q[2], gf1);
- M(q[3], X, Y);
- scalarmult(p, q, s);
-}
-
-function crypto_sign_keypair(
- pk: Uint8Array,
- sk: Uint8Array,
- seeded: boolean,
-): number {
- const d = new Uint8Array(64);
- const p = [gf(), gf(), gf(), gf()];
-
- if (!seeded) randombytes(sk, 32);
- crypto_hash(d, sk, 32);
- d[0] &= 248;
- d[31] &= 127;
- d[31] |= 64;
-
- scalarbase(p, d);
- pack(pk, p);
-
- for (let i = 0; i < 32; i++) sk[i + 32] = pk[i];
- return 0;
-}
-
-var L = new Float64Array([
- 0xed,
- 0xd3,
- 0xf5,
- 0x5c,
- 0x1a,
- 0x63,
- 0x12,
- 0x58,
- 0xd6,
- 0x9c,
- 0xf7,
- 0xa2,
- 0xde,
- 0xf9,
- 0xde,
- 0x14,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0,
- 0x10,
-]);
-
-function modL(r: Uint8Array, x: Float64Array) {
- var carry, i, j, k;
- for (i = 63; i >= 32; --i) {
- carry = 0;
- for (j = i - 32, k = i - 12; j < k; ++j) {
- x[j] += carry - 16 * x[i] * L[j - (i - 32)];
- carry = (x[j] + 128) >> 8;
- x[j] -= carry * 256;
- }
- x[j] += carry;
- x[i] = 0;
- }
- carry = 0;
- for (j = 0; j < 32; j++) {
- x[j] += carry - (x[31] >> 4) * L[j];
- carry = x[j] >> 8;
- x[j] &= 255;
- }
- for (j = 0; j < 32; j++) x[j] -= carry * L[j];
- for (i = 0; i < 32; i++) {
- x[i + 1] += x[i] >> 8;
- r[i] = x[i] & 255;
- }
-}
-
-function reduce(r: Uint8Array) {
- const x = new Float64Array(64);
- for (let i = 0; i < 64; i++) x[i] = r[i];
- for (let i = 0; i < 64; i++) r[i] = 0;
- modL(r, x);
-}
-
-// Note: difference from C - smlen returned, not passed as argument.
-function crypto_sign(sm: Uint8Array, m: Uint8Array, n: number, sk: Uint8Array) {
- var d = new Uint8Array(64),
- h = new Uint8Array(64),
- r = new Uint8Array(64);
- var i,
- j,
- x = new Float64Array(64);
- var p = [gf(), gf(), gf(), gf()];
-
- crypto_hash(d, sk, 32);
- d[0] &= 248;
- d[31] &= 127;
- d[31] |= 64;
-
- var smlen = n + 64;
- for (i = 0; i < n; i++) sm[64 + i] = m[i];
- for (i = 0; i < 32; i++) sm[32 + i] = d[32 + i];
-
- crypto_hash(r, sm.subarray(32), n + 32);
- reduce(r);
- scalarbase(p, r);
- pack(sm, p);
-
- for (i = 32; i < 64; i++) sm[i] = sk[i];
- crypto_hash(h, sm, n + 64);
- reduce(h);
-
- for (i = 0; i < 64; i++) x[i] = 0;
- for (i = 0; i < 32; i++) x[i] = r[i];
- for (i = 0; i < 32; i++) {
- for (j = 0; j < 32; j++) {
- x[i + j] += h[i] * d[j];
- }
- }
-
- modL(sm.subarray(32), x);
- return smlen;
-}
-
-function unpackneg(r: Float64Array[], p: Uint8Array) {
- const t = gf();
- const chk = gf();
- const num = gf();
- const den = gf();
- const den2 = gf();
- const den4 = gf();
- const den6 = gf();
-
- set25519(r[2], gf1);
- unpack25519(r[1], p);
- S(num, r[1]);
- M(den, num, D);
- Z(num, num, r[2]);
- A(den, r[2], den);
-
- S(den2, den);
- S(den4, den2);
- M(den6, den4, den2);
- M(t, den6, num);
- M(t, t, den);
-
- pow2523(t, t);
- M(t, t, num);
- M(t, t, den);
- M(t, t, den);
- M(r[0], t, den);
-
- S(chk, r[0]);
- M(chk, chk, den);
- if (neq25519(chk, num)) M(r[0], r[0], I);
-
- S(chk, r[0]);
- M(chk, chk, den);
- if (neq25519(chk, num)) return -1;
-
- if (par25519(r[0]) === p[31] >> 7) Z(r[0], gf0, r[0]);
-
- M(r[3], r[0], r[1]);
- return 0;
-}
-
-function crypto_sign_open(
- m: Uint8Array,
- sm: Uint8Array,
- n: number,
- pk: Uint8Array,
-) {
- var i, mlen;
- var t = new Uint8Array(32),
- h = new Uint8Array(64);
- var p = [gf(), gf(), gf(), gf()],
- q = [gf(), gf(), gf(), gf()];
-
- mlen = -1;
- if (n < 64) return -1;
-
- if (unpackneg(q, pk)) return -1;
-
- for (i = 0; i < n; i++) m[i] = sm[i];
- for (i = 0; i < 32; i++) m[i + 32] = pk[i];
- crypto_hash(h, m, n);
- reduce(h);
- scalarmult(p, q, h);
-
- scalarbase(q, sm.subarray(32));
- add(p, q);
- pack(t, p);
-
- n -= 64;
- if (crypto_verify_32(sm, 0, t, 0)) {
- for (i = 0; i < n; i++) m[i] = 0;
- return -1;
- }
-
- for (i = 0; i < n; i++) m[i] = sm[i + 64];
- mlen = n;
- return mlen;
-}
-
-var crypto_secretbox_KEYBYTES = 32,
- crypto_secretbox_NONCEBYTES = 24,
- crypto_secretbox_ZEROBYTES = 32,
- crypto_secretbox_BOXZEROBYTES = 16,
- crypto_scalarmult_BYTES = 32,
- crypto_scalarmult_SCALARBYTES = 32,
- crypto_box_PUBLICKEYBYTES = 32,
- crypto_box_SECRETKEYBYTES = 32,
- crypto_box_BEFORENMBYTES = 32,
- crypto_box_NONCEBYTES = crypto_secretbox_NONCEBYTES,
- crypto_box_ZEROBYTES = crypto_secretbox_ZEROBYTES,
- crypto_box_BOXZEROBYTES = crypto_secretbox_BOXZEROBYTES,
- crypto_sign_BYTES = 64,
- crypto_sign_PUBLICKEYBYTES = 32,
- crypto_sign_SECRETKEYBYTES = 64,
- crypto_sign_SEEDBYTES = 32,
- crypto_hash_BYTES = 64;
-
-const lowlevel = {
- crypto_core_hsalsa20: crypto_core_hsalsa20,
- crypto_stream_xor: crypto_stream_xor,
- crypto_stream: crypto_stream,
- crypto_stream_salsa20_xor: crypto_stream_salsa20_xor,
- crypto_stream_salsa20: crypto_stream_salsa20,
- crypto_onetimeauth: crypto_onetimeauth,
- crypto_onetimeauth_verify: crypto_onetimeauth_verify,
- crypto_verify_16: crypto_verify_16,
- crypto_verify_32: crypto_verify_32,
- crypto_secretbox: crypto_secretbox,
- crypto_secretbox_open: crypto_secretbox_open,
- crypto_scalarmult: crypto_scalarmult,
- crypto_scalarmult_base: crypto_scalarmult_base,
- crypto_box_beforenm: crypto_box_beforenm,
- crypto_box_afternm: crypto_box_afternm,
- crypto_box: crypto_box,
- crypto_box_open: crypto_box_open,
- crypto_box_keypair: crypto_box_keypair,
- crypto_hash: crypto_hash,
- crypto_sign: crypto_sign,
- crypto_sign_keypair: crypto_sign_keypair,
- crypto_sign_open: crypto_sign_open,
-
- crypto_secretbox_KEYBYTES: crypto_secretbox_KEYBYTES,
- crypto_secretbox_NONCEBYTES: crypto_secretbox_NONCEBYTES,
- crypto_secretbox_ZEROBYTES: crypto_secretbox_ZEROBYTES,
- crypto_secretbox_BOXZEROBYTES: crypto_secretbox_BOXZEROBYTES,
- crypto_scalarmult_BYTES: crypto_scalarmult_BYTES,
- crypto_scalarmult_SCALARBYTES: crypto_scalarmult_SCALARBYTES,
- crypto_box_PUBLICKEYBYTES: crypto_box_PUBLICKEYBYTES,
- crypto_box_SECRETKEYBYTES: crypto_box_SECRETKEYBYTES,
- crypto_box_BEFORENMBYTES: crypto_box_BEFORENMBYTES,
- crypto_box_NONCEBYTES: crypto_box_NONCEBYTES,
- crypto_box_ZEROBYTES: crypto_box_ZEROBYTES,
- crypto_box_BOXZEROBYTES: crypto_box_BOXZEROBYTES,
- crypto_sign_BYTES: crypto_sign_BYTES,
- crypto_sign_PUBLICKEYBYTES: crypto_sign_PUBLICKEYBYTES,
- crypto_sign_SECRETKEYBYTES: crypto_sign_SECRETKEYBYTES,
- crypto_sign_SEEDBYTES: crypto_sign_SEEDBYTES,
- crypto_hash_BYTES: crypto_hash_BYTES,
-};
-
-/* High-level API */
-
-function checkLengths(k: Uint8Array, n: Uint8Array) {
- if (k.length !== crypto_secretbox_KEYBYTES) throw new Error("bad key size");
- if (n.length !== crypto_secretbox_NONCEBYTES)
- throw new Error("bad nonce size");
-}
-
-function checkBoxLengths(pk: Uint8Array, sk: Uint8Array) {
- if (pk.length !== crypto_box_PUBLICKEYBYTES)
- throw new Error("bad public key size");
- if (sk.length !== crypto_box_SECRETKEYBYTES)
- throw new Error("bad secret key size");
-}
-
-function checkArrayTypes(...args: Uint8Array[]) {
- for (var i = 0; i < args.length; i++) {
- if (!(args[i] instanceof Uint8Array))
- throw new TypeError("unexpected type, use Uint8Array");
- }
-}
-
-function cleanup(arr: Uint8Array) {
- for (var i = 0; i < arr.length; i++) arr[i] = 0;
-}
-
-export function randomBytes(n: number) {
- var b = new Uint8Array(n);
- randombytes(b, n);
- return b;
-}
-
-export function secretbox(msg: Uint8Array, nonce: Uint8Array, key: Uint8Array) {
- checkArrayTypes(msg, nonce, key);
- checkLengths(key, nonce);
- var m = new Uint8Array(crypto_secretbox_ZEROBYTES + msg.length);
- var c = new Uint8Array(m.length);
- for (var i = 0; i < msg.length; i++)
- m[i + crypto_secretbox_ZEROBYTES] = msg[i];
- crypto_secretbox(c, m, m.length, nonce, key);
- return c.subarray(crypto_secretbox_BOXZEROBYTES);
-}
-
-export function secretbox_open(
- box: Uint8Array,
- nonce: Uint8Array,
- key: Uint8Array,
-) {
- checkArrayTypes(box, nonce, key);
- checkLengths(key, nonce);
- var c = new Uint8Array(crypto_secretbox_BOXZEROBYTES + box.length);
- var m = new Uint8Array(c.length);
- for (var i = 0; i < box.length; i++)
- c[i + crypto_secretbox_BOXZEROBYTES] = box[i];
- if (c.length < 32) return null;
- if (crypto_secretbox_open(m, c, c.length, nonce, key) !== 0) return null;
- return m.subarray(crypto_secretbox_ZEROBYTES);
-}
-
-export const secretbox_keyLength = crypto_secretbox_KEYBYTES;
-export const secretbox_nonceLength = crypto_secretbox_NONCEBYTES;
-export const secretbox_overheadLength = crypto_secretbox_BOXZEROBYTES;
-
-export function scalarMult(n: Uint8Array, p: Uint8Array) {
- checkArrayTypes(n, p);
- if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error("bad n size");
- if (p.length !== crypto_scalarmult_BYTES) throw new Error("bad p size");
- var q = new Uint8Array(crypto_scalarmult_BYTES);
- crypto_scalarmult(q, n, p);
- return q;
-}
-
-export function scalarMult_base(n: Uint8Array) {
- checkArrayTypes(n);
- if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error("bad n size");
- var q = new Uint8Array(crypto_scalarmult_BYTES);
- crypto_scalarmult_base(q, n);
- return q;
-}
-
-export const scalarMult_scalarLength = crypto_scalarmult_SCALARBYTES;
-export const scalarMult_groupElementLength = crypto_scalarmult_BYTES;
-
-export function box(
- msg: Uint8Array,
- nonce: Uint8Array,
- publicKey: Uint8Array,
- secretKey: Uint8Array,
-) {
- var k = box_before(publicKey, secretKey);
- return secretbox(msg, nonce, k);
-}
-
-export function box_before(publicKey: Uint8Array, secretKey: Uint8Array) {
- checkArrayTypes(publicKey, secretKey);
- checkBoxLengths(publicKey, secretKey);
- var k = new Uint8Array(crypto_box_BEFORENMBYTES);
- crypto_box_beforenm(k, publicKey, secretKey);
- return k;
-}
-
-export const box_after = secretbox;
-
-export function box_open(
- msg: Uint8Array,
- nonce: Uint8Array,
- publicKey: Uint8Array,
- secretKey: Uint8Array,
-) {
- var k = box_before(publicKey, secretKey);
- return secretbox_open(msg, nonce, k);
-}
-
-export const box_open_after = secretbox_open;
-
-export function box_keyPair() {
- var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES);
- var sk = new Uint8Array(crypto_box_SECRETKEYBYTES);
- crypto_box_keypair(pk, sk);
- return { publicKey: pk, secretKey: sk };
-}
-
-export function box_keyPair_fromSecretKey(secretKey: Uint8Array) {
- checkArrayTypes(secretKey);
- if (secretKey.length !== crypto_box_SECRETKEYBYTES)
- throw new Error("bad secret key size");
- var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES);
- crypto_scalarmult_base(pk, secretKey);
- return { publicKey: pk, secretKey: new Uint8Array(secretKey) };
-}
-
-export const box_publicKeyLength = crypto_box_PUBLICKEYBYTES;
-export const box_secretKeyLength = crypto_box_SECRETKEYBYTES;
-export const box_sharedKeyLength = crypto_box_BEFORENMBYTES;
-export const box_nonceLength = crypto_box_NONCEBYTES;
-export const box_overheadLength = secretbox_overheadLength;
-
-export function sign(msg: Uint8Array, secretKey: Uint8Array) {
- checkArrayTypes(msg, secretKey);
- if (secretKey.length !== crypto_sign_SECRETKEYBYTES)
- throw new Error("bad secret key size");
- var signedMsg = new Uint8Array(crypto_sign_BYTES + msg.length);
- crypto_sign(signedMsg, msg, msg.length, secretKey);
- return signedMsg;
-}
-
-export function sign_open(signedMsg: Uint8Array, publicKey: Uint8Array) {
- checkArrayTypes(signedMsg, publicKey);
- if (publicKey.length !== crypto_sign_PUBLICKEYBYTES)
- throw new Error("bad public key size");
- var tmp = new Uint8Array(signedMsg.length);
- var mlen = crypto_sign_open(tmp, signedMsg, signedMsg.length, publicKey);
- if (mlen < 0) return null;
- var m = new Uint8Array(mlen);
- for (var i = 0; i < m.length; i++) m[i] = tmp[i];
- return m;
-}
-
-export function sign_detached(msg: Uint8Array, secretKey: Uint8Array) {
- var signedMsg = sign(msg, secretKey);
- var sig = new Uint8Array(crypto_sign_BYTES);
- for (var i = 0; i < sig.length; i++) sig[i] = signedMsg[i];
- return sig;
-}
-
-export function sign_detached_verify(
- msg: Uint8Array,
- sig: Uint8Array,
- publicKey: Uint8Array,
-) {
- checkArrayTypes(msg, sig, publicKey);
- if (sig.length !== crypto_sign_BYTES) throw new Error("bad signature size");
- if (publicKey.length !== crypto_sign_PUBLICKEYBYTES)
- throw new Error("bad public key size");
- var sm = new Uint8Array(crypto_sign_BYTES + msg.length);
- var m = new Uint8Array(crypto_sign_BYTES + msg.length);
- var i;
- for (i = 0; i < crypto_sign_BYTES; i++) sm[i] = sig[i];
- for (i = 0; i < msg.length; i++) sm[i + crypto_sign_BYTES] = msg[i];
- return crypto_sign_open(m, sm, sm.length, publicKey) >= 0;
-}
-
-export function sign_keyPair() {
- var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES);
- var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES);
- crypto_sign_keypair(pk, sk, false);
- return { publicKey: pk, secretKey: sk };
-}
-
-export function x25519_edwards_keyPair_fromSecretKey(
- secretKey: Uint8Array,
-): Uint8Array {
- const p = [gf(), gf(), gf(), gf()];
- const pk = new Uint8Array(32);
-
- const d = new Uint8Array(64);
- if (secretKey.length != 32) {
- throw new Error("bad secret key size");
- }
- d.set(secretKey, 0);
- //crypto_hash(d, secretKey, 32);
-
- d[0] &= 248;
- d[31] &= 127;
- d[31] |= 64;
-
- scalarbase(p, d);
- pack(pk, p);
-
- return pk;
-}
-
-export function sign_keyPair_fromSecretKey(secretKey: Uint8Array) {
- checkArrayTypes(secretKey);
- if (secretKey.length !== crypto_sign_SECRETKEYBYTES)
- throw new Error("bad secret key size");
- var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES);
- for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32 + i];
- return { publicKey: pk, secretKey: new Uint8Array(secretKey) };
-}
-
-export function sign_keyPair_fromSeed(seed: Uint8Array) {
- checkArrayTypes(seed);
- if (seed.length !== crypto_sign_SEEDBYTES) throw new Error("bad seed size");
- var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES);
- var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES);
- for (var i = 0; i < 32; i++) sk[i] = seed[i];
- crypto_sign_keypair(pk, sk, true);
- return { publicKey: pk, secretKey: sk };
-}
-
-export const sign_publicKeyLength = crypto_sign_PUBLICKEYBYTES;
-export const sign_secretKeyLength = crypto_sign_SECRETKEYBYTES;
-export const sign_seedLength = crypto_sign_SEEDBYTES;
-export const sign_signatureLength = crypto_sign_BYTES;
-
-export function hash(msg: Uint8Array) {
- checkArrayTypes(msg);
- var h = new Uint8Array(crypto_hash_BYTES);
- crypto_hash(h, msg, msg.length);
- return h;
-}
-
-export const hash_hashLength = crypto_hash_BYTES;
-
-export function verify(x: Uint8Array, y: Uint8Array) {
- checkArrayTypes(x, y);
- // Zero length arguments are considered not equal.
- if (x.length === 0 || y.length === 0) return false;
- if (x.length !== y.length) return false;
- return vn(x, 0, y, 0, x.length) === 0 ? true : false;
-}
-
-export function setPRNG(fn: (x: Uint8Array, n: number) => void) {
- randombytes = fn;
-}
-
-export function sign_ed25519_pk_to_curve25519(
- ed25519_pk: Uint8Array,
-): Uint8Array {
- const ge_a = [gf(), gf(), gf(), gf()];
- const x = gf();
- const one_minus_y = gf();
- const x25519_pk = new Uint8Array(32);
-
- if (unpackneg(ge_a, ed25519_pk)) {
- throw Error("invalid public key");
- }
-
- set25519(one_minus_y, gf1);
- Z(one_minus_y, one_minus_y, ge_a[1]);
-
- set25519(x, gf1);
- A(x, x, ge_a[1]);
-
- inv25519(one_minus_y, one_minus_y);
- M(x, x, one_minus_y);
- pack25519(x25519_pk, x);
-
- return x25519_pk;
-}
-
-(function() {
- // Initialize PRNG if environment provides CSPRNG.
- // If not, methods calling randombytes will throw.
- const crypto =
- typeof self !== "undefined" ? self.crypto || (self as any).msCrypto : null;
- if (crypto && crypto.getRandomValues) {
- // Browsers.
- var QUOTA = 65536;
- setPRNG(function(x: Uint8Array, n: number) {
- var i,
- v = new Uint8Array(n);
- for (i = 0; i < n; i += QUOTA) {
- crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA)));
- }
- for (i = 0; i < n; i++) x[i] = v[i];
- cleanup(v);
- });
- } else if (typeof require !== "undefined") {
- // Node.js.
- const cr = require("crypto");
- if (cr && cr.randomBytes) {
- setPRNG(function(x: Uint8Array, n: number) {
- var i,
- v = cr.randomBytes(n);
- for (i = 0; i < n; i++) x[i] = v[i];
- cleanup(v);
- });
- }
- }
-})();
diff --git a/src/crypto/nodeEmscriptenLoader.ts b/src/crypto/nodeEmscriptenLoader.ts
@@ -1,101 +0,0 @@
-
-import { EmscEnvironment } from "./emscInterface";
-import { CryptoImplementation } from "./cryptoImplementation";
-
-import fs = require("fs");
-
-export class NodeEmscriptenLoader {
- private cachedEmscEnvironment: EmscEnvironment | undefined = undefined;
- private cachedEmscEnvironmentPromise:
- | Promise<EmscEnvironment>
- | undefined = undefined;
-
- private async getWasmBinary(): Promise<Uint8Array> {
- // @ts-ignore
- const akonoGetData = global.__akono_getData;
- if (akonoGetData) {
- // We're running embedded node on Android
- console.log("reading wasm binary from akono");
- const data = akonoGetData("taler-emscripten-lib.wasm");
- // The data we get is base64-encoded binary data
- let buf = new Buffer(data, 'base64');
- return new Uint8Array(buf);
-
- } else {
- // We're in a normal node environment
- const binaryPath = __dirname + "/../../../emscripten/taler-emscripten-lib.wasm";
- const wasmBinary = new Uint8Array(fs.readFileSync(binaryPath));
- return wasmBinary;
- }
- }
-
- async getEmscriptenEnvironment(): Promise<EmscEnvironment> {
- if (this.cachedEmscEnvironment) {
- return this.cachedEmscEnvironment;
- }
-
- if (this.cachedEmscEnvironmentPromise) {
- return this.cachedEmscEnvironmentPromise;
- }
-
- let lib: any;
-
- const wasmBinary = await this.getWasmBinary();
-
- return new Promise((resolve, reject) => {
- // Arguments passed to the emscripten prelude
- const libArgs = {
- wasmBinary,
- onRuntimeInitialized: () => {
- if (!lib) {
- console.error("fatal emscripten initialization error");
- return;
- }
- this.cachedEmscEnvironmentPromise = undefined;
- this.cachedEmscEnvironment = new EmscEnvironment(lib);
- resolve(this.cachedEmscEnvironment);
- },
- };
-
- // Make sure that TypeScript doesn't try
- // to check the taler-emscripten-lib.
- const indirectRequire = require;
-
- const g = global;
-
- // unavoidable hack, so that emscripten detects
- // the environment as node even though importScripts
- // is present.
-
- // @ts-ignore
- const savedImportScripts = g.importScripts;
- // @ts-ignore
- delete g.importScripts;
- // @ts-ignore
- const savedCrypto = g.crypto;
- // @ts-ignore
- delete g.crypto;
-
- // Assume that the code is run from the dist/ directory.
- const libFn = indirectRequire(
- "../../../emscripten/taler-emscripten-lib.js",
- );
- lib = libFn(libArgs);
-
- // @ts-ignore
- g.importScripts = savedImportScripts;
- // @ts-ignore
- g.crypto = savedCrypto;
-
- if (!lib) {
- throw Error("could not load taler-emscripten-lib.js");
- }
-
- if (!lib.ccall) {
- throw Error(
- "sanity check failed: taler-emscripten lib does not have 'ccall'",
- );
- }
- });
- }
-}
diff --git a/src/crypto/nodeProcessWorker.ts b/src/crypto/nodeProcessWorker.ts
@@ -84,7 +84,6 @@ export class Worker {
});
this.child.on("message", (msg: any) => {
- console.log("nodeProcessWorker got child message", msg);
this.dispatchMessage(msg);
});
}
@@ -114,7 +113,6 @@ export class Worker {
* Forcibly terminate the worker thread.
*/
terminate () {
- console.log("terminating node.js worker");
this.child.kill("SIGINT");
}
}
diff --git a/src/crypto/nodeWorkerEntry.ts b/src/crypto/nodeWorkerEntry.ts
@@ -14,20 +14,13 @@
TALER; see the file COPYING. If not, see <http://www.gnu.org/licenses/>
*/
-
// tslint:disable:no-var-requires
-import fs = require("fs");
-import vm = require("vm");
-import { NodeEmscriptenLoader } from "./nodeEmscriptenLoader";
import { CryptoImplementation } from "./cryptoImplementation";
-const loader = new NodeEmscriptenLoader();
-
async function handleRequest(operation: string, id: number, args: string[]) {
- let emsc = await loader.getEmscriptenEnvironment();
- const impl = new CryptoImplementation(emsc);
+ const impl = new CryptoImplementation();
if (!(operation in impl)) {
console.error(`crypto operation '${operation}' not found`);
@@ -42,16 +35,12 @@ async function handleRequest(operation: string, id: number, args: string[]) {
console.error("process.send not available");
}
} catch (e) {
- console.log("error during operation", e);
+ console.error("error during operation", e);
return;
}
}
process.on("message", (msgStr: any) => {
- console.log("got message in node worker entry", msgStr);
-
- console.log("typeof msg", typeof msgStr);
-
const msg = JSON.parse(msgStr);
const args = msg.data.args;
@@ -76,5 +65,5 @@ process.on("message", (msgStr: any) => {
});
process.on("uncaughtException", (err: any) => {
- console.log("uncaught exception in node worker entry", err);
+ console.error("uncaught exception in node worker entry", err);
});
diff --git a/src/crypto/kdf.ts b/src/crypto/primitives/kdf.ts
diff --git a/src/crypto/primitives/nacl-fast.ts b/src/crypto/primitives/nacl-fast.ts
@@ -0,0 +1,3110 @@
+// Ported in 2014 by Dmitry Chestnykh and Devi Mandiri.
+// TypeScript port in 2019 by Florian Dold.
+// Public domain.
+//
+// Implementation derived from TweetNaCl version 20140427.
+// See for details: http://tweetnacl.cr.yp.to/
+
+const gf = function(init: number[] = []) {
+ const r = new Float64Array(16);
+ if (init) for (let i = 0; i < init.length; i++) r[i] = init[i];
+ return r;
+};
+
+// Pluggable, initialized in high-level API below.
+let randombytes = function(x: Uint8Array, n: number): void {
+ throw new Error("no PRNG");
+};
+
+const _0 = new Uint8Array(16);
+const _9 = new Uint8Array(32);
+_9[0] = 9;
+
+// prettier-ignore
+const gf0 = gf();
+const gf1 = gf([1]);
+const _121665 = gf([0xdb41, 1]);
+const D = gf([
+ 0x78a3,
+ 0x1359,
+ 0x4dca,
+ 0x75eb,
+ 0xd8ab,
+ 0x4141,
+ 0x0a4d,
+ 0x0070,
+ 0xe898,
+ 0x7779,
+ 0x4079,
+ 0x8cc7,
+ 0xfe73,
+ 0x2b6f,
+ 0x6cee,
+ 0x5203,
+]);
+const D2 = gf([
+ 0xf159,
+ 0x26b2,
+ 0x9b94,
+ 0xebd6,
+ 0xb156,
+ 0x8283,
+ 0x149a,
+ 0x00e0,
+ 0xd130,
+ 0xeef3,
+ 0x80f2,
+ 0x198e,
+ 0xfce7,
+ 0x56df,
+ 0xd9dc,
+ 0x2406,
+]);
+const X = gf([
+ 0xd51a,
+ 0x8f25,
+ 0x2d60,
+ 0xc956,
+ 0xa7b2,
+ 0x9525,
+ 0xc760,
+ 0x692c,
+ 0xdc5c,
+ 0xfdd6,
+ 0xe231,
+ 0xc0a4,
+ 0x53fe,
+ 0xcd6e,
+ 0x36d3,
+ 0x2169,
+]);
+const Y = gf([
+ 0x6658,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+ 0x6666,
+]);
+const I = gf([
+ 0xa0b0,
+ 0x4a0e,
+ 0x1b27,
+ 0xc4ee,
+ 0xe478,
+ 0xad2f,
+ 0x1806,
+ 0x2f43,
+ 0xd7a7,
+ 0x3dfb,
+ 0x0099,
+ 0x2b4d,
+ 0xdf0b,
+ 0x4fc1,
+ 0x2480,
+ 0x2b83,
+]);
+
+function ts64(x: Uint8Array, i: number, h: number, l: number) {
+ x[i] = (h >> 24) & 0xff;
+ x[i + 1] = (h >> 16) & 0xff;
+ x[i + 2] = (h >> 8) & 0xff;
+ x[i + 3] = h & 0xff;
+ x[i + 4] = (l >> 24) & 0xff;
+ x[i + 5] = (l >> 16) & 0xff;
+ x[i + 6] = (l >> 8) & 0xff;
+ x[i + 7] = l & 0xff;
+}
+
+function vn(x: Uint8Array, xi: number, y: Uint8Array, yi: number, n: number) {
+ var i,
+ d = 0;
+ for (i = 0; i < n; i++) d |= x[xi + i] ^ y[yi + i];
+ return (1 & ((d - 1) >>> 8)) - 1;
+}
+
+function crypto_verify_16(
+ x: Uint8Array,
+ xi: number,
+ y: Uint8Array,
+ yi: number,
+) {
+ return vn(x, xi, y, yi, 16);
+}
+
+function crypto_verify_32(
+ x: Uint8Array,
+ xi: number,
+ y: Uint8Array,
+ yi: number,
+) {
+ return vn(x, xi, y, yi, 32);
+}
+
+// prettier-ignore
+function core_salsa20(o: Uint8Array, p: Uint8Array, k: Uint8Array, c: Uint8Array) {
+ var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24,
+ j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24,
+ j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24,
+ j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24,
+ j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24,
+ j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24,
+ j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24,
+ j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24,
+ j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24,
+ j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24,
+ j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24,
+ j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24,
+ j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24,
+ j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24,
+ j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24,
+ j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24;
+
+ var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7,
+ x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14,
+ x15 = j15, u;
+
+ for (var i = 0; i < 20; i += 2) {
+ u = x0 + x12 | 0;
+ x4 ^= u<<7 | u>>>(32-7);
+ u = x4 + x0 | 0;
+ x8 ^= u<<9 | u>>>(32-9);
+ u = x8 + x4 | 0;
+ x12 ^= u<<13 | u>>>(32-13);
+ u = x12 + x8 | 0;
+ x0 ^= u<<18 | u>>>(32-18);
+
+ u = x5 + x1 | 0;
+ x9 ^= u<<7 | u>>>(32-7);
+ u = x9 + x5 | 0;
+ x13 ^= u<<9 | u>>>(32-9);
+ u = x13 + x9 | 0;
+ x1 ^= u<<13 | u>>>(32-13);
+ u = x1 + x13 | 0;
+ x5 ^= u<<18 | u>>>(32-18);
+
+ u = x10 + x6 | 0;
+ x14 ^= u<<7 | u>>>(32-7);
+ u = x14 + x10 | 0;
+ x2 ^= u<<9 | u>>>(32-9);
+ u = x2 + x14 | 0;
+ x6 ^= u<<13 | u>>>(32-13);
+ u = x6 + x2 | 0;
+ x10 ^= u<<18 | u>>>(32-18);
+
+ u = x15 + x11 | 0;
+ x3 ^= u<<7 | u>>>(32-7);
+ u = x3 + x15 | 0;
+ x7 ^= u<<9 | u>>>(32-9);
+ u = x7 + x3 | 0;
+ x11 ^= u<<13 | u>>>(32-13);
+ u = x11 + x7 | 0;
+ x15 ^= u<<18 | u>>>(32-18);
+
+ u = x0 + x3 | 0;
+ x1 ^= u<<7 | u>>>(32-7);
+ u = x1 + x0 | 0;
+ x2 ^= u<<9 | u>>>(32-9);
+ u = x2 + x1 | 0;
+ x3 ^= u<<13 | u>>>(32-13);
+ u = x3 + x2 | 0;
+ x0 ^= u<<18 | u>>>(32-18);
+
+ u = x5 + x4 | 0;
+ x6 ^= u<<7 | u>>>(32-7);
+ u = x6 + x5 | 0;
+ x7 ^= u<<9 | u>>>(32-9);
+ u = x7 + x6 | 0;
+ x4 ^= u<<13 | u>>>(32-13);
+ u = x4 + x7 | 0;
+ x5 ^= u<<18 | u>>>(32-18);
+
+ u = x10 + x9 | 0;
+ x11 ^= u<<7 | u>>>(32-7);
+ u = x11 + x10 | 0;
+ x8 ^= u<<9 | u>>>(32-9);
+ u = x8 + x11 | 0;
+ x9 ^= u<<13 | u>>>(32-13);
+ u = x9 + x8 | 0;
+ x10 ^= u<<18 | u>>>(32-18);
+
+ u = x15 + x14 | 0;
+ x12 ^= u<<7 | u>>>(32-7);
+ u = x12 + x15 | 0;
+ x13 ^= u<<9 | u>>>(32-9);
+ u = x13 + x12 | 0;
+ x14 ^= u<<13 | u>>>(32-13);
+ u = x14 + x13 | 0;
+ x15 ^= u<<18 | u>>>(32-18);
+ }
+ x0 = x0 + j0 | 0;
+ x1 = x1 + j1 | 0;
+ x2 = x2 + j2 | 0;
+ x3 = x3 + j3 | 0;
+ x4 = x4 + j4 | 0;
+ x5 = x5 + j5 | 0;
+ x6 = x6 + j6 | 0;
+ x7 = x7 + j7 | 0;
+ x8 = x8 + j8 | 0;
+ x9 = x9 + j9 | 0;
+ x10 = x10 + j10 | 0;
+ x11 = x11 + j11 | 0;
+ x12 = x12 + j12 | 0;
+ x13 = x13 + j13 | 0;
+ x14 = x14 + j14 | 0;
+ x15 = x15 + j15 | 0;
+
+ o[ 0] = x0 >>> 0 & 0xff;
+ o[ 1] = x0 >>> 8 & 0xff;
+ o[ 2] = x0 >>> 16 & 0xff;
+ o[ 3] = x0 >>> 24 & 0xff;
+
+ o[ 4] = x1 >>> 0 & 0xff;
+ o[ 5] = x1 >>> 8 & 0xff;
+ o[ 6] = x1 >>> 16 & 0xff;
+ o[ 7] = x1 >>> 24 & 0xff;
+
+ o[ 8] = x2 >>> 0 & 0xff;
+ o[ 9] = x2 >>> 8 & 0xff;
+ o[10] = x2 >>> 16 & 0xff;
+ o[11] = x2 >>> 24 & 0xff;
+
+ o[12] = x3 >>> 0 & 0xff;
+ o[13] = x3 >>> 8 & 0xff;
+ o[14] = x3 >>> 16 & 0xff;
+ o[15] = x3 >>> 24 & 0xff;
+
+ o[16] = x4 >>> 0 & 0xff;
+ o[17] = x4 >>> 8 & 0xff;
+ o[18] = x4 >>> 16 & 0xff;
+ o[19] = x4 >>> 24 & 0xff;
+
+ o[20] = x5 >>> 0 & 0xff;
+ o[21] = x5 >>> 8 & 0xff;
+ o[22] = x5 >>> 16 & 0xff;
+ o[23] = x5 >>> 24 & 0xff;
+
+ o[24] = x6 >>> 0 & 0xff;
+ o[25] = x6 >>> 8 & 0xff;
+ o[26] = x6 >>> 16 & 0xff;
+ o[27] = x6 >>> 24 & 0xff;
+
+ o[28] = x7 >>> 0 & 0xff;
+ o[29] = x7 >>> 8 & 0xff;
+ o[30] = x7 >>> 16 & 0xff;
+ o[31] = x7 >>> 24 & 0xff;
+
+ o[32] = x8 >>> 0 & 0xff;
+ o[33] = x8 >>> 8 & 0xff;
+ o[34] = x8 >>> 16 & 0xff;
+ o[35] = x8 >>> 24 & 0xff;
+
+ o[36] = x9 >>> 0 & 0xff;
+ o[37] = x9 >>> 8 & 0xff;
+ o[38] = x9 >>> 16 & 0xff;
+ o[39] = x9 >>> 24 & 0xff;
+
+ o[40] = x10 >>> 0 & 0xff;
+ o[41] = x10 >>> 8 & 0xff;
+ o[42] = x10 >>> 16 & 0xff;
+ o[43] = x10 >>> 24 & 0xff;
+
+ o[44] = x11 >>> 0 & 0xff;
+ o[45] = x11 >>> 8 & 0xff;
+ o[46] = x11 >>> 16 & 0xff;
+ o[47] = x11 >>> 24 & 0xff;
+
+ o[48] = x12 >>> 0 & 0xff;
+ o[49] = x12 >>> 8 & 0xff;
+ o[50] = x12 >>> 16 & 0xff;
+ o[51] = x12 >>> 24 & 0xff;
+
+ o[52] = x13 >>> 0 & 0xff;
+ o[53] = x13 >>> 8 & 0xff;
+ o[54] = x13 >>> 16 & 0xff;
+ o[55] = x13 >>> 24 & 0xff;
+
+ o[56] = x14 >>> 0 & 0xff;
+ o[57] = x14 >>> 8 & 0xff;
+ o[58] = x14 >>> 16 & 0xff;
+ o[59] = x14 >>> 24 & 0xff;
+
+ o[60] = x15 >>> 0 & 0xff;
+ o[61] = x15 >>> 8 & 0xff;
+ o[62] = x15 >>> 16 & 0xff;
+ o[63] = x15 >>> 24 & 0xff;
+}
+
+function core_hsalsa20(
+ o: Uint8Array,
+ p: Uint8Array,
+ k: Uint8Array,
+ c: Uint8Array,
+) {
+ var j0 =
+ (c[0] & 0xff) |
+ ((c[1] & 0xff) << 8) |
+ ((c[2] & 0xff) << 16) |
+ ((c[3] & 0xff) << 24),
+ j1 =
+ (k[0] & 0xff) |
+ ((k[1] & 0xff) << 8) |
+ ((k[2] & 0xff) << 16) |
+ ((k[3] & 0xff) << 24),
+ j2 =
+ (k[4] & 0xff) |
+ ((k[5] & 0xff) << 8) |
+ ((k[6] & 0xff) << 16) |
+ ((k[7] & 0xff) << 24),
+ j3 =
+ (k[8] & 0xff) |
+ ((k[9] & 0xff) << 8) |
+ ((k[10] & 0xff) << 16) |
+ ((k[11] & 0xff) << 24),
+ j4 =
+ (k[12] & 0xff) |
+ ((k[13] & 0xff) << 8) |
+ ((k[14] & 0xff) << 16) |
+ ((k[15] & 0xff) << 24),
+ j5 =
+ (c[4] & 0xff) |
+ ((c[5] & 0xff) << 8) |
+ ((c[6] & 0xff) << 16) |
+ ((c[7] & 0xff) << 24),
+ j6 =
+ (p[0] & 0xff) |
+ ((p[1] & 0xff) << 8) |
+ ((p[2] & 0xff) << 16) |
+ ((p[3] & 0xff) << 24),
+ j7 =
+ (p[4] & 0xff) |
+ ((p[5] & 0xff) << 8) |
+ ((p[6] & 0xff) << 16) |
+ ((p[7] & 0xff) << 24),
+ j8 =
+ (p[8] & 0xff) |
+ ((p[9] & 0xff) << 8) |
+ ((p[10] & 0xff) << 16) |
+ ((p[11] & 0xff) << 24),
+ j9 =
+ (p[12] & 0xff) |
+ ((p[13] & 0xff) << 8) |
+ ((p[14] & 0xff) << 16) |
+ ((p[15] & 0xff) << 24),
+ j10 =
+ (c[8] & 0xff) |
+ ((c[9] & 0xff) << 8) |
+ ((c[10] & 0xff) << 16) |
+ ((c[11] & 0xff) << 24),
+ j11 =
+ (k[16] & 0xff) |
+ ((k[17] & 0xff) << 8) |
+ ((k[18] & 0xff) << 16) |
+ ((k[19] & 0xff) << 24),
+ j12 =
+ (k[20] & 0xff) |
+ ((k[21] & 0xff) << 8) |
+ ((k[22] & 0xff) << 16) |
+ ((k[23] & 0xff) << 24),
+ j13 =
+ (k[24] & 0xff) |
+ ((k[25] & 0xff) << 8) |
+ ((k[26] & 0xff) << 16) |
+ ((k[27] & 0xff) << 24),
+ j14 =
+ (k[28] & 0xff) |
+ ((k[29] & 0xff) << 8) |
+ ((k[30] & 0xff) << 16) |
+ ((k[31] & 0xff) << 24),
+ j15 =
+ (c[12] & 0xff) |
+ ((c[13] & 0xff) << 8) |
+ ((c[14] & 0xff) << 16) |
+ ((c[15] & 0xff) << 24);
+
+ var x0 = j0,
+ x1 = j1,
+ x2 = j2,
+ x3 = j3,
+ x4 = j4,
+ x5 = j5,
+ x6 = j6,
+ x7 = j7,
+ x8 = j8,
+ x9 = j9,
+ x10 = j10,
+ x11 = j11,
+ x12 = j12,
+ x13 = j13,
+ x14 = j14,
+ x15 = j15,
+ u;
+
+ for (var i = 0; i < 20; i += 2) {
+ u = (x0 + x12) | 0;
+ x4 ^= (u << 7) | (u >>> (32 - 7));
+ u = (x4 + x0) | 0;
+ x8 ^= (u << 9) | (u >>> (32 - 9));
+ u = (x8 + x4) | 0;
+ x12 ^= (u << 13) | (u >>> (32 - 13));
+ u = (x12 + x8) | 0;
+ x0 ^= (u << 18) | (u >>> (32 - 18));
+
+ u = (x5 + x1) | 0;
+ x9 ^= (u << 7) | (u >>> (32 - 7));
+ u = (x9 + x5) | 0;
+ x13 ^= (u << 9) | (u >>> (32 - 9));
+ u = (x13 + x9) | 0;
+ x1 ^= (u << 13) | (u >>> (32 - 13));
+ u = (x1 + x13) | 0;
+ x5 ^= (u << 18) | (u >>> (32 - 18));
+
+ u = (x10 + x6) | 0;
+ x14 ^= (u << 7) | (u >>> (32 - 7));
+ u = (x14 + x10) | 0;
+ x2 ^= (u << 9) | (u >>> (32 - 9));
+ u = (x2 + x14) | 0;
+ x6 ^= (u << 13) | (u >>> (32 - 13));
+ u = (x6 + x2) | 0;
+ x10 ^= (u << 18) | (u >>> (32 - 18));
+
+ u = (x15 + x11) | 0;
+ x3 ^= (u << 7) | (u >>> (32 - 7));
+ u = (x3 + x15) | 0;
+ x7 ^= (u << 9) | (u >>> (32 - 9));
+ u = (x7 + x3) | 0;
+ x11 ^= (u << 13) | (u >>> (32 - 13));
+ u = (x11 + x7) | 0;
+ x15 ^= (u << 18) | (u >>> (32 - 18));
+
+ u = (x0 + x3) | 0;
+ x1 ^= (u << 7) | (u >>> (32 - 7));
+ u = (x1 + x0) | 0;
+ x2 ^= (u << 9) | (u >>> (32 - 9));
+ u = (x2 + x1) | 0;
+ x3 ^= (u << 13) | (u >>> (32 - 13));
+ u = (x3 + x2) | 0;
+ x0 ^= (u << 18) | (u >>> (32 - 18));
+
+ u = (x5 + x4) | 0;
+ x6 ^= (u << 7) | (u >>> (32 - 7));
+ u = (x6 + x5) | 0;
+ x7 ^= (u << 9) | (u >>> (32 - 9));
+ u = (x7 + x6) | 0;
+ x4 ^= (u << 13) | (u >>> (32 - 13));
+ u = (x4 + x7) | 0;
+ x5 ^= (u << 18) | (u >>> (32 - 18));
+
+ u = (x10 + x9) | 0;
+ x11 ^= (u << 7) | (u >>> (32 - 7));
+ u = (x11 + x10) | 0;
+ x8 ^= (u << 9) | (u >>> (32 - 9));
+ u = (x8 + x11) | 0;
+ x9 ^= (u << 13) | (u >>> (32 - 13));
+ u = (x9 + x8) | 0;
+ x10 ^= (u << 18) | (u >>> (32 - 18));
+
+ u = (x15 + x14) | 0;
+ x12 ^= (u << 7) | (u >>> (32 - 7));
+ u = (x12 + x15) | 0;
+ x13 ^= (u << 9) | (u >>> (32 - 9));
+ u = (x13 + x12) | 0;
+ x14 ^= (u << 13) | (u >>> (32 - 13));
+ u = (x14 + x13) | 0;
+ x15 ^= (u << 18) | (u >>> (32 - 18));
+ }
+
+ o[0] = (x0 >>> 0) & 0xff;
+ o[1] = (x0 >>> 8) & 0xff;
+ o[2] = (x0 >>> 16) & 0xff;
+ o[3] = (x0 >>> 24) & 0xff;
+
+ o[4] = (x5 >>> 0) & 0xff;
+ o[5] = (x5 >>> 8) & 0xff;
+ o[6] = (x5 >>> 16) & 0xff;
+ o[7] = (x5 >>> 24) & 0xff;
+
+ o[8] = (x10 >>> 0) & 0xff;
+ o[9] = (x10 >>> 8) & 0xff;
+ o[10] = (x10 >>> 16) & 0xff;
+ o[11] = (x10 >>> 24) & 0xff;
+
+ o[12] = (x15 >>> 0) & 0xff;
+ o[13] = (x15 >>> 8) & 0xff;
+ o[14] = (x15 >>> 16) & 0xff;
+ o[15] = (x15 >>> 24) & 0xff;
+
+ o[16] = (x6 >>> 0) & 0xff;
+ o[17] = (x6 >>> 8) & 0xff;
+ o[18] = (x6 >>> 16) & 0xff;
+ o[19] = (x6 >>> 24) & 0xff;
+
+ o[20] = (x7 >>> 0) & 0xff;
+ o[21] = (x7 >>> 8) & 0xff;
+ o[22] = (x7 >>> 16) & 0xff;
+ o[23] = (x7 >>> 24) & 0xff;
+
+ o[24] = (x8 >>> 0) & 0xff;
+ o[25] = (x8 >>> 8) & 0xff;
+ o[26] = (x8 >>> 16) & 0xff;
+ o[27] = (x8 >>> 24) & 0xff;
+
+ o[28] = (x9 >>> 0) & 0xff;
+ o[29] = (x9 >>> 8) & 0xff;
+ o[30] = (x9 >>> 16) & 0xff;
+ o[31] = (x9 >>> 24) & 0xff;
+}
+
+function crypto_core_salsa20(
+ out: Uint8Array,
+ inp: Uint8Array,
+ k: Uint8Array,
+ c: Uint8Array,
+) {
+ core_salsa20(out, inp, k, c);
+}
+
+function crypto_core_hsalsa20(
+ out: Uint8Array,
+ inp: Uint8Array,
+ k: Uint8Array,
+ c: Uint8Array,
+) {
+ core_hsalsa20(out, inp, k, c);
+}
+
+var sigma = new Uint8Array([
+ 101,
+ 120,
+ 112,
+ 97,
+ 110,
+ 100,
+ 32,
+ 51,
+ 50,
+ 45,
+ 98,
+ 121,
+ 116,
+ 101,
+ 32,
+ 107,
+]);
+// "expand 32-byte k"
+
+function crypto_stream_salsa20_xor(
+ c: Uint8Array,
+ cpos: number,
+ m: Uint8Array,
+ mpos: number,
+ b: number,
+ n: Uint8Array,
+ k: Uint8Array,
+) {
+ var z = new Uint8Array(16),
+ x = new Uint8Array(64);
+ var u, i;
+ for (i = 0; i < 16; i++) z[i] = 0;
+ for (i = 0; i < 8; i++) z[i] = n[i];
+ while (b >= 64) {
+ crypto_core_salsa20(x, z, k, sigma);
+ for (i = 0; i < 64; i++) c[cpos + i] = m[mpos + i] ^ x[i];
+ u = 1;
+ for (i = 8; i < 16; i++) {
+ u = (u + (z[i] & 0xff)) | 0;
+ z[i] = u & 0xff;
+ u >>>= 8;
+ }
+ b -= 64;
+ cpos += 64;
+ mpos += 64;
+ }
+ if (b > 0) {
+ crypto_core_salsa20(x, z, k, sigma);
+ for (i = 0; i < b; i++) c[cpos + i] = m[mpos + i] ^ x[i];
+ }
+ return 0;
+}
+
+function crypto_stream_salsa20(
+ c: Uint8Array,
+ cpos: number,
+ b: number,
+ n: Uint8Array,
+ k: Uint8Array,
+) {
+ var z = new Uint8Array(16),
+ x = new Uint8Array(64);
+ var u, i;
+ for (i = 0; i < 16; i++) z[i] = 0;
+ for (i = 0; i < 8; i++) z[i] = n[i];
+ while (b >= 64) {
+ crypto_core_salsa20(x, z, k, sigma);
+ for (i = 0; i < 64; i++) c[cpos + i] = x[i];
+ u = 1;
+ for (i = 8; i < 16; i++) {
+ u = (u + (z[i] & 0xff)) | 0;
+ z[i] = u & 0xff;
+ u >>>= 8;
+ }
+ b -= 64;
+ cpos += 64;
+ }
+ if (b > 0) {
+ crypto_core_salsa20(x, z, k, sigma);
+ for (i = 0; i < b; i++) c[cpos + i] = x[i];
+ }
+ return 0;
+}
+
+function crypto_stream(
+ c: Uint8Array,
+ cpos: number,
+ d: number,
+ n: Uint8Array,
+ k: Uint8Array,
+) {
+ var s = new Uint8Array(32);
+ crypto_core_hsalsa20(s, n, k, sigma);
+ var sn = new Uint8Array(8);
+ for (var i = 0; i < 8; i++) sn[i] = n[i + 16];
+ return crypto_stream_salsa20(c, cpos, d, sn, s);
+}
+
+function crypto_stream_xor(
+ c: Uint8Array,
+ cpos: number,
+ m: Uint8Array,
+ mpos: number,
+ d: number,
+ n: Uint8Array,
+ k: Uint8Array,
+) {
+ var s = new Uint8Array(32);
+ crypto_core_hsalsa20(s, n, k, sigma);
+ var sn = new Uint8Array(8);
+ for (var i = 0; i < 8; i++) sn[i] = n[i + 16];
+ return crypto_stream_salsa20_xor(c, cpos, m, mpos, d, sn, s);
+}
+
+/*
+ * Port of Andrew Moon's Poly1305-donna-16. Public domain.
+ * https://github.com/floodyberry/poly1305-donna
+ */
+
+class poly1305 {
+ buffer = new Uint8Array(16);
+ r = new Uint16Array(10);
+ h = new Uint16Array(10);
+ pad = new Uint16Array(8);
+ leftover = 0;
+ fin = 0;
+
+ constructor(key: Uint8Array) {
+ var t0, t1, t2, t3, t4, t5, t6, t7;
+
+ t0 = (key[0] & 0xff) | ((key[1] & 0xff) << 8);
+ this.r[0] = t0 & 0x1fff;
+ t1 = (key[2] & 0xff) | ((key[3] & 0xff) << 8);
+ this.r[1] = ((t0 >>> 13) | (t1 << 3)) & 0x1fff;
+ t2 = (key[4] & 0xff) | ((key[5] & 0xff) << 8);
+ this.r[2] = ((t1 >>> 10) | (t2 << 6)) & 0x1f03;
+ t3 = (key[6] & 0xff) | ((key[7] & 0xff) << 8);
+ this.r[3] = ((t2 >>> 7) | (t3 << 9)) & 0x1fff;
+ t4 = (key[8] & 0xff) | ((key[9] & 0xff) << 8);
+ this.r[4] = ((t3 >>> 4) | (t4 << 12)) & 0x00ff;
+ this.r[5] = (t4 >>> 1) & 0x1ffe;
+ t5 = (key[10] & 0xff) | ((key[11] & 0xff) << 8);
+ this.r[6] = ((t4 >>> 14) | (t5 << 2)) & 0x1fff;
+ t6 = (key[12] & 0xff) | ((key[13] & 0xff) << 8);
+ this.r[7] = ((t5 >>> 11) | (t6 << 5)) & 0x1f81;
+ t7 = (key[14] & 0xff) | ((key[15] & 0xff) << 8);
+ this.r[8] = ((t6 >>> 8) | (t7 << 8)) & 0x1fff;
+ this.r[9] = (t7 >>> 5) & 0x007f;
+
+ this.pad[0] = (key[16] & 0xff) | ((key[17] & 0xff) << 8);
+ this.pad[1] = (key[18] & 0xff) | ((key[19] & 0xff) << 8);
+ this.pad[2] = (key[20] & 0xff) | ((key[21] & 0xff) << 8);
+ this.pad[3] = (key[22] & 0xff) | ((key[23] & 0xff) << 8);
+ this.pad[4] = (key[24] & 0xff) | ((key[25] & 0xff) << 8);
+ this.pad[5] = (key[26] & 0xff) | ((key[27] & 0xff) << 8);
+ this.pad[6] = (key[28] & 0xff) | ((key[29] & 0xff) << 8);
+ this.pad[7] = (key[30] & 0xff) | ((key[31] & 0xff) << 8);
+ }
+
+ blocks(m: Uint8Array, mpos: number, bytes: number) {
+ var hibit = this.fin ? 0 : 1 << 11;
+ var t0, t1, t2, t3, t4, t5, t6, t7, c;
+ var d0, d1, d2, d3, d4, d5, d6, d7, d8, d9;
+
+ var h0 = this.h[0],
+ h1 = this.h[1],
+ h2 = this.h[2],
+ h3 = this.h[3],
+ h4 = this.h[4],
+ h5 = this.h[5],
+ h6 = this.h[6],
+ h7 = this.h[7],
+ h8 = this.h[8],
+ h9 = this.h[9];
+
+ var r0 = this.r[0],
+ r1 = this.r[1],
+ r2 = this.r[2],
+ r3 = this.r[3],
+ r4 = this.r[4],
+ r5 = this.r[5],
+ r6 = this.r[6],
+ r7 = this.r[7],
+ r8 = this.r[8],
+ r9 = this.r[9];
+
+ while (bytes >= 16) {
+ t0 = (m[mpos + 0] & 0xff) | ((m[mpos + 1] & 0xff) << 8);
+ h0 += t0 & 0x1fff;
+ t1 = (m[mpos + 2] & 0xff) | ((m[mpos + 3] & 0xff) << 8);
+ h1 += ((t0 >>> 13) | (t1 << 3)) & 0x1fff;
+ t2 = (m[mpos + 4] & 0xff) | ((m[mpos + 5] & 0xff) << 8);
+ h2 += ((t1 >>> 10) | (t2 << 6)) & 0x1fff;
+ t3 = (m[mpos + 6] & 0xff) | ((m[mpos + 7] & 0xff) << 8);
+ h3 += ((t2 >>> 7) | (t3 << 9)) & 0x1fff;
+ t4 = (m[mpos + 8] & 0xff) | ((m[mpos + 9] & 0xff) << 8);
+ h4 += ((t3 >>> 4) | (t4 << 12)) & 0x1fff;
+ h5 += (t4 >>> 1) & 0x1fff;
+ t5 = (m[mpos + 10] & 0xff) | ((m[mpos + 11] & 0xff) << 8);
+ h6 += ((t4 >>> 14) | (t5 << 2)) & 0x1fff;
+ t6 = (m[mpos + 12] & 0xff) | ((m[mpos + 13] & 0xff) << 8);
+ h7 += ((t5 >>> 11) | (t6 << 5)) & 0x1fff;
+ t7 = (m[mpos + 14] & 0xff) | ((m[mpos + 15] & 0xff) << 8);
+ h8 += ((t6 >>> 8) | (t7 << 8)) & 0x1fff;
+ h9 += (t7 >>> 5) | hibit;
+
+ c = 0;
+
+ d0 = c;
+ d0 += h0 * r0;
+ d0 += h1 * (5 * r9);
+ d0 += h2 * (5 * r8);
+ d0 += h3 * (5 * r7);
+ d0 += h4 * (5 * r6);
+ c = d0 >>> 13;
+ d0 &= 0x1fff;
+ d0 += h5 * (5 * r5);
+ d0 += h6 * (5 * r4);
+ d0 += h7 * (5 * r3);
+ d0 += h8 * (5 * r2);
+ d0 += h9 * (5 * r1);
+ c += d0 >>> 13;
+ d0 &= 0x1fff;
+
+ d1 = c;
+ d1 += h0 * r1;
+ d1 += h1 * r0;
+ d1 += h2 * (5 * r9);
+ d1 += h3 * (5 * r8);
+ d1 += h4 * (5 * r7);
+ c = d1 >>> 13;
+ d1 &= 0x1fff;
+ d1 += h5 * (5 * r6);
+ d1 += h6 * (5 * r5);
+ d1 += h7 * (5 * r4);
+ d1 += h8 * (5 * r3);
+ d1 += h9 * (5 * r2);
+ c += d1 >>> 13;
+ d1 &= 0x1fff;
+
+ d2 = c;
+ d2 += h0 * r2;
+ d2 += h1 * r1;
+ d2 += h2 * r0;
+ d2 += h3 * (5 * r9);
+ d2 += h4 * (5 * r8);
+ c = d2 >>> 13;
+ d2 &= 0x1fff;
+ d2 += h5 * (5 * r7);
+ d2 += h6 * (5 * r6);
+ d2 += h7 * (5 * r5);
+ d2 += h8 * (5 * r4);
+ d2 += h9 * (5 * r3);
+ c += d2 >>> 13;
+ d2 &= 0x1fff;
+
+ d3 = c;
+ d3 += h0 * r3;
+ d3 += h1 * r2;
+ d3 += h2 * r1;
+ d3 += h3 * r0;
+ d3 += h4 * (5 * r9);
+ c = d3 >>> 13;
+ d3 &= 0x1fff;
+ d3 += h5 * (5 * r8);
+ d3 += h6 * (5 * r7);
+ d3 += h7 * (5 * r6);
+ d3 += h8 * (5 * r5);
+ d3 += h9 * (5 * r4);
+ c += d3 >>> 13;
+ d3 &= 0x1fff;
+
+ d4 = c;
+ d4 += h0 * r4;
+ d4 += h1 * r3;
+ d4 += h2 * r2;
+ d4 += h3 * r1;
+ d4 += h4 * r0;
+ c = d4 >>> 13;
+ d4 &= 0x1fff;
+ d4 += h5 * (5 * r9);
+ d4 += h6 * (5 * r8);
+ d4 += h7 * (5 * r7);
+ d4 += h8 * (5 * r6);
+ d4 += h9 * (5 * r5);
+ c += d4 >>> 13;
+ d4 &= 0x1fff;
+
+ d5 = c;
+ d5 += h0 * r5;
+ d5 += h1 * r4;
+ d5 += h2 * r3;
+ d5 += h3 * r2;
+ d5 += h4 * r1;
+ c = d5 >>> 13;
+ d5 &= 0x1fff;
+ d5 += h5 * r0;
+ d5 += h6 * (5 * r9);
+ d5 += h7 * (5 * r8);
+ d5 += h8 * (5 * r7);
+ d5 += h9 * (5 * r6);
+ c += d5 >>> 13;
+ d5 &= 0x1fff;
+
+ d6 = c;
+ d6 += h0 * r6;
+ d6 += h1 * r5;
+ d6 += h2 * r4;
+ d6 += h3 * r3;
+ d6 += h4 * r2;
+ c = d6 >>> 13;
+ d6 &= 0x1fff;
+ d6 += h5 * r1;
+ d6 += h6 * r0;
+ d6 += h7 * (5 * r9);
+ d6 += h8 * (5 * r8);
+ d6 += h9 * (5 * r7);
+ c += d6 >>> 13;
+ d6 &= 0x1fff;
+
+ d7 = c;
+ d7 += h0 * r7;
+ d7 += h1 * r6;
+ d7 += h2 * r5;
+ d7 += h3 * r4;
+ d7 += h4 * r3;
+ c = d7 >>> 13;
+ d7 &= 0x1fff;
+ d7 += h5 * r2;
+ d7 += h6 * r1;
+ d7 += h7 * r0;
+ d7 += h8 * (5 * r9);
+ d7 += h9 * (5 * r8);
+ c += d7 >>> 13;
+ d7 &= 0x1fff;
+
+ d8 = c;
+ d8 += h0 * r8;
+ d8 += h1 * r7;
+ d8 += h2 * r6;
+ d8 += h3 * r5;
+ d8 += h4 * r4;
+ c = d8 >>> 13;
+ d8 &= 0x1fff;
+ d8 += h5 * r3;
+ d8 += h6 * r2;
+ d8 += h7 * r1;
+ d8 += h8 * r0;
+ d8 += h9 * (5 * r9);
+ c += d8 >>> 13;
+ d8 &= 0x1fff;
+
+ d9 = c;
+ d9 += h0 * r9;
+ d9 += h1 * r8;
+ d9 += h2 * r7;
+ d9 += h3 * r6;
+ d9 += h4 * r5;
+ c = d9 >>> 13;
+ d9 &= 0x1fff;
+ d9 += h5 * r4;
+ d9 += h6 * r3;
+ d9 += h7 * r2;
+ d9 += h8 * r1;
+ d9 += h9 * r0;
+ c += d9 >>> 13;
+ d9 &= 0x1fff;
+
+ c = ((c << 2) + c) | 0;
+ c = (c + d0) | 0;
+ d0 = c & 0x1fff;
+ c = c >>> 13;
+ d1 += c;
+
+ h0 = d0;
+ h1 = d1;
+ h2 = d2;
+ h3 = d3;
+ h4 = d4;
+ h5 = d5;
+ h6 = d6;
+ h7 = d7;
+ h8 = d8;
+ h9 = d9;
+
+ mpos += 16;
+ bytes -= 16;
+ }
+ this.h[0] = h0;
+ this.h[1] = h1;
+ this.h[2] = h2;
+ this.h[3] = h3;
+ this.h[4] = h4;
+ this.h[5] = h5;
+ this.h[6] = h6;
+ this.h[7] = h7;
+ this.h[8] = h8;
+ this.h[9] = h9;
+ }
+
+ finish(mac: Uint8Array, macpos: number) {
+ var g = new Uint16Array(10);
+ var c, mask, f, i;
+
+ if (this.leftover) {
+ i = this.leftover;
+ this.buffer[i++] = 1;
+ for (; i < 16; i++) this.buffer[i] = 0;
+ this.fin = 1;
+ this.blocks(this.buffer, 0, 16);
+ }
+
+ c = this.h[1] >>> 13;
+ this.h[1] &= 0x1fff;
+ for (i = 2; i < 10; i++) {
+ this.h[i] += c;
+ c = this.h[i] >>> 13;
+ this.h[i] &= 0x1fff;
+ }
+ this.h[0] += c * 5;
+ c = this.h[0] >>> 13;
+ this.h[0] &= 0x1fff;
+ this.h[1] += c;
+ c = this.h[1] >>> 13;
+ this.h[1] &= 0x1fff;
+ this.h[2] += c;
+
+ g[0] = this.h[0] + 5;
+ c = g[0] >>> 13;
+ g[0] &= 0x1fff;
+ for (i = 1; i < 10; i++) {
+ g[i] = this.h[i] + c;
+ c = g[i] >>> 13;
+ g[i] &= 0x1fff;
+ }
+ g[9] -= 1 << 13;
+
+ mask = (c ^ 1) - 1;
+ for (i = 0; i < 10; i++) g[i] &= mask;
+ mask = ~mask;
+ for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i];
+
+ this.h[0] = (this.h[0] | (this.h[1] << 13)) & 0xffff;
+ this.h[1] = ((this.h[1] >>> 3) | (this.h[2] << 10)) & 0xffff;
+ this.h[2] = ((this.h[2] >>> 6) | (this.h[3] << 7)) & 0xffff;
+ this.h[3] = ((this.h[3] >>> 9) | (this.h[4] << 4)) & 0xffff;
+ this.h[4] =
+ ((this.h[4] >>> 12) | (this.h[5] << 1) | (this.h[6] << 14)) & 0xffff;
+ this.h[5] = ((this.h[6] >>> 2) | (this.h[7] << 11)) & 0xffff;
+ this.h[6] = ((this.h[7] >>> 5) | (this.h[8] << 8)) & 0xffff;
+ this.h[7] = ((this.h[8] >>> 8) | (this.h[9] << 5)) & 0xffff;
+
+ f = this.h[0] + this.pad[0];
+ this.h[0] = f & 0xffff;
+ for (i = 1; i < 8; i++) {
+ f = (((this.h[i] + this.pad[i]) | 0) + (f >>> 16)) | 0;
+ this.h[i] = f & 0xffff;
+ }
+
+ mac[macpos + 0] = (this.h[0] >>> 0) & 0xff;
+ mac[macpos + 1] = (this.h[0] >>> 8) & 0xff;
+ mac[macpos + 2] = (this.h[1] >>> 0) & 0xff;
+ mac[macpos + 3] = (this.h[1] >>> 8) & 0xff;
+ mac[macpos + 4] = (this.h[2] >>> 0) & 0xff;
+ mac[macpos + 5] = (this.h[2] >>> 8) & 0xff;
+ mac[macpos + 6] = (this.h[3] >>> 0) & 0xff;
+ mac[macpos + 7] = (this.h[3] >>> 8) & 0xff;
+ mac[macpos + 8] = (this.h[4] >>> 0) & 0xff;
+ mac[macpos + 9] = (this.h[4] >>> 8) & 0xff;
+ mac[macpos + 10] = (this.h[5] >>> 0) & 0xff;
+ mac[macpos + 11] = (this.h[5] >>> 8) & 0xff;
+ mac[macpos + 12] = (this.h[6] >>> 0) & 0xff;
+ mac[macpos + 13] = (this.h[6] >>> 8) & 0xff;
+ mac[macpos + 14] = (this.h[7] >>> 0) & 0xff;
+ mac[macpos + 15] = (this.h[7] >>> 8) & 0xff;
+ }
+
+ update(m: Uint8Array, mpos: number, bytes: number) {
+ var i, want;
+
+ if (this.leftover) {
+ want = 16 - this.leftover;
+ if (want > bytes) want = bytes;
+ for (i = 0; i < want; i++) this.buffer[this.leftover + i] = m[mpos + i];
+ bytes -= want;
+ mpos += want;
+ this.leftover += want;
+ if (this.leftover < 16) return;
+ this.blocks(this.buffer, 0, 16);
+ this.leftover = 0;
+ }
+
+ if (bytes >= 16) {
+ want = bytes - (bytes % 16);
+ this.blocks(m, mpos, want);
+ mpos += want;
+ bytes -= want;
+ }
+
+ if (bytes) {
+ for (i = 0; i < bytes; i++) this.buffer[this.leftover + i] = m[mpos + i];
+ this.leftover += bytes;
+ }
+ }
+}
+
+function crypto_onetimeauth(
+ out: Uint8Array,
+ outpos: number,
+ m: Uint8Array,
+ mpos: number,
+ n: number,
+ k: Uint8Array,
+) {
+ var s = new poly1305(k);
+ s.update(m, mpos, n);
+ s.finish(out, outpos);
+ return 0;
+}
+
+function crypto_onetimeauth_verify(
+ h: Uint8Array,
+ hpos: number,
+ m: Uint8Array,
+ mpos: number,
+ n: number,
+ k: Uint8Array,
+) {
+ var x = new Uint8Array(16);
+ crypto_onetimeauth(x, 0, m, mpos, n, k);
+ return crypto_verify_16(h, hpos, x, 0);
+}
+
+function crypto_secretbox(
+ c: Uint8Array,
+ m: Uint8Array,
+ d: number,
+ n: Uint8Array,
+ k: Uint8Array,
+) {
+ var i;
+ if (d < 32) return -1;
+ crypto_stream_xor(c, 0, m, 0, d, n, k);
+ crypto_onetimeauth(c, 16, c, 32, d - 32, c);
+ for (i = 0; i < 16; i++) c[i] = 0;
+ return 0;
+}
+
+function crypto_secretbox_open(
+ m: Uint8Array,
+ c: Uint8Array,
+ d: number,
+ n: Uint8Array,
+ k: Uint8Array,
+) {
+ var i;
+ var x = new Uint8Array(32);
+ if (d < 32) return -1;
+ crypto_stream(x, 0, 32, n, k);
+ if (crypto_onetimeauth_verify(c, 16, c, 32, d - 32, x) !== 0) return -1;
+ crypto_stream_xor(m, 0, c, 0, d, n, k);
+ for (i = 0; i < 32; i++) m[i] = 0;
+ return 0;
+}
+
+function set25519(r: Float64Array, a: Float64Array) {
+ var i;
+ for (i = 0; i < 16; i++) r[i] = a[i] | 0;
+}
+
+function car25519(o: Float64Array) {
+ var i,
+ v,
+ c = 1;
+ for (i = 0; i < 16; i++) {
+ v = o[i] + c + 65535;
+ c = Math.floor(v / 65536);
+ o[i] = v - c * 65536;
+ }
+ o[0] += c - 1 + 37 * (c - 1);
+}
+
+function sel25519(p: Float64Array, q: Float64Array, b: number) {
+ var t,
+ c = ~(b - 1);
+ for (var i = 0; i < 16; i++) {
+ t = c & (p[i] ^ q[i]);
+ p[i] ^= t;
+ q[i] ^= t;
+ }
+}
+
+function pack25519(o: Uint8Array, n: Float64Array) {
+ var i, j, b;
+ var m = gf(),
+ t = gf();
+ for (i = 0; i < 16; i++) t[i] = n[i];
+ car25519(t);
+ car25519(t);
+ car25519(t);
+ for (j = 0; j < 2; j++) {
+ m[0] = t[0] - 0xffed;
+ for (i = 1; i < 15; i++) {
+ m[i] = t[i] - 0xffff - ((m[i - 1] >> 16) & 1);
+ m[i - 1] &= 0xffff;
+ }
+ m[15] = t[15] - 0x7fff - ((m[14] >> 16) & 1);
+ b = (m[15] >> 16) & 1;
+ m[14] &= 0xffff;
+ sel25519(t, m, 1 - b);
+ }
+ for (i = 0; i < 16; i++) {
+ o[2 * i] = t[i] & 0xff;
+ o[2 * i + 1] = t[i] >> 8;
+ }
+}
+
+function neq25519(a: Float64Array, b: Float64Array) {
+ var c = new Uint8Array(32),
+ d = new Uint8Array(32);
+ pack25519(c, a);
+ pack25519(d, b);
+ return crypto_verify_32(c, 0, d, 0);
+}
+
+function par25519(a: Float64Array) {
+ var d = new Uint8Array(32);
+ pack25519(d, a);
+ return d[0] & 1;
+}
+
+function unpack25519(o: Float64Array, n: Uint8Array) {
+ var i;
+ for (i = 0; i < 16; i++) o[i] = n[2 * i] + (n[2 * i + 1] << 8);
+ o[15] &= 0x7fff;
+}
+
+function A(o: Float64Array, a: Float64Array, b: Float64Array) {
+ for (var i = 0; i < 16; i++) o[i] = a[i] + b[i];
+}
+
+function Z(o: Float64Array, a: Float64Array, b: Float64Array) {
+ for (var i = 0; i < 16; i++) o[i] = a[i] - b[i];
+}
+
+function M(o: Float64Array, a: Float64Array, b: Float64Array) {
+ var v,
+ c,
+ t0 = 0,
+ t1 = 0,
+ t2 = 0,
+ t3 = 0,
+ t4 = 0,
+ t5 = 0,
+ t6 = 0,
+ t7 = 0,
+ t8 = 0,
+ t9 = 0,
+ t10 = 0,
+ t11 = 0,
+ t12 = 0,
+ t13 = 0,
+ t14 = 0,
+ t15 = 0,
+ t16 = 0,
+ t17 = 0,
+ t18 = 0,
+ t19 = 0,
+ t20 = 0,
+ t21 = 0,
+ t22 = 0,
+ t23 = 0,
+ t24 = 0,
+ t25 = 0,
+ t26 = 0,
+ t27 = 0,
+ t28 = 0,
+ t29 = 0,
+ t30 = 0,
+ b0 = b[0],
+ b1 = b[1],
+ b2 = b[2],
+ b3 = b[3],
+ b4 = b[4],
+ b5 = b[5],
+ b6 = b[6],
+ b7 = b[7],
+ b8 = b[8],
+ b9 = b[9],
+ b10 = b[10],
+ b11 = b[11],
+ b12 = b[12],
+ b13 = b[13],
+ b14 = b[14],
+ b15 = b[15];
+
+ v = a[0];
+ t0 += v * b0;
+ t1 += v * b1;
+ t2 += v * b2;
+ t3 += v * b3;
+ t4 += v * b4;
+ t5 += v * b5;
+ t6 += v * b6;
+ t7 += v * b7;
+ t8 += v * b8;
+ t9 += v * b9;
+ t10 += v * b10;
+ t11 += v * b11;
+ t12 += v * b12;
+ t13 += v * b13;
+ t14 += v * b14;
+ t15 += v * b15;
+ v = a[1];
+ t1 += v * b0;
+ t2 += v * b1;
+ t3 += v * b2;
+ t4 += v * b3;
+ t5 += v * b4;
+ t6 += v * b5;
+ t7 += v * b6;
+ t8 += v * b7;
+ t9 += v * b8;
+ t10 += v * b9;
+ t11 += v * b10;
+ t12 += v * b11;
+ t13 += v * b12;
+ t14 += v * b13;
+ t15 += v * b14;
+ t16 += v * b15;
+ v = a[2];
+ t2 += v * b0;
+ t3 += v * b1;
+ t4 += v * b2;
+ t5 += v * b3;
+ t6 += v * b4;
+ t7 += v * b5;
+ t8 += v * b6;
+ t9 += v * b7;
+ t10 += v * b8;
+ t11 += v * b9;
+ t12 += v * b10;
+ t13 += v * b11;
+ t14 += v * b12;
+ t15 += v * b13;
+ t16 += v * b14;
+ t17 += v * b15;
+ v = a[3];
+ t3 += v * b0;
+ t4 += v * b1;
+ t5 += v * b2;
+ t6 += v * b3;
+ t7 += v * b4;
+ t8 += v * b5;
+ t9 += v * b6;
+ t10 += v * b7;
+ t11 += v * b8;
+ t12 += v * b9;
+ t13 += v * b10;
+ t14 += v * b11;
+ t15 += v * b12;
+ t16 += v * b13;
+ t17 += v * b14;
+ t18 += v * b15;
+ v = a[4];
+ t4 += v * b0;
+ t5 += v * b1;
+ t6 += v * b2;
+ t7 += v * b3;
+ t8 += v * b4;
+ t9 += v * b5;
+ t10 += v * b6;
+ t11 += v * b7;
+ t12 += v * b8;
+ t13 += v * b9;
+ t14 += v * b10;
+ t15 += v * b11;
+ t16 += v * b12;
+ t17 += v * b13;
+ t18 += v * b14;
+ t19 += v * b15;
+ v = a[5];
+ t5 += v * b0;
+ t6 += v * b1;
+ t7 += v * b2;
+ t8 += v * b3;
+ t9 += v * b4;
+ t10 += v * b5;
+ t11 += v * b6;
+ t12 += v * b7;
+ t13 += v * b8;
+ t14 += v * b9;
+ t15 += v * b10;
+ t16 += v * b11;
+ t17 += v * b12;
+ t18 += v * b13;
+ t19 += v * b14;
+ t20 += v * b15;
+ v = a[6];
+ t6 += v * b0;
+ t7 += v * b1;
+ t8 += v * b2;
+ t9 += v * b3;
+ t10 += v * b4;
+ t11 += v * b5;
+ t12 += v * b6;
+ t13 += v * b7;
+ t14 += v * b8;
+ t15 += v * b9;
+ t16 += v * b10;
+ t17 += v * b11;
+ t18 += v * b12;
+ t19 += v * b13;
+ t20 += v * b14;
+ t21 += v * b15;
+ v = a[7];
+ t7 += v * b0;
+ t8 += v * b1;
+ t9 += v * b2;
+ t10 += v * b3;
+ t11 += v * b4;
+ t12 += v * b5;
+ t13 += v * b6;
+ t14 += v * b7;
+ t15 += v * b8;
+ t16 += v * b9;
+ t17 += v * b10;
+ t18 += v * b11;
+ t19 += v * b12;
+ t20 += v * b13;
+ t21 += v * b14;
+ t22 += v * b15;
+ v = a[8];
+ t8 += v * b0;
+ t9 += v * b1;
+ t10 += v * b2;
+ t11 += v * b3;
+ t12 += v * b4;
+ t13 += v * b5;
+ t14 += v * b6;
+ t15 += v * b7;
+ t16 += v * b8;
+ t17 += v * b9;
+ t18 += v * b10;
+ t19 += v * b11;
+ t20 += v * b12;
+ t21 += v * b13;
+ t22 += v * b14;
+ t23 += v * b15;
+ v = a[9];
+ t9 += v * b0;
+ t10 += v * b1;
+ t11 += v * b2;
+ t12 += v * b3;
+ t13 += v * b4;
+ t14 += v * b5;
+ t15 += v * b6;
+ t16 += v * b7;
+ t17 += v * b8;
+ t18 += v * b9;
+ t19 += v * b10;
+ t20 += v * b11;
+ t21 += v * b12;
+ t22 += v * b13;
+ t23 += v * b14;
+ t24 += v * b15;
+ v = a[10];
+ t10 += v * b0;
+ t11 += v * b1;
+ t12 += v * b2;
+ t13 += v * b3;
+ t14 += v * b4;
+ t15 += v * b5;
+ t16 += v * b6;
+ t17 += v * b7;
+ t18 += v * b8;
+ t19 += v * b9;
+ t20 += v * b10;
+ t21 += v * b11;
+ t22 += v * b12;
+ t23 += v * b13;
+ t24 += v * b14;
+ t25 += v * b15;
+ v = a[11];
+ t11 += v * b0;
+ t12 += v * b1;
+ t13 += v * b2;
+ t14 += v * b3;
+ t15 += v * b4;
+ t16 += v * b5;
+ t17 += v * b6;
+ t18 += v * b7;
+ t19 += v * b8;
+ t20 += v * b9;
+ t21 += v * b10;
+ t22 += v * b11;
+ t23 += v * b12;
+ t24 += v * b13;
+ t25 += v * b14;
+ t26 += v * b15;
+ v = a[12];
+ t12 += v * b0;
+ t13 += v * b1;
+ t14 += v * b2;
+ t15 += v * b3;
+ t16 += v * b4;
+ t17 += v * b5;
+ t18 += v * b6;
+ t19 += v * b7;
+ t20 += v * b8;
+ t21 += v * b9;
+ t22 += v * b10;
+ t23 += v * b11;
+ t24 += v * b12;
+ t25 += v * b13;
+ t26 += v * b14;
+ t27 += v * b15;
+ v = a[13];
+ t13 += v * b0;
+ t14 += v * b1;
+ t15 += v * b2;
+ t16 += v * b3;
+ t17 += v * b4;
+ t18 += v * b5;
+ t19 += v * b6;
+ t20 += v * b7;
+ t21 += v * b8;
+ t22 += v * b9;
+ t23 += v * b10;
+ t24 += v * b11;
+ t25 += v * b12;
+ t26 += v * b13;
+ t27 += v * b14;
+ t28 += v * b15;
+ v = a[14];
+ t14 += v * b0;
+ t15 += v * b1;
+ t16 += v * b2;
+ t17 += v * b3;
+ t18 += v * b4;
+ t19 += v * b5;
+ t20 += v * b6;
+ t21 += v * b7;
+ t22 += v * b8;
+ t23 += v * b9;
+ t24 += v * b10;
+ t25 += v * b11;
+ t26 += v * b12;
+ t27 += v * b13;
+ t28 += v * b14;
+ t29 += v * b15;
+ v = a[15];
+ t15 += v * b0;
+ t16 += v * b1;
+ t17 += v * b2;
+ t18 += v * b3;
+ t19 += v * b4;
+ t20 += v * b5;
+ t21 += v * b6;
+ t22 += v * b7;
+ t23 += v * b8;
+ t24 += v * b9;
+ t25 += v * b10;
+ t26 += v * b11;
+ t27 += v * b12;
+ t28 += v * b13;
+ t29 += v * b14;
+ t30 += v * b15;
+
+ t0 += 38 * t16;
+ t1 += 38 * t17;
+ t2 += 38 * t18;
+ t3 += 38 * t19;
+ t4 += 38 * t20;
+ t5 += 38 * t21;
+ t6 += 38 * t22;
+ t7 += 38 * t23;
+ t8 += 38 * t24;
+ t9 += 38 * t25;
+ t10 += 38 * t26;
+ t11 += 38 * t27;
+ t12 += 38 * t28;
+ t13 += 38 * t29;
+ t14 += 38 * t30;
+ // t15 left as is
+
+ // first car
+ c = 1;
+ v = t0 + c + 65535;
+ c = Math.floor(v / 65536);
+ t0 = v - c * 65536;
+ v = t1 + c + 65535;
+ c = Math.floor(v / 65536);
+ t1 = v - c * 65536;
+ v = t2 + c + 65535;
+ c = Math.floor(v / 65536);
+ t2 = v - c * 65536;
+ v = t3 + c + 65535;
+ c = Math.floor(v / 65536);
+ t3 = v - c * 65536;
+ v = t4 + c + 65535;
+ c = Math.floor(v / 65536);
+ t4 = v - c * 65536;
+ v = t5 + c + 65535;
+ c = Math.floor(v / 65536);
+ t5 = v - c * 65536;
+ v = t6 + c + 65535;
+ c = Math.floor(v / 65536);
+ t6 = v - c * 65536;
+ v = t7 + c + 65535;
+ c = Math.floor(v / 65536);
+ t7 = v - c * 65536;
+ v = t8 + c + 65535;
+ c = Math.floor(v / 65536);
+ t8 = v - c * 65536;
+ v = t9 + c + 65535;
+ c = Math.floor(v / 65536);
+ t9 = v - c * 65536;
+ v = t10 + c + 65535;
+ c = Math.floor(v / 65536);
+ t10 = v - c * 65536;
+ v = t11 + c + 65535;
+ c = Math.floor(v / 65536);
+ t11 = v - c * 65536;
+ v = t12 + c + 65535;
+ c = Math.floor(v / 65536);
+ t12 = v - c * 65536;
+ v = t13 + c + 65535;
+ c = Math.floor(v / 65536);
+ t13 = v - c * 65536;
+ v = t14 + c + 65535;
+ c = Math.floor(v / 65536);
+ t14 = v - c * 65536;
+ v = t15 + c + 65535;
+ c = Math.floor(v / 65536);
+ t15 = v - c * 65536;
+ t0 += c - 1 + 37 * (c - 1);
+
+ // second car
+ c = 1;
+ v = t0 + c + 65535;
+ c = Math.floor(v / 65536);
+ t0 = v - c * 65536;
+ v = t1 + c + 65535;
+ c = Math.floor(v / 65536);
+ t1 = v - c * 65536;
+ v = t2 + c + 65535;
+ c = Math.floor(v / 65536);
+ t2 = v - c * 65536;
+ v = t3 + c + 65535;
+ c = Math.floor(v / 65536);
+ t3 = v - c * 65536;
+ v = t4 + c + 65535;
+ c = Math.floor(v / 65536);
+ t4 = v - c * 65536;
+ v = t5 + c + 65535;
+ c = Math.floor(v / 65536);
+ t5 = v - c * 65536;
+ v = t6 + c + 65535;
+ c = Math.floor(v / 65536);
+ t6 = v - c * 65536;
+ v = t7 + c + 65535;
+ c = Math.floor(v / 65536);
+ t7 = v - c * 65536;
+ v = t8 + c + 65535;
+ c = Math.floor(v / 65536);
+ t8 = v - c * 65536;
+ v = t9 + c + 65535;
+ c = Math.floor(v / 65536);
+ t9 = v - c * 65536;
+ v = t10 + c + 65535;
+ c = Math.floor(v / 65536);
+ t10 = v - c * 65536;
+ v = t11 + c + 65535;
+ c = Math.floor(v / 65536);
+ t11 = v - c * 65536;
+ v = t12 + c + 65535;
+ c = Math.floor(v / 65536);
+ t12 = v - c * 65536;
+ v = t13 + c + 65535;
+ c = Math.floor(v / 65536);
+ t13 = v - c * 65536;
+ v = t14 + c + 65535;
+ c = Math.floor(v / 65536);
+ t14 = v - c * 65536;
+ v = t15 + c + 65535;
+ c = Math.floor(v / 65536);
+ t15 = v - c * 65536;
+ t0 += c - 1 + 37 * (c - 1);
+
+ o[0] = t0;
+ o[1] = t1;
+ o[2] = t2;
+ o[3] = t3;
+ o[4] = t4;
+ o[5] = t5;
+ o[6] = t6;
+ o[7] = t7;
+ o[8] = t8;
+ o[9] = t9;
+ o[10] = t10;
+ o[11] = t11;
+ o[12] = t12;
+ o[13] = t13;
+ o[14] = t14;
+ o[15] = t15;
+}
+
+function S(o: Float64Array, a: Float64Array) {
+ M(o, a, a);
+}
+
+function inv25519(o: Float64Array, i: Float64Array) {
+ var c = gf();
+ var a;
+ for (a = 0; a < 16; a++) c[a] = i[a];
+ for (a = 253; a >= 0; a--) {
+ S(c, c);
+ if (a !== 2 && a !== 4) M(c, c, i);
+ }
+ for (a = 0; a < 16; a++) o[a] = c[a];
+}
+
+function pow2523(o: Float64Array, i: Float64Array) {
+ var c = gf();
+ var a;
+ for (a = 0; a < 16; a++) c[a] = i[a];
+ for (a = 250; a >= 0; a--) {
+ S(c, c);
+ if (a !== 1) M(c, c, i);
+ }
+ for (a = 0; a < 16; a++) o[a] = c[a];
+}
+
+function crypto_scalarmult(q: Uint8Array, n: Uint8Array, p: Uint8Array) {
+ var z = new Uint8Array(32);
+ var x = new Float64Array(80),
+ r,
+ i;
+ var a = gf(),
+ b = gf(),
+ c = gf(),
+ d = gf(),
+ e = gf(),
+ f = gf();
+ for (i = 0; i < 31; i++) z[i] = n[i];
+ z[31] = (n[31] & 127) | 64;
+ z[0] &= 248;
+ unpack25519(x, p);
+ for (i = 0; i < 16; i++) {
+ b[i] = x[i];
+ d[i] = a[i] = c[i] = 0;
+ }
+ a[0] = d[0] = 1;
+ for (i = 254; i >= 0; --i) {
+ r = (z[i >>> 3] >>> (i & 7)) & 1;
+ sel25519(a, b, r);
+ sel25519(c, d, r);
+ A(e, a, c);
+ Z(a, a, c);
+ A(c, b, d);
+ Z(b, b, d);
+ S(d, e);
+ S(f, a);
+ M(a, c, a);
+ M(c, b, e);
+ A(e, a, c);
+ Z(a, a, c);
+ S(b, a);
+ Z(c, d, f);
+ M(a, c, _121665);
+ A(a, a, d);
+ M(c, c, a);
+ M(a, d, f);
+ M(d, b, x);
+ S(b, e);
+ sel25519(a, b, r);
+ sel25519(c, d, r);
+ }
+ for (i = 0; i < 16; i++) {
+ x[i + 16] = a[i];
+ x[i + 32] = c[i];
+ x[i + 48] = b[i];
+ x[i + 64] = d[i];
+ }
+ var x32 = x.subarray(32);
+ var x16 = x.subarray(16);
+ inv25519(x32, x32);
+ M(x16, x16, x32);
+ pack25519(q, x16);
+ return 0;
+}
+
+function crypto_scalarmult_base(q: Uint8Array, n: Uint8Array) {
+ return crypto_scalarmult(q, n, _9);
+}
+
+function crypto_box_keypair(y: Uint8Array, x: Uint8Array) {
+ randombytes(x, 32);
+ return crypto_scalarmult_base(y, x);
+}
+
+function crypto_box_beforenm(k: Uint8Array, y: Uint8Array, x: Uint8Array) {
+ var s = new Uint8Array(32);
+ crypto_scalarmult(s, x, y);
+ return crypto_core_hsalsa20(k, _0, s, sigma);
+}
+
+var crypto_box_afternm = crypto_secretbox;
+var crypto_box_open_afternm = crypto_secretbox_open;
+
+function crypto_box(
+ c: Uint8Array,
+ m: Uint8Array,
+ d: number,
+ n: Uint8Array,
+ y: Uint8Array,
+ x: Uint8Array,
+) {
+ var k = new Uint8Array(32);
+ crypto_box_beforenm(k, y, x);
+ return crypto_box_afternm(c, m, d, n, k);
+}
+
+function crypto_box_open(
+ m: Uint8Array,
+ c: Uint8Array,
+ d: number,
+ n: Uint8Array,
+ y: Uint8Array,
+ x: Uint8Array,
+) {
+ var k = new Uint8Array(32);
+ crypto_box_beforenm(k, y, x);
+ return crypto_box_open_afternm(m, c, d, n, k);
+}
+
+// prettier-ignore
+var K = [
+ 0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd,
+ 0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc,
+ 0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019,
+ 0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118,
+ 0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe,
+ 0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2,
+ 0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1,
+ 0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694,
+ 0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3,
+ 0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65,
+ 0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483,
+ 0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5,
+ 0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210,
+ 0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4,
+ 0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725,
+ 0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70,
+ 0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926,
+ 0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df,
+ 0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8,
+ 0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b,
+ 0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001,
+ 0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30,
+ 0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910,
+ 0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8,
+ 0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53,
+ 0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8,
+ 0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb,
+ 0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3,
+ 0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60,
+ 0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec,
+ 0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9,
+ 0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b,
+ 0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207,
+ 0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178,
+ 0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6,
+ 0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b,
+ 0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493,
+ 0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c,
+ 0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a,
+ 0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817
+];
+
+function crypto_hashblocks_hl(
+ hh: Int32Array,
+ hl: Int32Array,
+ m: Uint8Array,
+ n: number,
+) {
+ var wh = new Int32Array(16),
+ wl = new Int32Array(16),
+ bh0,
+ bh1,
+ bh2,
+ bh3,
+ bh4,
+ bh5,
+ bh6,
+ bh7,
+ bl0,
+ bl1,
+ bl2,
+ bl3,
+ bl4,
+ bl5,
+ bl6,
+ bl7,
+ th,
+ tl,
+ i,
+ j,
+ h,
+ l,
+ a,
+ b,
+ c,
+ d;
+
+ var ah0 = hh[0],
+ ah1 = hh[1],
+ ah2 = hh[2],
+ ah3 = hh[3],
+ ah4 = hh[4],
+ ah5 = hh[5],
+ ah6 = hh[6],
+ ah7 = hh[7],
+ al0 = hl[0],
+ al1 = hl[1],
+ al2 = hl[2],
+ al3 = hl[3],
+ al4 = hl[4],
+ al5 = hl[5],
+ al6 = hl[6],
+ al7 = hl[7];
+
+ var pos = 0;
+ while (n >= 128) {
+ for (i = 0; i < 16; i++) {
+ j = 8 * i + pos;
+ wh[i] = (m[j + 0] << 24) | (m[j + 1] << 16) | (m[j + 2] << 8) | m[j + 3];
+ wl[i] = (m[j + 4] << 24) | (m[j + 5] << 16) | (m[j + 6] << 8) | m[j + 7];
+ }
+ for (i = 0; i < 80; i++) {
+ bh0 = ah0;
+ bh1 = ah1;
+ bh2 = ah2;
+ bh3 = ah3;
+ bh4 = ah4;
+ bh5 = ah5;
+ bh6 = ah6;
+ bh7 = ah7;
+
+ bl0 = al0;
+ bl1 = al1;
+ bl2 = al2;
+ bl3 = al3;
+ bl4 = al4;
+ bl5 = al5;
+ bl6 = al6;
+ bl7 = al7;
+
+ // add
+ h = ah7;
+ l = al7;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ // Sigma1
+ h =
+ ((ah4 >>> 14) | (al4 << (32 - 14))) ^
+ ((ah4 >>> 18) | (al4 << (32 - 18))) ^
+ ((al4 >>> (41 - 32)) | (ah4 << (32 - (41 - 32))));
+ l =
+ ((al4 >>> 14) | (ah4 << (32 - 14))) ^
+ ((al4 >>> 18) | (ah4 << (32 - 18))) ^
+ ((ah4 >>> (41 - 32)) | (al4 << (32 - (41 - 32))));
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ // Ch
+ h = (ah4 & ah5) ^ (~ah4 & ah6);
+ l = (al4 & al5) ^ (~al4 & al6);
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ // K
+ h = K[i * 2];
+ l = K[i * 2 + 1];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ // w
+ h = wh[i % 16];
+ l = wl[i % 16];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ th = (c & 0xffff) | (d << 16);
+ tl = (a & 0xffff) | (b << 16);
+
+ // add
+ h = th;
+ l = tl;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ // Sigma0
+ h =
+ ((ah0 >>> 28) | (al0 << (32 - 28))) ^
+ ((al0 >>> (34 - 32)) | (ah0 << (32 - (34 - 32)))) ^
+ ((al0 >>> (39 - 32)) | (ah0 << (32 - (39 - 32))));
+ l =
+ ((al0 >>> 28) | (ah0 << (32 - 28))) ^
+ ((ah0 >>> (34 - 32)) | (al0 << (32 - (34 - 32)))) ^
+ ((ah0 >>> (39 - 32)) | (al0 << (32 - (39 - 32))));
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ // Maj
+ h = (ah0 & ah1) ^ (ah0 & ah2) ^ (ah1 & ah2);
+ l = (al0 & al1) ^ (al0 & al2) ^ (al1 & al2);
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ bh7 = (c & 0xffff) | (d << 16);
+ bl7 = (a & 0xffff) | (b << 16);
+
+ // add
+ h = bh3;
+ l = bl3;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ h = th;
+ l = tl;
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ bh3 = (c & 0xffff) | (d << 16);
+ bl3 = (a & 0xffff) | (b << 16);
+
+ ah1 = bh0;
+ ah2 = bh1;
+ ah3 = bh2;
+ ah4 = bh3;
+ ah5 = bh4;
+ ah6 = bh5;
+ ah7 = bh6;
+ ah0 = bh7;
+
+ al1 = bl0;
+ al2 = bl1;
+ al3 = bl2;
+ al4 = bl3;
+ al5 = bl4;
+ al6 = bl5;
+ al7 = bl6;
+ al0 = bl7;
+
+ if (i % 16 === 15) {
+ for (j = 0; j < 16; j++) {
+ // add
+ h = wh[j];
+ l = wl[j];
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ h = wh[(j + 9) % 16];
+ l = wl[(j + 9) % 16];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ // sigma0
+ th = wh[(j + 1) % 16];
+ tl = wl[(j + 1) % 16];
+ h =
+ ((th >>> 1) | (tl << (32 - 1))) ^
+ ((th >>> 8) | (tl << (32 - 8))) ^
+ (th >>> 7);
+ l =
+ ((tl >>> 1) | (th << (32 - 1))) ^
+ ((tl >>> 8) | (th << (32 - 8))) ^
+ ((tl >>> 7) | (th << (32 - 7)));
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ // sigma1
+ th = wh[(j + 14) % 16];
+ tl = wl[(j + 14) % 16];
+ h =
+ ((th >>> 19) | (tl << (32 - 19))) ^
+ ((tl >>> (61 - 32)) | (th << (32 - (61 - 32)))) ^
+ (th >>> 6);
+ l =
+ ((tl >>> 19) | (th << (32 - 19))) ^
+ ((th >>> (61 - 32)) | (tl << (32 - (61 - 32)))) ^
+ ((tl >>> 6) | (th << (32 - 6)));
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ wh[j] = (c & 0xffff) | (d << 16);
+ wl[j] = (a & 0xffff) | (b << 16);
+ }
+ }
+ }
+
+ // add
+ h = ah0;
+ l = al0;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ h = hh[0];
+ l = hl[0];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ hh[0] = ah0 = (c & 0xffff) | (d << 16);
+ hl[0] = al0 = (a & 0xffff) | (b << 16);
+
+ h = ah1;
+ l = al1;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ h = hh[1];
+ l = hl[1];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ hh[1] = ah1 = (c & 0xffff) | (d << 16);
+ hl[1] = al1 = (a & 0xffff) | (b << 16);
+
+ h = ah2;
+ l = al2;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ h = hh[2];
+ l = hl[2];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ hh[2] = ah2 = (c & 0xffff) | (d << 16);
+ hl[2] = al2 = (a & 0xffff) | (b << 16);
+
+ h = ah3;
+ l = al3;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ h = hh[3];
+ l = hl[3];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ hh[3] = ah3 = (c & 0xffff) | (d << 16);
+ hl[3] = al3 = (a & 0xffff) | (b << 16);
+
+ h = ah4;
+ l = al4;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ h = hh[4];
+ l = hl[4];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ hh[4] = ah4 = (c & 0xffff) | (d << 16);
+ hl[4] = al4 = (a & 0xffff) | (b << 16);
+
+ h = ah5;
+ l = al5;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ h = hh[5];
+ l = hl[5];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ hh[5] = ah5 = (c & 0xffff) | (d << 16);
+ hl[5] = al5 = (a & 0xffff) | (b << 16);
+
+ h = ah6;
+ l = al6;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ h = hh[6];
+ l = hl[6];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ hh[6] = ah6 = (c & 0xffff) | (d << 16);
+ hl[6] = al6 = (a & 0xffff) | (b << 16);
+
+ h = ah7;
+ l = al7;
+
+ a = l & 0xffff;
+ b = l >>> 16;
+ c = h & 0xffff;
+ d = h >>> 16;
+
+ h = hh[7];
+ l = hl[7];
+
+ a += l & 0xffff;
+ b += l >>> 16;
+ c += h & 0xffff;
+ d += h >>> 16;
+
+ b += a >>> 16;
+ c += b >>> 16;
+ d += c >>> 16;
+
+ hh[7] = ah7 = (c & 0xffff) | (d << 16);
+ hl[7] = al7 = (a & 0xffff) | (b << 16);
+
+ pos += 128;
+ n -= 128;
+ }
+
+ return n;
+}
+
+function crypto_hash(out: Uint8Array, m: Uint8Array, n: number) {
+ const hh = new Int32Array(8);
+ const hl = new Int32Array(8);
+ const x = new Uint8Array(256);
+ let b = n;
+
+ hh[0] = 0x6a09e667;
+ hh[1] = 0xbb67ae85;
+ hh[2] = 0x3c6ef372;
+ hh[3] = 0xa54ff53a;
+ hh[4] = 0x510e527f;
+ hh[5] = 0x9b05688c;
+ hh[6] = 0x1f83d9ab;
+ hh[7] = 0x5be0cd19;
+
+ hl[0] = 0xf3bcc908;
+ hl[1] = 0x84caa73b;
+ hl[2] = 0xfe94f82b;
+ hl[3] = 0x5f1d36f1;
+ hl[4] = 0xade682d1;
+ hl[5] = 0x2b3e6c1f;
+ hl[6] = 0xfb41bd6b;
+ hl[7] = 0x137e2179;
+
+ crypto_hashblocks_hl(hh, hl, m, n);
+ n %= 128;
+
+ for (let i = 0; i < n; i++) x[i] = m[b - n + i];
+ x[n] = 128;
+
+ n = 256 - 128 * (n < 112 ? 1 : 0);
+ x[n - 9] = 0;
+ ts64(x, n - 8, (b / 0x20000000) | 0, b << 3);
+ crypto_hashblocks_hl(hh, hl, x, n);
+
+ for (let i = 0; i < 8; i++)
+ ts64(out, 8 * i, hh[i], hl[i]);
+
+ return 0;
+}
+
+
+/**
+ * Incremental version of crypto_hash.
+ */
+export class HashState {
+ private hh = new Int32Array(8);
+ private hl = new Int32Array(8);
+
+ private next = new Uint8Array(128);
+ private p = 0;
+ private total = 0;
+
+ constructor() {
+ this.hh[0] = 0x6a09e667;
+ this.hh[1] = 0xbb67ae85;
+ this.hh[2] = 0x3c6ef372;
+ this.hh[3] = 0xa54ff53a;
+ this.hh[4] = 0x510e527f;
+ this.hh[5] = 0x9b05688c;
+ this.hh[6] = 0x1f83d9ab;
+ this.hh[7] = 0x5be0cd19;
+
+ this.hl[0] = 0xf3bcc908;
+ this.hl[1] = 0x84caa73b;
+ this.hl[2] = 0xfe94f82b;
+ this.hl[3] = 0x5f1d36f1;
+ this.hl[4] = 0xade682d1;
+ this.hl[5] = 0x2b3e6c1f;
+ this.hl[6] = 0xfb41bd6b;
+ this.hl[7] = 0x137e2179;
+ }
+
+ update(data: Uint8Array): HashState {
+ this.total += data.length;
+ let i = 0;
+ while (i < data.length) {
+ const r = 128 - this.p;
+ if (r > (data.length - i)) {
+ for (let j = 0; i + j < data.length; j++) {
+ this.next[this.p + j] = data[i + j];
+ }
+ this.p += data.length - i;
+ break;
+ } else {
+ for (let j = 0; this.p + j < 128; j++) {
+ this.next[this.p + j] = data[i + j];
+ }
+ crypto_hashblocks_hl(this.hh, this.hl, this.next, 128);
+ i += 128 - this.p;
+ this.p = 0;
+ }
+ }
+ return this;
+ }
+
+ finish(): Uint8Array {
+ const out = new Uint8Array(64);
+ let n = this.p;
+ const x = new Uint8Array(256);
+ let b = this.total;
+ for (let i = 0; i < n; i++) x[i] = this.next[i];
+ x[n] = 128;
+
+ n = 256 - 128 * (n < 112 ? 1 : 0);
+ x[n - 9] = 0;
+ ts64(x, n - 8, (b / 0x20000000) | 0, b << 3);
+ crypto_hashblocks_hl(this.hh, this.hl, x, n);
+
+ for (let i = 0; i < 8; i++)
+ ts64(out, 8 * i, this.hh[i], this.hl[i]);
+ return out;
+ }
+}
+
+function add(p: Float64Array[], q: Float64Array[]) {
+ var a = gf(),
+ b = gf(),
+ c = gf(),
+ d = gf(),
+ e = gf(),
+ f = gf(),
+ g = gf(),
+ h = gf(),
+ t = gf();
+
+ Z(a, p[1], p[0]);
+ Z(t, q[1], q[0]);
+ M(a, a, t);
+ A(b, p[0], p[1]);
+ A(t, q[0], q[1]);
+ M(b, b, t);
+ M(c, p[3], q[3]);
+ M(c, c, D2);
+ M(d, p[2], q[2]);
+ A(d, d, d);
+ Z(e, b, a);
+ Z(f, d, c);
+ A(g, d, c);
+ A(h, b, a);
+
+ M(p[0], e, f);
+ M(p[1], h, g);
+ M(p[2], g, f);
+ M(p[3], e, h);
+}
+
+function cswap(p: Float64Array[], q: Float64Array[], b: number) {
+ var i;
+ for (i = 0; i < 4; i++) {
+ sel25519(p[i], q[i], b);
+ }
+}
+
+function pack(r: Uint8Array, p: Float64Array[]) {
+ var tx = gf(),
+ ty = gf(),
+ zi = gf();
+ inv25519(zi, p[2]);
+ M(tx, p[0], zi);
+ M(ty, p[1], zi);
+ pack25519(r, ty);
+ r[31] ^= par25519(tx) << 7;
+}
+
+function scalarmult(p: Float64Array[], q: Float64Array[], s: Uint8Array) {
+ var b, i;
+ set25519(p[0], gf0);
+ set25519(p[1], gf1);
+ set25519(p[2], gf1);
+ set25519(p[3], gf0);
+ for (i = 255; i >= 0; --i) {
+ b = (s[(i / 8) | 0] >> (i & 7)) & 1;
+ cswap(p, q, b);
+ add(q, p);
+ add(p, p);
+ cswap(p, q, b);
+ }
+}
+
+function scalarbase(p: Float64Array[], s: Uint8Array) {
+ const q = [gf(), gf(), gf(), gf()];
+ set25519(q[0], X);
+ set25519(q[1], Y);
+ set25519(q[2], gf1);
+ M(q[3], X, Y);
+ scalarmult(p, q, s);
+}
+
+function crypto_sign_keypair(
+ pk: Uint8Array,
+ sk: Uint8Array,
+ seeded: boolean,
+): number {
+ const d = new Uint8Array(64);
+ const p = [gf(), gf(), gf(), gf()];
+
+ if (!seeded) randombytes(sk, 32);
+ crypto_hash(d, sk, 32);
+ d[0] &= 248;
+ d[31] &= 127;
+ d[31] |= 64;
+
+ scalarbase(p, d);
+ pack(pk, p);
+
+ for (let i = 0; i < 32; i++) sk[i + 32] = pk[i];
+ return 0;
+}
+
+var L = new Float64Array([
+ 0xed,
+ 0xd3,
+ 0xf5,
+ 0x5c,
+ 0x1a,
+ 0x63,
+ 0x12,
+ 0x58,
+ 0xd6,
+ 0x9c,
+ 0xf7,
+ 0xa2,
+ 0xde,
+ 0xf9,
+ 0xde,
+ 0x14,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0,
+ 0x10,
+]);
+
+function modL(r: Uint8Array, x: Float64Array) {
+ var carry, i, j, k;
+ for (i = 63; i >= 32; --i) {
+ carry = 0;
+ for (j = i - 32, k = i - 12; j < k; ++j) {
+ x[j] += carry - 16 * x[i] * L[j - (i - 32)];
+ carry = (x[j] + 128) >> 8;
+ x[j] -= carry * 256;
+ }
+ x[j] += carry;
+ x[i] = 0;
+ }
+ carry = 0;
+ for (j = 0; j < 32; j++) {
+ x[j] += carry - (x[31] >> 4) * L[j];
+ carry = x[j] >> 8;
+ x[j] &= 255;
+ }
+ for (j = 0; j < 32; j++) x[j] -= carry * L[j];
+ for (i = 0; i < 32; i++) {
+ x[i + 1] += x[i] >> 8;
+ r[i] = x[i] & 255;
+ }
+}
+
+function reduce(r: Uint8Array) {
+ const x = new Float64Array(64);
+ for (let i = 0; i < 64; i++) x[i] = r[i];
+ for (let i = 0; i < 64; i++) r[i] = 0;
+ modL(r, x);
+}
+
+// Note: difference from C - smlen returned, not passed as argument.
+function crypto_sign(sm: Uint8Array, m: Uint8Array, n: number, sk: Uint8Array) {
+ var d = new Uint8Array(64),
+ h = new Uint8Array(64),
+ r = new Uint8Array(64);
+ var i,
+ j,
+ x = new Float64Array(64);
+ var p = [gf(), gf(), gf(), gf()];
+
+ crypto_hash(d, sk, 32);
+ d[0] &= 248;
+ d[31] &= 127;
+ d[31] |= 64;
+
+ var smlen = n + 64;
+ for (i = 0; i < n; i++) sm[64 + i] = m[i];
+ for (i = 0; i < 32; i++) sm[32 + i] = d[32 + i];
+
+ crypto_hash(r, sm.subarray(32), n + 32);
+ reduce(r);
+ scalarbase(p, r);
+ pack(sm, p);
+
+ for (i = 32; i < 64; i++) sm[i] = sk[i];
+ crypto_hash(h, sm, n + 64);
+ reduce(h);
+
+ for (i = 0; i < 64; i++) x[i] = 0;
+ for (i = 0; i < 32; i++) x[i] = r[i];
+ for (i = 0; i < 32; i++) {
+ for (j = 0; j < 32; j++) {
+ x[i + j] += h[i] * d[j];
+ }
+ }
+
+ modL(sm.subarray(32), x);
+ return smlen;
+}
+
+function unpackneg(r: Float64Array[], p: Uint8Array) {
+ const t = gf();
+ const chk = gf();
+ const num = gf();
+ const den = gf();
+ const den2 = gf();
+ const den4 = gf();
+ const den6 = gf();
+
+ set25519(r[2], gf1);
+ unpack25519(r[1], p);
+ S(num, r[1]);
+ M(den, num, D);
+ Z(num, num, r[2]);
+ A(den, r[2], den);
+
+ S(den2, den);
+ S(den4, den2);
+ M(den6, den4, den2);
+ M(t, den6, num);
+ M(t, t, den);
+
+ pow2523(t, t);
+ M(t, t, num);
+ M(t, t, den);
+ M(t, t, den);
+ M(r[0], t, den);
+
+ S(chk, r[0]);
+ M(chk, chk, den);
+ if (neq25519(chk, num)) M(r[0], r[0], I);
+
+ S(chk, r[0]);
+ M(chk, chk, den);
+ if (neq25519(chk, num)) return -1;
+
+ if (par25519(r[0]) === p[31] >> 7) Z(r[0], gf0, r[0]);
+
+ M(r[3], r[0], r[1]);
+ return 0;
+}
+
+function crypto_sign_open(
+ m: Uint8Array,
+ sm: Uint8Array,
+ n: number,
+ pk: Uint8Array,
+) {
+ var i, mlen;
+ var t = new Uint8Array(32),
+ h = new Uint8Array(64);
+ var p = [gf(), gf(), gf(), gf()],
+ q = [gf(), gf(), gf(), gf()];
+
+ mlen = -1;
+ if (n < 64) return -1;
+
+ if (unpackneg(q, pk)) return -1;
+
+ for (i = 0; i < n; i++) m[i] = sm[i];
+ for (i = 0; i < 32; i++) m[i + 32] = pk[i];
+ crypto_hash(h, m, n);
+ reduce(h);
+ scalarmult(p, q, h);
+
+ scalarbase(q, sm.subarray(32));
+ add(p, q);
+ pack(t, p);
+
+ n -= 64;
+ if (crypto_verify_32(sm, 0, t, 0)) {
+ for (i = 0; i < n; i++) m[i] = 0;
+ return -1;
+ }
+
+ for (i = 0; i < n; i++) m[i] = sm[i + 64];
+ mlen = n;
+ return mlen;
+}
+
+var crypto_secretbox_KEYBYTES = 32,
+ crypto_secretbox_NONCEBYTES = 24,
+ crypto_secretbox_ZEROBYTES = 32,
+ crypto_secretbox_BOXZEROBYTES = 16,
+ crypto_scalarmult_BYTES = 32,
+ crypto_scalarmult_SCALARBYTES = 32,
+ crypto_box_PUBLICKEYBYTES = 32,
+ crypto_box_SECRETKEYBYTES = 32,
+ crypto_box_BEFORENMBYTES = 32,
+ crypto_box_NONCEBYTES = crypto_secretbox_NONCEBYTES,
+ crypto_box_ZEROBYTES = crypto_secretbox_ZEROBYTES,
+ crypto_box_BOXZEROBYTES = crypto_secretbox_BOXZEROBYTES,
+ crypto_sign_BYTES = 64,
+ crypto_sign_PUBLICKEYBYTES = 32,
+ crypto_sign_SECRETKEYBYTES = 64,
+ crypto_sign_SEEDBYTES = 32,
+ crypto_hash_BYTES = 64;
+
+const lowlevel = {
+ crypto_core_hsalsa20: crypto_core_hsalsa20,
+ crypto_stream_xor: crypto_stream_xor,
+ crypto_stream: crypto_stream,
+ crypto_stream_salsa20_xor: crypto_stream_salsa20_xor,
+ crypto_stream_salsa20: crypto_stream_salsa20,
+ crypto_onetimeauth: crypto_onetimeauth,
+ crypto_onetimeauth_verify: crypto_onetimeauth_verify,
+ crypto_verify_16: crypto_verify_16,
+ crypto_verify_32: crypto_verify_32,
+ crypto_secretbox: crypto_secretbox,
+ crypto_secretbox_open: crypto_secretbox_open,
+ crypto_scalarmult: crypto_scalarmult,
+ crypto_scalarmult_base: crypto_scalarmult_base,
+ crypto_box_beforenm: crypto_box_beforenm,
+ crypto_box_afternm: crypto_box_afternm,
+ crypto_box: crypto_box,
+ crypto_box_open: crypto_box_open,
+ crypto_box_keypair: crypto_box_keypair,
+ crypto_hash: crypto_hash,
+ crypto_sign: crypto_sign,
+ crypto_sign_keypair: crypto_sign_keypair,
+ crypto_sign_open: crypto_sign_open,
+
+ crypto_secretbox_KEYBYTES: crypto_secretbox_KEYBYTES,
+ crypto_secretbox_NONCEBYTES: crypto_secretbox_NONCEBYTES,
+ crypto_secretbox_ZEROBYTES: crypto_secretbox_ZEROBYTES,
+ crypto_secretbox_BOXZEROBYTES: crypto_secretbox_BOXZEROBYTES,
+ crypto_scalarmult_BYTES: crypto_scalarmult_BYTES,
+ crypto_scalarmult_SCALARBYTES: crypto_scalarmult_SCALARBYTES,
+ crypto_box_PUBLICKEYBYTES: crypto_box_PUBLICKEYBYTES,
+ crypto_box_SECRETKEYBYTES: crypto_box_SECRETKEYBYTES,
+ crypto_box_BEFORENMBYTES: crypto_box_BEFORENMBYTES,
+ crypto_box_NONCEBYTES: crypto_box_NONCEBYTES,
+ crypto_box_ZEROBYTES: crypto_box_ZEROBYTES,
+ crypto_box_BOXZEROBYTES: crypto_box_BOXZEROBYTES,
+ crypto_sign_BYTES: crypto_sign_BYTES,
+ crypto_sign_PUBLICKEYBYTES: crypto_sign_PUBLICKEYBYTES,
+ crypto_sign_SECRETKEYBYTES: crypto_sign_SECRETKEYBYTES,
+ crypto_sign_SEEDBYTES: crypto_sign_SEEDBYTES,
+ crypto_hash_BYTES: crypto_hash_BYTES,
+};
+
+/* High-level API */
+
+function checkLengths(k: Uint8Array, n: Uint8Array) {
+ if (k.length !== crypto_secretbox_KEYBYTES) throw new Error("bad key size");
+ if (n.length !== crypto_secretbox_NONCEBYTES)
+ throw new Error("bad nonce size");
+}
+
+function checkBoxLengths(pk: Uint8Array, sk: Uint8Array) {
+ if (pk.length !== crypto_box_PUBLICKEYBYTES)
+ throw new Error("bad public key size");
+ if (sk.length !== crypto_box_SECRETKEYBYTES)
+ throw new Error("bad secret key size");
+}
+
+function checkArrayTypes(...args: Uint8Array[]) {
+ for (var i = 0; i < args.length; i++) {
+ if (!(args[i] instanceof Uint8Array))
+ throw new TypeError("unexpected type, use Uint8Array");
+ }
+}
+
+function cleanup(arr: Uint8Array) {
+ for (var i = 0; i < arr.length; i++) arr[i] = 0;
+}
+
+export function randomBytes(n: number) {
+ var b = new Uint8Array(n);
+ randombytes(b, n);
+ return b;
+}
+
+export function secretbox(msg: Uint8Array, nonce: Uint8Array, key: Uint8Array) {
+ checkArrayTypes(msg, nonce, key);
+ checkLengths(key, nonce);
+ var m = new Uint8Array(crypto_secretbox_ZEROBYTES + msg.length);
+ var c = new Uint8Array(m.length);
+ for (var i = 0; i < msg.length; i++)
+ m[i + crypto_secretbox_ZEROBYTES] = msg[i];
+ crypto_secretbox(c, m, m.length, nonce, key);
+ return c.subarray(crypto_secretbox_BOXZEROBYTES);
+}
+
+export function secretbox_open(
+ box: Uint8Array,
+ nonce: Uint8Array,
+ key: Uint8Array,
+) {
+ checkArrayTypes(box, nonce, key);
+ checkLengths(key, nonce);
+ var c = new Uint8Array(crypto_secretbox_BOXZEROBYTES + box.length);
+ var m = new Uint8Array(c.length);
+ for (var i = 0; i < box.length; i++)
+ c[i + crypto_secretbox_BOXZEROBYTES] = box[i];
+ if (c.length < 32) return null;
+ if (crypto_secretbox_open(m, c, c.length, nonce, key) !== 0) return null;
+ return m.subarray(crypto_secretbox_ZEROBYTES);
+}
+
+export const secretbox_keyLength = crypto_secretbox_KEYBYTES;
+export const secretbox_nonceLength = crypto_secretbox_NONCEBYTES;
+export const secretbox_overheadLength = crypto_secretbox_BOXZEROBYTES;
+
+export function scalarMult(n: Uint8Array, p: Uint8Array) {
+ checkArrayTypes(n, p);
+ if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error("bad n size");
+ if (p.length !== crypto_scalarmult_BYTES) throw new Error("bad p size");
+ var q = new Uint8Array(crypto_scalarmult_BYTES);
+ crypto_scalarmult(q, n, p);
+ return q;
+}
+
+export function scalarMult_base(n: Uint8Array) {
+ checkArrayTypes(n);
+ if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error("bad n size");
+ var q = new Uint8Array(crypto_scalarmult_BYTES);
+ crypto_scalarmult_base(q, n);
+ return q;
+}
+
+export const scalarMult_scalarLength = crypto_scalarmult_SCALARBYTES;
+export const scalarMult_groupElementLength = crypto_scalarmult_BYTES;
+
+export function box(
+ msg: Uint8Array,
+ nonce: Uint8Array,
+ publicKey: Uint8Array,
+ secretKey: Uint8Array,
+) {
+ var k = box_before(publicKey, secretKey);
+ return secretbox(msg, nonce, k);
+}
+
+export function box_before(publicKey: Uint8Array, secretKey: Uint8Array) {
+ checkArrayTypes(publicKey, secretKey);
+ checkBoxLengths(publicKey, secretKey);
+ var k = new Uint8Array(crypto_box_BEFORENMBYTES);
+ crypto_box_beforenm(k, publicKey, secretKey);
+ return k;
+}
+
+export const box_after = secretbox;
+
+export function box_open(
+ msg: Uint8Array,
+ nonce: Uint8Array,
+ publicKey: Uint8Array,
+ secretKey: Uint8Array,
+) {
+ var k = box_before(publicKey, secretKey);
+ return secretbox_open(msg, nonce, k);
+}
+
+export const box_open_after = secretbox_open;
+
+export function box_keyPair() {
+ var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES);
+ var sk = new Uint8Array(crypto_box_SECRETKEYBYTES);
+ crypto_box_keypair(pk, sk);
+ return { publicKey: pk, secretKey: sk };
+}
+
+export function box_keyPair_fromSecretKey(secretKey: Uint8Array) {
+ checkArrayTypes(secretKey);
+ if (secretKey.length !== crypto_box_SECRETKEYBYTES)
+ throw new Error("bad secret key size");
+ var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES);
+ crypto_scalarmult_base(pk, secretKey);
+ return { publicKey: pk, secretKey: new Uint8Array(secretKey) };
+}
+
+export const box_publicKeyLength = crypto_box_PUBLICKEYBYTES;
+export const box_secretKeyLength = crypto_box_SECRETKEYBYTES;
+export const box_sharedKeyLength = crypto_box_BEFORENMBYTES;
+export const box_nonceLength = crypto_box_NONCEBYTES;
+export const box_overheadLength = secretbox_overheadLength;
+
+export function sign(msg: Uint8Array, secretKey: Uint8Array) {
+ checkArrayTypes(msg, secretKey);
+ if (secretKey.length !== crypto_sign_SECRETKEYBYTES)
+ throw new Error("bad secret key size");
+ var signedMsg = new Uint8Array(crypto_sign_BYTES + msg.length);
+ crypto_sign(signedMsg, msg, msg.length, secretKey);
+ return signedMsg;
+}
+
+export function sign_open(signedMsg: Uint8Array, publicKey: Uint8Array) {
+ checkArrayTypes(signedMsg, publicKey);
+ if (publicKey.length !== crypto_sign_PUBLICKEYBYTES)
+ throw new Error("bad public key size");
+ var tmp = new Uint8Array(signedMsg.length);
+ var mlen = crypto_sign_open(tmp, signedMsg, signedMsg.length, publicKey);
+ if (mlen < 0) return null;
+ var m = new Uint8Array(mlen);
+ for (var i = 0; i < m.length; i++) m[i] = tmp[i];
+ return m;
+}
+
+export function sign_detached(msg: Uint8Array, secretKey: Uint8Array) {
+ var signedMsg = sign(msg, secretKey);
+ var sig = new Uint8Array(crypto_sign_BYTES);
+ for (var i = 0; i < sig.length; i++) sig[i] = signedMsg[i];
+ return sig;
+}
+
+export function sign_detached_verify(
+ msg: Uint8Array,
+ sig: Uint8Array,
+ publicKey: Uint8Array,
+) {
+ checkArrayTypes(msg, sig, publicKey);
+ if (sig.length !== crypto_sign_BYTES) throw new Error("bad signature size");
+ if (publicKey.length !== crypto_sign_PUBLICKEYBYTES)
+ throw new Error("bad public key size");
+ var sm = new Uint8Array(crypto_sign_BYTES + msg.length);
+ var m = new Uint8Array(crypto_sign_BYTES + msg.length);
+ var i;
+ for (i = 0; i < crypto_sign_BYTES; i++) sm[i] = sig[i];
+ for (i = 0; i < msg.length; i++) sm[i + crypto_sign_BYTES] = msg[i];
+ return crypto_sign_open(m, sm, sm.length, publicKey) >= 0;
+}
+
+export function sign_keyPair() {
+ var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES);
+ var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES);
+ crypto_sign_keypair(pk, sk, false);
+ return { publicKey: pk, secretKey: sk };
+}
+
+export function x25519_edwards_keyPair_fromSecretKey(
+ secretKey: Uint8Array,
+): Uint8Array {
+ const p = [gf(), gf(), gf(), gf()];
+ const pk = new Uint8Array(32);
+
+ const d = new Uint8Array(64);
+ if (secretKey.length != 32) {
+ throw new Error("bad secret key size");
+ }
+ d.set(secretKey, 0);
+ //crypto_hash(d, secretKey, 32);
+
+ d[0] &= 248;
+ d[31] &= 127;
+ d[31] |= 64;
+
+ scalarbase(p, d);
+ pack(pk, p);
+
+ return pk;
+}
+
+export function sign_keyPair_fromSecretKey(secretKey: Uint8Array) {
+ checkArrayTypes(secretKey);
+ if (secretKey.length !== crypto_sign_SECRETKEYBYTES)
+ throw new Error("bad secret key size");
+ var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES);
+ for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32 + i];
+ return { publicKey: pk, secretKey: new Uint8Array(secretKey) };
+}
+
+export function sign_keyPair_fromSeed(seed: Uint8Array) {
+ checkArrayTypes(seed);
+ if (seed.length !== crypto_sign_SEEDBYTES) throw new Error("bad seed size");
+ var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES);
+ var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES);
+ for (var i = 0; i < 32; i++) sk[i] = seed[i];
+ crypto_sign_keypair(pk, sk, true);
+ return { publicKey: pk, secretKey: sk };
+}
+
+export const sign_publicKeyLength = crypto_sign_PUBLICKEYBYTES;
+export const sign_secretKeyLength = crypto_sign_SECRETKEYBYTES;
+export const sign_seedLength = crypto_sign_SEEDBYTES;
+export const sign_signatureLength = crypto_sign_BYTES;
+
+export function hash(msg: Uint8Array) {
+ checkArrayTypes(msg);
+ var h = new Uint8Array(crypto_hash_BYTES);
+ crypto_hash(h, msg, msg.length);
+ return h;
+}
+
+export const hash_hashLength = crypto_hash_BYTES;
+
+export function verify(x: Uint8Array, y: Uint8Array) {
+ checkArrayTypes(x, y);
+ // Zero length arguments are considered not equal.
+ if (x.length === 0 || y.length === 0) return false;
+ if (x.length !== y.length) return false;
+ return vn(x, 0, y, 0, x.length) === 0 ? true : false;
+}
+
+export function setPRNG(fn: (x: Uint8Array, n: number) => void) {
+ randombytes = fn;
+}
+
+export function sign_ed25519_pk_to_curve25519(
+ ed25519_pk: Uint8Array,
+): Uint8Array {
+ const ge_a = [gf(), gf(), gf(), gf()];
+ const x = gf();
+ const one_minus_y = gf();
+ const x25519_pk = new Uint8Array(32);
+
+ if (unpackneg(ge_a, ed25519_pk)) {
+ throw Error("invalid public key");
+ }
+
+ set25519(one_minus_y, gf1);
+ Z(one_minus_y, one_minus_y, ge_a[1]);
+
+ set25519(x, gf1);
+ A(x, x, ge_a[1]);
+
+ inv25519(one_minus_y, one_minus_y);
+ M(x, x, one_minus_y);
+ pack25519(x25519_pk, x);
+
+ return x25519_pk;
+}
+
+(function() {
+ // Initialize PRNG if environment provides CSPRNG.
+ // If not, methods calling randombytes will throw.
+ const crypto =
+ typeof self !== "undefined" ? self.crypto || (self as any).msCrypto : null;
+ if (crypto && crypto.getRandomValues) {
+ // Browsers.
+ var QUOTA = 65536;
+ setPRNG(function(x: Uint8Array, n: number) {
+ var i,
+ v = new Uint8Array(n);
+ for (i = 0; i < n; i += QUOTA) {
+ crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA)));
+ }
+ for (i = 0; i < n; i++) x[i] = v[i];
+ cleanup(v);
+ });
+ } else if (typeof require !== "undefined") {
+ // Node.js.
+ const cr = require("crypto");
+ if (cr && cr.randomBytes) {
+ setPRNG(function(x: Uint8Array, n: number) {
+ var i,
+ v = cr.randomBytes(n);
+ for (i = 0; i < n; i++) x[i] = v[i];
+ cleanup(v);
+ });
+ }
+ }
+})();
diff --git a/src/crypto/sha256.ts b/src/crypto/primitives/sha256.ts
diff --git a/src/crypto/synchronousWorker.ts b/src/crypto/synchronousWorker.ts
@@ -16,9 +16,6 @@
import { CryptoImplementation } from "./cryptoImplementation";
-import { NodeEmscriptenLoader } from "./nodeEmscriptenLoader";
-
-import fs = require("fs");
import { CryptoWorkerFactory } from "./cryptoApi";
import { CryptoWorker } from "./cryptoWorker";
@@ -56,8 +53,6 @@ export class SynchronousCryptoWorker {
*/
onerror: undefined | ((m: any) => void);
- private emscriptenLoader = new NodeEmscriptenLoader();
-
constructor() {
this.onerror = undefined;
this.onmessage = undefined;
@@ -84,9 +79,7 @@ export class SynchronousCryptoWorker {
}
private async handleRequest(operation: string, id: number, args: string[]) {
- let emsc = await this.emscriptenLoader.getEmscriptenEnvironment();
-
- const impl = new CryptoImplementation(emsc);
+ const impl = new CryptoImplementation();
if (!(operation in impl)) {
console.error(`crypto operation '${operation}' not found`);
diff --git a/src/crypto/talerCrypto-test.ts b/src/crypto/talerCrypto-test.ts
@@ -29,8 +29,8 @@ import {
rsaUnblind,
rsaVerify,
} from "./talerCrypto";
-import { hmacSha512, sha512, kdf } from "./kdf";
-import nacl = require("./nacl-fast");
+import { sha512, kdf } from "./primitives/kdf";
+import nacl = require("./primitives/nacl-fast");
function hexToBytes(hex: string) {
for (var bytes = [], c = 0; c < hex.length; c += 2)
@@ -159,3 +159,43 @@ test("taler-exchange-tvg blind signing", t => {
const v = rsaVerify(decodeCrock(messageHash), decodeCrock(sig), decodeCrock(rsaPublicKey));
t.true(v);
});
+
+
+test("incremental hashing #1", (t) => {
+ const n = 1024;
+ const d = nacl.randomBytes(n);
+
+ const h1 = nacl.hash(d);
+ const h2 = new nacl.HashState().update(d).finish();
+
+ const s = new nacl.HashState();
+ for (let i = 0; i < n; i++) {
+ const b = new Uint8Array(1);
+ b[0] = d[i];
+ s.update(b);
+ }
+
+ const h3 = s.finish();
+
+ t.deepEqual(encodeCrock(h1), encodeCrock(h2));
+ t.deepEqual(encodeCrock(h1), encodeCrock(h3));
+});
+
+test("incremental hashing #2", (t) => {
+ const n = 10;
+ const d = nacl.randomBytes(n);
+
+ const h1 = nacl.hash(d);
+ const h2 = new nacl.HashState().update(d).finish();
+ const s = new nacl.HashState();
+ for (let i = 0; i < n; i++) {
+ const b = new Uint8Array(1);
+ b[0] = d[i];
+ s.update(b);
+ }
+
+ const h3 = s.finish();
+
+ t.deepEqual(encodeCrock(h1), encodeCrock(h3));
+ t.deepEqual(encodeCrock(h1), encodeCrock(h2));
+});
+\ No newline at end of file
diff --git a/src/crypto/talerCrypto.ts b/src/crypto/talerCrypto.ts
@@ -18,9 +18,9 @@
* Native implementation of GNU Taler crypto.
*/
-import nacl = require("./nacl-fast");
+import nacl = require("./primitives/nacl-fast");
import bigint from "big-integer";
-import { kdf } from "./kdf";
+import { kdf } from "./primitives/kdf";
export function getRandomBytes(n: number): Uint8Array {
return nacl.randomBytes(n);
@@ -123,7 +123,7 @@ export function decodeCrock(encoded: string): Uint8Array {
}
export function eddsaGetPublic(eddsaPriv: Uint8Array): Uint8Array {
- const pair = nacl.sign_keyPair_fromSeed(eddsaPriv);
+ const pair = nacl.sign_keyPair_fromSeed(eddsaPriv);
return pair.publicKey;
}
@@ -131,7 +131,10 @@ export function ecdheGetPublic(ecdhePriv: Uint8Array): Uint8Array {
return nacl.scalarMult_base(ecdhePriv);
}
-export function keyExchangeEddsaEcdhe(eddsaPriv: Uint8Array, ecdhePub: Uint8Array): Uint8Array {
+export function keyExchangeEddsaEcdhe(
+ eddsaPriv: Uint8Array,
+ ecdhePub: Uint8Array,
+): Uint8Array {
const ph = nacl.hash(eddsaPriv);
const a = new Uint8Array(32);
for (let i = 0; i < 32; i++) {
@@ -141,7 +144,10 @@ export function keyExchangeEddsaEcdhe(eddsaPriv: Uint8Array, ecdhePub: Uint8Arra
return nacl.hash(x);
}
-export function keyExchangeEcdheEddsa(ecdhePriv: Uint8Array, eddsaPub: Uint8Array): Uint8Array {
+export function keyExchangeEcdheEddsa(
+ ecdhePriv: Uint8Array,
+ eddsaPub: Uint8Array,
+): Uint8Array {
const curve25519Pub = nacl.sign_ed25519_pk_to_curve25519(eddsaPub);
const x = nacl.scalarMult(ecdhePriv, curve25519Pub);
return nacl.hash(x);
@@ -172,8 +178,8 @@ function kdfMod(
while (true) {
const ctx = new Uint8Array(info.byteLength + 2);
ctx.set(info, 0);
- ctx[ctx.length - 2] = (counter >>> 8) & 0xFF;
- ctx[ctx.length - 1] = counter & 0xFF;
+ ctx[ctx.length - 2] = (counter >>> 8) & 0xff;
+ ctx[ctx.length - 1] = counter & 0xff;
const buf = kdf(buflen, ikm, salt, ctx);
const arr = Array.from(buf);
arr[0] = arr[0] & mask;
@@ -185,7 +191,7 @@ function kdfMod(
}
}
-function stringToBuf(s: string) {
+export function stringToBytes(s: string) {
const te = new TextEncoder();
return te.encode(s);
}
@@ -194,9 +200,12 @@ function loadBigInt(arr: Uint8Array) {
return bigint.fromArray(Array.from(arr), 256, false);
}
-function rsaBlindingKeyDerive(rsaPub: RsaPub, bks: Uint8Array): bigint.BigInteger {
- const salt = stringToBuf("Blinding KDF extrator HMAC key");
- const info = stringToBuf("Blinding KDF");
+function rsaBlindingKeyDerive(
+ rsaPub: RsaPub,
+ bks: Uint8Array,
+): bigint.BigInteger {
+ const salt = stringToBytes("Blinding KDF extrator HMAC key");
+ const info = stringToBytes("Blinding KDF");
return kdfMod(rsaPub.N, bks, salt, info);
}
@@ -206,7 +215,7 @@ function rsaBlindingKeyDerive(rsaPub: RsaPub, bks: Uint8Array): bigint.BigIntege
* Assuming n is an RSA modulous and r is generated using a call to
* GNUNET_CRYPTO_kdf_mod_mpi, if gcd(r,n) != 1 then n must be a
* malicious RSA key designed to deanomize the user.
- *
+ *
* @param r KDF result
* @param n RSA modulus of the public key
*/
@@ -218,7 +227,7 @@ function rsaGcdValidate(r: bigint.BigInteger, n: bigint.BigInteger) {
}
function rsaFullDomainHash(hm: Uint8Array, rsaPub: RsaPub): bigint.BigInteger {
- const info = stringToBuf("RSA-FDA FTpsW!");
+ const info = stringToBytes("RSA-FDA FTpsW!");
const salt = rsaPubEncode(rsaPub);
const r = kdfMod(rsaPub.N, hm, salt, info);
rsaGcdValidate(r, rsaPub.N);
@@ -228,12 +237,15 @@ function rsaFullDomainHash(hm: Uint8Array, rsaPub: RsaPub): bigint.BigInteger {
function rsaPubDecode(rsaPub: Uint8Array): RsaPub {
const modulusLength = (rsaPub[0] << 8) | rsaPub[1];
const exponentLength = (rsaPub[2] << 8) | rsaPub[3];
- const modulus = rsaPub.slice(4, 4 + modulusLength)
- const exponent = rsaPub.slice(4 + modulusLength, 4 + modulusLength + exponentLength);
+ const modulus = rsaPub.slice(4, 4 + modulusLength);
+ const exponent = rsaPub.slice(
+ 4 + modulusLength,
+ 4 + modulusLength + exponentLength,
+ );
const res = {
N: loadBigInt(modulus),
e: loadBigInt(exponent),
- }
+ };
return res;
}
@@ -241,16 +253,20 @@ function rsaPubEncode(rsaPub: RsaPub): Uint8Array {
const mb = rsaPub.N.toArray(256).value;
const eb = rsaPub.e.toArray(256).value;
const out = new Uint8Array(4 + mb.length + eb.length);
- out[0] = (mb.length >>> 8) & 0xFF;
- out[1] = mb.length & 0xFF;
- out[2] = (eb.length >>> 8) & 0xFF;
- out[3] = eb.length & 0xFF;
+ out[0] = (mb.length >>> 8) & 0xff;
+ out[1] = mb.length & 0xff;
+ out[2] = (eb.length >>> 8) & 0xff;
+ out[3] = eb.length & 0xff;
out.set(mb, 4);
out.set(eb, 4 + mb.length);
return out;
}
-export function rsaBlind(hm: Uint8Array, bks: Uint8Array, rsaPubEnc: Uint8Array): Uint8Array {
+export function rsaBlind(
+ hm: Uint8Array,
+ bks: Uint8Array,
+ rsaPubEnc: Uint8Array,
+): Uint8Array {
const rsaPub = rsaPubDecode(rsaPubEnc);
const data = rsaFullDomainHash(hm, rsaPub);
const r = rsaBlindingKeyDerive(rsaPub, bks);
@@ -259,7 +275,11 @@ export function rsaBlind(hm: Uint8Array, bks: Uint8Array, rsaPubEnc: Uint8Array)
return new Uint8Array(bm.toArray(256).value);
}
-export function rsaUnblind(sig: Uint8Array, rsaPubEnc: Uint8Array, bks: Uint8Array): Uint8Array {
+export function rsaUnblind(
+ sig: Uint8Array,
+ rsaPubEnc: Uint8Array,
+ bks: Uint8Array,
+): Uint8Array {
const rsaPub = rsaPubDecode(rsaPubEnc);
const blinded_s = loadBigInt(sig);
const r = rsaBlindingKeyDerive(rsaPub, bks);
@@ -268,10 +288,86 @@ export function rsaUnblind(sig: Uint8Array, rsaPubEnc: Uint8Array, bks: Uint8Arr
return new Uint8Array(s.toArray(256).value);
}
-export function rsaVerify(hm: Uint8Array, rsaSig: Uint8Array, rsaPubEnc: Uint8Array): boolean {
+export function rsaVerify(
+ hm: Uint8Array,
+ rsaSig: Uint8Array,
+ rsaPubEnc: Uint8Array,
+): boolean {
const rsaPub = rsaPubDecode(rsaPubEnc);
const d = rsaFullDomainHash(hm, rsaPub);
const sig = loadBigInt(rsaSig);
const sig_e = sig.modPow(rsaPub.e, rsaPub.N);
return sig_e.equals(d);
-}
-\ No newline at end of file
+}
+
+export interface EddsaKeyPair {
+ eddsaPub: Uint8Array;
+ eddsaPriv: Uint8Array;
+}
+
+export interface EcdheKeyPair {
+ ecdhePub: Uint8Array;
+ ecdhePriv: Uint8Array;
+}
+
+export function createEddsaKeyPair(): EddsaKeyPair {
+ const eddsaPriv = nacl.randomBytes(32);
+ const eddsaPub = eddsaGetPublic(eddsaPriv);
+ return { eddsaPriv, eddsaPub };
+}
+
+export function createEcdheKeyPair(): EcdheKeyPair {
+ const ecdhePriv = nacl.randomBytes(32);
+ const ecdhePub = ecdheGetPublic(ecdhePriv);
+ return { ecdhePriv, ecdhePub };
+}
+
+export function createBlindingKeySecret(): Uint8Array {
+ return nacl.randomBytes(32);
+}
+
+export function hash(d: Uint8Array): Uint8Array {
+ return nacl.hash(d);
+}
+
+export function eddsaSign(msg: Uint8Array, eddsaPriv: Uint8Array): Uint8Array {
+ const pair = nacl.sign_keyPair_fromSeed(eddsaPriv);
+ return nacl.sign_detached(msg, pair.secretKey);
+}
+
+export function eddsaVerify(
+ msg: Uint8Array,
+ sig: Uint8Array,
+ eddsaPub: Uint8Array,
+): boolean {
+ return nacl.sign_detached_verify(msg, sig, eddsaPub);
+}
+
+export function createHashContext(): nacl.HashState {
+ return new nacl.HashState();
+}
+
+export interface FreshCoin {
+ coinPub: Uint8Array;
+ coinPriv: Uint8Array;
+ bks: Uint8Array;
+}
+
+export function setupRefreshPlanchet(
+ secretSeed: Uint8Array,
+ coinNumber: number,
+): FreshCoin {
+ const info = stringToBytes("taler-coin-derivation");
+ const saltArrBuf = new ArrayBuffer(4);
+ const salt = new Uint8Array(saltArrBuf);
+ const saltDataView = new DataView(saltArrBuf);
+ saltDataView.setUint32(0, coinNumber);
+ const out = kdf(64, secretSeed, salt, info);
+ const coinPriv = out.slice(0, 32);
+ const bks = out.slice(32, 64);
+ return {
+ bks,
+ coinPriv,
+ coinPub: eddsaGetPublic(coinPriv),
+ };
+}
diff --git a/src/dbTypes.ts b/src/dbTypes.ts
@@ -283,26 +283,26 @@ export class DenominationRecord {
/**
* Validity start date of the denomination.
*/
- @Checkable.String()
- stampStart: string;
+ @Checkable.Value(() => Timestamp)
+ stampStart: Timestamp;
/**
* Date after which the currency can't be withdrawn anymore.
*/
- @Checkable.String()
- stampExpireWithdraw: string;
+ @Checkable.Value(() => Timestamp)
+ stampExpireWithdraw: Timestamp;
/**
* Date after the denomination officially doesn't exist anymore.
*/
- @Checkable.String()
- stampExpireLegal: string;
+ @Checkable.Value(() => Timestamp)
+ stampExpireLegal: Timestamp;
/**
* Data after which coins of this denomination can't be deposited anymore.
*/
- @Checkable.String()
- stampExpireDeposit: string;
+ @Checkable.Value(() => Timestamp)
+ stampExpireDeposit: Timestamp;
/**
* Signature by the exchange's master key over the denomination
diff --git a/src/headless/helpers.ts b/src/headless/helpers.ts
@@ -33,6 +33,7 @@ import * as amounts from "../amounts";
import { Bank } from "./bank";
import fs = require("fs");
+import { NodeCryptoWorkerFactory } from "../crypto/nodeProcessWorker";
const enableTracing = false;
@@ -188,14 +189,16 @@ export async function getDefaultNodeWallet(
myUnsupportedUpgrade,
);
+ const worker = new SynchronousCryptoWorkerFactory();
+ //const worker = new NodeCryptoWorkerFactory();
+
return new Wallet(
myDb,
myHttpLib,
myBadge,
myNotifier,
- new SynchronousCryptoWorkerFactory(),
+ worker,
);
- //const myWallet = new Wallet(myDb, myHttpLib, myBadge, myNotifier, new NodeCryptoWorkerFactory());
}
export async function withdrawTestBalance(
diff --git a/src/headless/taler-wallet-cli.ts b/src/headless/taler-wallet-cli.ts
@@ -353,7 +353,6 @@ testCli
default: "TESTKUDOS:4",
})
.action(async args => {
- console.log("parsed args", args);
applyVerbose(args.wallet.verbose);
let cmdObj = args.integrationtestCmd;
diff --git a/src/helpers.ts b/src/helpers.ts
@@ -140,6 +140,17 @@ export function extractTalerStamp(stamp: string): Timestamp | undefined {
}
/**
+ * Extract a timestamp from a Taler timestamp string.
+ */
+export function extractTalerStampOrThrow(stamp: string): Timestamp {
+ const r = extractTalerStamp(stamp);
+ if (!r) {
+ throw Error("invalid time stamp");
+ }
+ return r;
+}
+
+/**
* Check if a timestamp is in the right format.
*/
export function timestampCheck(stamp: string): boolean {
diff --git a/src/talerTypes.ts b/src/talerTypes.ts
@@ -388,10 +388,10 @@ export class ContractTerms {
@Checkable.String(timestampCheck)
refund_deadline: string;
- /**
+ /**
* Deadline for the wire transfer.
*/
- @Checkable.String(timestampCheck)
+ @Checkable.String()
wire_transfer_deadline: string;
/**
diff --git a/src/wallet-test.ts b/src/wallet-test.ts
@@ -59,10 +59,10 @@ function fakeCwd(current: string, value: string, feeDeposit: string): types.Coin
feeWithdraw: a("EUR:0.0"),
isOffered: true,
masterSig: "(mock)",
- stampExpireDeposit: "(mock)",
- stampExpireLegal: "(mock)",
- stampExpireWithdraw: "(mock)",
- stampStart: "(mock)",
+ stampExpireDeposit: { t_ms: 0 },
+ stampExpireLegal: { t_ms: 0 },
+ stampExpireWithdraw: { t_ms: 0 },
+ stampStart: { t_ms: 0 },
status: dbTypes.DenominationStatus.VerifiedGood,
value: a(value),
},
diff --git a/src/wallet.ts b/src/wallet.ts
@@ -30,6 +30,7 @@ import {
getTalerStampSec,
strcmp,
extractTalerStamp,
+ extractTalerStampOrThrow,
} from "./helpers";
import { HttpRequestLibrary } from "./http";
import * as LibtoolVersion from "./libtoolVersion";
@@ -163,20 +164,10 @@ const builtinCurrencies: CurrencyRecord[] = [
];
function isWithdrawableDenom(d: DenominationRecord) {
- const nowSec = new Date().getTime() / 1000;
- const stampWithdrawSec = getTalerStampSec(d.stampExpireWithdraw);
- if (stampWithdrawSec === null) {
- return false;
- }
- const stampStartSec = getTalerStampSec(d.stampStart);
- if (stampStartSec === null) {
- return false;
- }
- // Withdraw if still possible to withdraw within a minute
- if (stampWithdrawSec + 60 > nowSec && nowSec >= stampStartSec) {
- return true;
- }
- return false;
+ const now = getTimestampNow();
+ const started = now.t_ms >= d.stampStart.t_ms;
+ const stillOkay = d.stampExpireWithdraw.t_ms + (60 * 1000) > now.t_ms;
+ return started && stillOkay;
}
interface SelectPayCoinsResult {
@@ -1374,6 +1365,7 @@ export class Wallet {
denom.feeWithdraw,
);
if (x.saturated) {
+ // FIXME!!!!
console.error("database inconsistent");
throw TransactionAbort;
}
@@ -1891,10 +1883,10 @@ export class Wallet {
const { isTrusted, isAudited } = await this.getExchangeTrust(exchangeInfo);
- let earliestDepositExpiration = Infinity;
- for (const denom of selectedDenoms) {
- const expireDeposit = getTalerStampSec(denom.stampExpireDeposit)!;
- if (expireDeposit < earliestDepositExpiration) {
+ let earliestDepositExpiration = selectedDenoms[0].stampExpireDeposit;
+ for (let i = 1; i < selectedDenoms.length; i++) {
+ const expireDeposit = selectedDenoms[i].stampExpireDeposit;
+ if (expireDeposit.t_ms < earliestDepositExpiration.t_ms) {
earliestDepositExpiration = expireDeposit;
}
}
@@ -2653,6 +2645,7 @@ export class Wallet {
resp = await this.http.postJson(reqUrl.href(), req);
} catch (e) {
console.error("got error during /refresh/reveal request");
+ console.error(e);
return;
}
@@ -3137,10 +3130,10 @@ export class Wallet {
feeWithdraw: Amounts.parseOrThrow(denomIn.fee_withdraw),
isOffered: true,
masterSig: denomIn.master_sig,
- stampExpireDeposit: denomIn.stamp_expire_deposit,
- stampExpireLegal: denomIn.stamp_expire_legal,
- stampExpireWithdraw: denomIn.stamp_expire_withdraw,
- stampStart: denomIn.stamp_start,
+ stampExpireDeposit: extractTalerStampOrThrow(denomIn.stamp_expire_deposit),
+ stampExpireLegal: extractTalerStampOrThrow(denomIn.stamp_expire_legal),
+ stampExpireWithdraw: extractTalerStampOrThrow(denomIn.stamp_expire_withdraw),
+ stampStart: extractTalerStampOrThrow(denomIn.stamp_start),
status: DenominationStatus.Unverified,
value: Amounts.parseOrThrow(denomIn.value),
};
diff --git a/src/walletTypes.ts b/src/walletTypes.ts
@@ -113,7 +113,7 @@ export interface ReserveCreationInfo {
/**
* The earliest deposit expiration of the selected coins.
*/
- earliestDepositExpiration: number;
+ earliestDepositExpiration: Timestamp;
/**
* Number of currently offered denominations.
@@ -591,11 +591,15 @@ export interface HistoryQuery {
level: number;
}
-export interface Timestamp {
+@Checkable.Class()
+export class Timestamp {
/**
* Timestamp in milliseconds.
*/
+ @Checkable.Number()
t_ms: number;
+
+ static checked: (obj: any) => Timestamp;
}
export interface Duration {
diff --git a/src/webex/renderHtml.tsx b/src/webex/renderHtml.tsx
@@ -240,7 +240,7 @@ function FeeDetailsView(props: {
{i18n.str`Rounding loss:`} {overhead}
</p>
<p>{i18n.str`Earliest expiration (for deposit): ${moment
- .unix(rci.earliestDepositExpiration)
+ .unix(rci.earliestDepositExpiration.t_ms / 1000)
.fromNow()}`}</p>
<h3>Coin Fees</h3>
<div style={{ overflow: "auto" }}>
diff --git a/tsconfig.json b/tsconfig.json
@@ -27,18 +27,14 @@
"src/android/index.ts",
"src/checkable.ts",
"src/crypto/browserWorkerEntry.ts",
- "src/crypto/cryptoApi-test.ts",
"src/crypto/cryptoApi.ts",
"src/crypto/cryptoImplementation.ts",
"src/crypto/cryptoWorker.ts",
- "src/crypto/emscInterface-test.ts",
- "src/crypto/emscInterface.ts",
- "src/crypto/kdf.ts",
- "src/crypto/nacl-fast.ts",
- "src/crypto/nodeEmscriptenLoader.ts",
"src/crypto/nodeProcessWorker.ts",
"src/crypto/nodeWorkerEntry.ts",
- "src/crypto/sha256.ts",
+ "src/crypto/primitives/kdf.ts",
+ "src/crypto/primitives/nacl-fast.ts",
+ "src/crypto/primitives/sha256.ts",
"src/crypto/synchronousWorker.ts",
"src/crypto/talerCrypto-test.ts",
"src/crypto/talerCrypto.ts",